Merge webkit.org at r51976 : Initial merge by git.

Change-Id: Ib0e7e2f0fb4bee5a186610272edf3186f0986b43

1 files changed, 16672 insertions, 1 deletions

diff --git a/WebCore/ChangeLog b/WebCore/ChangeLog
index 1727089..67567ab 100644
--- a/WebCore/ChangeLog
+++ b/WebCore/ChangeLog
@@ -1,3 +1,16674 @@
+2009-12-10  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32140
+        REGRESSION(r50072): Mailman administrative functionality is broken
+
+        Test: http/tests/misc/percent-sign-in-form-field-name.html
+
+        * platform/network/FormDataBuilder.cpp: (WebCore::appendQuotedString): Don't encode percent
+        sign, we never had a good reason to do that.
+
+2009-12-10  Kent Hansen  <kent.hansen@nokia.com>
+
+        Reviewed by Geoffrey Garen.
+
+        Remove getPropertyAttributes() from JavaScript bindings.
+        https://bugs.webkit.org/show_bug.cgi?id=31933
+
+        The functionality is provided by getOwnPropertyDescriptor().
+
+        * WebCore.order:
+        * bindings/js/JSDOMWindowCustom.cpp:
+        * bindings/js/JSDOMWindowShell.cpp:
+        * bindings/js/JSDOMWindowShell.h:
+        * bindings/scripts/CodeGeneratorJS.pm:
+        * page/DOMWindow.idl:
+
+2009-12-10  Kenneth Russell  <kbr@google.com>
+
+        Reviewed by Oliver Hunt.
+
+        Changed WebGLRenderingContext to synthesize GL errors rather than
+        raising JavaScript exceptions. Removed internal getError() calls
+        after each graphics call. The GraphicsContext3D maintains the
+        synthetic exceptions because only it has complete information
+        about certain conditions requiring them to be raised.
+
+        Based on idea from Ilmari Heikkinen, added create3DDebugContext()
+        to webgl-test.js and changed the WebGL layout tests expecting
+        error conditions to use it. Updated expected.txt files, which now
+        implicitly test the OpenGL error as it is part of the exception's
+        message.
+
+        Added new targeted test covering aspects of synthetic errors as
+        well as regression tests for bugs uncovered during its development.
+
+        Test: fast/canvas/webgl/error-reporting.html
+
+        * html/canvas/WebGLRenderingContext.cpp:
+        (WebCore::WebGLRenderingContext::sizeInBytes):
+        (WebCore::WebGLRenderingContext::activeTexture):
+        (WebCore::WebGLRenderingContext::attachShader):
+        (WebCore::WebGLRenderingContext::bindAttribLocation):
+        (WebCore::WebGLRenderingContext::bindBuffer):
+        (WebCore::WebGLRenderingContext::bindFramebuffer):
+        (WebCore::WebGLRenderingContext::bindRenderbuffer):
+        (WebCore::WebGLRenderingContext::bindTexture):
+        (WebCore::WebGLRenderingContext::bufferData):
+        (WebCore::WebGLRenderingContext::bufferSubData):
+        (WebCore::WebGLRenderingContext::compileShader):
+        (WebCore::WebGLRenderingContext::createShader):
+        (WebCore::WebGLRenderingContext::detachShader):
+        (WebCore::WebGLRenderingContext::disableVertexAttribArray):
+        (WebCore::WebGLRenderingContext::drawArrays):
+        (WebCore::WebGLRenderingContext::drawElements):
+        (WebCore::WebGLRenderingContext::enableVertexAttribArray):
+        (WebCore::WebGLRenderingContext::framebufferRenderbuffer):
+        (WebCore::WebGLRenderingContext::framebufferTexture2D):
+        (WebCore::WebGLRenderingContext::getActiveAttrib):
+        (WebCore::WebGLRenderingContext::getActiveUniform):
+        (WebCore::WebGLRenderingContext::getBufferParameter):
+        (WebCore::WebGLRenderingContext::getFramebufferAttachmentParameter):
+        (WebCore::WebGLRenderingContext::getParameter):
+        (WebCore::WebGLRenderingContext::getProgramParameter):
+        (WebCore::WebGLRenderingContext::getProgramInfoLog):
+        (WebCore::WebGLRenderingContext::getRenderbufferParameter):
+        (WebCore::WebGLRenderingContext::getShaderParameter):
+        (WebCore::WebGLRenderingContext::getShaderInfoLog):
+        (WebCore::WebGLRenderingContext::getShaderSource):
+        (WebCore::WebGLRenderingContext::getTexParameter):
+        (WebCore::WebGLRenderingContext::getUniform):
+        (WebCore::WebGLRenderingContext::getUniformLocation):
+        (WebCore::WebGLRenderingContext::getVertexAttrib):
+        (WebCore::WebGLRenderingContext::linkProgram):
+        (WebCore::WebGLRenderingContext::shaderSource):
+        (WebCore::WebGLRenderingContext::texImage2D):
+        (WebCore::WebGLRenderingContext::texSubImage2D):
+        (WebCore::WebGLRenderingContext::uniform1f):
+        (WebCore::WebGLRenderingContext::uniform1fv):
+        (WebCore::WebGLRenderingContext::uniform1i):
+        (WebCore::WebGLRenderingContext::uniform1iv):
+        (WebCore::WebGLRenderingContext::uniform2f):
+        (WebCore::WebGLRenderingContext::uniform2fv):
+        (WebCore::WebGLRenderingContext::uniform2i):
+        (WebCore::WebGLRenderingContext::uniform2iv):
+        (WebCore::WebGLRenderingContext::uniform3f):
+        (WebCore::WebGLRenderingContext::uniform3fv):
+        (WebCore::WebGLRenderingContext::uniform3i):
+        (WebCore::WebGLRenderingContext::uniform3iv):
+        (WebCore::WebGLRenderingContext::uniform4f):
+        (WebCore::WebGLRenderingContext::uniform4fv):
+        (WebCore::WebGLRenderingContext::uniform4i):
+        (WebCore::WebGLRenderingContext::uniform4iv):
+        (WebCore::WebGLRenderingContext::uniformMatrix2fv):
+        (WebCore::WebGLRenderingContext::uniformMatrix3fv):
+        (WebCore::WebGLRenderingContext::uniformMatrix4fv):
+        (WebCore::WebGLRenderingContext::useProgram):
+        (WebCore::WebGLRenderingContext::validateProgram):
+        (WebCore::WebGLRenderingContext::vertexAttribPointer):
+        * html/canvas/WebGLRenderingContext.h:
+        (WebCore::WebGLRenderingContext::cleanupAfterGraphicsCall):
+        * platform/graphics/GraphicsContext3D.h:
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::GraphicsContext3D::getActiveAttrib):
+        (WebCore::GraphicsContext3D::getActiveUniform):
+        (WebCore::GraphicsContext3D::getError):
+        (WebCore::GraphicsContext3D::synthesizeGLError):
+
+2009-12-10  Stephen White  <senorblanco@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Fix for assert on Chrome/skia with SVG Filters enabled.
+        https://bugs.webkit.org/show_bug.cgi?id=32394
+
+        Covered by LayoutTests/svg/W3C-SVG-1.1/filters-tile-01-b.svg and others.
+
+        * platform/graphics/skia/ImageBufferSkia.cpp:
+        (WebCore::ImageBuffer::platformTransformColorSpace):
+
+2009-12-10  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by Darin Adler.
+
+        REGRESSION(4.0.4-42a12): With 2 highlighted lines of text in gmail/hotmail selecting Bold selects other 2 edit buttons automatically.
+        <rdar://problem/7442065>
+        https://bugs.webkit.org/show_bug.cgi?id=32285
+
+        When examining the styles of the nodes after the first in a range selection, we take into
+        cosideration differences in style of txt nodes only.
+        
+        Test: editing/execCommand/queryCommandState-02.html
+
+        * editing/Editor.cpp:
+        (WebCore::Editor::selectionHasStyle):
+
+2009-12-10  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Alexey Proskuryakov.
+
+        Crash in XMLTokenizer::popCurrentNode if window.close() is called during parsing
+        https://bugs.webkit.org/show_bug.cgi?id=31576
+
+        Add a RefCounted wrapper object around xmlParserCtxtPtr so we can
+        maintain it's lifetime more effectively.
+
+        Test: fast/parser/xhtml-close-while-parsing.xhtml
+
+        * dom/XMLTokenizer.cpp:
+        (WebCore::XMLTokenizer::popCurrentNode):
+        * dom/XMLTokenizer.h:
+        (WebCore::XMLParserContext::context):
+        (WebCore::XMLParserContext::XMLParserContext):
+        (WebCore::XMLTokenizer::context):
+        * dom/XMLTokenizerLibxml2.cpp:
+        (WebCore::XMLParserContext::createStringParser):
+        (WebCore::XMLParserContext::createMemoryParser):
+        (WebCore::XMLParserContext::~XMLParserContext):
+        (WebCore::XMLTokenizer::~XMLTokenizer):
+        (WebCore::XMLTokenizer::doWrite):
+        (WebCore::XMLTokenizer::initializeParserContext):
+        (WebCore::XMLTokenizer::doEnd):
+        (WebCore::XMLTokenizer::lineNumber):
+        (WebCore::XMLTokenizer::columnNumber):
+        (WebCore::XMLTokenizer::stopParsing):
+        (WebCore::parseXMLDocumentFragment):
+        (WebCore::parseAttributes):
+
+2009-12-10  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: debugger shortcuts don't work when
+        Search field or Console drawer has focus.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32392
+
+        * inspector/front-end/inspector.js:
+        (WebInspector.loaded):
+        (WebInspector.documentKeyDown):
+        (WebInspector.documentKeyUp):
+        (WebInspector.searchKeyDown):
+
+2009-12-10  Dimitri Glazkov  <dglazkov@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        [V8] Events created in isolated worlds may fire in main world.
+        https://bugs.webkit.org/show_bug.cgi?id=32386
+
+        Test: http/tests/security/isolatedWorld/events.html
+
+        * WebCore.gypi: Added WorldContextHandle.
+        * bindings/v8/ScriptEventListener.cpp:
+        (WebCore::createAttributeEventListener): Added WorldContextHandle params.
+        * bindings/v8/SharedPersistent.h: Fixed a few style/include issues.
+        * bindings/v8/V8AbstractEventListener.cpp:
+        (WebCore::V8AbstractEventListener::V8AbstractEventListener): Added WorldContextHandle params.
+        (WebCore::V8AbstractEventListener::handleEvent): Adjusted context retrieval to use WorldContextHandle.
+        (WebCore::V8AbstractEventListener::invokeEventHandler): Ditto.
+        * bindings/v8/V8AbstractEventListener.h:
+        (WebCore::V8AbstractEventListener::worldContext): Added WorldContextHandle params.
+        * bindings/v8/V8EventListenerList.h:
+        (WebCore::V8EventListenerList::findOrCreateWrapper): Ditto.
+        * bindings/v8/V8LazyEventListener.cpp:
+        (WebCore::V8LazyEventListener::V8LazyEventListener): Ditto.
+        (WebCore::V8LazyEventListener::prepareListenerObject): Adjusted context retrieval to use WorldContextHandle.
+        * bindings/v8/V8LazyEventListener.h:
+        (WebCore::V8LazyEventListener::create): Added WorldContextHandle params.
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::context): Refactored to use mainWorldContext();
+        (WebCore::V8Proxy::mainWorldContext): Added.
+        (WebCore::toV8Context): Changed to use WorldContextHandle.
+        * bindings/v8/V8Proxy.h: Added mainWorldContext decl.
+        * bindings/v8/V8Utilities.cpp:
+        (WebCore::reportException): Added an extra check to avoid crashes during frame teardown.
+        * bindings/v8/V8WorkerContextEventListener.cpp:
+        (WebCore::V8WorkerContextEventListener::V8WorkerContextEventListener): Added WorldContextHandle params.
+        * bindings/v8/V8WorkerContextEventListener.h:
+        (WebCore::V8WorkerContextEventListener::create): Added WorldContextHandle params.
+        * bindings/v8/WorldContextHandle.cpp: Added.
+        * bindings/v8/WorldContextHandle.h: Added.
+        * bindings/v8/custom/V8CustomEventListener.cpp:
+        (WebCore::V8EventListener::V8EventListener): Added WorldContextHandle params.
+        * bindings/v8/custom/V8CustomEventListener.h:
+        (WebCore::V8EventListener::create): Added WorldContextHandle params.
+
+2009-12-10  Jon Honeycutt  <jhoneycutt@apple.com>
+
+        Pass more information about a plug-in to the PluginHalterDelegate
+
+        Reviewed by Adam Roben.
+
+        * loader/EmptyClients.h:
+        Remove this unused class.
+
+        * page/HaltablePlugin.h:
+        Add new functions to return the plug-in's name and whether it is
+        windowed.
+
+        * page/PluginHalter.cpp:
+        (WebCore::PluginHalter::timerFired):
+        Pass new arguments to the client.
+
+        * page/PluginHalterClient.h:
+        Add new parameters.
+
+        * plugins/PluginView.cpp:
+        (WebCore::PluginView::pluginName):
+        Return the name from the PluginPackage.
+
+        * plugins/PluginView.h:
+        (WebCore::PluginView::isWindowed):
+
+2009-12-09  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Pavel Feldman.
+
+        Fixes <http://webkit.org/b/31738>.
+        Web Inspector: Console Scope Bar should be on top of console when Console is a Panel.
+        
+        When the console is set to be shown as a full panel, move the scope bar to the top
+        where it looks best. When it is only shown as a drawer, move it to the bottom, where
+        it originally was. This takes up less space as a drawer, and makes it more discoverable
+        and usable when it is the full panel.
+
+        * inspector/front-end/ConsolePanel.js:
+        (WebInspector.ConsolePanel.prototype.show): Move filter bar to top.
+        (WebInspector.ConsolePanel.prototype.hide): Move filter bar back to bottom.
+        * inspector/front-end/inspector.css:
+
+2009-12-10  Stephen White  <senorblanco@chromium.org>
+
+        Reviewed by Dirk Schulze.
+
+        Fix for alpha blending in SVG Filters on Chromium/skia.
+        https://bugs.webkit.org/show_bug.cgi?id=32378
+
+        Covered by LayoutTests/svg/filters/feGaussianBlur.svg and others.
+
+        * platform/graphics/skia/ImageBufferSkia.cpp:
+        (WebCore::ImageBuffer::platformTransformColorSpace):
+
+2009-12-10  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Add context menu actions for DOM tree.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32348
+
+        * English.lproj/localizedStrings.js:
+        * inspector/front-end/ContextMenu.js:
+        (WebInspector.ContextMenu):
+        (WebInspector.ContextMenu.prototype.show):
+        (WebInspector.ContextMenu.prototype.appendItem):
+        (WebInspector.ContextMenu.prototype.appendSeparator):
+        (WebInspector.ContextMenu.prototype._itemSelected):
+        (WebInspector.contextMenuItemSelected):
+        (WebInspector.contextMenuCleared):
+        * inspector/front-end/ElementsTreeOutline.js:
+        (WebInspector.ElementsTreeOutline.prototype._onmouseout):
+        (WebInspector.ElementsTreeOutline.prototype.populateContextMenu):
+        (WebInspector.ElementsTreeElement.prototype.ondblclick):
+        (WebInspector.ElementsTreeElement.prototype._startEditingFromEvent):
+        (WebInspector.ElementsTreeElement.prototype._populateTagContextMenu):
+        (WebInspector.ElementsTreeElement.prototype._populateTextContextMenu):
+        (WebInspector.ElementsTreeElement.prototype._startEditing):
+        (WebInspector.ElementsTreeElement.prototype._addNewAttribute):
+        * inspector/front-end/ObjectPropertiesSection.js:
+        (WebInspector.ObjectPropertyTreeElement.prototype.ondblclick):
+        * inspector/front-end/ResourceView.js:
+        (WebInspector.ResourceView.prototype._toggleURLdecoding):
+        * inspector/front-end/ResourcesPanel.js:
+        (WebInspector.ResourceSidebarTreeElement.prototype.ondblclick):
+        * inspector/front-end/StylesSidebarPane.js:
+        (WebInspector.StylePropertyTreeElement.prototype):
+        * inspector/front-end/inspector.js:
+        (WebInspector.contextMenuEventFired):
+        * inspector/front-end/treeoutline.js:
+        (TreeElement.treeElementDoubleClicked):
+
+2009-12-09  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Reviewed by Oliver Hunt.
+
+        Filters contain some leaks in untested code
+        https://bugs.webkit.org/show_bug.cgi?id=32325
+
+        Fix obvious leak in SVGFE*Lighting classes. Implement the create() idiom for 
+        all classes in svg/graphics, that were missing it. The lighting filters aren't
+        implemented so far, but the associated FilterEffect objects are build, which created
+        these leaks.
+
+        This removes the SVG related failures in the leaks bot.
+
+        * svg/SVGFEDiffuseLightingElement.cpp:
+        (WebCore::SVGFEDiffuseLightingElement::findLights):
+        * svg/SVGFEDiffuseLightingElement.h:
+        * svg/SVGFEDistantLightElement.cpp:
+        (WebCore::SVGFEDistantLightElement::lightSource):
+        * svg/SVGFEDistantLightElement.h:
+        * svg/SVGFELightElement.h:
+        * svg/SVGFEPointLightElement.cpp:
+        (WebCore::SVGFEPointLightElement::lightSource):
+        * svg/SVGFEPointLightElement.h:
+        * svg/SVGFESpecularLightingElement.cpp:
+        (WebCore::SVGFESpecularLightingElement::findLights):
+        * svg/SVGFESpecularLightingElement.h:
+        * svg/SVGFESpotLightElement.cpp:
+        (WebCore::SVGFESpotLightElement::lightSource):
+        * svg/SVGFESpotLightElement.h:
+        * svg/graphics/filters/SVGDistantLightSource.h:
+        (WebCore::DistantLightSource::create):
+        (WebCore::DistantLightSource::DistantLightSource):
+        * svg/graphics/filters/SVGFEDiffuseLighting.cpp:
+        (WebCore::FEDiffuseLighting::FEDiffuseLighting):
+        (WebCore::FEDiffuseLighting::create):
+        (WebCore::FEDiffuseLighting::setLightSource):
+        * svg/graphics/filters/SVGFEDiffuseLighting.h:
+        * svg/graphics/filters/SVGFESpecularLighting.cpp:
+        (WebCore::FESpecularLighting::FESpecularLighting):
+        (WebCore::FESpecularLighting::create):
+        (WebCore::FESpecularLighting::setLightSource):
+        * svg/graphics/filters/SVGFESpecularLighting.h:
+        * svg/graphics/filters/SVGLightSource.h:
+        * svg/graphics/filters/SVGPointLightSource.h:
+        (WebCore::PointLightSource::create):
+        (WebCore::PointLightSource::PointLightSource):
+        * svg/graphics/filters/SVGSpotLightSource.h:
+        (WebCore::SpotLightSource::create):
+        (WebCore::SpotLightSource::SpotLightSource):
+
+2009-12-10  Kenneth Russell  <kbr@google.com>
+
+        Reviewed by Oliver Hunt.
+
+        [Chromium] SporeViewer demo doesn't work in Chromium
+        https://bugs.webkit.org/show_bug.cgi?id=32364
+
+        Test: fast/canvas/webgl/bug-32364.html
+
+        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::vertexAttribAndUniformHelperf):
+        (WebCore::uniformHelperi):
+
+2009-12-09  Beth Dakin  <bdakin@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        Fix for https://bugs.webkit.org/show_bug.cgi?id=32346 SVG property 
+        -webkit-shadow should apply shadow on the result after compositing
+        -and corresponding-
+        <rdar://problem/7389404>
+
+        Set a transparency layer when setting a shadow to apply the shadow 
+        to the composite.
+        * rendering/SVGRenderSupport.cpp:
+        (WebCore::SVGRenderBase::prepareToRenderSVGContent):
+        (WebCore::SVGRenderBase::finishRenderSVGContent):
+
+2009-12-09  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32332
+        WebSocket events should be dispatched synchronously
+
+        Updated websocket/tests/simple to test for the new behavior.
+
+        When Web Sockets API says that events should be queued for async dispatch, it means something
+        different. We should keep this in mind when dealing with other HTML5-related specs.
+
+        The model for HTML5 is that code running in response to network events (e.g. WebSocket or
+        XMLHttpRequest algorithms) runs in a separate thread of execution, and thus needs to post
+        async events as its only way to communicate with client code. As long as network events are
+        queued themselves (as they are in WebKit), there is no need to queue JS events for async
+        dispatch.
+
+        * websockets/WebSocket.cpp:
+        (WebCore::WebSocket::didConnect):
+        (WebCore::WebSocket::didReceiveMessage):
+        (WebCore::WebSocket::didClose):
+
+2009-12-09  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32355
+        Assertion failure when opening a WebSocket connection
+
+        I couldn't make a reliable test for this. Once the test from bug 32299 is landed, it
+        will provide partial coverage, as I was frequently seeing the assertion failure with it.
+
+        * platform/network/SocketStreamHandleBase.cpp: (WebCore::SocketStreamHandleBase::send):
+        It's not an error if zero is returned from platformSend() - it just means that nothing could
+        be pushed down to the network layer, and all data was queued for later.
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::readStreamCallback): This will no longer happen with SocketStream,
+        but a client can potentially destroy the handle from any callback, so we need to check that
+        this didn't happen.
+        (WebCore::SocketStreamHandle::writeStreamCallback): Ditto.
+
+2009-12-09  Sam Weinig  <sam@webkit.org>
+
+        Roll out 51919 and 51920. They were incorrect and unnecessary right now.
+
+        * platform/mac/WebCoreObjCExtras.mm:
+        (WebCoreObjCScheduleDeallocateOnMainThread):
+        * platform/network/mac/NetworkStateNotifierMac.cpp:
+        (WebCore::NetworkStateNotifier::NetworkStateNotifier):
+
+2009-12-09  Steve Block  <steveblock@google.com>
+
+        Reviewed by Darin Fisher.
+
+        Adds wtf/StdLibExtras.h include for DEFINE_STATIC_LOCAL in V8 ScriptState.
+        https://bugs.webkit.org/show_bug.cgi?id=32330
+
+        Build fix only, no new tests.
+
+        * bindings/v8/ScriptState.cpp: Modified. Adds wtf/StdLibExtras.h include.
+
+2009-12-09  Steve Block  <steveblock@google.com>
+
+        Reviewed by Darin Adler.
+
+        Adds ENABLE(INSPECTOR) guards around script binding methods that use types
+        defined only when INSPECTOR is enabled.
+        https://bugs.webkit.org/show_bug.cgi?id=32328
+
+        Build fix only, no new tests.
+
+        * bindings/js/ScriptValue.cpp: Modified. Added ENABLE(INSPECTOR) guard to ScriptValue::quarantineValue.
+        * bindings/v8/ScriptObject.cpp: Modified. Added ENABLE(INSPECTOR) guard to some overloads of ScriptGlobalObject::set.
+
+2009-12-09  Steve Block  <steveblock@google.com>
+
+        Reviewed by Adam Barth.
+
+        Adds Android Makefiles for building with V8.
+        Also updates existing Android Makefiles with latest additions.
+        https://bugs.webkit.org/show_bug.cgi?id=32278
+
+        Build fix only, no new tests.
+
+        * Android.derived.jscbindings.mk: Modified.
+        * Android.derived.mk: Modified.
+        * Android.derived.v8bindings.mk: Added.
+        * Android.jscbindings.mk: Modified.
+        * Android.mk: Modified.
+        * Android.v8bindings.mk: Added.
+
+2009-12-09  Jonathan Dixon  <joth@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Bug 32338 - [Chromium] Fix Chromium builder by including missing GeolocationServiceChromium
+        https://bugs.webkit.org/show_bug.cgi?id=32338
+
+        Fix build break: re-include file dropped out by merge in http://trac.webkit.org/changeset/51681/trunk/WebCore/WebCore.gypi
+
+        * WebCore.gypi: Add missing GeolocationServiceChromium.cpp
+
+2009-12-09  Andreas Kling  <andreas.kling@nokia.com>
+
+        Reviewed by Brady Eidson.
+
+        Fixed a typo in http://trac.webkit.org/changeset/51644 that broke
+        the QWebPage autotest.
+
+        No new test required.
+
+        * loader/FrameLoader.cpp:
+        (WebCore::FrameLoader::navigateToDifferentDocument):
+
+2009-12-09  Robert Hogan  <robert@roberthogan.net>
+
+        Reviewed by Eric Seidel.
+
+        Exclude JSSVG*.cpp generated files from --minimal and --no-svg builds.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=32286
+
+        * WebCore.pro:
+
+2009-12-09  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Eric Carlson.
+
+        Ogg mimetypes are incorrect
+        https://bugs.webkit.org/show_bug.cgi?id=27113
+
+        The ogg extension is handled by audio/ogg instead of
+        application/ogg. See
+        http://wiki.xiph.org/MIME_Types_and_File_Extensions
+
+        * platform/MIMETypeRegistry.cpp:
+        (WebCore::TypeExtensionPair::):
+
+2009-12-09  Sam Weinig  <sam@webkit.org>
+
+        Reviewed by Anders Carlsson.
+
+        Use the current run loop instead of the main runloop for the NetworkStateNotifier.
+
+        * platform/network/mac/NetworkStateNotifierMac.cpp:
+        (WebCore::NetworkStateNotifier::NetworkStateNotifier):
+
+2009-12-09  Sam Weinig  <sam@webkit.org>
+
+        Reviewed by Anders Carlsson.
+
+        Use isMainThread() helper instead of pthread_main_np() != 0.
+
+        * platform/mac/WebCoreObjCExtras.mm:
+        (WebCoreObjCScheduleDeallocateOnMainThread):
+
+2009-12-09  Sam Weinig  <sam@webkit.org>
+
+        Reviewed by Anders Carlsson.
+
+        Add some #ifdefs to allow us to experiment with a single NSView mac WebKit.
+
+        * page/Chrome.h:
+        * page/EventHandler.h:
+        * page/mac/ChromeMac.mm:
+        * page/mac/DragControllerMac.mm:
+        (WebCore::DragController::dragOperation):
+        * page/mac/EventHandlerMac.mm:
+        (WebCore::EventHandler::eventLoopHandleMouseDragged):
+        (WebCore::EventHandler::eventActivatedView):
+        (WebCore::EventHandler::passMousePressEventToSubframe):
+        (WebCore::EventHandler::passMouseMoveEventToSubframe):
+        (WebCore::EventHandler::passMouseReleaseEventToSubframe):
+        (WebCore::EventHandler::passWheelEventToWidget):
+        (WebCore::EventHandler::focusDocumentView):
+        (WebCore::EventHandler::passWidgetMouseDownEventToWidget):
+        (WebCore::EventHandler::createDraggingClipboard):
+        (WebCore::isKeyboardOptionTab):
+        (WebCore::EventHandler::invertSenseOfTabsToLinks):
+        (WebCore::EventHandler::tabsToAllControls):
+        (WebCore::EventHandler::needsKeyboardEventDisambiguationQuirks):
+        (WebCore::EventHandler::accessKeyModifiers):
+        * platform/ScrollView.cpp:
+        (WebCore::ScrollView::wheelEvent):
+        * platform/Widget.cpp:
+        * platform/Widget.h:
+        * platform/mac/ScrollViewMac.mm:
+        * platform/mac/WidgetMac.mm:
+        (WebCore::Widget::Widget):
+        (WebCore::Widget::~Widget):
+        (WebCore::Widget::show):
+        (WebCore::Widget::hide):
+        (WebCore::Widget::setCursor):
+        (WebCore::Widget::paint):
+        (WebCore::Widget::setFocus):
+        (WebCore::Widget::setIsSelected):
+        (WebCore::Widget::frameRect):
+        (WebCore::Widget::setFrameRect):
+
+2009-12-09  Michael Nordman  <michaeln@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        Chromium build fix.
+
+        No new tests.
+
+        * bindings/v8/DOMData.cpp
+        * bindings/v8/V8DOMWrapper.cpp
+        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
+        (WebCore::vertexAttribAndUniformHelperf):
+        (WebCore::uniformHelperi):
+        (WebCore::uniformMatrixHelper):
+
+2009-12-09  Søren Gjesse  <sgjesse@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        [V8] Isolated world reuse failure
+        https://bugs.webkit.org/show_bug.cgi?id=32306
+
+        Fixed bug introduced in r51407: (http://trac.webkit.org/changeset/51407) which caused layout test
+        LayoutTests/http/tests/security/isolatedWorld/world-reuse.html to fail.
+
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::setInjectedScriptContextDebugId):
+        (WebCore::V8Proxy::contextDebugId):
+
+2009-12-09  Patrick Scott  <phanna@email.unc.edu>
+
+        Fix the build with ENABLE_ORIENTATION_EVENTS
+        https://bugs.webkit.org/show_bug.cgi?id=32321
+
+        * page/Frame.cpp:
+        (WebCore::Frame::sendOrientationChangeEvent):
+
+2009-12-09  Avi Drissman  <avi@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Chromium tickmarks in scrollbar now UX approved.
+        https://bugs.webkit.org/show_bug.cgi?id=32069
+
+        * platform/chromium/ScrollbarThemeChromiumMac.mm:
+        (WebCore::ScrollbarThemeChromiumMac::paint):
+
+2009-12-09  Chris Marrin  <cmarrin@apple.com>
+
+        Reviewed by Adam Roben.
+
+        Delay load DLLs for accelerated compositing
+        https://bugs.webkit.org/show_bug.cgi?id=31856
+        
+        Add logic to turn off accelerated compositing if d3d9 or QuartzCore
+        DLLs are not present.
+        
+        This patch also changes the WKCACFLayerRenderer to be a pointer.
+        This allows me to have a create() method which will not create it when
+        accelerated compositing is disabled because of missing DLLs. It 
+        avoids having to do so many checks. I also made WebViewWndProc 
+        a member function to allow several methods to be made protected, which
+        allows me to avoid doing availability checks there as well.
+
+        * platform/graphics/win/WKCACFLayer.cpp:
+        * platform/graphics/win/WKCACFLayer.h:
+        * platform/graphics/win/WKCACFLayerRenderer.cpp:
+        * platform/graphics/win/WKCACFLayerRenderer.h:
+        * rendering/RenderLayerBacking.cpp:
+
+2009-12-09  Nate Chapin  <japhet@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Rename dom/ClassNames to SpaceSplitString and update build files.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32250
+
+        * GNUmakefile.am:
+        * WebCore.gypi:
+        * WebCore.pro:
+        * WebCore.vcproj/WebCore.vcproj:
+        * WebCore.xcodeproj/project.pbxproj:
+        * WebCoreSources.bkl:
+        * css/CSSStyleSelector.cpp:
+        (WebCore::CSSStyleSelector::matchRules):
+        * dom/ClassNames.cpp: Removed.
+        * dom/ClassNames.h: Removed.
+        * dom/ClassNodeList.h:
+        * dom/NamedMappedAttrMap.h:
+        (WebCore::NamedMappedAttrMap::classNames):
+        * dom/SpaceSplitString.cpp: Copied from WebCore/dom/ClassNames.cpp.
+        (WebCore::SpaceSplitStringData::createVector):
+        (WebCore::SpaceSplitStringData::containsAll):
+        * dom/SpaceSplitString.h: Copied from WebCore/dom/ClassNames.h.
+        (WebCore::SpaceSplitStringData::SpaceSplitStringData):
+        (WebCore::SpaceSplitString::SpaceSplitString):
+        (WebCore::SpaceSplitString::set):
+        (WebCore::SpaceSplitString::containsAll):
+        * dom/StyledElement.h:
+        (WebCore::StyledElement::classNames):
+        * html/HTMLAnchorElement.cpp:
+        (WebCore::HTMLAnchorElement::setRel):
+
+2009-12-09  Stephen White  <senorblanco@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Enable SVG filters in Chromium build.
+        https://bugs.webkit.org/show_bug.cgi?id=32323
+
+        Covered by SVG filter layout tests.
+
+        * WebCore.gyp/WebCore.gyp:
+        * WebCore.gypi:
+        * bindings/scripts/CodeGeneratorV8.pm:
+        * bindings/v8/DerivedSourcesAllInOne.cpp:
+        * bindings/v8/V8DOMWrapper.cpp:
+        * bindings/v8/V8Index.cpp:
+        * bindings/v8/V8Index.h:
+
+2009-12-09  Oliver Hunt  <oliver@apple.com>
+
+        Build fix
+
+        * bindings/js/JSWebGLRenderingContextCustom.cpp:
+        (WebCore::functionForUniform):
+
+2009-12-08  Fumitoshi Ukai  <ukai@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        WebSocket allow space (U+0020) in sub protocol name.
+        https://bugs.webkit.org/show_bug.cgi?id=32266
+
+        Test: websocket/tests/sub-protocol-with-space.html
+
+        * websockets/WebSocket.cpp:
+        (WebCore::isValidProtocolString):
+
+2009-12-08  Peterson Trethewey  <petersont@google.com>
+
+        Reviewed by Oliver Hunt.
+
+        Implement WebGLUniformLocation and change API to use it.
+        https://bugs.webkit.org/show_bug.cgi?id=31173
+
+        Test: fast/canvas/webgl/uniform-location.html
+
+        * DerivedSources.make:
+        * WebCore.gypi:
+        * WebCore.xcodeproj/project.pbxproj:
+        * bindings/js/JSWebGLRenderingContextCustom.cpp:
+        (WebCore::JSWebGLRenderingContext::getProgramParameter):
+        (WebCore::JSWebGLRenderingContext::getUniform):
+        (WebCore::functionForUniform):
+        (WebCore::dataFunctionf):
+        (WebCore::dataFunctioni):
+        (WebCore::dataFunctionMatrix):
+        * bindings/scripts/CodeGeneratorV8.pm:
+        * bindings/v8/DerivedSourcesAllInOne.cpp:
+        * bindings/v8/V8Index.cpp:
+        * bindings/v8/V8Index.h:
+        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
+        (WebCore::toWebGLUniformLocation):
+        (WebCore::):
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::isFunctionToCallForAttribute):
+        (WebCore::vertexAttribAndUniformHelperf):
+        (WebCore::uniformHelperi):
+        (WebCore::uniformMatrixHelper):
+        * html/canvas/WebGLRenderingContext.cpp:
+        (WebCore::WebGLRenderingContext::getUniform):
+        (WebCore::WebGLRenderingContext::getUniformLocation):
+        (WebCore::WebGLRenderingContext::uniform1f):
+        (WebCore::WebGLRenderingContext::uniform1fv):
+        (WebCore::WebGLRenderingContext::uniform1i):
+        (WebCore::WebGLRenderingContext::uniform1iv):
+        (WebCore::WebGLRenderingContext::uniform2f):
+        (WebCore::WebGLRenderingContext::uniform2fv):
+        (WebCore::WebGLRenderingContext::uniform2i):
+        (WebCore::WebGLRenderingContext::uniform2iv):
+        (WebCore::WebGLRenderingContext::uniform3f):
+        (WebCore::WebGLRenderingContext::uniform3fv):
+        (WebCore::WebGLRenderingContext::uniform3i):
+        (WebCore::WebGLRenderingContext::uniform3iv):
+        (WebCore::WebGLRenderingContext::uniform4f):
+        (WebCore::WebGLRenderingContext::uniform4fv):
+        (WebCore::WebGLRenderingContext::uniform4i):
+        (WebCore::WebGLRenderingContext::uniform4iv):
+        (WebCore::WebGLRenderingContext::uniformMatrix2fv):
+        (WebCore::WebGLRenderingContext::uniformMatrix3fv):
+        (WebCore::WebGLRenderingContext::uniformMatrix4fv):
+        * html/canvas/WebGLRenderingContext.h:
+        * html/canvas/WebGLRenderingContext.idl:
+        * html/canvas/WebGLUniformLocation.cpp: Added.
+        (WebCore::WebGLUniformLocation::create):
+        (WebCore::WebGLUniformLocation::WebGLUniformLocation):
+        * html/canvas/WebGLUniformLocation.h: Added.
+        (WebCore::WebGLUniformLocation::~WebGLUniformLocation):
+        (WebCore::WebGLUniformLocation::program):
+        (WebCore::WebGLUniformLocation::location):
+        * html/canvas/WebGLUniformLocation.idl: Added.
+
+2009-12-08  Adam Langley  <agl@google.com>
+
+        Reviewed by Darin Adler.
+
+        Fix assertion failure in WebCore::RenderBlock::startDelayUpdateScrollInfo
+
+        startDelayUpdateScrollInfo calls a function that can end up calling
+        startDelayUpdateScrollInfo again. However, it's static state is
+        inconsistent when this happens leading to an assertion failure (or
+        probably a memory leak if assertions are off).
+
+        Thanks to Robert Swiecki for the test case.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32172
+        http://code.google.com/p/chromium/issues/detail?id=28880
+
+        Test: fast/css/recursive-delay-update-scroll.html
+
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::finishDelayUpdateScrollInfo):
+
+2009-12-08  Steve Falkenburg  <sfalken@apple.com>
+
+        Reviewed by Adam Roben.
+
+        WebCore source level debugging on Windows not reliable in some cases
+        https://bugs.webkit.org/show_bug.cgi?id=32297
+
+        Customized pdb file name/location for WebCore static library.
+
+        * WebCore.vcproj/WebCoreCommon.vsprops: Add ProgramDataBaseFileName.
+
+2009-12-08  Kevin Watters  <kevinwatters@gmail.com>
+
+        Reviewed by Kevin Ollivier.
+
+        [wx] Mac plugins support.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=32236
+
+        * platform/FileSystem.h:
+        * platform/cf/BinaryPropertyList.h:
+        * platform/network/curl/ResourceHandleManager.cpp:
+        * platform/wx/FileSystemWx.cpp:
+        (WebCore::fileExists):
+        (WebCore::unloadModule):
+        (WebCore::wxDirTraverserNonRecursive::wxDirTraverserNonRecursive):
+        (WebCore::wxDirTraverserNonRecursive::OnFile):
+        (WebCore::wxDirTraverserNonRecursive::OnDir):
+        (WebCore::listDirectory):
+        * plugins/mac/PluginViewMac.cpp:
+        (WebCore::nativeWindowFor):
+        (WebCore::cgHandleFor):
+        (WebCore::topLevelOffsetFor):
+        (WebCore::PluginView::platformStart):
+        (WebCore::PluginView::setFocus):
+        (WebCore::PluginView::invalidateRect):
+        (WebCore::PluginView::handleKeyboardEvent):
+        (WebCore::PluginView::globalMousePosForPlugin):
+        * plugins/wx/PluginDataWx.cpp: Added.
+        (WebCore::PluginData::initPlugins):
+        (WebCore::PluginData::refresh):
+        * wscript:
+
+2009-12-08  Brady Eidson  <beidson@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Navigating to a cached page can result in accessing a destroyed HTMLInputElement.
+        <rdar://problem/6856662> and https://webkit.org/b/32293
+
+        Test: fast/loader/input-element-page-cache-crash.html
+
+        * html/HTMLInputElement.cpp:
+        (WebCore::HTMLInputElement::parseMappedAttribute): Make sure to unregister for the activation
+          callback after the new m_autocomplete setting has been stored so the unregistration actually
+          takes place.
+
+2009-12-08  Dmitry Titov  <dimich@chromium.org>
+
+        Rubber-stamped by David Levin.
+
+        Revert and reopen "Add asserts to RefCounted to make sure ref/deref happens on the right thread."
+        It may have caused massive increase of reported leaks on the bots.
+        https://bugs.webkit.org/show_bug.cgi?id=31639
+
+        * ForwardingHeaders/wtf/ThreadVerifier.h: Removed.
+        * loader/icon/IconRecord.cpp:
+        (WebCore::IconRecord::IconRecord):
+        * platform/SharedBuffer.cpp:
+        (WebCore::SharedBuffer::SharedBuffer):
+        * platform/text/StringImpl.cpp:
+        (WebCore::StringImpl::StringImpl):
+
+2009-12-08  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Chromium: support custom WebCore context menu items in Chromium port.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32277
+
+        * platform/ContextMenu.h:
+        * platform/ContextMenuItem.h:
+        (WebCore::PlatformMenuItemDescription::PlatformMenuItemDescription):
+        * platform/chromium/ContextMenuChromium.cpp:
+        (WebCore::ContextMenu::ContextMenu):
+        (WebCore::ContextMenu::itemCount):
+        (WebCore::ContextMenu::insertItem):
+        (WebCore::ContextMenu::appendItem):
+        (WebCore::ContextMenu::itemWithAction):
+        (WebCore::ContextMenu::itemAtIndex):
+        (WebCore::ContextMenu::platformDescription):
+        * platform/chromium/ContextMenuItemChromium.cpp:
+        (WebCore::ContextMenuItem::ContextMenuItem):
+        (WebCore::ContextMenuItem::releasePlatformDescription):
+        (WebCore::ContextMenuItem::type):
+        (WebCore::ContextMenuItem::action):
+        (WebCore::ContextMenuItem::title):
+        (WebCore::ContextMenuItem::checked):
+        (WebCore::ContextMenuItem::enabled):
+        (WebCore::ContextMenuItem::setType):
+        (WebCore::ContextMenuItem::setAction):
+        (WebCore::ContextMenuItem::setTitle):
+        (WebCore::ContextMenuItem::setChecked):
+        (WebCore::ContextMenuItem::setEnabled):
+
+2009-12-08  Adam Langley  <agl@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        Chromium Linux: set default scrollbar colours.
+
+        This is so that layout tests have sane defaults for the scrollbar
+        colours, even if the API user doesn't set any.
+
+        This is a fix due to r51827.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32287
+
+        This is very well covered by existing layout tests.
+
+        * rendering/RenderThemeChromiumLinux.cpp:
+
+2009-12-08  Beth Dakin  <bdakin@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        Fix for <rdar://problem/7397808> Crash occurs at 
+        RenderObject::containingBlock() as I type in the Google Search 
+        field (during page load)
+
+        * editing/Editor.cpp:
+        (WebCore::Editor::insideVisibleArea): ownerRenderer() needs to be 
+        null checked.
+
+2009-12-08  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Add asserts to RefCounted to make sure ref/deref happens on the right thread.
+        https://bugs.webkit.org/show_bug.cgi?id=31639
+
+        * loader/icon/IconRecord.cpp:
+        (WebCore::IconRecord::IconRecord): Disable thread verification for this class because of its cross-thread use in IconDatabase.
+        * platform/SharedBuffer.cpp:
+        (WebCore::SharedBuffer::SharedBuffer): Ditto.
+        * platform/text/StringImpl.cpp:
+        (WebCore::StringImpl::StringImpl): Disable thread verification for this class, add FIXME to enforce proper usage via crossThreadString.
+        * ForwardingHeaders/wtf/ThreadVerifier.h: Added.
+
+2009-12-08  John Gregg  <johnnyg@google.com>
+
+        Reviewed by Adam Barth.
+
+        Inform the NotificationCenter when its window goes away in the same
+        manner as other DOMWindow fields, and prevent invalid operations on
+        it after that happens.
+
+        As part of this, change the V8 bindings for notifications to call
+        through the NotificationCenter rather than doing those operations
+        itself.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31886
+
+        Test: fast/notifications/notification-after-close.html
+
+        * bindings/v8/custom/V8NotificationCenterCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * notifications/Notification.cpp:
+        (WebCore::Notification::Notification):
+        * notifications/NotificationCenter.cpp:
+        (WebCore::NotificationCenter::checkPermission):
+        (WebCore::NotificationCenter::requestPermission):
+        * notifications/NotificationCenter.h:
+        (WebCore::NotificationCenter::createHTMLNotification):
+        (WebCore::NotificationCenter::createNotification):
+        (WebCore::NotificationCenter::disconnectFrame):
+        * page/DOMWindow.cpp:
+        (WebCore::DOMWindow::clear):
+
+2009-12-08  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by John Sullivan.
+
+        Fixed block selection gap repainting in table cells
+
+        Test: fast/repaint/block-selection-gap-in-table-cell.html
+
+        This recently-introduced regression exposed the fact that
+        RenderTableCell did not override offsetFromContainer() to adjust for
+        the fact that table cells’ coordinates are relative to the table
+        section, not the table row. With this fixed, RenderTableCell no longer
+        needs to override mapLocalToContainer() and mapAbsoluteToLocalPoint(),
+        since the base class implementations of those use offsetFromContainer().
+
+        * rendering/RenderTableCell.cpp:
+        (WebCore::RenderTableCell::offsetFromContainer):
+        * rendering/RenderTableCell.h:
+
+2009-12-08  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Not reviewed. Sane way to force a rebuild on all win slaves, according to Adam Roben.
+
+        * WebCorePrefix.h:
+
+2009-12-08  Dan Bernstein  <mitz@apple.com>
+
+        Build fix
+
+        * loader/loader.cpp:
+        (WebCore::cachedResourceTypeToTargetType):
+
+2009-12-08  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Not reviewed. Touch svgtags.in to eventually fix the win debug build.
+
+        * svg/svgtags.in:
+
+2009-12-08  Mike Belshe  <mike@belshe.com>
+
+        Reviewed by Darin Fisher.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32167
+        Update the ResourceRequest::RequestType.  This previously
+        was specific to Chromium.  Moved into ResourceRequestBase, enabling
+        more specificity about the type (which is otherwise only known to the
+        loader), and also making this information available to all platforms.
+        Any platform with a network layer which can utilize this information
+        may want to use it for prioritization.
+
+        Note to Chromium glue: TargetIsSubResource renamed to TargetIsSubresource.
+
+        * loader/loader.cpp:
+        (WebCore::Loader::Loader):
+        (WebCore::CachedResourceTypeToTargetType):
+        (WebCore::Loader::Host::servePendingRequests):
+        * platform/network/ResourceRequestBase.h:
+        (WebCore::ResourceRequestBase::):
+        (WebCore::ResourceRequestBase::targetType):
+        (WebCore::ResourceRequestBase::setTargetType):
+        (WebCore::ResourceRequestBase::ResourceRequestBase):
+        * platform/network/chromium/ResourceRequest.h:
+        (WebCore::ResourceRequest::ResourceRequest):
+
+2009-12-08  Steve Block  <steveblock@google.com>
+
+        Reviewed by Adam Barth.
+
+        [Android] Adds Makefiles for Android port.
+        https://bugs.webkit.org/show_bug.cgi?id=31325
+
+        Build system change only. No tests possible.
+
+        * Android.derived.jscbindings.mk: Added.
+        * Android.derived.mk: Added.
+        * Android.jscbindings.mk: Added.
+        * Android.mk: Added.
+        * WebCorePrefix.h: Modified. Sets up some flags and adds a header required for building on Android.
+
+2009-12-08  Christian Dywan  <christian@twotoasts.de>
+
+        Reviewed by Xan Lopez.
+
+        * platform/network/soup/DNSSoup.cpp:
+        (WebCore::prefetchDNS): Conditionalize prefetching on
+        the libSoup version.
+
+2009-12-08  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Rubber-stamped by Maciej Stachowiak.
+
+        Turn on (SVG) Filters for Win.
+        https://bugs.webkit.org/show_bug.cgi?id=32224
+
+        * WebCore.vcproj/WebCoreCommon.vsprops:
+        * WebCore.vcproj/build-generated-files.sh:
+        * bindings/scripts/CodeGeneratorCOM.pm: Touch file to assure a world rebuild. Hopefully.
+
+2009-12-08  Carol Szabo  <carol.szabo@nokia.com>
+
+        Reviewed by Darin Adler.
+
+        CSS Counter Nesting still does not work according to the spec.
+        https://bugs.webkit.org/show_bug.cgi?id=31723
+
+        Test: fast/css/counters/nesting.html
+
+        * rendering/RenderCounter.cpp:
+        (WebCore::findPlaceForCounter):
+        Replaced the faulty counter insertion algorithm with one that works.
+
+2009-12-08  John Sullivan  <sullivan@apple.com>
+
+        Add isAutofilled getter to match existing setter.
+
+        Reviewed by Ada Chan.
+
+        * bindings/objc/DOMHTML.mm:
+        (-[DOMHTMLInputElement _isAutofilled]):
+        Implemented new cover function.
+        
+        * bindings/objc/DOMPrivate.h:
+        Declared new cover function.
+
+2009-12-08  Dominik Röttsches  <dominik.roettsches@access-company.com>
+
+        Reviewed by Gustavo Noronha Silva.
+
+        [Gtk] Create a TextBreakIterator implementation based on GLib (without ICU)
+        https://bugs.webkit.org/show_bug.cgi?id=31469
+
+        Added a TextBreakIterator implementation based on GLib and pango,
+        which allows compiling WebCore without ICU.
+
+        * GNUmakefile.am:
+        * platform/text/gtk/TextBreakIteratorGtk.cpp: Added.
+        (WebCore::):
+        (WebCore::setUpIterator):
+        (WebCore::characterBreakIterator):
+        (WebCore::cursorMovementIterator):
+        (WebCore::wordBreakIterator):
+        (WebCore::lineBreakIterator):
+        (WebCore::sentenceBreakIterator):
+        (WebCore::textBreakFirst):
+        (WebCore::textBreakLast):
+        (WebCore::textBreakNext):
+        (WebCore::textBreakPrevious):
+        (WebCore::textBreakPreceding):
+        (WebCore::textBreakFollowing):
+        (WebCore::textBreakCurrent):
+        (WebCore::isTextBreak):
+
+2009-12-08  Alexander Pavlov  <apavlov@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Change the way cookies are retrieved in the WebInspector frontend.
+
+        Moved the cookie filtering from the native code into the frontend so that
+        all cookies can be retrieved regardless of the associated domain
+        (required for certain audits to run.)
+        https://bugs.webkit.org/show_bug.cgi?id=32160
+
+        Test: inspector/cookie-resource-match.html
+
+        * inspector/InspectorBackend.cpp:
+        (WebCore::InspectorBackend::getCookies):
+        * inspector/InspectorBackend.h:
+        * inspector/InspectorBackend.idl:
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::getCookies):
+        * inspector/InspectorController.h:
+        * inspector/front-end/CookieItemsView.js:
+        (WebInspector.CookieItemsView.prototype.update.callback):
+        (WebInspector.CookieItemsView.prototype.update):
+        (WebInspector.CookieItemsView.prototype._cookiesForDomain):
+        * inspector/front-end/DOMAgent.js:
+        (WebInspector.Cookies.getCookiesAsync):
+        (WebInspector.Cookies.cookieMatchesResourceURL):
+        (WebInspector.Cookies.cookieDomainMatchesResourceDomain):
+        * inspector/front-end/Resource.js:
+        (WebInspector.Resource):
+        (WebInspector.Resource.prototype.get documentURL):
+        (WebInspector.Resource.prototype.set documentURL):
+        * inspector/front-end/inspector.js:
+        (WebInspector.addResource):
+
+2009-12-08  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Not reviewed. Touch svgtags.in, in order to force SVGNames.* regeneration. Praying for gtk bot to be fixed :-)
+
+        * svg/svgtags.in:
+
+2009-12-08  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Not reviewed. Trying to force a rebuild on the Gtk slave. If that doesn't work, someone must force a rebuild from scratch.
+
+        * bindings/scripts/CodeGeneratorJS.pm:
+
+2009-12-06  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: provide custom context menu in the front-end window.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32200
+
+        * English.lproj/localizedStrings.js:
+        * GNUmakefile.am:
+        * WebCore.gypi:
+        * WebCore.pro:
+        * WebCore.vcproj/WebCore.vcproj:
+        * WebCore.xcodeproj/project.pbxproj:
+        * bindings/js/JSInspectorFrontendHostCustom.cpp:
+        (WebCore::JSInspectorFrontendHost::showContextMenu):
+        * inspector/InspectorFrontend.cpp:
+        (WebCore::InspectorFrontend::contextMenuItemSelected):
+        (WebCore::InspectorFrontend::contextMenuCleared):
+        * inspector/InspectorFrontend.h:
+        * inspector/InspectorFrontendHost.cpp:
+        (WebCore::InspectorFrontendHost::InspectorFrontendHost):
+        (WebCore::InspectorFrontendHost::~InspectorFrontendHost):
+        (WebCore::InspectorFrontendHost::showContextMenu):
+        (WebCore::InspectorFrontendHost::contextMenuItemSelected):
+        (WebCore::InspectorFrontendHost::contextMenuCleared):
+        * inspector/InspectorFrontendHost.h:
+        (WebCore::InspectorFrontendHost::MenuSelectionHandler::create):
+        (WebCore::InspectorFrontendHost::MenuSelectionHandler::~MenuSelectionHandler):
+        (WebCore::InspectorFrontendHost::MenuSelectionHandler::disconnect):
+        (WebCore::InspectorFrontendHost::MenuSelectionHandler::contextMenuItemSelected):
+        (WebCore::InspectorFrontendHost::MenuSelectionHandler::contextMenuCleared):
+        (WebCore::InspectorFrontendHost::MenuSelectionHandler::MenuSelectionHandler):
+        * inspector/InspectorFrontendHost.idl:
+        * inspector/front-end/ContextMenu.js: Added.
+        * inspector/front-end/WebKit.qrc:
+        * inspector/front-end/inspector.html:
+        * inspector/front-end/inspector.js:
+        (WebInspector.loaded):
+        (WebInspector.documentContextMenu):
+        * page/ContextMenuController.cpp:
+        (WebCore::ContextMenuController::ContextMenuController):
+        (WebCore::ContextMenuController::clearContextMenu):
+        (WebCore::ContextMenuController::handleContextMenuEvent):
+        (WebCore::ContextMenuController::showContextMenu):
+        (WebCore::ContextMenuController::createContextMenu):
+        (WebCore::ContextMenuController::contextMenuItemSelected):
+        * page/ContextMenuController.h:
+        * page/ContextMenuSelectionHandler.h: Added.
+        (WebCore::ContextMenuSelectionHandler::ContextMenuSelectionHandler):
+        (WebCore::ContextMenuSelectionHandler::~ContextMenuSelectionHandler):
+        * platform/ContextMenu.cpp:
+        (WebCore::ContextMenu::checkOrEnableIfNeeded):
+        * platform/ContextMenuItem.h:
+
+2009-12-08  Andras Becsi  <abecsi@inf.u-szeged.hu>
+
+        Rubber-stamped by Kenneth Rohde Christiansen.
+
+        [Qt] Build fix of duplicated platform/graphics/filters/FEGaussianBlur.cpp in WebCore.pro after enabled svg filters.
+
+        No new tests needed.
+        * WebCore.pro:
+
+2009-12-07  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Add a function to show render tree for debugging
+        https://bugs.webkit.org/show_bug.cgi?id=31288
+
+        No new tests because this just adds a function for debugging.
+
+        * rendering/RenderObject.cpp:
+        (WebCore::RenderObject::showRenderObject):
+        (WebCore::RenderObject::showRenderTreeAndMark):
+        (showRenderTree):
+        * rendering/RenderObject.h:
+
+2009-12-07  Victor Wang  <victorw@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Implement NamedPropertyEnumerator and IndexedPropertyEnumerator for
+        V8 NPObject. This should make the object enumerable and fix the
+        enumeration issue in layout test plugins/netscape-enumerate.html.
+
+        Also fix some existing style issues per webkit style guidelines.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32254
+
+        Test: plugins/netscape-enumerate.html
+
+        * bindings/v8/V8NPObject.cpp:
+        (npObjectInvokeImpl):
+        (npObjectInvokeDefaultHandler):
+        (npObjectGetProperty):
+        (npObjectPropertyEnumerator):
+        (npObjectNamedPropertyEnumerator):
+        (npObjectIndexedPropertyEnumerator):
+        (createV8ObjectForNPObject):
+
+2009-12-07  Fumitoshi Ukai  <ukai@chromium.org>
+
+        Reviewed by Alexey Proskuryakov.
+
+        Fragments now make WebSocket URL parsing fail.
+        https://bugs.webkit.org/show_bug.cgi?id=32144
+
+        * websockets/WebSocket.cpp:
+        (WebCore::WebSocket::connect):
+
+2009-12-07  Fumitoshi Ukai  <ukai@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Fix wrong length parsing in WebSocket.
+        https://bugs.webkit.org/show_bug.cgi?id=32203
+
+        * websockets/WebSocketChannel.cpp:
+        (WebCore::WebSocketChannel::didReceiveData):
+
+2009-12-07  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Rubber-stamped by Maciej Stachowiak.
+
+        Turn on (SVG) Filters for Qt.
+        https://bugs.webkit.org/show_bug.cgi?id=32224
+
+        * WebCore.pro:
+
+2009-12-07  Evan Martin  <evan@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Chromium: theme scrollbars to match GTK theme.
+        Add functions to RenderThemeChromiumLinux to change the scrollbar
+        color.
+
+        Since the change is to the Chromium WebKit API layer, testing will
+        be in Chromium's test shell.
+        http://bugs.webkit.org/show_bug.cgi?id=32048
+
+        Patch from Markus Gutschke <markus@chromium.org>.
+
+        * platform/chromium/ScrollbarThemeChromiumLinux.cpp:
+        (WebCore::saturateAndBrighten):
+        (WebCore::outlineColor):
+        (WebCore::ScrollbarThemeChromiumLinux::paintTrackPiece):
+        (WebCore::ScrollbarThemeChromiumLinux::paintThumb):
+        * rendering/RenderThemeChromiumLinux.cpp:
+        (WebCore::RenderThemeChromiumLinux::setScrollbarColors):
+        * rendering/RenderThemeChromiumLinux.h:
+        (WebCore::RenderThemeChromiumLinux::thumbInactiveColor):
+        (WebCore::RenderThemeChromiumLinux::thumbActiveColor):
+        (WebCore::RenderThemeChromiumLinux::trackColor):
+
+2009-12-08  Gustavo Noronha Silva  <gustavo.noronha@collabora.co.uk>
+
+        Reviewed by Xan Lopez.
+
+        [GTK] Doesn't respect Content-Disposition for downloads, and provides no way for apps to do that
+        https://bugs.webkit.org/show_bug.cgi?id=32247
+
+        Allow creating a ResourceResponse from a SoupMessage.
+
+        Covered by API test.
+
+        * platform/network/soup/ResourceResponse.h:
+        (WebCore::ResourceResponse::ResourceResponse):
+        * platform/network/soup/ResourceResponseSoup.cpp:
+        (WebCore::ResourceResponse::updateFromSoupMessage):
+
+2009-12-07  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Not reviewed. Reverting problematic patch, causing errors.
+
+        Revert r51789 (Avoid zero division during SVGPaintServerPattern::setup()). Crashes on all Windows slaves.
+        Reopen bug https://bugs.webkit.org/show_bug.cgi?id=29912.
+
+        * svg/graphics/SVGPaintServerPattern.cpp:
+        (WebCore::SVGPaintServerPattern::setup):
+
+2009-12-07  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Add support for HTMLInputElement::stepUp() and stepDown() for
+        type=number and type=range.
+        https://bugs.webkit.org/show_bug.cgi?id=27451
+
+        Our implementation of stepUp() and stepDown() rounds the resultant
+        value to conform to the step value.
+        Change the number-string conversion method for RenderSlider to be
+        consistent with type=number.
+
+        Tests: fast/forms/input-step-number.html
+               fast/forms/input-step-range.html
+               fast/forms/input-step-unsupported.html
+
+        * html/HTMLInputElement.cpp:
+        (WebCore::HTMLInputElement::rangeUnderflow): Unify the code for NUMBER and RANGE.
+        (WebCore::HTMLInputElement::rangeOverflow): Unify the code for NUMBER and RANGE.
+        (WebCore::HTMLInputElement::minimum): Renamed from rangeMinimum(), and support for NUMBER.
+        (WebCore::HTMLInputElement::maximum): Renamed from rangeMaximum(), and support for NUMBER.
+        (WebCore::HTMLInputElement::stepBase):
+        (WebCore::HTMLInputElement::stepMismatch): Use stepBase().
+        (WebCore::HTMLInputElement::applyStepForNumberOrRange):
+        (WebCore::HTMLInputElement::stepUp):
+        (WebCore::HTMLInputElement::stepDown):
+        (WebCore::HTMLInputElement::formStringFromDouble):
+        * html/HTMLInputElement.h:
+        (WebCore::HTMLInputElement::stepUp):
+        (WebCore::HTMLInputElement::stepDown):
+        * html/HTMLInputElement.idl: Add stepUp() and stepDown().
+        * rendering/RenderSlider.cpp:
+        (WebCore::SliderRange::SliderRange): Sync with rangeMinimum()/rangeMaximum() renaming.
+        (WebCore::RenderSlider::updateFromElement): Use formStringFromDouble().
+        (WebCore::RenderSlider::setValueForPosition): Use formStringFromDouble().
+
+2009-12-07  Albert J. Wong  <ajwong@chromium.org>
+
+        Not reviewed: Chromium build fix try 2 (dumb error).
+
+        * bindings/v8/ScriptValue.h:
+        (WebCore::ScriptValue::getString):
+
+2009-12-07  Albert J. Wong  <ajwong@chromium.org>
+
+        Not reviewed: Chromium build fix.
+
+        Fix Chromium build break caused by an added dependency from
+        ScriptControllerBase to JSDOMWindowShell, and an API change in
+        ScriptValue.
+
+        * bindings/ScriptControllerBase.cpp:
+        (WebCore::ScriptController::executeIfJavaScriptURL):
+        * bindings/v8/ScriptValue.h:
+        (WebCore::ScriptValue::getString):
+
+2009-12-07  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by Darin Adler.
+
+        REGRESSION(4.0.4-42a12): Indent does not work for twice modified with background text in gmail.
+        <rdar://problem/7442387>
+        https://bugs.webkit.org/show_bug.cgi?id=32233
+        
+        Fixes problem in re-creating the correct hierarchy under the new block.
+        Added extensive testing to cover all the cases.
+
+        Test: editing/execCommand/indent-with-style2.html
+
+        * editing/CompositeEditCommand.cpp:
+        (WebCore::CompositeEditCommand::cloneParagraphUnderNewElement):
+
+2009-12-07  Dmitry Titov  <dimich@chromium.org>
+
+        Rubber-stamped by Darin Adler.
+
+        Remove ENABLE_SHARED_SCRIPT flags
+        https://bugs.webkit.org/show_bug.cgi?id=32245
+        This patch was obtained by "git revert" command and then un-reverting of ChangeLog files.
+
+        * Configurations/FeatureDefines.xcconfig:
+        * GNUmakefile.am:
+        * WebCore.pro:
+
+2009-12-07  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Not reviewed. Force JS binding regeneration, eventually fixing the broken tests on the bots.
+
+        * bindings/scripts/CodeGeneratorJS.pm:
+
+2009-12-07  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Not reviewed. Try to fix mac builds by touching svgtags.in - I only tried from-scratch builds.
+
+        * svg/svgtags.in:
+
+2009-12-07  Gavin Barraclough  <barraclough@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32184
+        Handle out-of-memory conditions with JSC Ropes with a JS exception, rather than crashing.
+        Switch from using fastMalloc to tryFastMalloc, pass an ExecState to record the exception on.
+
+        * bindings/ScriptControllerBase.cpp:
+        (WebCore::ScriptController::executeIfJavaScriptURL):
+        * bindings/js/JSCanvasRenderingContext2DCustom.cpp:
+        (WebCore::toHTMLCanvasStyle):
+        (WebCore::JSCanvasRenderingContext2D::setFillColor):
+        (WebCore::JSCanvasRenderingContext2D::setStrokeColor):
+        (WebCore::JSCanvasRenderingContext2D::setShadow):
+        * bindings/js/ScriptCallStack.cpp:
+        (WebCore::ScriptCallStack::ScriptCallStack):
+        (WebCore::ScriptCallStack::initialize):
+        * bindings/js/ScriptValue.cpp:
+        (WebCore::ScriptValue::getString):
+        * bindings/js/ScriptValue.h:
+        * bindings/js/SerializedScriptValue.cpp:
+        (WebCore::SerializingTreeWalker::convertIfTerminal):
+        * bindings/objc/WebScriptObject.mm:
+        (+[WebScriptObject _convertValueToObjcValue:originRootObject:rootObject:]):
+        * page/Console.cpp:
+        (WebCore::Console::addMessage):
+
+2009-12-07  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Reviewed by Holger Hans Peter Freyther.
+
+        Turn on (SVG) Filters support, by default.
+        https://bugs.webkit.org/show_bug.cgi?id=32224
+
+        Only enable filters on mac for now, skipped all affected tests on the other platforms.
+        Will enable them one after another, to minimize breakage.
+
+        * Configurations/FeatureDefines.xcconfig: Enable FILTERS build flag.
+
+2009-12-07  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Fix a bug that KURL rejects a host name which has an IPv4 address
+        inside an IPv6 form like [::127.0.0.1].
+        https://bugs.webkit.org/show_bug.cgi?id=29913
+
+        * platform/KURL.cpp:
+        (WebCore::characterClassTable): Add IPv6Char to '.'.
+
+2009-12-07  Brady Eidson  <beidson@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        <rdar://problem/7443417> - Closing a window opened with "New windows open with: Same Page" results in crash in ::~HistoryItem
+
+        The HistoryItem copy constructor has one very specific use case - to support the feature of a WebView copying another WebView's
+        BackForwardList.  That constructor wasn't initializing its m_document pointer, leading to this crash in the destructor.
+
+        * history/HistoryItem.cpp:
+        (WebCore::HistoryItem::~HistoryItem): Change the setDocument(0) to an ASSERT that the document is already 0. A HistoryItem cannot
+          outlive its Document and Documents will always clear the back-pointer in their ::detach() method.
+        (WebCore::HistoryItem::HistoryItem): Missed the m_document initializer in the copy constructor. Also remove an invalid assertion
+          about the original items m_cachedPage object (which is irrelevant to the copy).
+
+2009-12-07  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Remove partial SharedScript implementation.
+        https://bugs.webkit.org/show_bug.cgi?id=32237
+        The patch was obtained by running "git revert" command and then un-reverting WebCore/ChangeLog.
+
+        * DerivedSources.make:
+        * SharedScript/SharedScriptContext.cpp: Removed.
+        * SharedScript/SharedScriptContext.h: Removed.
+        * SharedScript/SharedScriptContext.idl: Removed.
+        * SharedScript/SharedScriptController.h: Removed.
+        * SharedScript/WebKitSharedScript.cpp: Removed.
+        * SharedScript/WebKitSharedScript.h: Removed.
+        * SharedScript/WebKitSharedScript.idl: Removed.
+        * SharedScript/WebKitSharedScriptRepository.cpp: Removed.
+        * SharedScript/WebKitSharedScriptRepository.h: Removed.
+        * WebCore.vcproj/WebCore.vcproj:
+        * WebCore.xcodeproj/project.pbxproj:
+        * dom/Document.cpp:
+        (WebCore::Document::detach):
+        * dom/EventTarget.cpp:
+        * dom/EventTarget.h:
+        * dom/ScriptExecutionContext.h:
+
+2009-12-07  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Nikolas Zimmermann.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32226
+        Random crashes in WebSocket tests on Leopard Debug builbot
+
+        * platform/network/SocketStreamHandleBase.cpp: (WebCore::SocketStreamHandleBase::close):
+        Make sure the object still exists when setting m_state.
+
+2009-12-07  Shiki Okasaka  <shiki@google.com>
+
+        Reviewed by Dirk Schulze.
+
+        Avoid zero division during SVGPaintServerPattern::setup()
+        https://bugs.webkit.org/show_bug.cgi?id=29912
+
+        Fix zero division bugs in SVGPaintServerPattern::setup() that occurred
+        if the tile of a pattern was bigger than the pattern and the pattern
+        size was < 0.5, and if the attribute overflow was set to visible.
+
+        Test: svg/custom/small-pattern.html
+
+        * svg/graphics/SVGPaintServerPattern.cpp:
+        (WebCore::SVGPaintServerPattern::setup):
+
+2009-12-07  Kenneth Russell  <kbr@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        [v8] WebCore::WebGLArrayBufferInternal::byteLengthAttrGetter NULL pointer
+        https://bugs.webkit.org/show_bug.cgi?id=31889
+
+        Fixed bug in handling of zero-argument constructor call.
+
+        Test: fast/canvas/webgl/bug-31889.html
+
+        * bindings/v8/custom/V8WebGLArrayBufferCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+
+2009-12-07  Gyuyoung Kim  <gyuyoung@gmail.com>
+
+        Reviewed by Eric Seidel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32024
+        [GTK] WebKit does not compile without JAVASCRIPT_DEBUGGER
+
+        Fix build errors when javascript-debugger is disabled on GTK
+
+        * GNUmakefile.am:
+
+2009-12-07  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Fixed <rdar://problem/7437820> Weird selection artifacts
+
+        Tests: fast/repaint/block-selection-gap-stale-cache-2.html
+               fast/repaint/block-selection-gap-stale-cache.html
+
+        Instead of caching the block selection gaps’ bounds in the RenderView at setSelection()
+        time, cache them in each RenderLayer at paint time. This prevents the cache from getting
+        stale due to layout changes and overflow scrolling.
+
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::selectionGapRectsForRepaint): Account for overflow scroll.
+        (WebCore::RenderBlock::paintSelection): Update the enclosing layer’s selection gaps bounds.
+        * rendering/RenderLayer.cpp:
+        (WebCore::RenderLayer::addBlockSelectionGapsBounds): Added. Updates the selection gaps
+        bounds to include the given rect.
+        (WebCore::RenderLayer::clearBlockSelectionGapsBounds): Added. Recursively clears the cached
+        selection gaps bounds.
+        (WebCore::RenderLayer::repaintBlockSelectionGaps): Added. Recursively invalidates the
+        selection gaps bounds.
+        * rendering/RenderLayer.h:
+        * rendering/RenderView.cpp:
+        (WebCore::RenderView::setSelection): Clear the layer-level selection gaps bounds instead
+        of the view-level cache.
+        (WebCore::RenderView::clearSelection): Changed to call repaintBlockSelectionGaps().
+        * rendering/RenderView.h:
+
+2009-12-07  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Gustavo Noronha.
+
+        Fixed whitelist comment and removed useless (tags, sdp) mimetypes
+        from it. Also, GStreamer doesn't handle directly SMIL.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::mimeTypeCache):
+
+2009-12-07  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Xan Lopez.
+
+        https://bugs.webkit.org/show_bug.cgi?id=25415
+        [GTK][ATK] Please implement support for get_text_at_offset
+
+        Eliminate the segfaults which occur when accessing the text interface now
+        implemented by text controls.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (getPangoLayoutForAtk):
+
+2009-12-07  Gustavo Noronha Silva  <gns@gnome.org>
+
+        Reviewed by Xan Lopez.
+
+        Turn the MediaPlayer supported types blacklist into a whitelist
+
+        [GTK] REGRESSION: webkit thinks it can render PDFs
+        https://bugs.webkit.org/show_bug.cgi?id=32183
+
+        Covered by API test.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::mimeTypeCache):
+
+2009-12-07  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Xan Lopez.
+
+        https://bugs.webkit.org/show_bug.cgi?id=25524
+        [Gtk] Expose the title attribute to assistive technologies
+
+        Expose 'alt' attribute from images as accessible name.
+        Expose the 'title' core HTML attribute as accessible description.
+        This is a modified version of the original fix submitted by Mario Sanchez Prada,
+        adjusted so that it doesn't impact other platforms.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (webkit_accessible_get_name):
+        (webkit_accessible_get_description):
+
+2009-12-07  Tor Arne Vestbø  <tor.arne.vestbo@nokia.com>
+
+        Reviewed by Simon Hausmann.
+
+        [Qt] Fix support for generic font families
+
+        By not propagating the resolved font family in FontCacheQt and
+        only concidering the font description we ended up passing the
+        generic font families to Qt directly. Since most systems don't
+        have a mapping for these font families we ended up using the
+        default font in most cases.
+
+        * platform/graphics/qt/FontCacheQt.cpp:
+        * platform/graphics/qt/FontPlatformData.h:
+        * platform/graphics/qt/FontPlatformDataQt.cpp:
+
+2009-12-06  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Maciej Stachowiak.
+
+        Object.getOwnPropertyDescriptor() allows cross-frame access
+        https://bugs.webkit.org/show_bug.cgi?id=32119
+
+        Make all implementations of getOwnPropertyDescriptor that have
+        cross domain restrictions simply fail immediately on cross domain
+        access, rather than trying to mimic the behaviour of normal
+        property access.
+
+        Test: http/tests/security/cross-frame-access-getOwnPropertyDescriptor.html
+
+        * bindings/js/JSDOMWindowCustom.cpp:
+        (WebCore::JSDOMWindow::getOwnPropertyDescriptor):
+        * bindings/js/JSHistoryCustom.cpp:
+        (WebCore::JSHistory::getOwnPropertyDescriptorDelegate):
+        * bindings/js/JSLocationCustom.cpp:
+        (WebCore::JSLocation::getOwnPropertyDescriptorDelegate):
+        * bindings/scripts/CodeGeneratorJS.pm:
+
+2009-12-07  Steve Block  <steveblock@google.com>
+
+        Reviewed by Adam Barth.
+
+        Moves JSC-specific functions from jni_utility and moves them to new jsc/jni_utility_private files.
+        https://bugs.webkit.org/show_bug.cgi?id=32157
+
+        Build fix only, no new tests.
+
+        * WebCore.xcodeproj/project.pbxproj: Modified. Add jni_utility_private.[cpp|h].
+        * bridge/jni/jni_instance.cpp: Modified. Include jni_utility_private.h for JSC.
+        * bridge/jni/jni_jsobject.mm: Modified. Include jni_utility_private.h for JSC.
+        * bridge/jni/jni_objc.mm: Modified. Include jni_utility_private.h for JSC.
+        * bridge/jni/jni_runtime.cpp: Modified. Include jni_utility_private.h for JSC.
+        * bridge/jni/jni_utility.cpp: Modified. Removed convertValueToJValue and convertArrayInstanceToJavaArray.
+        * bridge/jni/jni_utility.h: Modified. Removed convertValueToJValue and dispatchJNICall.
+        * bridge/jni/jsc: Added.
+        * bridge/jni/jsc/jni_utility_private.cpp: Added.
+        (JSC::Bindings::convertArrayInstanceToJavaArray):
+        (JSC::Bindings::convertValueToJValue):
+        * bridge/jni/jsc/jni_utility_private.h: Added. Header for convertValueToJValue and dispatchJNICall.
+        * platform/android/TemporaryLinkStubs.cpp: Modified. Include jni_utility_private.h for JSC.
+
+2009-12-06  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Maciej Stachowiak.
+
+        texImage2D pixel junk for transparency
+        https://bugs.webkit.org/show_bug.cgi?id=32188
+
+        Use kCGBlendModeCopy when drawing an image to the intermediate context
+        used to create a GL texture.
+
+        No test as we don't currently have any mechanism to retrieve pixel data
+        from the webgl context.
+
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::imageToTexture):
+
+2009-12-03  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Gustavo Noronha.
+
+        Advertize audio/ogg correctly and refactored mime-type cache
+        building.
+
+        [GTK] Recognize oga as audio/ogg
+        https://bugs.webkit.org/show_bug.cgi?id=31990
+
+        Test: media/media-can-play-ogg.html
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::mimeTypeCache):
+
+2009-12-05  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Eric Seidel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32175
+        REGRESSION: websocket/tests/url-parsing.html is crashing on Leopard Bot
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::readStreamCallback): Call platformClose() to unschedule both
+        streams, guaranteeing that there will be no callbacks after SocketStreamHandle is destroyed.
+        (WebCore::SocketStreamHandle::writeStreamCallback): Edited a comment a bit.
+
+2009-12-05  Adam Langley  <agl@google.com>
+
+        Reviewed by Adam Barth.
+
+        Check that a CSS format() argument is of a valid type.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31815
+        http://code.google.com/p/chromium/issues/detail?id=28582
+
+        Test: fast/css/url-format-non-string.html
+
+        * css/CSSParser.cpp:
+        (WebCore::CSSParser::parseFontFaceSrc):
+
+2009-12-04  Adam Langley  <agl@google.com>
+
+        Reviewed by Eric Seidel.
+
+        Chromium: make rounded borders heavier.
+
+        Skia draws its rounded corners differently from the other ports.
+        Whereas they have anti-aliased clipping regions, Skia only has 1-bit
+        regions. (Which is technically more correct, but somewhat unhelpful
+        for us.) Instead, with Skia we use a layer and collect all the
+        clipping paths in effect. When the state is popped, we paint
+        transparency outside the clipping paths and merge the layer down.
+
+        This appears to cause rounded borders to look a little thin, which is
+        addressed in this patch.
+
+        This is well covered by existing tests but will require new baselines
+        in the Chromium tree.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31778
+
+        * platform/graphics/skia/GraphicsContextSkia.cpp:
+        (WebCore::GraphicsContext::addInnerRoundedRectClip):
+
+2009-12-04  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        <rdar://problem/7441571> Hardware-backed layers are skipped when printing
+        
+        When printing, set the PaintBehaviorFlattenCompositingLayers flag so that compositing layers
+        paint. This also causes 3D transforms to be flattened to 2D.
+
+        Test: printing/compositing-layer-printing.html
+
+        * page/FrameView.cpp:
+        (WebCore::FrameView::paintContents):
+
+2009-12-04  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Beth Dakin.
+
+        Fix up some issues in my SVGListTraits change from yesterday.
+
+        * svg/SVGListTraits.h:
+        (WebCore::):
+
+2009-12-04  Albert J. Wong  <ajwong@chromium.org>
+
+        Not reviewed: chromium build fix.
+
+        Fix Chromium build break caused by moving of isDefaultPortForProtocol() and
+        portAllowed() into KURL.h/KURL.cpp.  Cloning code.
+
+        * platform/KURLGoogle.cpp:
+        (WebCore::isDefaultPortForProtocol):
+        (WebCore::portAllowed):
+
+2009-12-04  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Remove suppress highlight when restoring selected node.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32152
+
+        * inspector/front-end/ElementsPanel.js:
+        (WebInspector.ElementsPanel.prototype.setDocument.selectNode):
+        (WebInspector.ElementsPanel.prototype.setDocument.selectLastSelectedNode):
+        (WebInspector.ElementsPanel.prototype.setDocument):
+
+2009-12-04  Dirk Schulze  <krit@webkit.org>
+
+        Reviewed by Nikolas Zimmermann.
+
+        Gradient SVG animation demonstrates tearing at animation extremes
+        https://bugs.webkit.org/show_bug.cgi?id=11929
+
+        The focalPoint of a radial gradient is temporarly substracted by
+        the centralPoint, if the focalPoint is not in the radius of the
+        gradient. This is needed to calculate a new postion of the focalPoint
+        according to the specification. But the new focalPoint needs to be
+        moved by the centralPoint after this calculation, which is not the case
+        at the moment. This patch fixes this issue. It was also introduced a
+        deviation of maximal 0.2% for Cairo to get around the fixed point numbers
+        in Cairo.
+
+        W3C-SVG-1.1/pservers-grad-13-b needed an update. The missing adjustment
+        of the new focalPoint caused wrong results for the last three tests.
+
+        Test: svg/custom/radial-gradient-with-outstanding-focalPoint.svg
+
+        * svg/SVGRadialGradientElement.cpp:
+        (WebCore::SVGRadialGradientElement::buildGradient):
+
+2009-12-04  Anton Muhin  <antonm@chromium.org>
+
+        Reviewed by Dmitry Titov.
+
+        Do not use WebCore::String::String(const UChar*, int length) to convert
+        short v8 strings.
+
+        Plus added string traits.
+        https://bugs.webkit.org/show_bug.cgi?id=31415
+
+        * bindings/v8/V8Binding.cpp:
+        (WebCore::):
+        (WebCore::v8StringToWebCoreString):
+
+2009-12-04  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Darin Adler.
+
+        REGRESSION: AX: buttons now extremely repetitive
+        https://bugs.webkit.org/show_bug.cgi?id=32164
+
+        Test: platform/mac/accessibility/button-shouldnot-have-axvalue.html
+
+        * accessibility/AccessibilityObject.h:
+        (WebCore::AccessibilityObject::isButton):
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+        (-[AccessibilityObjectWrapper accessibilityAttributeNames]):
+
+2009-12-04  Zoltan Herczeg  <zherczeg@inf.u-szeged.hu>
+
+        Reviewed by Darin Adler.
+
+        Check whether the right side of a string append is non-empty
+        https://bugs.webkit.org/show_bug.cgi?id=32151
+
+        Especially beneficial for CachedScript::script() method
+        which usually appends an empty string returned by flush()
+        to its m_script member. m_script is often hundreds of kbytes
+        which is duplated without reason.
+
+        * platform/text/String.cpp:
+        (WebCore::String::append):
+
+2009-12-04  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by John Sullivan.
+
+        Mail.app crashes when indenting table pasted from Numbers.app.
+        <rdar://problem/7209507>
+        https://bugs.webkit.org/show_bug.cgi?id=32166
+
+        Test: LayoutTests/editing/execCommand/indent-partial-table.html
+        
+        * editing/IndentOutdentCommand.cpp:
+        (WebCore::IndentOutdentCommand::indentRegion): Added test to verify that the end of the paragraph
+        after the selection has not been moved.
+
+2009-12-04  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32085
+        WebSocket should block the same ports that are blocked for resource loading
+
+        Test: websocket/tests/url-parsing.html
+
+        * page/SecurityOrigin.cpp:
+        (WebCore::SecurityOrigin::SecurityOrigin):
+        (WebCore::SecurityOrigin::localURLSchemes):
+        * page/SecurityOrigin.h:
+        Move isDefaultPortForProtocol() to KURL, because that's a better place for it (SecurityOrigin
+        is not even in WebCore/platform directory).
+
+        * html/HTMLAnchorElement.cpp:
+        (WebCore::HTMLAnchorElement::host):
+        (WebCore::HTMLAnchorElement::setHost):
+        (WebCore::HTMLAnchorElement::setPort):
+        Updated for the new location of isDefaultPortForProtocol().
+
+        * platform/KURL.cpp:
+        (WebCore::KURL::protocolIs): In an assertion, compare to "javascript" case-insensitively,
+        since the function doesn't require lower case input.
+        (WebCore::isDefaultPortForProtocol): Moved from SecurityOrigin.
+        (WebCore::portAllowed): Moved from ResourceHandle.
+        * platform/KURL.h:
+
+        * platform/network/ResourceHandle.cpp: (WebCore::ResourceHandle::create): Updated for the
+        new location of portAllowed().
+
+        * websockets/WebSocket.cpp: (WebCore::WebSocket::connect): Per the spec, raise a SECURITY_ERR
+        if trying to connect to a blocked port.
+
+2009-12-04  Benjamin Poulain  <benjamin.poulain@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] WebKit crashes when loading certain SVG images
+        https://bugs.webkit.org/show_bug.cgi?id=29443
+
+        Remove FontFallbackListQt and rely on the common FontFallbackList
+        to handle the fonts. FontCache and FontPlatformData have been
+        updated to work with the common FontFallbackList.
+
+        In the previous implementation, FontPlatformDataCacheKey
+        was a clone of FontPlatformData with the hashing
+        capabilities added in order to use it as a key in the cache's
+        hashmap. FontPlatformData has been modified to handle the hashing
+        function directly so the data are not copied twice in memory.
+
+        FontFallbackList::fontDataAt() from FontFallbackListQt was a copy of
+        code from FontCache::getFontData() and FontFallbackList::fontDataAt().
+        The behavior is similar except currFamily->family().length() was
+        not tested and the fallback fonts selector were not used.
+
+        Existing tests cover the change.
+
+        * WebCore.pro:
+        * platform/graphics/qt/FontCacheQt.cpp:
+        (WebCore::FontCache::platformInit):
+        (WebCore::FontCache::getFontDataForCharacters):
+        (WebCore::FontCache::getSimilarFontPlatformData):
+        (WebCore::FontCache::getLastResortFallbackFont):
+        (WebCore::FontCache::getTraitsInFamily):
+        (WebCore::FontCache::createFontPlatformData):
+        * platform/graphics/qt/FontCustomPlatformData.cpp:
+        (WebCore::FontCustomPlatformData::fontPlatformData):
+        * platform/graphics/qt/FontFallbackListQt.cpp:
+        Removed. We now use the implementation from FontFallbackList.cpp
+        * platform/graphics/qt/FontPlatformData.h:
+        Add hashing capabilities to be able to use the data with the FontCache.
+        This was previously done in FontCacheQt.cpp
+        (WebCore::FontPlatformDataPrivate::FontPlatformDataPrivate):
+        (WebCore::FontPlatformData::FontPlatformData):
+        (WebCore::FontPlatformData::isHashTableDeletedValue):
+        (WebCore::FontPlatformData::font):
+        (WebCore::FontPlatformData::size):
+        (WebCore::FontPlatformData::family):
+        (WebCore::FontPlatformData::bold):
+        (WebCore::FontPlatformData::italic):
+        (WebCore::FontPlatformData::smallCaps):
+        (WebCore::FontPlatformData::pixelSize):
+        * platform/graphics/qt/FontPlatformDataQt.cpp:
+        (WebCore::FontPlatformData::FontPlatformData):
+        (WebCore::FontPlatformData::~FontPlatformData):
+        (WebCore::FontPlatformData::operator=):
+        (WebCore::FontPlatformData::operator==):
+        (WebCore::FontPlatformData::hash):
+
+2009-12-04  Adam Treat  <atreat@rim.com>
+
+        Reviewed by Dan Bernstein.
+
+        Fix wrong assert that was only working through sheer luck.
+        https://bugs.webkit.org/show_bug.cgi?id=32162
+
+        * platform/text/BidiContext.cpp:
+        (WebCore::BidiContext::create):
+
+2009-12-04  Tor Arne Vestbø  <tor.arne.vestbo@nokia.com>
+
+        Reviewed by Simon Hausmann.
+
+        [Qt] Allow removing 'qrc' as a local security origin scheme
+
+        * page/SecurityOrigin.cpp:
+
+2009-12-04  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        Allow custom memory allocation control for WebCore's CollectionCache
+        https://bugs.webkit.org/show_bug.cgi?id=32109
+
+        Inherits the following class from FastAllocBase because it is
+        instantiated by 'new':
+
+        struct name            - instantiated at: WebCore/'location'
+
+        struct CollectionCache - dom/Document.cpp:4029
+
+        * html/CollectionCache.h:
+
+2009-12-04  Steve Block  <steveblock@google.com>
+
+        Reviewed by Darin Adler.
+
+        Fixes a crashing bug in Geolocation when a watch is cleared from some callbacks. 
+        https://bugs.webkit.org/show_bug.cgi?id=32111
+
+        In Geolocation::GeoNotifier::timerFired, a JS callback may be invoked if a
+        fatal error was registered on this GeoNotifier or if this request has timed
+        out. If the request is a watch, and is cleared by a call to clearWatch in the
+        callback, the GeoNotifier object will be destroyed. We must therefore cache the
+        m_geolocation member to allow us to call Geolocation::fatalErrorOccurred or
+        Geolocation::requestTimedOut.
+
+        Tests: fast/dom/Geolocation/permission-denied-already-clear-watch.html
+               fast/dom/Geolocation/timeout-clear-watch.html
+
+        * page/Geolocation.cpp: Modified.
+        (WebCore::Geolocation::GeoNotifier::timerFired): Modified. Cache the m_geolocation member before invoking the JS callback.
+
+2009-12-04  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        Allow custom memory allocation control for 2 classes of the platform directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=
+
+        Inherits the following class from Noncopyable because it is instantiated
+        by 'new' and no need to be copyable:
+
+        class/struct name         - instantiated at: WebCore/'location'
+
+        class SharedTimer         - (its child class) workers/WorkerRunLoop.cpp:91
+
+        Inherits the following class from FastAllocBase because it is
+        instantiated by 'new':
+
+        class TransformOperations - rendering/style/RenderStyle.h:1175
+
+        Noncopyable.h's include added to SharedTimer.h.
+
+        * platform/SharedTimer.h:
+        * platform/graphics/transforms/TransformOperations.h:
+
+2009-12-04  Xan Lopez  <xlopez@igalia.com>
+
+        Reviewed by Gustavo Noronha.
+
+        [GTK]Enable DNS prefetching
+        https://bugs.webkit.org/show_bug.cgi?id=23846
+
+        Enable DNS prefetching.
+
+        Based on a patch by José Millán.
+
+        * platform/network/soup/DNSSoup.cpp:
+        (WebCore::prefetchDNS):
+
+2009-12-04  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        Allow custom memory allocation control for the svg directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=
+
+        Inherits the following classes from Noncopyable because these are instantiated
+        by 'new' and no need to be copyable:
+
+        class/struct name           - instantiated at: WebCore/'location'
+
+        struct ResourceSet          - svg/graphics/SVGResource.cpp:148
+        class SVGFontData           - css/CSSFontFaceSource.cpp:156
+        class SVGDocumentExtensions - dom/Document.cpp:3962
+        class SVGViewSpec           - svg/SVGSVGElement.cpp:191
+
+        * svg/SVGDocumentExtensions.h:
+        * svg/SVGFontData.h:
+        * svg/SVGViewSpec.h:
+        * svg/graphics/SVGResource.cpp:
+
+2009-12-03  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Beth Dakin.
+
+        WAI-ARIA: aria-activedescendant doesn't work as intended
+        https://bugs.webkit.org/show_bug.cgi?id=32100
+
+        Fixes a number of issues regarding the "tree" role and aria-activedescendant.
+        1. The indexes were being reported incorrectly by treeitems.
+        2. aria-activedescendant changes were not being sent to the containing item.
+        3. The tree's selected rows need to consult aria-activedescendant.
+        4. Since a tree changes what it returns as its children (it returns its rows)
+           the mac-specific array indexing methods need to correctly handle the tree case.
+
+        Tests: platform/mac/accessibility/aria-tree-activedescendant.html
+               platform/mac/accessibility/aria-tree-index-of-items.html
+
+        * accessibility/AXObjectCache.h:
+        (WebCore::AXObjectCache::):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::shouldFocusActiveDescendant):
+        (WebCore::AccessibilityRenderObject::activeDescendant):
+        (WebCore::AccessibilityRenderObject::handleActiveDescendantChanged):
+        (WebCore::AccessibilityRenderObject::ariaTreeSelectedRows):
+        * accessibility/mac/AXObjectCacheMac.mm:
+        (WebCore::AXObjectCache::postPlatformNotification):
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+        (-[AccessibilityObjectWrapper accessibilityAttributeValue:]):
+        (-[AccessibilityObjectWrapper accessibilityIndexOfChild:]):
+        (-[AccessibilityObjectWrapper accessibilityArrayAttributeValues:index:maxCount:]):
+        * accessibility/win/AXObjectCacheWin.cpp:
+        (WebCore::AXObjectCache::postPlatformNotification):
+
+2009-12-03  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        Allow custom memory allocation control for the xml directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=
+
+        Inherits the following class from Noncopyable because it is instantiated 
+        by 'new' and no need to be copyable:
+
+        class/struct name               - instantiated at: WebCore/'location'
+
+        struct XMLHttpRequestStaticData - xml/XMLHttpRequest.cpp:134
+
+        Inherits the following classes from FastAllocBase because these are instantiated by 'new':
+
+        class NodeTest                  - xml/XPathGrammar.y:258
+        class NodeSet                   - xml/XPathValue.cpp:52
+        struct EvaluationContext        - xml/XPathExpressionNode.cpp:40
+
+        * xml/XMLHttpRequest.cpp:
+        * xml/XPathExpressionNode.h:
+        * xml/XPathNodeSet.h:
+        * xml/XPathStep.h:
+
+2009-12-03  Drew Wilson  <atwilson@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        New History changes do not compile for Chromium/V8
+        https://bugs.webkit.org/show_bug.cgi?id=32148
+
+        Existing tests suffice (just trying to get code to compile).
+
+        * WebCore.gypi:
+        Added V8HistoryCustom.cpp and other missing files.
+        * bindings/v8/custom/V8CustomBinding.h:
+        Added custom handlers for History.pushState()/replaceState().
+        * bindings/v8/custom/V8HistoryCustom.cpp: Added.
+        Added custom handlers for History.pushState()/replaceState().
+        * history/BackForwardListChromium.cpp:
+        (WebCore::BackForwardList::pushStateItem):
+        Stubbed out this routine for now - will implement in the future.
+
+2009-12-03  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        OwnPtr<XBLBindingManager> Document::m_bindingManager;
+        https://bugs.webkit.org/show_bug.cgi?id=32147
+
+        The document actually owns the bindingManager.  That's what the code
+        should say.
+
+        * dom/Document.cpp:
+        (WebCore::Document::~Document):
+        * dom/Document.h:
+        (WebCore::Document::bindingManager):
+
+2009-12-03  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        OwnPtr<Tokenizer> Document::m_tokenizer;
+        https://bugs.webkit.org/show_bug.cgi?id=32145
+
+        The document actually owns the tokenizer.  That's what the code should say.
+
+        * dom/Document.cpp:
+        (WebCore::Document::removedLastRef):
+        (WebCore::Document::~Document):
+        (WebCore::Document::cancelParsing):
+        (WebCore::Document::implicitOpen):
+        (WebCore::Document::implicitClose):
+        * dom/Document.h:
+        (WebCore::Document::tokenizer):
+
+2009-12-03  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        OwnPtr<RenderArena> Document::m_renderArena;
+        https://bugs.webkit.org/show_bug.cgi?id=32146
+
+        The document owns the renderArena.  That's what the code should say.
+
+        * dom/Document.cpp:
+        (WebCore::Document::Document): Also, removed a redundant initialization
+        of the tokenizer that I missed in my previous patch.
+        (WebCore::Document::~Document):
+        (WebCore::Document::attach):
+        (WebCore::Document::detach):
+        * dom/Document.h:
+        (WebCore::Document::renderArena):
+
+2009-12-03  Drew Wilson  <atwilson@chromium.org>
+
+        Rolling back r51633 because it causes a chromium perf regression.
+
+        * platform/graphics/SimpleFontData.h:
+        * platform/graphics/mac/ComplexTextControllerCoreText.cpp:
+
+2009-12-03  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        The code should say that Document owns DocLoader
+        https://bugs.webkit.org/show_bug.cgi?id=32143
+
+        It's the truth.
+
+        * dom/Document.cpp:
+        (WebCore::Document::~Document):
+        * dom/Document.h:
+        (WebCore::Document::docLoader):
+
+2009-12-03  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Eric Seidel.
+
+        AX: VO just says "term" on many web sites
+        https://bugs.webkit.org/show_bug.cgi?id=32139
+
+        Test: platform/mac/accessibility/definition-list-term.html
+
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::accessibilityDescription):
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+        (-[AccessibilityObjectWrapper subrole]):
+        (-[AccessibilityObjectWrapper roleDescription]):
+
+2009-12-03  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Beth Dakin.
+
+        Implement WAI-ARIA scrollbar role and related property aria-orientation
+        https://bugs.webkit.org/show_bug.cgi?id=32126
+
+        Test: accessibility/aria-scrollbar-role.html
+
+        * accessibility/AccessibilityObject.cpp:
+        (WebCore::createARIARoleMap):
+        * accessibility/AccessibilityObject.h:
+        (WebCore::AccessibilityObject::isScrollbar):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::valueForRange):
+        (WebCore::AccessibilityRenderObject::orientation):
+        (WebCore::AccessibilityRenderObject::canHaveChildren):
+        * accessibility/AccessibilityRenderObject.h:
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+        (-[AccessibilityObjectWrapper additionalAccessibilityAttributeNames]):
+        (-[AccessibilityObjectWrapper accessibilityAttributeValue:]):
+        * html/HTMLAttributeNames.in:
+
+2009-12-03  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Fixed <rdar://problem/7401617> Selection painting issue in hardware-
+        accelerated layers
+        which is another part of https://bugs.webkit.org/show_bug.cgi?id=23628
+        Fix selection painting to do container-relative repaints
+
+        Test: fast/repaint/block-selection-gap-in-composited-layer.html
+
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::selectionGapRectsForRepaint): Compute and paint
+        gap rects in the coordinate space of the repaint container.
+        * rendering/RenderLayerCompositor.cpp:
+        (WebCore::RenderLayerCompositor::recursiveRepaintLayerRect): Added a
+        FIXME.
+        * rendering/RenderView.cpp:
+        (WebCore::RenderView::setSelection): Map block selection gap rects from
+        the repaint container’s coordinate space to the view’s coordinate space
+        before adding them to the cached selection bounds.
+        (WebCore::RenderView::clearSelection): Changed to use
+        repaintRectangleInViewAndCompositedLayers() so that the selection rect
+        is invalidated in composited layers as well.
+
+2009-12-03  Jonathan Dixon  <joth@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Bug 32066 - Add enable geolocation flag to WebCore::Settings for Chromium
+        https://bugs.webkit.org/show_bug.cgi?id=32066
+
+        Adds geolocationEnabled in Settings for runtime control of geolocaiton features. This defaults to ON
+        as it is intended as a development and testing aid, not a user control. To completely remove geolocation
+        from a given port, the compile time ENABLE_GEOLOCATION should still be used.
+        Adding placeholder GeolocationServiceChromium implementation, as this is required to allows
+        ENABLE_GEOLOCATION to be defined (in turn required for testing), even though this patch does not
+        make that the default just yet.
+
+        * WebCore.gypi:
+        * page/Settings.cpp:
+        (WebCore::Settings::Settings): Add new m_geolocationEnabled flag default value
+        (WebCore::Settings::setGeolocationEnabled): Setter for  m_geolocationEnabled flag
+        * page/Settings.h:
+        (WebCore::Settings::geolocationEnabled):  Add m_geolocationEnabled flag
+        * platform/chromium/GeolocationServiceChromium.cpp: Added.
+        (WebCore::GeolocationServiceChromium::GeolocationServiceChromium): Place holder GeolocationServiceChromium)
+        (WebCore::createGeolocationService): factory function, only required when ENABLED(GEOLOCATION) is true
+
+2009-12-03  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by John Sullivan.
+
+        SpinTracer: 349 spins in Mail at WebCore::Editor::advanceToNextMisspelling(bool)
+        <rdar://problem/7198592>
+        https://bugs.webkit.org/show_bug.cgi?id=32129
+
+        Fixed the way the next paragraph is calculated.
+        I've added a repro case in Safari and attached it to the Bugzilla bug.
+
+        * editing/Editor.cpp:
+        (WebCore::findFirstMisspellingOrBadGrammarInRange): Changed the way we move to the
+        next paragraph in the loop.
+
+2009-12-03  Oliver Hunt  <oliver@apple.com>
+
+        Build fix
+
+        * svg/SVGListTraits.h:
+        (WebCore::):
+
+2009-12-03  Oliver Hunt  <oliver@apple.com>
+
+        Build fix
+
+        * svg/SVGListTraits.h:
+        (WebCore::):
+
+2009-12-03  Brady Eidson  <beidson@apple.com>
+
+        No wonder editing WebCore.exp repeatedly while I worked on this patch never seemed to stick.
+
+        Long live our auto-generated overlords that I didn't know about...  
+
+        * WebCore.base.exp:
+
+2009-12-03  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        REGRESSION (r51627): 3 SVG tests are failing
+        https://bugs.webkit.org/show_bug.cgi?id=32117
+
+        Null checking Items in the SVGList is insufficient as items may
+        be floats, etc so add SVGListTraits::isNull and add appropriate
+        specializations.
+
+        Test: svg/dom/svglist-exception-on-out-bounds-error.html
+
+        * svg/SVGList.h:
+        (WebCore::SVGListTypeOperations::isNull):
+        (WebCore::SVGList::initialize):
+        (WebCore::SVGList::insertItemBefore):
+        (WebCore::SVGList::replaceItem):
+        (WebCore::SVGList::appendItem):
+        * svg/SVGListTraits.h:
+        (WebCore::):
+
+2009-12-03  Brady Eidson  <beidson@apple.com>
+
+        No review - release build fix.
+
+        * history/HistoryItem.cpp:
+        (WebCore::HistoryItem::documentDetached):
+
+2009-12-03  Brady Eidson  <beidson@apple.com>
+
+        No review - release build fix.
+
+        * loader/HistoryController.cpp:
+        (WebCore::HistoryController::pushState):
+
+2009-12-03  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by Adele Peterson.
+
+        Multiple Undos removes the last posted comment and/or the ones before it.
+        <rdar://problem/6557066>
+        https://bugs.webkit.org/show_bug.cgi?id=32079
+        
+        The fix consists in preventing Undos and Redos to be applied to elements that
+        are no longer editable. We do not attempt to remove the commands from the queue.
+        It is a relatively simple fix that comes with a little extra overhead for the apply
+        and unapply methods where we are now performing the editability check.
+
+        Test: editing/undo/undo-indent-noneditable.html
+
+        * editing/AppendNodeCommand.cpp:
+        (WebCore::AppendNodeCommand::doApply):
+        (WebCore::AppendNodeCommand::doUnapply):
+        * editing/DeleteFromTextNodeCommand.cpp:
+        (WebCore::DeleteFromTextNodeCommand::doApply):
+        (WebCore::DeleteFromTextNodeCommand::doUnapply):
+        * editing/InsertIntoTextNodeCommand.cpp:
+        (WebCore::InsertIntoTextNodeCommand::doApply):
+        (WebCore::InsertIntoTextNodeCommand::doUnapply):
+        * editing/InsertNodeBeforeCommand.cpp:
+        (WebCore::InsertNodeBeforeCommand::doApply):
+        (WebCore::InsertNodeBeforeCommand::doUnapply):
+        * editing/JoinTextNodesCommand.cpp:
+        (WebCore::JoinTextNodesCommand::doApply):
+        (WebCore::JoinTextNodesCommand::doUnapply):
+        * editing/MergeIdenticalElementsCommand.cpp:
+        (WebCore::MergeIdenticalElementsCommand::doApply):
+        (WebCore::MergeIdenticalElementsCommand::doUnapply):
+        * editing/RemoveNodeCommand.cpp:
+        (WebCore::RemoveNodeCommand::doApply):
+        (WebCore::RemoveNodeCommand::doUnapply):
+        * editing/SplitElementCommand.cpp:
+        (WebCore::SplitElementCommand::executeApply):
+        (WebCore::SplitElementCommand::doUnapply):
+        * editing/SplitTextNodeCommand.cpp:
+        (WebCore::SplitTextNodeCommand::doApply):
+        (WebCore::SplitTextNodeCommand::doUnapply):
+        * editing/WrapContentsInDummySpanCommand.cpp:
+        (WebCore::WrapContentsInDummySpanCommand::doUnapply):
+        (WebCore::WrapContentsInDummySpanCommand::doReapply):
+
+2009-12-03  Brady Eidson  <beidson@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        <rdar://problem/7214236> and http://webkit.org/b/32052 - Implement HTML5 state object history API
+
+        Tests: fast/loader/stateobjects/document-destroyed-navigate-back.html
+               fast/loader/stateobjects/document-destroyed-navigate-back-with-fragment-scroll.html
+               fast/loader/stateobjects/popstate-after-load-complete-addeventlistener.html
+               fast/loader/stateobjects/popstate-after-load-complete-body-attribute.html
+               fast/loader/stateobjects/popstate-after-load-complete-window-attribute.html
+               fast/loader/stateobjects/pushstate-object-types.html
+               fast/loader/stateobjects/pushstate-then-replacestate.html
+               fast/loader/stateobjects/pushstate-with-fragment-urls-and-hashchange.html
+               fast/loader/stateobjects/replacestate-then-pushstate.html
+               http/tests/loading/state-object-security-exception.html
+
+        Derived sources and project file changes:
+        * DerivedSources.cpp:
+        * DerivedSources.make:
+        * GNUmakefile.am
+        * WebCore.pro
+        * WebCore.vcproj/WebCore.vcproj:
+        * WebCore.xcodeproj/project.pbxproj:
+
+        Add the new PopStateEvent:
+        * dom/PopStateEvent.cpp: Added.
+        (WebCore::PopStateEvent::PopStateEvent):
+        (WebCore::PopStateEvent::initPopStateEvent):
+        * dom/PopStateEvent.h: Added.
+        (WebCore::PopStateEvent::create):
+        (WebCore::PopStateEvent::isPopStateEvent):
+        (WebCore::PopStateEvent::state):
+        * dom/PopStateEvent.idl: Added.
+        * bindings/js/JSPopStateEventCustom.cpp: Added.
+        (WebCore::JSPopStateEvent::initPopStateEvent):
+        (WebCore::JSPopStateEvent::state):
+        * bindings/js/JSEventCustom.cpp:
+        (WebCore::toJS):
+        * dom/Event.cpp:
+        (WebCore::Event::isPopStateEvent):
+        * dom/Event.h:
+        * dom/EventNames.h:
+
+        Add the "onpopstate" attribute:
+        * html/HTMLAttributeNames.in:
+        * html/HTMLBodyElement.cpp:
+        (WebCore::HTMLBodyElement::parseMappedAttribute):
+        * html/HTMLBodyElement.idl:
+        * html/HTMLFrameSetElement.cpp:
+        (WebCore::HTMLFrameSetElement::parseMappedAttribute):
+        * html/HTMLFrameSetElement.h:
+        * html/HTMLFrameSetElement.idl:
+        * page/DOMWindow.h:
+        * page/DOMWindow.idl:
+
+        Add pushState and replaceState management to the loader and history machinery:
+        * bindings/js/JSHistoryCustom.cpp:
+        (WebCore::JSHistory::pushState):
+        (WebCore::JSHistory::replaceState):
+        * loader/HistoryController.cpp:
+        (WebCore::HistoryController::updateForSameDocumentNavigation): Augmented from "scrollToAnchor()", combining
+          both the same-document fragment scroll case with the new same-document state object activation case.
+        (WebCore::HistoryController::pushState):
+        (WebCore::HistoryController::replaceState):
+        * loader/HistoryController.h:
+        * history/BackForwardList.cpp:
+        (WebCore::BackForwardList::addItem): Use insertItemAfterCurrent.
+        (WebCore::BackForwardList::insertItemAfterCurrent): Optionally insert the item without clearing the forward
+          list, as pushStateItem might've selectively cleared only certain items, with the bulk of the forward list
+          meant to remain.
+        (WebCore::BackForwardList::pushStateItem): Clear the forward list *only* for the state item's document, then 
+          insert the new item.
+        (WebCore::BackForwardList::removeItem):
+        * history/BackForwardList.h:
+        * page/History.cpp:
+        (WebCore::History::urlForState):
+        (WebCore::History::stateObjectAdded):
+        * page/History.h:
+        * page/History.idl:
+
+        Let HistoryItems and Documents associate with each other, as well as letting HistoryItems contain state objects:
+        * history/HistoryItem.cpp:
+        (WebCore::HistoryItem::HistoryItem):
+        (WebCore::HistoryItem::~HistoryItem):
+        (WebCore::HistoryItem::setStateObject):
+        (WebCore::HistoryItem::setDocument):
+        (WebCore::HistoryItem::documentDetached):
+        * history/HistoryItem.h:
+        (WebCore::HistoryItem::stateObject):
+        (WebCore::HistoryItem::document):
+        * dom/Document.cpp:
+        (WebCore::Document::detach): Notify all back/forward history items owned by this Document that it
+          is going away.
+        (WebCore::Document::registerHistoryItem): Manage the list of back/forward history items this document owns.
+        (WebCore::Document::unregisterHistoryItem): Ditto.
+        * dom/Document.h:
+
+        Add the ability for Documents, DocumentLoaders, and FrameLoaderClients to be notified when a Documents
+        URL changes as the result of pushState(), replaceState(), or a popstate navigation:
+        * dom/Document.cpp:
+        (WebCore::Document::implicitClose): If there's a pending state object, dispatch the popstate event.
+        (WebCore::Document::updateURLForPushOrReplaceState):
+        (WebCore::Document::statePopped): If loading is complete, dispatch the popstate event. Otherwise, set 
+          the pending state object.
+        * loader/DocumentLoader.cpp:
+        (WebCore::DocumentLoader::replaceRequestURLForSameDocumentNavigation):
+        * loader/DocumentLoader.h:
+        * loader/FrameLoaderClient.h:
+        * loader/EmptyClients.h:
+        (WebCore::EmptyFrameLoaderClient::dispatchDidChangeStateObjectForPageForFrame):
+
+        Change handling of "loading a HistoryItem" to distinguish between new-Document navigations and same-Document
+        navigations, combining the old concept of anchor scrolls with the new concept of state object navigations:
+        * loader/FrameLoader.cpp:
+        (WebCore::FrameLoader::loadInSameDocument):
+        (WebCore::FrameLoader::continueFragmentScrollAfterNavigationPolicy):
+        (WebCore::FrameLoader::navigateWithinDocument):
+        (WebCore::FrameLoader::navigateToDifferentDocument):
+        (WebCore::FrameLoader::loadItem):
+        * loader/FrameLoader.h:
+        * page/Page.cpp:
+        (WebCore::Page::goToItem): Changed to allow state object activations to pass through without the load stopping.
+
+2009-12-03  Pavel Feldman  <pfeldman@chromium.org>
+
+        Not reviewed: chromium build fix.
+        r51621 changed JS bindings only, broke v8's.
+
+        * bindings/v8/ScriptFunctionCall.cpp:
+        (WebCore::ScriptFunctionCall::appendArgument):
+        * bindings/v8/ScriptFunctionCall.h:
+
+2009-12-03  Dimitri Glazkov  <dglazkov@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        [V8] Attributes and NamedNodeMaps aren't tracked correctly and may be prematurely garbage-collected.
+        https://bugs.webkit.org/show_bug.cgi?id=32094
+
+        Covered by existing test: LayoutTests/fast/dom/Attr/access-after-element-destruction.html
+
+        * bindings/v8/DOMObjectsInclude.h:
+        * bindings/v8/V8DOMWrapper.cpp:
+        (WebCore::V8DOMWrapper::getTemplate):
+        (WebCore::V8DOMWrapper::convertToV8Object):
+        (WebCore::V8DOMWrapper::convertNamedNodeMapToV8Object):
+        * bindings/v8/V8DOMWrapper.h:
+        * bindings/v8/V8GCController.cpp:
+        (WebCore::ObjectGrouperVisitor::visitDOMWrapper):
+        * bindings/v8/custom/V8CustomBinding.h:
+
+2009-12-03  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Chromium: Add support for settings containing ":"
+
+        https://bugs.webkit.org/show_bug.cgi?id=32118
+
+        * inspector/front-end/WatchExpressionsSidebarPane.js:
+        (WebInspector.WatchExpressionsSection):
+
+2009-12-03  Rafael Antognolli  <antognolli@profusion.mobi>, Kenneth Christiansen <kenneth@webkit.org>
+
+        Reviewed by Simon Fraser.
+
+        repaint events from outside the viewport aren't received
+        https://bugs.webkit.org/show_bug.cgi?id=32081
+
+        When using a tiled backing store for painting, you need to receive
+        event from outside the viewport. Setting the viewport to the size
+        of the contents is not an option if you want to make use of WebCore's
+        infrastructure for drawing scrollbars etc.
+
+        A new property, paintsEntireContents, has been introduced for the
+        above use-case. It is settable, as tiling will be optional for Qt,
+        and for the not yet upstreamed EFL port, there will be two different
+        views, where only one of them are tiled.
+
+        No change in behavior, so no new tests added.
+
+        * page/FrameView.cpp:
+        (WebCore::FrameView::repaintContentRectangle):
+        * platform/ScrollView.cpp:
+        (WebCore::ScrollView::ScrollView):
+        (WebCore::ScrollView::setPaintsEntireContents):
+        (WebCore::ScrollView::wheelEvent):
+        * platform/ScrollView.h:
+        (WebCore::ScrollView::paintsEntireContents):
+
+2009-11-23  Jeremy Moskovich  <jeremy@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Switch Chrome/Mac to use Core Text APIs rather than ATSUI APIs.
+        https://bugs.webkit.org/show_bug.cgi?id=31802
+
+        No test since this is already covered by existing pixel tests.
+
+        * platform/graphics/SimpleFontData.h: Change #ifdef to define getNSFont() on Chrome/Mac .
+        * platform/graphics/mac/ComplexTextControllerCoreText.cpp: Provide forward declarations
+        of Core Text functions that are public on 10.6 but SPI on 10.5.
+
+2009-12-03  Pavel Feldman  <pfeldman@dhcp-172-28-174-220.spb.corp.google.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Simplify the settings support in inspector controller.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32076
+
+        Test: inspector/settings-set-get.html
+
+        * WebCore.Inspector.exp:
+        * bindings/js/JSInspectorFrontendHostCustom.cpp:
+        * bindings/v8/custom/V8InspectorFrontendHostCustom.cpp:
+        * inspector/InspectorClient.h:
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::~InspectorController):
+        (WebCore::InspectorController::setting):
+        (WebCore::InspectorController::setSetting):
+        (WebCore::InspectorController::setWindowVisible):
+        (WebCore::InspectorController::attachWindow):
+        (WebCore::InspectorController::setAttachedWindowHeight):
+        (WebCore::InspectorController::storeLastActivePanel):
+        (WebCore::InspectorController::scriptObjectReady):
+        (WebCore::InspectorController::showWindow):
+        (WebCore::InspectorController::enableResourceTracking):
+        (WebCore::InspectorController::disableResourceTracking):
+        (WebCore::InspectorController::ensureResourceTrackingSettingsLoaded):
+        (WebCore::InspectorController::enableProfiler):
+        (WebCore::InspectorController::disableProfiler):
+        (WebCore::InspectorController::enableDebuggerFromFrontend):
+        (WebCore::InspectorController::disableDebugger):
+        * inspector/InspectorController.h:
+        * inspector/InspectorFrontendHost.cpp:
+        (WebCore::InspectorFrontendHost::setting):
+        (WebCore::InspectorFrontendHost::setSetting):
+        * inspector/InspectorFrontendHost.h:
+        * inspector/InspectorFrontendHost.idl:
+        * loader/EmptyClients.h:
+        (WebCore::EmptyInspectorClient::populateSetting):
+        (WebCore::EmptyInspectorClient::storeSetting):
+
+2009-12-03  Ben Murdoch  <benm@google.com>
+
+        Reviewed by Brady Eidson.
+
+        [Android] notifyHistoryItemChanged() should pass a pointer to the HistoryItem that changed.
+        https://bugs.webkit.org/show_bug.cgi?id=31915
+
+        No change in functionality so no new tests required.
+
+        * history/HistoryItem.cpp:
+        (WebCore::defaultNotifyHistoryItemChanged): Update this function to pass the HistoryItem that is being changed.
+        (WebCore::HistoryItem::setAlternateTitle): Update call to notifyHistoryItemChanged to include the new parameter.
+        (WebCore::HistoryItem::setURLString): ditto.
+        (WebCore::HistoryItem::setOriginalURLString): ditto.
+        (WebCore::HistoryItem::setReferrer): ditto.
+        (WebCore::HistoryItem::setTitle): ditto.
+        (WebCore::HistoryItem::setTarget): ditto.
+        (WebCore::HistoryItem::setDocumentState): On Android, add a call to notifyHistoryItemChanged. See bug for a discussion of why this is needed.
+        (WebCore::HistoryItem::clearDocumentState): ditto.
+        (WebCore::HistoryItem::setIsTargetItem): ditto.
+        (WebCore::HistoryItem::addChildItem): ditto.
+        (WebCore::HistoryItem::setFormInfoFromRequest): ditto.
+        * history/HistoryItem.h: Update signature of notifyHistoryItemChanged.
+
+2009-12-03  Ben Murdoch  <benm@google.com>
+
+        Reviewed by Brady Eidson.
+
+        [Android] The FrameLoaderClient is unaware of BackForwardList changes.
+        https://bugs.webkit.org/show_bug.cgi?id=31914
+
+        This change adds three new methods on the FrameLoaderClient interface to receive notifications when the BackForwardList changes.
+
+        No new tests required. Functionality on all platforms upstream remains the same. Android is the first platform to make use of these callbacks.
+
+        * history/BackForwardList.cpp:
+        (WebCore::BackForwardList::addItem): Execute the callback.
+        (WebCore::BackForwardList::goBack): ditto.
+        (WebCore::BackForwardList::goForward): ditto.
+        (WebCore::BackForwardList::goToItem): ditto.
+        (WebCore::BackForwardList::setCapacity): dito.
+        * loader/EmptyClients.h:
+        (WebCore::EmptyFrameLoaderClient::dispatchDidAddBackForwardItem): Add an empty implementation for the callback that does nothing.
+        (WebCore::EmptyFrameLoaderClient::dispatchDidRemoveBackForwardItem): ditto.
+        (WebCore::EmptyFrameLoaderClient::dispatchDidChangeBackForwardIndex): ditto.
+        * loader/FrameLoaderClient.h:
+
+2009-12-03  Ben Murdoch  <benm@google.com>
+
+        Reviewed by Brady Eidson.
+
+        [Android] Upstream WebCore/history/android: Require some platform specific state attached to HistoryItem.
+        https://bugs.webkit.org/show_bug.cgi?id=31913
+
+        Android stores information such as the zoom scale factor and bridge back to the Java counterpart with HistoryItem.
+
+        No new tests required as this is Android specific code.
+
+        * history/HistoryItem.h: Add Android specific member data to HistoryItem.
+        * history/android: Added.
+        * history/android/AndroidWebHistoryBridge.h: Added.
+        * history/android/HistoryItemAndroid.cpp: Added, provides implementation for Android specific member functions in HistoryItem.
+        (WebCore::HistoryItem::bridge): Added.
+        (WebCore::HistoryItem::setBridge): Added.
+
+2009-12-03  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Maciej Stachowiak.
+
+        NULL ptr in SVGPathSegList::getPathSegAtLength()
+        https://bugs.webkit.org/show_bug.cgi?id=30313
+
+        Add exception checks to SVGPathSegList's implementation to catch (and propagate) exceptions.
+        Add null checks to SVGList's content manipulation functions to prevent
+        null values from entering the list in the first place.
+
+        Test: svg/dom/svgpath-out-of-bounds-getPathSeg.html
+
+        * svg/SVGList.h:
+        (WebCore::SVGList::initialize):
+        (WebCore::SVGList::insertItemBefore):
+        (WebCore::SVGList::replaceItem):
+        (WebCore::SVGList::appendItem):
+        * svg/SVGPathElement.cpp:
+        (WebCore::SVGPathElement::getPathSegAtLength):
+        * svg/SVGPathElement.h:
+        * svg/SVGPathElement.idl:
+        * svg/SVGPathSegList.cpp:
+        (WebCore::SVGPathSegList::getPathSegAtLength):
+        (WebCore::SVGPathSegList::toPathData):
+        (WebCore::SVGPathSegList::createAnimated):
+        * svg/SVGPathSegList.h:
+
+2009-12-02  Yusuke Sato  <yusukes@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Sanitize web fonts using the OTS library 
+        https://bugs.webkit.org/show_bug.cgi?id=31106
+
+        Add support for OpenType sanitizer (OTS). It parses OpenType files (from @font-face)
+        and attempts to validate and sanitize them. We hope this reduces the attack surface
+        of the system font libraries.
+
+        * WebCore.gyp/WebCore.gyp: Added dependency to (chromium_src_dir)/third_party/ots/ library.
+        * WebCore.gypi: Added new files below.
+        * WebCore.xcodeproj/project.pbxproj: Ditto.
+        * platform/graphics/chromium/FontCustomPlatformData.cpp: Validate and transcode a web font.
+        (WebCore::createFontCustomPlatformData):
+        * platform/graphics/mac/FontCustomPlatformData.cpp: Ditto.
+        (WebCore::createFontCustomPlatformData):
+        * platform/graphics/opentype/OpenTypeSanitizer.cpp: Added.
+        (WebCore::OpenTypeSanitizer::sanitize):
+        * platform/graphics/opentype/OpenTypeSanitizer.h: Added.
+        (WebCore::OpenTypeSanitizer::OpenTypeSanitizer):
+
+2009-12-02  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        Web Inspector frontend heap allocates ScriptFunctionCall which is unsafe
+        https://bugs.webkit.org/show_bug.cgi?id=32098
+
+        Fix is simply to make the ScriptFunctionCall stack allocated as nature intended.
+        Doing this required adding an appendArgument(char*) to ScriptFunctionCall so
+        that an explicit String cast would not be necessary.
+
+        To prevent something like this happening again in future i've added private
+        operator new implementations to ScriptFunctionCall making this type of mistake
+        produce errors when compiling.
+
+        Test case: Inspector tests now pass with GC on every alloc enabled.
+
+        * bindings/js/ScriptFunctionCall.cpp:
+        (WebCore::ScriptFunctionCall::appendArgument):
+        * bindings/js/ScriptFunctionCall.h:
+        (WebCore::ScriptFunctionCall::operator new):
+        (WebCore::ScriptFunctionCall::operator new[]):
+        * inspector/InspectorFrontend.cpp:
+        (WebCore::InspectorFrontend::addConsoleMessage):
+        (WebCore::InspectorFrontend::updateConsoleMessageRepeatCount):
+        (WebCore::InspectorFrontend::addResource):
+        (WebCore::InspectorFrontend::updateResource):
+        (WebCore::InspectorFrontend::removeResource):
+        (WebCore::InspectorFrontend::updateFocusedNode):
+        (WebCore::InspectorFrontend::setAttachedWindow):
+        (WebCore::InspectorFrontend::addRecordToTimeline):
+        (WebCore::InspectorFrontend::parsedScriptSource):
+        (WebCore::InspectorFrontend::failedToParseScriptSource):
+        (WebCore::InspectorFrontend::addProfileHeader):
+        (WebCore::InspectorFrontend::setRecordingProfile):
+        (WebCore::InspectorFrontend::didGetProfileHeaders):
+        (WebCore::InspectorFrontend::didGetProfile):
+        (WebCore::InspectorFrontend::pausedScript):
+        (WebCore::InspectorFrontend::setDocument):
+        (WebCore::InspectorFrontend::setDetachedRoot):
+        (WebCore::InspectorFrontend::setChildNodes):
+        (WebCore::InspectorFrontend::childNodeCountUpdated):
+        (WebCore::InspectorFrontend::childNodeInserted):
+        (WebCore::InspectorFrontend::childNodeRemoved):
+        (WebCore::InspectorFrontend::attributesUpdated):
+        (WebCore::InspectorFrontend::didRemoveNode):
+        (WebCore::InspectorFrontend::didGetChildNodes):
+        (WebCore::InspectorFrontend::didApplyDomChange):
+        (WebCore::InspectorFrontend::didGetEventListenersForNode):
+        (WebCore::InspectorFrontend::didGetCookies):
+        (WebCore::InspectorFrontend::didDispatchOnInjectedScript):
+        (WebCore::InspectorFrontend::addDatabase):
+        (WebCore::InspectorFrontend::selectDatabase):
+        (WebCore::InspectorFrontend::didGetDatabaseTableNames):
+        (WebCore::InspectorFrontend::addDOMStorage):
+        (WebCore::InspectorFrontend::selectDOMStorage):
+        (WebCore::InspectorFrontend::didGetDOMStorageEntries):
+        (WebCore::InspectorFrontend::didSetDOMStorageItem):
+        (WebCore::InspectorFrontend::didRemoveDOMStorageItem):
+        (WebCore::InspectorFrontend::updateDOMStorage):
+        (WebCore::InspectorFrontend::addNodesToSearchResult):
+        (WebCore::InspectorFrontend::evaluateForTestInFrontend):
+        * inspector/InspectorFrontend.h:
+
+2009-12-02  Dave Hyatt  <hyatt@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32072, clean up invalid @-rule error handling so that we
+        pass more CSS test suite stuff.  Make the grammar stop enforcing the ordering of @namespace vs.
+        @variables vs. @import.  Just let the parser handle that instead.  This simplifies the grammar and
+        makes error handling deal with more cases correctly.
+
+        Added fast/css/namespaces/namespaces-invalid-at-rules.xml
+
+        * css/CSSGrammar.y:
+        * css/CSSParser.cpp:
+        (WebCore::CSSParser::CSSParser):
+        (WebCore::CSSParser::parseRule):
+        (WebCore::CSSParser::createCharsetRule):
+        (WebCore::CSSParser::createImportRule):
+        (WebCore::CSSParser::createMediaRule):
+        (WebCore::CSSParser::createKeyframesRule):
+        (WebCore::CSSParser::createStyleRule):
+        (WebCore::CSSParser::createFontFaceRule):
+        (WebCore::CSSParser::addNamespace):
+        (WebCore::CSSParser::createVariablesRule):
+        * css/CSSParser.h:
+
+2009-12-02  Yusuke Sato  <yusukes@chromium.org>
+
+        Reviewed by Dan Bernstein.
+
+        Safari/Chromium for Windows fails to load CJK WebFonts
+        https://bugs.webkit.org/show_bug.cgi?id=31804
+        
+        * platform/graphics/opentype/OpenTypeUtilities.cpp:
+        (WebCore::renameAndActivateFont): Load a remote font even if the font has 2 or more faces.
+
+2009-12-02  Avi Drissman  <avi@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Chromium: Need tickmarks in scrollbar
+        https://bugs.webkit.org/show_bug.cgi?id=32069
+
+        * WebCore.gyp/WebCore.gyp:
+        * WebCore.gypi:
+        * platform/chromium/ScrollbarThemeChromiumMac.h: Added.
+        * platform/chromium/ScrollbarThemeChromiumMac.mm: Added.
+
+2009-11-13  Timothy Hatcher  <timothy@apple.com>
+
+        Expose a function to set the value of an input element on behalf of the user.
+        This function will dispatch the change event so the page is notified when autofill
+        happens. Also dispatch a change event when a select element is changed by autofill.
+
+        <rdar://problem/6760590> Would like a way to detect a login form AutoFill from JavaScript
+
+        Reviewed by Darin Adler.
+
+        * WebCore.xcodeproj/project.pbxproj: Added the DOMHTMLInputElementPrivate.h header.
+        * bindings/objc/DOMHTML.mm:
+        (-[DOMHTMLSelectElement _activateItemAtIndex:]): Call setSelectedIndexByUser instead so
+        a change event is fired. This method is called by Safari autofill.
+        * dom/Document.cpp:
+        (WebCore::Document::setFocusedNode): Use dispatchFormControlChangeEvent instead
+        of dispatching the change event directly to be consistent.
+        * html/HTMLFormControlElement.cpp:
+        (WebCore::HTMLInputElement::setValueForUser): Added. Calls setValue with the sendChangeEvent
+        (WebCore::HTMLInputElement::setValue): Added the optional sendChangeEvent argument. Mimics setChecked.
+        * html/HTMLInputElement.h:
+        * html/HTMLInputElement.idl: Added setValueForUser for non-JS languages.
+        * html/InputElement.h: Added setValueForUser.
+
+2009-12-02  Pavel Feldman  <pfeldman@dhcp-172-28-174-220.spb.corp.google.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: DOM tree selection disappears upon page refresh.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31142
+
+        Test: inspector/elements-panel-selection-on-refresh.html
+
+        * inspector/InjectedScriptHost.cpp:
+        (WebCore::InjectedScriptHost::pushNodeByPathToFrontend):
+        * inspector/InjectedScriptHost.h:
+        * inspector/InjectedScriptHost.idl:
+        * inspector/InspectorBackend.h:
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::close):
+        (WebCore::InspectorController::releaseDOMAgent):
+        (WebCore::InspectorController::resetScriptObjects):
+        * inspector/InspectorDOMAgent.cpp:
+        (WebCore::InspectorDOMAgent::~InspectorDOMAgent):
+        (WebCore::InspectorDOMAgent::reset):
+        (WebCore::InspectorDOMAgent::setDocument):
+        (WebCore::InspectorDOMAgent::pushDocumentToFrontend):
+        (WebCore::InspectorDOMAgent::nodeForPath):
+        (WebCore::InspectorDOMAgent::pushNodePathToFrontend):
+        * inspector/InspectorDOMAgent.h:
+        * inspector/front-end/DOMAgent.js:
+        (WebInspector.DOMNode.prototype._renumber):
+        (WebInspector.DOMAgent.prototype._setDocument):
+        * inspector/front-end/ElementsPanel.js:
+        (WebInspector.ElementsPanel.prototype.reset):
+        (WebInspector.ElementsPanel.prototype.setDocument.selectDefaultNode):
+        (WebInspector.ElementsPanel.prototype.setDocument.selectLastSelectedNode):
+        (WebInspector.ElementsPanel.prototype.setDocument):
+        * inspector/front-end/InjectedScript.js:
+        (InjectedScript.pushNodeByPathToFrontend):
+        * inspector/front-end/InjectedScriptAccess.js:
+
+2009-12-01  Dave Hyatt  <hyatt@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32045, make sure escape sequences work with
+        all the @-rules we support.  When escape sequences are present, the lexical scanner
+        just returns a generic token name: ATKEYWORD.  We have to process the escape sequences
+        and then recheck against the rules we support with the final processed name.  If we
+        find a match, we mutate the token value to the appropriate rule name token, e.g.,
+        NAMESPACE_SYM.
+
+        Added fast/css/namespaces/namespaces-escapes.xml
+
+        * css/CSSParser.cpp:
+        (WebCore::CSSParser::lex):
+        (WebCore::CSSParser::recheckAtKeyword):
+        (WebCore::CSSParser::text):
+        * css/CSSParser.h:
+
+2009-12-02  Anton Muhin  <antonm@chromium.org>
+
+        Reviewed by Adam Barth.:w
+
+        Allow to skip thread checks when accessing DOMDataStore for processes
+        which run V8 in single thread mode.
+        https://bugs.webkit.org/show_bug.cgi?id=31877
+
+        Should be covered by buildbots.
+
+        * bindings/v8/V8DOMMap.cpp:
+        (WebCore::getDOMDataStore):
+        (WebCore::enableFasterDOMStoreAccess):
+        (WebCore::getDOMNodeMap):
+        (WebCore::getDOMObjectMap):
+        (WebCore::getActiveDOMObjectMap):
+        (WebCore::getDOMSVGElementInstanceMap):
+        (WebCore::getDOMSVGObjectWithContextMap):
+        * bindings/v8/V8DOMMap.h:
+
+2009-12-02  Yury Semikhatsky  <yurys@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Code clean up: remove ScriptObjectQuarantine.* as a whole.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32060
+
+        * GNUmakefile.am:
+        * WebCore.gypi:
+        * WebCore.pro:
+        * WebCore.vcproj/WebCore.vcproj:
+        * WebCore.xcodeproj/project.pbxproj:
+        * WebCoreSources.bkl:
+        * bindings/js/JSBindingsAllInOne.cpp:
+        * bindings/js/ScriptObjectQuarantine.cpp: Removed.
+        * bindings/js/ScriptObjectQuarantine.h: Removed.
+        * bindings/js/ScriptValue.cpp:
+        (WebCore::ScriptValue::quarantineValue):
+        * bindings/js/ScriptValue.h:
+        * bindings/v8/ScriptObjectQuarantine.cpp: Removed.
+        * bindings/v8/ScriptObjectQuarantine.h: Removed.
+        * bindings/v8/ScriptValue.h:
+        (WebCore::ScriptValue::quarantineValue):
+        * inspector/ConsoleMessage.cpp:
+        (WebCore::ConsoleMessage::ConsoleMessage):
+        * inspector/InspectorController.cpp:
+        * inspector/InspectorDatabaseResource.cpp:
+        (WebCore::InspectorDatabaseResource::bind):
+        * inspector/InspectorFrontend.cpp:
+
+2009-12-02  Fumitoshi Ukai  <ukai@chromium.org>
+
+        Reviewed by Alexey Proskuryakov.
+
+        WebSocket handshake check query component of URL
+        https://bugs.webkit.org/show_bug.cgi?id=31617
+
+        Tests: websocket/tests/url-with-credential.html
+               websocket/tests/url-with-empty-query.html
+               websocket/tests/url-with-fragment.html
+               websocket/tests/url-with-query-for-no-query.html
+               websocket/tests/url-with-query.html
+
+        * platform/KURLGoogle.cpp:
+        (WebCore::KURL::query): returns a null if query is not specified and returns an empty if query is specified but empty.
+        * websockets/WebSocketHandshake.cpp:
+        (WebCore::resourceName): added. add query component to path if specified.
+        (WebCore::WebSocketHandshake::clientLocation):
+        (WebCore::WebSocketHandshake::clientHandshakeMessage):
+
+2009-12-01  David Levin  <levin@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Incorrect code in WebGLRenderingContext.cpp
+        https://bugs.webkit.org/show_bug.cgi?id=32046
+
+        Fix incorrect code that happened to work. != has higher precendence than &.
+        The simplest fix is to remove the "!= 0" which violates WebKit style
+        guidelines anyway.
+
+        Also added periods to few comments in the same function.
+
+        * html/canvas/WebGLRenderingContext.cpp:
+        (WebCore::WebGLRenderingContext::validateIndexArray):
+
+2009-12-01  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Change [Reflect] to [ConvertNullToNullString, Reflect] for min, max,
+        pattern and step attributes of HTMLInputElement.
+        https://bugs.webkit.org/show_bug.cgi?id=31708
+
+        * html/HTMLInputElement.idl:
+
+2009-12-01  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Darin Adler.
+
+        WAI-ARIA: implement support for ARIA drag and drop
+        https://bugs.webkit.org/show_bug.cgi?id=32007
+
+        Test: platform/mac/accessibility/aria-drag-drop.html
+
+        * accessibility/AccessibilityObject.h:
+        (WebCore::AccessibilityObject::supportsARIADropping):
+        (WebCore::AccessibilityObject::supportsARIADragging):
+        (WebCore::AccessibilityObject::isARIAGrabbed):
+        (WebCore::AccessibilityObject::setARIAGrabbed):
+        (WebCore::AccessibilityObject::determineARIADropEffects):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::supportsARIADropping):
+        (WebCore::AccessibilityRenderObject::supportsARIADragging):
+        (WebCore::AccessibilityRenderObject::isARIAGrabbed):
+        (WebCore::AccessibilityRenderObject::setARIAGrabbed):
+        (WebCore::AccessibilityRenderObject::determineARIADropEffects):
+        * accessibility/AccessibilityRenderObject.h:
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+        (-[AccessibilityObjectWrapper additionalAccessibilityAttributeNames]):
+        (-[AccessibilityObjectWrapper accessibilityAttributeValue:]):
+        (-[AccessibilityObjectWrapper accessibilityIsAttributeSettable:]):
+        (-[AccessibilityObjectWrapper accessibilitySetValue:forAttribute:]):
+        * html/HTMLAttributeNames.in:
+
+2009-12-01  Adam Barth  <abarth@webkit.org>
+
+        https://bugs.webkit.org/show_bug.cgi?id=21288
+
+        Unreviewed port of @sandbox to V8.
+
+        * bindings/v8/ScriptController.cpp:
+        (WebCore::ScriptController::isEnabled):
+        * bindings/v8/custom/V8DOMWindowCustom.cpp:
+        (WebCore::createWindow):
+
+2009-12-01  Patrik Persson  <patrik.j.persson@ericsson.com>
+
+        Reviewed by Darin Adler.
+
+        Implement HTML5 sandbox attribute for iframes.
+        http://www.w3.org/TR/html5/text-level-semantics.html#attr-iframe-sandbox
+        https://bugs.webkit.org/show_bug.cgi?id=21288
+
+        Tests: fast/frames/sandboxed-iframe-attribute-parsing.html
+               fast/frames/sandboxed-iframe-forms.html
+               fast/frames/sandboxed-iframe-navigation-allowed.html
+               fast/frames/sandboxed-iframe-navigation-parent.html
+               fast/frames/sandboxed-iframe-navigation-targetlink.html
+               fast/frames/sandboxed-iframe-navigation-windowopen.html
+               fast/frames/sandboxed-iframe-plugins.html
+               fast/frames/sandboxed-iframe-scripting.html
+               fast/frames/sandboxed-iframe-storage.html
+               http/tests/security/sandboxed-iframe-document-cookie.html
+               http/tests/security/sandboxed-iframe-modify-self.html
+               http/tests/security/xss-DENIED-sandboxed-iframe.html
+               http/tests/xmlhttprequest/access-control-sandboxed-iframe-allow.html
+               http/tests/xmlhttprequest/access-control-sandboxed-iframe-denied-without-wildcard.html
+               http/tests/xmlhttprequest/access-control-sandboxed-iframe-denied.html
+
+        * bindings/js/JSDOMWindowCustom.cpp: sandboxing navigation
+        (WebCore::createWindow):
+        * bindings/js/ScriptController.cpp: sandboxing scripts
+        (WebCore::ScriptController::isEnabled):
+        * dom/Document.cpp:
+        (WebCore::Document::processHttpEquiv):
+        (WebCore::Document::cookie): raise exception when accessed from sandbox
+        (WebCore::Document::setCookie): raise exception when accessed from sandbox
+        (WebCore::Document::initSecurityContext): updae sandbox status
+        (WebCore::Document::updateSandboxFlags):
+        * dom/Document.h:
+        * dom/Document.idl:
+        * html/HTMLAppletElement.cpp: sandboxing applets
+        (WebCore::HTMLAppletElement::createRenderer):
+        (WebCore::HTMLAppletElement::renderWidgetForJSBindings):
+        (WebCore::HTMLAppletElement::canEmbedJava):
+        * html/HTMLAppletElement.h:
+        * html/HTMLAttributeNames.in:
+        * html/HTMLFrameOwnerElement.cpp: management of sandbox flags as stated in attribute
+        (WebCore::HTMLFrameOwnerElement::HTMLFrameOwnerElement):
+        (WebCore::HTMLFrameOwnerElement::setSandboxFlags):
+        * html/HTMLFrameOwnerElement.h:
+        (WebCore::HTMLFrameOwnerElement::sandboxFlags):
+        * html/HTMLIFrameElement.cpp: sandbox attribute parsing
+        (WebCore::parseSandboxAttribute):
+        (WebCore::HTMLIFrameElement::parseMappedAttribute):
+        * html/HTMLIFrameElement.idl:
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::getCookies):
+        * loader/CrossOriginAccessControl.cpp:
+        (WebCore::passesAccessControlCheck):
+        * loader/FrameLoader.cpp:
+        (WebCore::FrameLoader::FrameLoader):
+        (WebCore::FrameLoader::init):
+        (WebCore::FrameLoader::submitForm): sandboxing forms
+        (WebCore::FrameLoader::requestObject): sandboxing plugins
+        (WebCore::FrameLoader::shouldAllowNavigation): sandboxing navigation
+        (WebCore::FrameLoader::updateSandboxFlags): propagation of sandbox flags
+        * loader/FrameLoader.h:
+        (WebCore::FrameLoader::ownerElementSandboxFlagsChanged):
+        (WebCore::FrameLoader::isSandboxed):
+        (WebCore::FrameLoader::sandboxFlags):
+        * loader/FrameLoaderTypes.h:
+        (WebCore::):
+        * page/DOMWindow.cpp: disable storage and databases in sandboxed frames
+        (WebCore::DOMWindow::sessionStorage):
+        (WebCore::DOMWindow::localStorage):
+        (WebCore::DOMWindow::openDatabase):
+        * page/SecurityOrigin.cpp: added sandboxing status
+        (WebCore::SecurityOrigin::SecurityOrigin):
+        (WebCore::SecurityOrigin::canAccess):
+        (WebCore::SecurityOrigin::canRequest):
+        (WebCore::SecurityOrigin::toString):
+        * page/SecurityOrigin.h:
+        (WebCore::SecurityOrigin::setSandboxFlags):
+        (WebCore::SecurityOrigin::isSandboxed):
+        (WebCore::SecurityOrigin::canAccessDatabase):
+        (WebCore::SecurityOrigin::canAccessStorage):
+        * websockets/WebSocketChannel.cpp:
+        (WebCore::WebSocketChannel::didReceiveData):
+
+2009-12-01  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by David Kilzer.
+
+        ARIA: support a way to create a static text object
+        https://bugs.webkit.org/show_bug.cgi?id=32030
+
+        Test: accessibility/aria-text-role.html
+
+        * accessibility/AccessibilityObject.cpp:
+        (WebCore::createARIARoleMap):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::stringValue):
+        (WebCore::AccessibilityRenderObject::isDescendantOfBarrenParent):
+        (WebCore::AccessibilityRenderObject::accessibilityIsIgnored):
+        (WebCore::AccessibilityRenderObject::text):
+        * accessibility/AccessibilityRenderObject.h:
+
+2009-12-01  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Maciej Stachowiak.
+
+        Inspector crashes when collecting on every allocation
+        https://bugs.webkit.org/show_bug.cgi?id=32044
+
+        The crash is caused by the prototype wrapper object getting collected
+        when allocating the object that is going to use it as a prototype.
+        Because the only reference to the prototype wrapper is through the
+        new object's Structure it does not get marked automatically.
+
+        * bindings/js/JSInspectedObjectWrapper.cpp:
+        (WebCore::JSInspectedObjectWrapper::wrap):
+        * bindings/js/JSInspectorCallbackWrapper.cpp:
+        (WebCore::JSInspectorCallbackWrapper::wrap):
+
+2009-12-01  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Reviewed by Simon Fraser.
+
+        Add SVG animation test framework with 'snapshot' functionality
+        https://bugs.webkit.org/show_bug.cgi?id=31897
+
+        Add 'sampleSVGAnimationForElementAtTime' method to the LayoutTestController,
+        for the use within the new SVG animation test framework (LayoutTests/svg/animations/)
+
+        layoutTestController.sampleAnimationAtTime(<svg animation id>, <absolute time>, <svg element id>);
+        to sample a svg animateMotion/animateColor/animate/set element at certain times.
+
+        After the desired SVG animation starts and calling the method above, it's immediately forwarded to
+        the desired sampling time. After JS returns from the 'sampleSVGAnimationForElementAtTime' method
+        a callback is fired used to sample the animation value at the target time. It's modelled similar
+        to the CSS animation/transition testing framework, inspired by
+        LayoutTests/animations/animation-test-helpers.js.
+
+        Though it has been extended to integrate within the fast/js/js-test-* framework, that's used for
+        the SVG dynamic-updates tests, to simplify test creation, by utilizing script-tests/* only.
+
+        Adding a simple testcase testing the DRT methods, it will soon be extended to test animVal/baseVal
+        interaction, while animating.
+
+        Test: svg/animations/animVal-basics.html
+
+        * WebCore.base.exp:
+        * WebCore.xcodeproj/project.pbxproj:
+        * svg/SVGDocumentExtensions.cpp:
+        (WebCore::SVGDocumentExtensions::sampleAnimationAtTime):
+        * svg/SVGDocumentExtensions.h:
+        * svg/animation/SMILTimeContainer.cpp:
+        (WebCore::SMILTimeContainer::SMILTimeContainer):
+        (WebCore::SMILTimeContainer::sampleAnimationAtTime):
+        (WebCore::SMILTimeContainer::updateAnimations):
+        * svg/animation/SMILTimeContainer.h:
+
+2009-12-01  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Add convenience methods to Element and QualifiedName that take
+        char* instead of AtomicString, in preparation for removing the
+        implicit conversion between the two types (30187).
+        https://bugs.webkit.org/show_bug.cgi?id=31749
+
+        * dom/Element.cpp:
+        (WebCore::Element::setCStringAttribute):  Equivalent to setAttribute.
+        * dom/Element.h:
+        * dom/QualifiedName.cpp:
+        (WebCore::QualifiedName::init):  Shared impl of both constructors
+        (WebCore::QualifiedName::QualifiedName):  New c'tor taking char*.
+        * dom/QualifiedName.h:
+        * platform/network/HTTPHeaderMap.cpp:
+        (WebCore::CaseFoldingCStringTranslator):  Enables lookup by C string
+        (WebCore::HTTPHeaderMap::get):  New variant that takes C string
+        (WebCore::HTTPHeaderMap::contains):  New variant that takes C string
+        (WebCore::HTTPHeaderMap::add):  New variant that takes C string
+        * platform/network/HTTPHeaderMap.h:
+        (WebCore::HTTPHeaderMap::get):
+        (WebCore::HTTPHeaderMap::add):
+        * platform/network/ResourceRequestBase.cpp:
+        (WebCore::ResourceRequestBase::httpHeaderField):  New variant that takes C string
+        * platform/network/ResourceRequestBase.h:
+        (WebCore::ResourceRequestBase::setHTTPHeaderField):  Use symbolic names for headers
+        * platform/network/ResourceResponseBase.cpp:
+        (WebCore::ResourceResponseBase::httpHeaderField):  New variant that takes C string
+        * platform/network/ResourceResponseBase.h:
+
+2009-12-01  Alexey Proskuryakov  <ap@apple.com>
+
+        More Windows build fix.
+
+        * platform/network/cf/CredentialStorageCFNet.cpp:
+        (WebCore::CredentialStorage::getFromPersistentStorage):
+
+2009-12-01  Alexey Proskuryakov  <ap@apple.com>
+
+        Windows build fix.
+
+        * platform/network/cf/CredentialStorageCFNet.cpp: Include RetainPtr.h.
+
+2009-12-01  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32036
+        Implement CredentialStorage::getFromPersistentStorage for CFNetwork
+
+        * platform/network/cf/CredentialStorageCFNet.cpp:
+        (WebCore::CredentialStorage::getFromPersistentStorage):
+
+2009-12-01  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Pavel Feldman.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32001
+
+        Added missing localized strings (that I left out of the patch for bug #21554):
+        %d × %d pixels
+        %d × %d pixels (Natural: %d × %d pixels)
+
+        Also, changed formatting of these stings to conform with existing ones (added
+        a space on both sides of the multiply sign).
+
+        * English.lproj/localizedStrings.js: Added stings.
+        * inspector/front-end/ElementsTreeOutline.js:
+        (WebInspector.ElementsTreeElement.prototype.createTooltipForImageNode):
+
+2009-12-01  Dave Hyatt  <hyatt@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        Fix for bug 32032, empty namespaces should be allowed in @namespace directives in CSS.
+
+        Added fast/css/namespaces/namespaces-empty.xml
+
+        * css/CSSStyleSheet.cpp:
+        (WebCore::CSSStyleSheet::addNamespace):
+        (WebCore::CSSStyleSheet::determineNamespace):
+
+2009-12-01  Joseph Pecoraro  <joepeck@webkit.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Escape key in the Search Field should be more User Friendly
+        https://bugs.webkit.org/show_bug.cgi?id=32005
+
+        * inspector/front-end/inspector.js:
+        (WebInspector.loaded): add mousedown listener on the search field
+        (WebInspector.searchFieldManualFocus): user clicked to focus on the search field
+        (WebInspector.searchKeyDown): handle escape
+
+2009-12-01  Dave Hyatt  <hyatt@apple.com>
+
+        Reviewed by David Kilzer.
+
+        @namespace directives need to use "maybe_space" in the "maybe_ns_prefix" portion of the grammar to match
+        the spec.  Not doing so prevent comments from being used immmediately after the namespace prefix.
+
+        Added fast/css/namespaces-comments.xml
+
+        * css/CSSGrammar.y:
+
+2009-12-01  Yael Aharon  <yael.aharon@nokia.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Reloading WebInspector from context menu is closing it instead of reloading.
+        https://bugs.webkit.org/show_bug.cgi?id=32004
+
+        When reloading WebInspector, don't delete its m_page.
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::close):
+
+2009-12-01  Steve Block  <steveblock@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        Adds V8 bindings for Geolocation.
+        https://bugs.webkit.org/show_bug.cgi?id=30206
+
+        Also adds Geolocation files to Chrome build files.
+
+        * WebCore.gyp/WebCore.gyp: Modified. Corrects list of Geolocation IDL files.
+        * WebCore.gypi: Modified. Adds Geolocation files.
+        * bindings/v8/DOMObjectsInclude.h: Modified. Adds Geolocation includes.
+        * bindings/v8/DerivedSourcesAllInOne.cpp: Modified. Adds Geolocation files.
+        * bindings/v8/V8Index.cpp: Modified. Includes Geolocation generated headers.
+        * bindings/v8/V8Index.h: Modified. Adds Geolocation types to DOM_OBJECT_TYPES.
+        * bindings/v8/custom/V8CoordinatesCustom.cpp: Added. Handles optional properties.
+        * bindings/v8/custom/V8CustomBinding.h: Modified. Declares callbacks and getters.
+        * bindings/v8/custom/V8CustomPositionCallback.cpp: Added.
+        (WebCore::V8CustomPositionCallback::V8CustomPositionCallback): Added. Constructor.
+        (WebCore::V8CustomPositionCallback::~V8CustomPositionCallback): Added. Destructor.
+        (WebCore::V8CustomPositionCallback::handleEvent): Added. Invokes callback.
+        * bindings/v8/custom/V8CustomPositionCallback.h: Added.
+        (WebCore::V8CustomPositionCallback::create): Added. Factory method.
+        * bindings/v8/custom/V8CustomPositionErrorCallback.cpp: Added.
+        (WebCore::V8CustomPositionErrorCallback::V8CustomPositionErrorCallback): Added. Constructor.
+        (WebCore::V8CustomPositionErrorCallback::~V8CustomPositionErrorCallback): Added. Destructor.
+        (WebCore::V8CustomPositionErrorCallback::handleEvent): Added. Invokes callback.
+        * bindings/v8/custom/V8CustomPositionErrorCallback.h: Added.
+        (WebCore::V8CustomPositionErrorCallback::create): Added. Factory method.
+        * bindings/v8/custom/V8GeolocationCustom.cpp: Added.
+        (WebCore::throwTypeMismatchException): Added. Throws a type mismatch error.
+        (WebCore::createPositionCallback): Added. Handles type checking for successCallback argument.
+        (WebCore::createPositionErrorCallback): Added. Handles type checking for errorCallback argument.
+        (WebCore::createPositionOptions): Added. Handles type checking for positionOptions argument.
+
+2009-12-01  Yury Semikhatsky  <yurys@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Provide a way to get ScriptState for the inspected page.
+
+        https://bugs.webkit.org/show_bug.cgi?id=32020
+
+        * bindings/v8/ScriptController.cpp:
+        (WebCore::ScriptController::mainWorldScriptState):
+        * bindings/v8/ScriptController.h:
+        * bindings/v8/ScriptState.cpp:
+        (WebCore::scriptStateFromPage):
+
+2009-12-01  Chris Marrin  <cmarrin@apple.com>
+
+        Reviewed by Adam Roben.
+
+        Changed mallocs to fastMallocs and frees to fastFrees in GraphicsContext3D. Also added error returns
+        https://bugs.webkit.org/show_bug.cgi?id=30778
+
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::GraphicsContext3D::getProgramInfoLog):
+        (WebCore::GraphicsContext3D::getShaderInfoLog):
+        (WebCore::GraphicsContext3D::getShaderSource):
+        (WebCore::imageToTexture):
+
+2009-12-01  Mads Ager  <ager@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        [V8] Don't crash in DOMWindow event getter in OOM situations
+        https://bugs.webkit.org/show_bug.cgi?id=32017
+
+        Add missing null handle checks in DOMWindow event property
+        accessors.  V8Proxy::context(frame) can return a null handle in
+        OOM situations either if failing to initialize a context or if an
+        OOM is handled gracefully and javascript is disabled.
+
+        No new tests because we don't have a good way to test
+        out-of-memory bugs.
+
+        * bindings/v8/custom/V8DOMWindowCustom.cpp:
+        (WebCore::ACCESSOR_GETTER):
+        (WebCore::ACCESSOR_SETTER):
+
+2009-12-01  Chris Marrin  <cmarrin@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        Updated HTMLCanvasElement to accept "experimental-webgl" as the context name.
+        https://bugs.webkit.org/show_bug.cgi?id=31672
+
+        * html/HTMLCanvasElement.cpp:
+        (WebCore::HTMLCanvasElement::getContext):
+
+2009-12-01  Pavel Feldman  <pfeldman@dhcp-172-28-174-220.spb.corp.google.com>
+
+        Not reviewed: chromium build fix, added missing import.
+
+        * inspector/InspectorFrontendHost.cpp:
+
+2009-12-01  Pavel Feldman  <pfeldman@chromium.org>
+
+        Not reviewed: fix windows build via unexcluding generated files from
+        project.
+
+        * WebCore.vcproj/WebCore.vcproj:
+
+2009-12-01  Mark Rowe  <mrowe@apple.com>
+
+        Stop copying IDL files in to the WebCore framework wrapper.
+
+        * WebCore.xcodeproj/project.pbxproj:
+
+2009-12-01  Mark Rowe  <mrowe@apple.com>
+
+        Fix the Tiger build by making the Xcode project compatible with Xcode 2.4.
+
+        This was probably broken by hand-editing the project file as Xcode itself
+        knows how to keep project files to a backwards-compatible subset of its format.
+
+        * WebCore.xcodeproj/project.pbxproj:
+
+2009-12-01  Pavel Feldman  <pfeldman@chromium.org>
+
+        Not reviewed: windows build fix (bad vcproj in r51528).
+
+        * WebCore.vcproj/WebCore.vcproj:
+
+2009-11-27  Pavel Feldman  <pfeldman@dhcp-172-28-174-220.spb.corp.google.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Split InspectorBackend into three parts: backend,
+        injected script host and frontend host.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=31888
+
+        * DerivedSources.make:
+        * GNUmakefile.am:
+        * WebCore.gypi:
+        * WebCore.pro:
+        * WebCore.vcproj/WebCore.vcproj:
+        * WebCore.xcodeproj/project.pbxproj:
+        * WebCoreSources.bkl:
+        * bindings/js/JSBindingsAllInOne.cpp:
+        * bindings/js/JSInspectorBackendCustom.cpp: Removed.
+        * bindings/js/JSInspectorFrontendHostCustom.cpp: Added.
+        (WebCore::JSInspectorFrontendHost::search):
+        (WebCore::JSInspectorFrontendHost::setting):
+        (WebCore::JSInspectorFrontendHost::setSetting):
+        * bindings/js/ScriptObject.cpp:
+        (WebCore::ScriptGlobalObject::set):
+        * bindings/js/ScriptObject.h:
+        * bindings/v8/DOMObjectsInclude.h:
+        * bindings/v8/DerivedSourcesAllInOne.cpp:
+        * bindings/v8/ScriptObject.cpp:
+        (WebCore::ScriptGlobalObject::set):
+        * bindings/v8/ScriptObject.h:
+        * bindings/v8/V8Index.cpp:
+        * bindings/v8/V8Index.h:
+        * bindings/v8/custom/V8CustomBinding.h:
+        * bindings/v8/custom/V8InjectedScriptHostCustom.cpp: Added.
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8InspectorBackendCustom.cpp: Removed.
+        * bindings/v8/custom/V8InspectorFrontendHostCustom.cpp: Added.
+        (WebCore::CALLBACK_FUNC_DECL):
+        * inspector/InjectedScriptHost.cpp: Added.
+        (WebCore::InjectedScriptHost::InjectedScriptHost):
+        (WebCore::InjectedScriptHost::~InjectedScriptHost):
+        (WebCore::InjectedScriptHost::copyText):
+        (WebCore::InjectedScriptHost::nodeForId):
+        (WebCore::InjectedScriptHost::wrapObject):
+        (WebCore::InjectedScriptHost::unwrapObject):
+        (WebCore::InjectedScriptHost::pushNodePathToFrontend):
+        (WebCore::InjectedScriptHost::addNodesToSearchResult):
+        (WebCore::InjectedScriptHost::currentCallFrame):
+        (WebCore::InjectedScriptHost::databaseForId):
+        (WebCore::InjectedScriptHost::selectDatabase):
+        (WebCore::InjectedScriptHost::selectDOMStorage):
+        (WebCore::InjectedScriptHost::reportDidDispatchOnInjectedScript):
+        (WebCore::InjectedScriptHost::inspectorDOMAgent):
+        (WebCore::InjectedScriptHost::inspectorFrontend):
+        * inspector/InjectedScriptHost.h: Added.
+        (WebCore::InjectedScriptHost::create):
+        (WebCore::InjectedScriptHost::inspectorController):
+        (WebCore::InjectedScriptHost::disconnectController):
+        * inspector/InjectedScriptHost.idl: Added.
+        * inspector/InspectorBackend.cpp:
+        (WebCore::InspectorBackend::InspectorBackend):
+        (WebCore::InspectorBackend::storeLastActivePanel):
+        (WebCore::InspectorBackend::toggleNodeSearch):
+        (WebCore::InspectorBackend::resourceTrackingEnabled):
+        (WebCore::InspectorBackend::debuggerEnabled):
+        (WebCore::InspectorBackend::enableDebugger):
+        (WebCore::InspectorBackend::disableDebugger):
+        (WebCore::InspectorBackend::addBreakpoint):
+        (WebCore::InspectorBackend::updateBreakpoint):
+        (WebCore::InspectorBackend::removeBreakpoint):
+        (WebCore::InspectorBackend::pauseInDebugger):
+        (WebCore::InspectorBackend::resumeDebugger):
+        (WebCore::InspectorBackend::stepOverStatementInDebugger):
+        (WebCore::InspectorBackend::stepIntoStatementInDebugger):
+        (WebCore::InspectorBackend::stepOutOfFunctionInDebugger):
+        (WebCore::InspectorBackend::pauseOnExceptions):
+        (WebCore::InspectorBackend::setPauseOnExceptions):
+        (WebCore::InspectorBackend::profilerEnabled):
+        (WebCore::InspectorBackend::enableProfiler):
+        (WebCore::InspectorBackend::disableProfiler):
+        (WebCore::InspectorBackend::startProfiling):
+        (WebCore::InspectorBackend::stopProfiling):
+        (WebCore::InspectorBackend::getProfileHeaders):
+        (WebCore::InspectorBackend::getProfile):
+        (WebCore::InspectorBackend::currentCallFrame):
+        (WebCore::InspectorBackend::highlightDOMNode):
+        (WebCore::InspectorBackend::hideDOMNodeHighlight):
+        (WebCore::InspectorBackend::getCookies):
+        (WebCore::InspectorBackend::deleteCookie):
+        (WebCore::InspectorBackend::didEvaluateForTestInFrontend):
+        (WebCore::InspectorBackend::nodeForId):
+        * inspector/InspectorBackend.h:
+        (WebCore::InspectorBackend::create):
+        * inspector/InspectorBackend.idl:
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::InspectorController):
+        (WebCore::InspectorController::~InspectorController):
+        (WebCore::InspectorController::inspectedPageDestroyed):
+        (WebCore::InspectorController::windowScriptObjectAvailable):
+        * inspector/InspectorController.h:
+        (WebCore::InspectorController::inspectorFrontendHost):
+        (WebCore::InspectorController::injectedScriptHost):
+        * inspector/InspectorFrontendHost.cpp: Added.
+        (WebCore::InspectorFrontendHost::InspectorFrontendHost):
+        (WebCore::InspectorFrontendHost::~InspectorFrontendHost):
+        (WebCore::InspectorFrontendHost::loaded):
+        (WebCore::InspectorFrontendHost::attach):
+        (WebCore::InspectorFrontendHost::detach):
+        (WebCore::InspectorFrontendHost::closeWindow):
+        (WebCore::InspectorFrontendHost::windowUnloading):
+        (WebCore::InspectorFrontendHost::setAttachedWindowHeight):
+        (WebCore::InspectorFrontendHost::moveWindowBy):
+        (WebCore::InspectorFrontendHost::localizedStringsURL):
+        (WebCore::InspectorFrontendHost::hiddenPanels):
+        (WebCore::InspectorFrontendHost::platform):
+        (WebCore::InspectorFrontendHost::port):
+        (WebCore::InspectorFrontendHost::addResourceSourceToFrame):
+        (WebCore::InspectorFrontendHost::addSourceToFrame):
+        * inspector/InspectorFrontendHost.h: Added.
+        (WebCore::InspectorFrontendHost::create):
+        (WebCore::InspectorFrontendHost::inspectorController):
+        (WebCore::InspectorFrontendHost::disconnectController):
+        * inspector/InspectorFrontendHost.idl: Added.
+        * inspector/front-end/Breakpoint.js:
+        (WebInspector.Breakpoint.prototype.set condition):
+        * inspector/front-end/BreakpointsSidebarPane.js:
+        (WebInspector.BreakpointsSidebarPane.prototype.addBreakpoint):
+        (WebInspector.BreakpointsSidebarPane.prototype.removeBreakpoint):
+        (WebInspector.BreakpointsSidebarPane.prototype._breakpointEnableChanged):
+        * inspector/front-end/ConsoleView.js:
+        (WebInspector.ConsoleView.prototype.clearMessages):
+        * inspector/front-end/CookieItemsView.js:
+        (WebInspector.CookieItemsView.prototype._deleteCookieCallback):
+        * inspector/front-end/DOMAgent.js:
+        (WebInspector.DOMAgent.prototype.getChildNodesAsync):
+        (WebInspector.DOMAgent.prototype.setAttributeAsync):
+        (WebInspector.DOMAgent.prototype.removeAttributeAsync):
+        (WebInspector.DOMAgent.prototype.setTextNodeValueAsync):
+        (WebInspector.Cookies.getCookiesAsync):
+        (WebInspector.EventListeners.getEventListenersForNodeAsync):
+        * inspector/front-end/DOMStorage.js:
+        (WebInspector.DOMStorage.prototype.getEntries):
+        (WebInspector.DOMStorage.prototype.setItem):
+        (WebInspector.DOMStorage.prototype.removeItem):
+        * inspector/front-end/Database.js:
+        (WebInspector.Database.prototype.getTableNames):
+        * inspector/front-end/ElementsPanel.js:
+        (WebInspector.ElementsPanel.this.treeOutline.focusedNodeChanged):
+        (WebInspector.ElementsPanel.prototype.hide):
+        (WebInspector.ElementsPanel.prototype.reset):
+        (WebInspector.ElementsPanel.prototype.handleCopyEvent):
+        (WebInspector.ElementsPanel.prototype._nodeSearchButtonClicked):
+        * inspector/front-end/ElementsTreeOutline.js:
+        (WebInspector.ElementsTreeOutline.prototype.set focusedDOMNode.restoreHighlightToHoveredNode):
+        (WebInspector.ElementsTreeOutline.prototype.set focusedDOMNode):
+        ():
+        * inspector/front-end/EventListenersSidebarPane.js:
+        (WebInspector.EventListenersSidebarPane.prototype):
+        * inspector/front-end/InjectedScript.js:
+        (InjectedScript._evaluateAndWrap):
+        (InjectedScript.performSearch.addNodesToResults):
+        (InjectedScript.getCallFrames):
+        (InjectedScript._callFrameForId):
+        (InjectedScript._clearConsoleMessages):
+        (InjectedScript._inspectObject):
+        (InjectedScript._copy):
+        (InjectedScript._ensureCommandLineAPIInstalled):
+        (InjectedScript._window):
+        (InjectedScript._nodeForId):
+        (InjectedScript._objectForId):
+        (InjectedScript.pushNodeToFrontend):
+        (InjectedScript.executeSql):
+        (InjectedScript.executeSql.errorCallback):
+        (InjectedScript.executeSql.queryTransaction):
+        * inspector/front-end/InjectedScriptAccess.js:
+        (InjectedScriptAccess._installHandler.InjectedScriptAccess.methodName):
+        (InjectedScriptAccess._installHandler):
+        * inspector/front-end/InspectorBackendStub.js: Added.
+        (.WebInspector.InspectorBackendStub):
+        (.WebInspector.InspectorBackendStub.prototype.wrapCallback):
+        (.WebInspector.InspectorBackendStub.prototype.platform):
+        (.WebInspector.InspectorBackendStub.prototype.port):
+        (.WebInspector.InspectorBackendStub.prototype.closeWindow):
+        (.WebInspector.InspectorBackendStub.prototype.attach):
+        (.WebInspector.InspectorBackendStub.prototype.detach):
+        (.WebInspector.InspectorBackendStub.prototype.storeLastActivePanel):
+        (.WebInspector.InspectorBackendStub.prototype.clearMessages):
+        (.WebInspector.InspectorBackendStub.prototype.searchingForNode):
+        (.WebInspector.InspectorBackendStub.prototype.search):
+        (.WebInspector.InspectorBackendStub.prototype.toggleNodeSearch):
+        (.WebInspector.InspectorBackendStub.prototype.setAttachedWindowHeight):
+        (.WebInspector.InspectorBackendStub.prototype.moveByUnrestricted):
+        (.WebInspector.InspectorBackendStub.prototype.addResourceSourceToFrame):
+        (.WebInspector.InspectorBackendStub.prototype.addSourceToFrame):
+        (.WebInspector.InspectorBackendStub.prototype.getResourceDocumentNode):
+        (.WebInspector.InspectorBackendStub.prototype.highlightDOMNode):
+        (.WebInspector.InspectorBackendStub.prototype.hideDOMNodeHighlight):
+        (.WebInspector.InspectorBackendStub.prototype.inspectedWindow):
+        (.WebInspector.InspectorBackendStub.prototype.loaded):
+        (.WebInspector.InspectorBackendStub.prototype.localizedStringsURL):
+        (.WebInspector.InspectorBackendStub.prototype.windowUnloading):
+        (.WebInspector.InspectorBackendStub.prototype.hiddenPanels):
+        (.WebInspector.InspectorBackendStub.prototype.debuggerEnabled):
+        (.WebInspector.InspectorBackendStub.prototype.enableResourceTracking):
+        (.WebInspector.InspectorBackendStub.prototype.disableResourceTracking):
+        (.WebInspector.InspectorBackendStub.prototype.resourceTrackingEnabled):
+        (.WebInspector.InspectorBackendStub.prototype.enableDebugger):
+        (.WebInspector.InspectorBackendStub.prototype.disableDebugger):
+        (.WebInspector.InspectorBackendStub.prototype.addBreakpoint):
+        (.WebInspector.InspectorBackendStub.prototype.removeBreakpoint):
+        (.WebInspector.InspectorBackendStub.prototype.updateBreakpoint):
+        (.WebInspector.InspectorBackendStub.prototype.pauseInDebugger):
+        (.WebInspector.InspectorBackendStub.prototype.pauseOnExceptions):
+        (.WebInspector.InspectorBackendStub.prototype.setPauseOnExceptions):
+        (.WebInspector.InspectorBackendStub.prototype.resumeDebugger):
+        (.WebInspector.InspectorBackendStub.prototype.profilerEnabled):
+        (.WebInspector.InspectorBackendStub.prototype.enableProfiler):
+        (.WebInspector.InspectorBackendStub.prototype.disableProfiler):
+        (.WebInspector.InspectorBackendStub.prototype.startProfiling):
+        (.WebInspector.InspectorBackendStub.prototype.stopProfiling):
+        (.WebInspector.InspectorBackendStub.prototype.getProfileHeaders):
+        (.WebInspector.InspectorBackendStub.prototype.getProfile):
+        (.WebInspector.InspectorBackendStub.prototype.takeHeapSnapshot):
+        (.WebInspector.InspectorBackendStub.prototype.databaseTableNames):
+        (.WebInspector.InspectorBackendStub.prototype.stepIntoStatementInDebugger):
+        (.WebInspector.InspectorBackendStub.prototype.stepOutOfFunctionInDebugger):
+        (.WebInspector.InspectorBackendStub.prototype.stepOverStatementInDebugger):
+        (.WebInspector.InspectorBackendStub.prototype.setSetting):
+        (.WebInspector.InspectorBackendStub.prototype.dispatchOnInjectedScript):
+        (.WebInspector.InspectorBackendStub.prototype.releaseWrapperObjectGroup):
+        (.WebInspector.InspectorBackendStub.prototype.setting):
+        * inspector/front-end/InspectorControllerStub.js:
+        * inspector/front-end/InspectorFrontendHostStub.js: Added.
+        (.WebInspector.InspectorFrontendHostStub):
+        (.WebInspector.InspectorFrontendHostStub.prototype.platform):
+        (.WebInspector.InspectorFrontendHostStub.prototype.port):
+        (.WebInspector.InspectorFrontendHostStub.prototype.closeWindow):
+        (.WebInspector.InspectorFrontendHostStub.prototype.attach):
+        (.WebInspector.InspectorFrontendHostStub.prototype.detach):
+        (.WebInspector.InspectorFrontendHostStub.prototype.search):
+        (.WebInspector.InspectorFrontendHostStub.prototype.setAttachedWindowHeight):
+        (.WebInspector.InspectorFrontendHostStub.prototype.moveWindowBy):
+        (.WebInspector.InspectorFrontendHostStub.prototype.addResourceSourceToFrame):
+        (.WebInspector.InspectorFrontendHostStub.prototype.addSourceToFrame):
+        (.WebInspector.InspectorFrontendHostStub.prototype.loaded):
+        (.WebInspector.InspectorFrontendHostStub.prototype.localizedStringsURL):
+        (.WebInspector.InspectorFrontendHostStub.prototype.hiddenPanels):
+        (.WebInspector.InspectorFrontendHostStub.prototype.setSetting):
+        (.WebInspector.InspectorFrontendHostStub.prototype.setting):
+        * inspector/front-end/ProfileView.js:
+        (WebInspector.CPUProfileView):
+        (WebInspector.CPUProfileType.prototype.buttonClicked):
+        * inspector/front-end/ProfilesPanel.js:
+        (WebInspector.ProfilesPanel.prototype._updateInterface):
+        (WebInspector.ProfilesPanel.prototype._enableProfiling):
+        (WebInspector.ProfilesPanel.prototype._toggleProfiling):
+        * inspector/front-end/ResourcesPanel.js:
+        (WebInspector.ResourcesPanel.prototype.reset):
+        (WebInspector.ResourcesPanel.prototype._toggleLargerResources):
+        (WebInspector.ResourcesPanel.prototype._enableResourceTracking):
+        (WebInspector.ResourcesPanel.prototype._toggleResourceTracking):
+        * inspector/front-end/ScriptView.js:
+        (WebInspector.ScriptView.prototype.setupSourceFrameIfNeeded):
+        * inspector/front-end/ScriptsPanel.js:
+        (WebInspector.ScriptsPanel.prototype.show):
+        (WebInspector.ScriptsPanel.prototype.addScript):
+        (WebInspector.ScriptsPanel.prototype.attachDebuggerWhenShown):
+        (WebInspector.ScriptsPanel.prototype.reset):
+        (WebInspector.ScriptsPanel.prototype.canShowResource):
+        (WebInspector.ScriptsPanel.prototype._showScriptOrResource):
+        (WebInspector.ScriptsPanel.prototype._addScriptToFilesMenu):
+        (WebInspector.ScriptsPanel.prototype._updatePauseOnExceptionsButton):
+        (WebInspector.ScriptsPanel.prototype._updateDebuggerButtons):
+        (WebInspector.ScriptsPanel.prototype._enableDebugging):
+        (WebInspector.ScriptsPanel.prototype._toggleDebugging):
+        (WebInspector.ScriptsPanel.prototype._togglePauseOnExceptions):
+        (WebInspector.ScriptsPanel.prototype._togglePause):
+        (WebInspector.ScriptsPanel.prototype._stepOverClicked):
+        (WebInspector.ScriptsPanel.prototype._stepIntoClicked):
+        (WebInspector.ScriptsPanel.prototype._stepOutClicked):
+        * inspector/front-end/SourceView.js:
+        (WebInspector.SourceView.prototype.setupSourceFrameIfNeeded):
+        (WebInspector.SourceView.prototype.performSearch.findSearchMatches):
+        (WebInspector.SourceView.prototype.performSearch):
+        * inspector/front-end/StylesSidebarPane.js:
+        (WebInspector.StylesSidebarPane.prototype._changeColorFormat):
+        * inspector/front-end/TestController.js:
+        (WebInspector.TestController.prototype.notifyDone):
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._toggleTimelineButtonClicked):
+        * inspector/front-end/WatchExpressionsSidebarPane.js:
+        (WebInspector.WatchExpressionsSection.prototype.update):
+        (WebInspector.WatchExpressionsSection.prototype.loadSavedExpressions):
+        (WebInspector.WatchExpressionsSection.prototype.saveExpressions):
+        * inspector/front-end/WebKit.qrc:
+        * inspector/front-end/inspector.html:
+        * inspector/front-end/inspector.js:
+        (WebInspector.pendingDispatches.0.get platform):
+        (WebInspector.get port):
+        (WebInspector.set currentPanel):
+        (WebInspector._createPanels):
+        (WebInspector._loadPreferences):
+        (WebInspector.set attached):
+        (WebInspector._updateHoverHighlight):
+        (WebInspector.loaded):
+        (windowLoaded):
+        (WebInspector.windowUnload):
+        (WebInspector.close):
+        (WebInspector.toolbarDrag):
+        (WebInspector.UIString):
+
+2009-11-30  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Reviewed by Dan Bernstein.
+
+        css2.1/t1205-c566-list-stl-00-e-ag.html is failing
+        https://bugs.webkit.org/show_bug.cgi?id=23264
+        css2.1/t1205-c565-list-pos-00-b.html is failing
+        https://bugs.webkit.org/show_bug.cgi?id=23263
+
+        Ignore whitespaces after list markers.
+        Rendering of this was already done for the case where inside=false.
+        This fixes the rendering of inside=true case and calcInlinePrefWidths.
+
+        Test: fast/lists/calc-width-with-space.html
+
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::calcInlinePrefWidths):
+        * rendering/RenderBlockLineLayout.cpp:
+        (WebCore::RenderBlock::findNextLineBreak):
+
+2009-11-30  Fumitoshi Ukai  <ukai@chromium.org>
+
+        Unreviewed Chromium build fix introduced by r51212
+
+        Fix scriptStateFromNode and ScriptStateFromPage to take DOMWrapperWorld
+        as the first argument.
+        Move mainThreadNormalWorld() to ScriptState.{h,cpp}.
+        Add debuggerWorld() and pluginWorld() in ScriptState.h.
+
+        * bindings/v8/ScriptController.cpp:
+        * bindings/v8/ScriptController.h:
+        * bindings/v8/ScriptState.cpp:
+        (WebCore::scriptStateFromNode):
+        (WebCore::scriptStateFromPage):
+        (WebCore::mainThreadNormalWorld):
+        * bindings/v8/ScriptState.h:
+        (WebCore::debuggerWorld):
+        (WebCore::pluginWorld):
+
+2009-11-30  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Can focus but not type into content editable block that contains only non-editable content.
+        <rdar://problem/5982901>
+        https://bugs.webkit.org/show_bug.cgi?id=31750
+        
+        The goal is to change the way we choose a visible position
+        after hit detection, by preferring a visually equivalent editable
+        position if available. By doing this, it is possible to add content
+        to an editable block that initially contains only non editable elements.
+
+        Test: editing/selection/mixed-editability-10.html
+
+        * WebCore.base.exp: Changed to match the new signature of downstream
+        and upstream in the Position class.
+        * dom/Position.cpp:
+        (WebCore::Position::atEditingBoundary): Added.
+        (WebCore::Position::upstream): Modified to allow to cross the boundary
+        between editable and non editable content if required.
+        (WebCore::Position::downstream): Modified to allow to cross the boundary
+        between editable and non editable content if required.
+        (WebCore::Position::isCandidate): Modified to qualify as candidates positions
+        that are at the editability boundary.
+        (WebCore::Position::getInlineBoxAndOffset): Modified to retrieve the inline box
+        to be used in calculating the caret rectangle.
+        * dom/Position.h:
+        (WebCore::Position::):
+        * dom/PositionIterator.cpp:
+        (WebCore::PositionIterator::atEditingBoundary): Added.
+        (WebCore::PositionIterator::isCandidate): Modified to qualify as candidates positions
+        that are at the editability boundary.
+        * dom/PositionIterator.h:
+        * editing/htmlediting.cpp:
+        (WebCore::firstEditablePositionAfterPositionInRoot): Modified to accept not only
+        descendants of the editable container, but the container itself.
+        (WebCore::lastEditablePositionBeforePositionInRoot): Modified to accept not only
+        descendants of the editable container, but the container itself.
+        * rendering/RenderObject.cpp:
+        (WebCore::RenderObject::createVisiblePosition): Added logic to prefer an editable position,
+        if available.
+        * rendering/RenderText.cpp:
+        (WebCore::RenderText::isAllCollapsibleWhitespace): Added.
+        * rendering/RenderText.h:
+
+2009-11-30  Kevin Ollivier  <kevino@theolliviers.com>
+
+        wx build fix, add header needed for wx build.
+
+        * css/CSSFontFaceSrcValue.cpp:
+
+2009-11-30  Mark Rowe  <mrowe@apple.com>
+
+        Reviewed by David Kilzer.
+
+        <rdar://problem/7424387> WebCore binary missing symbols when built for x86_64 from a machine that cannot run x86_64 binaries
+
+        The check for whether WTF_USE_PLUGIN_HOST_PROCESS is defined occurs under the native architecture of the build machine.
+        If that is 32-bit then WTF_USE_PLUGIN_HOST_PROCESS will not be defined.  We work around this by forcing the check to
+        be performed against the x86_64 architecture.
+
+        * DerivedSources.make:
+
+2009-11-30  Beth Dakin  <bdakin@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        Fix for https://bugs.webkit.org/show_bug.cgi?id=32000 Crash in 
+        Safari caused by extreme column-gap and column-width values 
+        -and corresponding-
+        <rdar://problem/7425433>
+
+        Prevent desiredColumnCount from being less than 1 since it is used 
+        as a divisor.
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::calcColumnWidth):
+
+2009-11-30  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31659
+        Connection must be closed in case of Web Socket handshake error
+
+        The network connection was closed, but the close event wasn't dispatched.
+
+        Tested by websocket/tests/handshake-error.html, which is un-skipped now.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp: (WebCore::SocketStreamHandle::platformClose):
+        Call client didHandle() method. This looks strange in CFNetwork implementation, because
+        it's the client that asked to close the stream, so it shouldn't need the callback. It makes
+        more sense in cross-process implementation, because closing is async there.
+
+2009-11-30  Gavin Barraclough  <barraclough@apple.com>
+
+        Reviewed by Geoff Garen.
+
+        Bug 31859 - Make world selection for JSC IsolatedWorlds automagical.
+
+        WebCore presently has to explicitly specify the world before entering into JSC,
+        which is a little fragile (particularly since property access via a
+        getter/setter might invoke execution). Instead derive the current world from
+        the lexical global object.
+
+        Remove the last uses of mainThreadCurrentWorld(), so the world is always obtained via
+        currentWorld().  Switch this to obtain the world from the ExecsState's lexical global
+        object instead.  Remove the call/construct/evaluate 'InWorld' methods, since these
+        are no longer necessary.
+
+        * WebCore.base.exp:
+        * bindings/js/JSCallbackData.cpp:
+        (WebCore::JSCallbackData::invokeCallback):
+        * bindings/js/JSCallbackData.h:
+        (WebCore::JSCallbackData::JSCallbackData):
+        * bindings/js/JSCustomXPathNSResolver.cpp:
+        (WebCore::JSCustomXPathNSResolver::lookupNamespaceURI):
+        * bindings/js/JSDOMBinding.cpp:
+        (WebCore::currentWorld):
+        (WebCore::mainThreadNormalWorld):
+        * bindings/js/JSDOMBinding.h:
+        (WebCore::WebCoreJSClientData::WebCoreJSClientData):
+        * bindings/js/JSDOMWindowBase.cpp:
+        (WebCore::JSDOMWindowBase::updateDocument):
+        * bindings/js/JSDOMWindowBase.h:
+        * bindings/js/JSEventListener.cpp:
+        (WebCore::JSEventListener::handleEvent):
+        (WebCore::JSEventListener::reportError):
+        * bindings/js/JSHTMLDocumentCustom.cpp:
+        (WebCore::JSHTMLDocument::open):
+        * bindings/js/JSNodeFilterCondition.cpp:
+        (WebCore::JSNodeFilterCondition::acceptNode):
+        * bindings/js/JSQuarantinedObjectWrapper.cpp:
+        (WebCore::JSQuarantinedObjectWrapper::construct):
+        (WebCore::JSQuarantinedObjectWrapper::call):
+        * bindings/js/ScheduledAction.cpp:
+        (WebCore::ScheduledAction::executeFunctionInContext):
+        * bindings/js/ScriptController.cpp:
+        (WebCore::ScriptController::evaluateInWorld):
+        (WebCore::ScriptController::initScript):
+        (WebCore::ScriptController::updateDocument):
+        * bindings/js/ScriptFunctionCall.cpp:
+        (WebCore::ScriptFunctionCall::call):
+        (WebCore::ScriptFunctionCall::construct):
+        * bindings/js/ScriptObjectQuarantine.cpp:
+        (WebCore::getQuarantinedScriptObject):
+        * bindings/js/ScriptState.cpp:
+        (WebCore::scriptStateFromNode):
+        (WebCore::scriptStateFromPage):
+        * bindings/js/ScriptState.h:
+        * bindings/js/WorkerScriptController.cpp:
+        (WebCore::WorkerScriptController::evaluate):
+        * bindings/objc/WebScriptObject.mm:
+        (-[WebScriptObject callWebScriptMethod:withArguments:]):
+        (-[WebScriptObject evaluateWebScript:]):
+        * bridge/NP_jsobject.cpp:
+        (_NPN_InvokeDefault):
+        (_NPN_Invoke):
+        (_NPN_Evaluate):
+        (_NPN_Construct):
+        * bridge/jni/jni_jsobject.mm:
+        (JavaJSObject::call):
+        (JavaJSObject::eval):
+        * dom/NodeFilter.h:
+        (WebCore::NodeFilter::acceptNode):
+        * dom/NodeIterator.h:
+        (WebCore::NodeIterator::nextNode):
+        (WebCore::NodeIterator::previousNode):
+        * dom/TreeWalker.h:
+        (WebCore::TreeWalker::parentNode):
+        (WebCore::TreeWalker::firstChild):
+        (WebCore::TreeWalker::lastChild):
+        (WebCore::TreeWalker::previousSibling):
+        (WebCore::TreeWalker::nextSibling):
+        (WebCore::TreeWalker::previousNode):
+        (WebCore::TreeWalker::nextNode):
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::windowScriptObjectAvailable):
+        (WebCore::InspectorController::didEvaluateForTestInFrontend):
+        * inspector/JavaScriptCallFrame.cpp:
+        (WebCore::JavaScriptCallFrame::evaluate):
+
+2009-11-30  Eric Carlson  <eric.carlson@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        All HTML5 media element events should be regular events
+        https://bugs.webkit.org/show_bug.cgi?id=30513
+
+        * html/HTMLMediaElement.cpp:
+        (WebCore::HTMLMediaElement::selectMediaResource):
+        (WebCore::HTMLMediaElement::noneSupported):
+        (WebCore::HTMLMediaElement::mediaEngineError):
+        (WebCore::HTMLMediaElement::setNetworkState):
+        (WebCore::HTMLMediaElement::userCancelledLoad):
+            Call scheduleEvent instead of scheduleProgressEvent.
+        (WebCore::HTMLMediaElement::progressEventTimerFired):
+            Call scheduleEvent instead of scheduleProgressEvent. Call renderer->updateFromElement
+            after scheduling a 'progress' event so the controller will update download
+            progress indicator.
+        * html/HTMLMediaElement.h:
+            Remove scheduleProgressEvent prototype.
+
+2009-11-30  Joseph Pecoraro  <joepeck@webkit.org>
+
+        Reviewed by Pavel Feldman.
+
+        Web Inspector: Wrong console output for Regexp escape sequence
+        https://bugs.webkit.org/show_bug.cgi?id=31538
+
+        Updated inspector/console-format.html
+
+        * inspector/front-end/ConsoleView.js:
+        (WebInspector.ConsoleView.createDividerElement): style issues.
+        (WebInspector.ConsoleView.createFilterElement): style issues.
+        (WebInspector.ConsoleView): added _customFormatters table.
+        (WebInspector.ConsoleView.prototype.updateMessageRepeatCount): style isses.
+        (WebInspector.ConsoleView.prototype._incrementErrorWarningCount): style issues.
+        (WebInspector.ConsoleView.prototype._format): simplified delegation to formatter logic.
+        (WebInspector.ConsoleView.prototype._formatobject):
+        (WebInspector.ConsoleView.prototype._formatnode):
+        (WebInspector.ConsoleView.prototype._printArray):
+        (WebInspector.ConsoleMessage.prototype._format): commented and broke down the algorithm into parts.
+        (WebInspector.ConsoleMessage.prototype._formatWithSubstitutionString.append): handle substitution string formatting.
+        (WebInspector.ConsoleMessage.prototype._formatIndividualValue): handling individual value formatting.
+        (WebInspector.ConsoleCommandResult):
+        * inspector/front-end/InjectedScript.js: simplified regex formatting.
+        * inspector/front-end/inspector.js:
+        (WebInspector.linkifyStringAsFragment): converted new RegExp to literal for performance benefits.
+        * inspector/front-end/utilities.js: 
+        (Element.prototype.hasStyleClass): update inaccurate comment.
+        (String.prototype.trimURL): converted new RegExp to literal for performance benefits.
+
+2009-11-30  Erik Arvidsson  <arv@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Clean up V8 bindings for CSSStyleDeclaration and CSSVariableDeclaration
+        https://bugs.webkit.org/show_bug.cgi?id=31895
+
+        No new tests. This is already covered by:
+                fast/dom/CSSStyleDeclaration/css-computed-style-item.html
+                fast/dom/CSSStyleDeclaration/css-style-item.html
+
+        * bindings/v8/V8Collection.h:
+        (WebCore::collectionStringIndexedPropertyGetter):
+        (WebCore::setCollectionStringIndexedGetter):
+        * bindings/v8/V8DOMWrapper.cpp:
+        (WebCore::V8DOMWrapper::getTemplate):
+
+2009-11-30  Steve Block  <steveblock@google.com>
+
+        Reviewed by Eric Seidel.
+
+        Adds include of wtf/StdLibExtras.h for DEFINE_STATIC_LOCAL in V8 ScriptController.
+        https://bugs.webkit.org/show_bug.cgi?id=31932
+
+        Build fix only, no new tests.
+
+        * bindings/v8/ScriptController.cpp: Modified. Adds include of wtf/StdLibExtras.h.
+
+2009-11-30  Steve Block  <steveblock@google.com>
+
+        Reviewed by Eric Seidel.
+
+        Adds PassOwnPtr include to ScriptExecutionContext.h.
+        https://bugs.webkit.org/show_bug.cgi?id=31929
+
+        Build fix only, no new tests.
+
+        * dom/ScriptExecutionContext.h: Modified. Adds PassOwnPtr include.
+
+2009-11-30  Dirk Schulze  <krit@webkit.org>
+
+        Reviewed by Nikolas Zimmermann.
+
+        REGRESSION (r49757): masking-mask-01-b.svg rendered incorrectly
+        [https://bugs.webkit.org/show_bug.cgi?id=31980]
+
+        It turns out, that we did not handle maskUnits="userSpaceOnUse"
+        correctly. We just need to move the context of the maskImage
+        if maskContentUnits="objectBoundingBox". The context gets scaled
+        on this unit combination, so we have to substract the position of
+        the targetRect. On userSpaceOnUse the position just depends on the
+        position of the mask element.
+        I added a test with some senseless and reasonable values for size
+        and postion of the mask and it's contents. I also used every
+        combination of maskUnits and maskContentUnits to be sure, that it
+        is fixed this time.
+
+        Test: svg/custom/mask-with-all-units.svg
+
+        * svg/SVGMaskElement.cpp:
+        (WebCore::SVGMaskElement::drawMaskerContent):
+
+2009-11-30  Steve Block  <steveblock@google.com>
+
+        Reviewed by Eric Seidel.
+
+        Adds ENABLE(INSPECTOR) guards around DOMWindow::inspectorTimelineAgent.
+        https://bugs.webkit.org/show_bug.cgi?id=31928
+
+        Build fix only, no new tests.
+
+        * page/DOMWindow.cpp: Modified. Adds ENABLE(INSPECTOR) guards around DOMWindow::inspectorTimelineAgent.
+
+2009-11-30  Steve Block  <steveblock@google.com>
+
+        Reviewed by Eric Seidel.
+
+        Adds SHARED_WORKERS guards to V8 WorkerContextExecutionProxy.
+        https://bugs.webkit.org/show_bug.cgi?id=31926
+
+        Build fix only, no new tests.
+
+        * bindings/v8/WorkerContextExecutionProxy.cpp:
+        (WebCore::WorkerContextExecutionProxy::initContextIfNeeded):
+        (WebCore::WorkerContextExecutionProxy::convertToV8Object):
+        (WebCore::WorkerContextExecutionProxy::convertEventTargetToV8Object):
+
+2009-11-30  Benjamin Poulain  <benjamin.poulain@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        Chrome::contentsSizeChanged() is called when the content size has not changed
+        https://bugs.webkit.org/show_bug.cgi?id=31978
+
+        Do not trigger contentsSizeChaned() is the new size is the same as the old one.
+
+        * page/FrameView.cpp:
+        (WebCore::FrameView::setContentsSize):
+
+2009-11-30  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Fix some compiler warnings seen on QtWebKit/Mac
+        https://bugs.webkit.org/show_bug.cgi?id=31962
+
+        No new tests as there is no functional change.
+
+        * platform/network/ResourceHandle.h: Make destructor virtual as 
+        after r50772 ResourceHandle has virtual functions.
+
+        * plugins/mac/PluginPackageMac.cpp: 
+        (WebCore::PluginPackage::fetchInfo): Fix typo WTF is a namespace
+        not a label
+
+        * plugins/mac/PluginViewMac.cpp:
+        (WebCore::PluginView::setNPWindowIfNeeded): Add l to the format
+        specifier
+
+2009-11-30  Xan Lopez  <xlopez@igalia.com>
+
+        Reviewed by Gustavo Noronha.
+
+        Add new headers to sources list.
+
+        * GNUmakefile.am:
+
+2009-11-30  Girish Ramakrishnan  <girish@forwardbias.in>
+
+        Reviewed by Holger Freyther.
+
+        [Qt] Mac Plugins : Get context menu to work in QGraphicsView
+        
+        Flash expects the value in record.where to be the global position for
+        displaying the context menu.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=31979
+
+        * plugins/mac/PluginViewMac.cpp:
+        (WebCore::PluginView::handleMouseEvent):
+
+2009-11-30  Steve Block  <steveblock@google.com>
+
+        Reviewed by Eric Seidel.
+
+        Adds PLATFORM(CHROMIUM) guards around memory usage code in V8GCController.
+        https://bugs.webkit.org/show_bug.cgi?id=31925
+
+        This code uses ChromiumBridge and Chromium-specific constant values not
+        appropriate for other platforms such as Android.
+
+        Build fix only, no new tests.
+
+        * bindings/v8/V8GCController.cpp: Modified. Adds PLATFORM(CHROMIUM) around Chromium-specific code.
+
+2009-11-29  Brent Fulgham  <bfulgham@webkit.org>
+
+        Build fix.
+
+        Correct draw signature used in ImageCairoWin.cpp.
+
+        * platform/graphics/win/ImageCairoWin.cpp:
+        (WebCore::BitmapImage::getHBITMAPOfSize):
+        (WebCore::BitmapImage::drawFrameMatchingSourceSize):
+
+2009-11-28  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        postMessage should serialize File objects
+        https://bugs.webkit.org/show_bug.cgi?id=31955
+
+        Update SerializedScriptValue to include support for
+        File objects in the serialized object graph.
+
+        * bindings/js/SerializedScriptValue.cpp:
+        (WebCore::SerializedScriptValueData::SerializedScriptValueData):
+        (WebCore::SerializingTreeWalker::convertIfTerminal):
+        (WebCore::DeserializingTreeWalker::convertIfTerminal):
+        * bindings/js/SerializedScriptValue.h:
+        (WebCore::SerializedScriptValueData::):
+        (WebCore::SerializedScriptValueData::asString):
+
+2009-11-29  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        Optimize the hierarchy rebuilding of compositing layers
+        https://bugs.webkit.org/show_bug.cgi?id=31879
+        
+        When updating the compositing layer hierarchy, instead of removing all
+        child layers and then re-adding them one by one, build a vector of child
+        layers, and set them in one go.
+        
+        * platform/graphics/GraphicsLayer.h:
+        * platform/graphics/GraphicsLayer.cpp:
+        (WebCore::GraphicsLayer::setChildren): New method that takes a Vector of child
+        GraphicsLayers.
+        
+        * platform/graphics/mac/GraphicsLayerCA.h: Override setChildren().
+        * platform/graphics/win/GraphicsLayerCACF.h: Ditto.
+        * platform/graphics/mac/GraphicsLayerCA.mm: 
+        (WebCore::GraphicsLayerCA::setChildren): Implement setChildren() to 
+        set the bit that notes that sublayers changed.
+        * platform/graphics/win/GraphicsLayerCACF.cpp:
+        (WebCore::GraphicsLayerCACF::setChildren): Implement setChildren() to 
+        udpate sublayers, with a note that this is not efficient.
+        
+        * rendering/RenderLayerCompositor.h:
+        * rendering/RenderLayerCompositor.cpp:
+        (WebCore::RenderLayerCompositor::updateCompositingLayers):
+        When updating compositing layers, use the faster updateLayerTreeGeometry() if
+        we know that no layer hierarchy changes are needed, and, at the root, use
+        the vector returned from rebuildCompositingLayerTree() to attach the root
+        layer.
+        (WebCore::RenderLayerCompositor::rebuildCompositingLayerTree): Changed to
+        collect child layers into Vectors of GraphicsLayers, which can be set as
+        layer children in one go.
+        (WebCore::RenderLayerCompositor::updateLayerTreeGeometry): Split out from
+        rebuildCompositingLayerTree() for simplicity, and called when we just need to
+        update layer geometry, without doing any reparenting.
+
+2009-11-29  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Adam Barth.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31971
+
+        Updated comment to reflect latest XSSAuditor bindings.
+
+        No functionality was changed. So, no new tests.
+
+        * page/XSSAuditor.h:
+
+2009-11-29  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31969
+
+        Removes unnecessary #include files.
+
+        No functionality was changed. So, no new tests.
+
+        * css/CSSComputedStyleDeclaration.cpp: Removed include CachedImage.h, and
+        Pair.h
+        * css/CSSCursorImageValue.cpp: Removed include RenderStyle.h
+        * css/CSSFontFaceSrcValue.cpp: Removed include Node.h
+        * css/CSSFontSelector.cpp: Removed include NodeList.h
+        * css/CSSGradientValue.cpp: Removed include GraphicsContext.h, ImageBuffer.h
+        * css/CSSImageValue.cpp: Removed include RenderStyle.h
+        * css/CSSImportRule.cpp: Removed include MediaList.h
+        * css/CSSMutableStyleDeclaration.cpp: Removed include CSSProperty.h
+        * css/CSSRule.cpp: Removed include CSSStyleSheet.h
+        * css/CSSStyleSelector.cpp: Removed include CSSFontFace.h,
+        CSSFontFaceSource.h, and CSSProperty.h
+        * page/EventSource.h: Removed include EventListener.h
+
+2009-11-29  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31965
+
+        Removed #include KeyframeList.h from CSSStyleSelector.h. Instead,
+        forward declared it.
+
+        As a side effect, we need to #include KeyframeList.h in
+        RenderLayerBacking.cpp.
+
+        No functionality was changed. So, no new tests.
+
+        * css/CSSStyleSelector.cpp:
+        * css/CSSStyleSelector.h: Removed #include KeyframeList.h
+        * rendering/RenderLayerBacking.cpp: Added #include KeyframeList.h
+
+2009-11-29  Shu Chang  <Chang.Shu@nokia.com>
+
+        Reviewed by Eric Seidel.
+
+        Continue to search for matching node in the case where multiple nodes
+        have the same id.
+        https://bugs.webkit.org/show_bug.cgi?id=31428
+
+        Test: fast/dom/Element/id-in-node-list-index01.html
+
+        * dom/DynamicNodeList.cpp:
+        (WebCore::DynamicNodeList::itemWithName):
+
+2009-11-29  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31966
+
+        Removed #include RenderStyle.h from file KeyframeAnimation.h. Instead,
+        forward declared it.
+
+        No functionality was changed. So, no new tests.
+
+        * page/animation/KeyframeAnimation.cpp:
+        * page/animation/KeyframeAnimation.h:
+
+2009-11-29  Daniel Bates  <dbates@webkit.org>
+
+        Unreviewed, fix change log entry date.
+
+        For some reason, bugzilla-tool did not update the date in the change
+        log entry for my last commit (r51468). So, this commit fixes the date
+        of that entry.
+
+2009-11-29  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Dan Bernstein.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31964
+
+        Removed #include StringImpl, StyleImage. Instead, forward declared them.
+        Also, we can substitute #include <wtf/PassRefPtr.h> for #include PlatformString.h,
+        since it seems we only really used it to include PassRefPtr.h.
+
+        No functionality was changed. So, no new tests.
+
+        * rendering/style/ContentData.h:
+
+2009-11-29  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        Allow custom memory allocation control for classes of the rendering and storage directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=31906
+
+        Inherits the following classes from Noncopyable because these are instantiated
+        by 'new' and no need to be copyable:
+
+        class/struct name               - instantiated at: WebCore/'location'
+
+        class SQLTransactionClient      - storage/DatabaseThread.cpp:45
+        class SQLTransactionCoordinator - storage/DatabaseThread.cpp:46
+        class OriginUsageRecord         - storage/OriginQuotaManager.cpp:66
+        class DatabaseTracker           - storage/DatabaseTracker.cpp:62
+        class ScrollbarTheme            - (its child class) rendering/RenderScrollbarTheme.cpp:35
+        class RenderSelectionInfoBase   - (its child class) rendering/RenderView.cpp:310
+        class RenderOverflow            - rendering/RenderBox.cpp:2846
+
+        Inherits the following classes from FastAllocBase because these are instantiated by 'new':
+
+        struct FillLayer                - css/CSSStyleSelector.cpp:197
+        struct ShadowData               - rendering/style/ShadowData.cpp:35
+        class CounterContent            - css/CSSStyleSelector.cpp:4111
+
+        * platform/ScrollbarTheme.h:
+        * rendering/RenderOverflow.h:
+        * rendering/RenderSelectionInfo.h:
+        * rendering/style/CounterContent.h:
+        * rendering/style/FillLayer.h:
+        * rendering/style/ShadowData.h:
+        * storage/DatabaseTracker.h:
+        * storage/OriginUsageRecord.h:
+        * storage/SQLTransactionClient.h:
+        * storage/SQLTransactionCoordinator.h:
+
+2009-11-28  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        [Chromium] Sify compose button alerts error
+        https://bugs.webkit.org/show_bug.cgi?id=31394
+
+        Test: http/tests/security/calling-versus-current.html
+
+        We're supposed to use the calling context for security checks.  In JSC
+        land, this is the lexicalGlobalObject.
+
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::canAccessPrivate):
+
+2009-11-27  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Unreviewed Chromium build fix introduced by r51428.
+
+        [Chromium] Ignore line-height CSS property for PushButton
+        https://bugs.webkit.org/show_bug.cgi?id=31712
+
+        * rendering/RenderThemeChromiumSkia.cpp:
+        (WebCore::RenderThemeChromiumSkia::adjustButtonStyle):
+
+2009-11-27  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Unreviewed Chromium test fix by reverting r51413.
+
+        [v8] Do not check the thread when accessing DOMDataStore
+        https://bugs.webkit.org/show_bug.cgi?id=31877
+
+        * bindings/v8/V8DOMMap.cpp:
+        (WebCore::getDOMNodeMap):
+        (WebCore::getDOMObjectMap):
+        (WebCore::getActiveDOMObjectMap):
+        (WebCore::getDOMSVGElementInstanceMap):
+        (WebCore::getDOMSVGObjectWithContextMap):
+
+2009-11-27  Daniel Bates  <dbates@webkit.org>
+
+        Unreviewed, comment fix.
+
+        Corrected misspelling of the word "implemented".
+
+        * inspector/front-end/InjectedScriptAccess.js:
+
+2009-11-27  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Adam Barth.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31940
+
+        Makes the error messages more descriptive when we refuse to load an object/embed or
+        refuse to load from the document base URL.
+
+        * page/XSSAuditor.cpp:
+        (WebCore::XSSAuditor::canLoadObject): Changed console message to be more descriptive.
+        (WebCore::XSSAuditor::canSetBaseElementURL): Ditto.
+
+2009-11-27  Yury Semikhatsky  <yurys@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        This is a WebCore part of the fix that allows to view plugin
+        resources loaded by plugins.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31832
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::willSendRequest):
+        (WebCore::InspectorController::didReceiveResponse):
+        (WebCore::InspectorController::didReceiveContentLength):
+        (WebCore::InspectorController::didFinishLoading):
+        (WebCore::InspectorController::didFailLoading):
+        * inspector/InspectorController.h:
+        * inspector/InspectorResource.cpp:
+        (WebCore::InspectorResource::addLength):
+        * loader/ResourceLoadNotifier.cpp:
+        (WebCore::ResourceLoadNotifier::didFailToLoad):
+        (WebCore::ResourceLoadNotifier::dispatchWillSendRequest):
+        (WebCore::ResourceLoadNotifier::dispatchDidReceiveResponse):
+        (WebCore::ResourceLoadNotifier::dispatchDidReceiveContentLength):
+        (WebCore::ResourceLoadNotifier::dispatchDidFinishLoading):
+
+2009-11-27  Yury Semikhatsky  <yurys@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Instead of generating negative identifiers for cached resources in
+        InspectorController and extending identifier type from 'unsigned long' to 'long
+        long' reuse progress tracker from the inspected page to generate those
+        identifiers. It guarantees that InspectorResources have unique ids since
+        all of them are generated by that progress tracker.
+
+        Added a couple new overloaded methods to Script* objects that accept
+        long and unsigned long arguments. These types of argumens have already
+        been passed as long long.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31921
+
+        * bindings/js/ScriptFunctionCall.cpp:
+        (WebCore::ScriptFunctionCall::appendArgument):
+        * bindings/js/ScriptFunctionCall.h:
+        * bindings/js/ScriptObject.cpp:
+        (WebCore::ScriptObject::set):
+        * bindings/js/ScriptObject.h:
+        * bindings/v8/ScriptFunctionCall.cpp:
+        (WebCore::ScriptFunctionCall::appendArgument):
+        * bindings/v8/ScriptFunctionCall.h:
+        * bindings/v8/ScriptObject.cpp:
+        (WebCore::ScriptObject::set):
+        * bindings/v8/ScriptObject.h:
+        * inspector/InspectorBackend.cpp:
+        (WebCore::InspectorBackend::dispatchOnInjectedScript):
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::InspectorController):
+        (WebCore::InspectorController::getTrackedResource):
+        (WebCore::InspectorController::didLoadResourceFromMemoryCache): Use inspected page's ProgressTracker to generate unique identifiers for cached resources in InspectorController.
+        * inspector/InspectorController.h:
+        * inspector/InspectorDOMAgent.cpp:
+        (WebCore::InspectorDOMAgent::buildObjectForNode):
+        (WebCore::InspectorDOMAgent::buildObjectForEventListener):
+        * inspector/InspectorFrontend.cpp:
+        (WebCore::InspectorFrontend::addResource):
+        (WebCore::InspectorFrontend::updateResource):
+        (WebCore::InspectorFrontend::removeResource):
+        (WebCore::InspectorFrontend::updateFocusedNode):
+        * inspector/InspectorFrontend.h:
+        * inspector/InspectorResource.cpp:
+        (WebCore::InspectorResource::InspectorResource):
+        (WebCore::InspectorResource::createCached):
+        * inspector/InspectorResource.h: Change InspectorResource identifier type from 'long long' to 'unsigned long'.
+        (WebCore::InspectorResource::create):
+        (WebCore::InspectorResource::identifier):
+        * inspector/TimelineRecordFactory.cpp:
+        (WebCore::TimelineRecordFactory::createResourceSendRequestRecord):
+        (WebCore::TimelineRecordFactory::createResourceReceiveResponseRecord):
+        (WebCore::TimelineRecordFactory::createResourceFinishRecord):
+
+2009-11-26  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Reviewed by Dan Bernstein.
+
+        Assertion failure in RenderBlock::positionForPointWithInlineChildren when running fast/inline/relative-positioned-overflow.html
+        https://bugs.webkit.org/show_bug.cgi?id=29966
+
+        When an empty inline element is clicked, the root inline box has
+        no leaf children. Use the renderer of a normal child instead.
+
+        This change resolves Windows port's assertion failure in a layout test.
+        Also, this fixes the behavior when a user drags the mouse from an
+        empty inline element to above texts.
+
+        Test: editing/selection/last-empty-inline.html
+
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::positionForPointWithInlineChildren):
+
+2009-11-26  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        [Chromium] Ignore line-height CSS property specified to push buttons on
+        Windows and Linux.
+        https://bugs.webkit.org/show_bug.cgi?id=31712
+
+        LayoutTests/fast/forms/control-restrict-line-height.html checks that the
+        following controls should ignore line-height CSS property.
+         - <select>
+         - <input type=button>
+         - <input type=search>
+        This change addresses the <input type=button> issue with Chromium/Windows
+        and Chromium/Linux.
+        
+        * rendering/RenderThemeChromiumSkia.cpp: Implement adjustButtonStyle() to ignore line-height.
+        * rendering/RenderThemeChromiumSkia.h: Declare adjustButtonStyle().
+
+2009-11-26  Kinuko Yasuda  <kinuko@chromium.com>
+
+        Reviewed by Eric Seidel.
+
+        Remove the special charset meta tag in the clipboard so that
+        copy-and-paste with interchange breaklines/spaces works correctly
+        within WebKit.
+
+        No new tests.  Layout tests that involve copy-and-paste with
+        interchange breaklines (like editing/pasteboard/paste-line-endings-00?)
+        should pass on Mac/Chromium with this fix.
+
+        * platform/chromium/ClipboardChromium.cpp:
+        * platform/chromium/PasteboardChromium.cpp:
+        (WebCore::Pasteboard::documentFragment):
+
+2009-11-26  İsmail Dönmez  <ismail@namtrac.org>
+
+        Reviewed by Eric Seidel.
+
+        Compile with QT_NO_WHEELEVENT defined.
+
+        * platform/qt/WheelEventQt.cpp:
+        (WebCore::PlatformWheelEvent::applyDelta):
+
+2009-11-26  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Oliver Hunt.
+
+        Move GOwnPtr* from wtf to wtf/gtk
+        https://bugs.webkit.org/show_bug.cgi?id=31793
+
+        No new tests as there is no functional change.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp: Change the
+          path for GOwnPtr.h.
+        * platform/text/TextEncoding.cpp: Ditto.
+        * platform/text/gtk/TextCodecGtk.cpp: Ditto.
+
+2009-11-26  Yury Semikhatsky  <yurys@chromium.org>
+
+        Not reviewed. Build fix: revert r51421.
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::willSendRequest):
+        (WebCore::InspectorController::didReceiveResponse):
+        (WebCore::InspectorController::didReceiveContentLength):
+        (WebCore::InspectorController::didFinishLoading):
+        (WebCore::InspectorController::didFailLoading):
+        * inspector/InspectorController.h:
+        * inspector/InspectorResource.cpp:
+        (WebCore::InspectorResource::addLength):
+        * loader/ResourceLoadNotifier.cpp:
+        (WebCore::ResourceLoadNotifier::didFailToLoad):
+        (WebCore::ResourceLoadNotifier::dispatchWillSendRequest):
+        (WebCore::ResourceLoadNotifier::dispatchDidReceiveResponse):
+        (WebCore::ResourceLoadNotifier::dispatchDidReceiveContentLength):
+        (WebCore::ResourceLoadNotifier::dispatchDidFinishLoading):
+
+2009-11-26  Yury Semikhatsky  <yurys@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        This is a WebCore part of the fix that allows to view plugin
+        resources loaded by plugins.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31832
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::willSendRequest):
+        (WebCore::InspectorController::didReceiveResponse):
+        (WebCore::InspectorController::didReceiveContentLength):
+        (WebCore::InspectorController::didFinishLoading):
+        (WebCore::InspectorController::didFailLoading):
+        * inspector/InspectorController.h: Remove unused DocumentLoader parameters from inspector methods.
+        * inspector/InspectorResource.cpp:
+        (WebCore::InspectorResource::addLength): Update loading end time when new data are received.
+        * loader/ResourceLoadNotifier.cpp:
+        (WebCore::ResourceLoadNotifier::didFailToLoad): Notify InspectorController about the failure.
+        (WebCore::ResourceLoadNotifier::dispatchWillSendRequest):
+        (WebCore::ResourceLoadNotifier::dispatchDidReceiveResponse):
+        (WebCore::ResourceLoadNotifier::dispatchDidReceiveContentLength):
+        (WebCore::ResourceLoadNotifier::dispatchDidFinishLoading):
+
+2009-11-26  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Pavel Feldman.
+
+        https://bugs.webkit.org/show_bug.cgi?id=21554
+
+        Implements support for hovering over <img> src to display the height and width of that image
+        in a tooltip. Displays both the displayable and natural dimensions of the image.
+
+        Test: inspector/elements-img-tooltip.html
+
+        * inspector/front-end/ElementsTreeOutline.js:
+        (WebInspector.ElementsTreeElement.prototype.createTooltipForImageNode): Added.
+        (WebInspector.ElementsTreeElement.prototype._updateTitle.callback):
+        (WebInspector.ElementsTreeElement.prototype._updateTitle):
+        (WebInspector.ElementsTreeElement.prototype._nodeTitleInfo):
+        * inspector/front-end/ObjectProxy.js:
+        (WebInspector.ObjectProxy.getPropertiesAsync): Added.
+        * inspector/front-end/inspector.js:
+        (WebInspector.linkifyURLAsNode): Added tooltipText argument.
+        (WebInspector.linkifyURL): Ditto.
+
+2009-11-26  Kevin Ollivier  <kevino@theolliviers.com>
+
+        wx build fix after drawPattern API change.
+
+        * platform/graphics/wx/ImageWx.cpp:
+        (WebCore::Image::drawPattern):
+
+2009-11-26  Anton Muhin  <antonm@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Use an internal field instead of hidden property to speedup lookup
+        of entered isolated world.
+
+        Plus some inlinings.
+        https://bugs.webkit.org/show_bug.cgi?id=31884
+
+        Covered by layout tests + manual running of some benchmarks as
+        content scripts.
+
+        * bindings/v8/V8DOMWrapper.cpp:
+        * bindings/v8/V8DOMWrapper.h:
+        (WebCore::V8DOMWrapper::setDOMWrapper):
+        * bindings/v8/V8HiddenPropertyName.h:
+        * bindings/v8/V8IsolatedWorld.cpp:
+        (WebCore::V8IsolatedWorld::V8IsolatedWorld):
+        * bindings/v8/V8IsolatedWorld.h:
+        (WebCore::V8IsolatedWorld::getEntered):
+        (WebCore::V8IsolatedWorld::getGlobalObject):
+        * bindings/v8/custom/V8CustomBinding.h:
+
+2009-11-26  Jocelyn Turcotte  <jocelyn.turcotte@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Corrects build break on Windows.
+
+        Rename platform/text/qt/TextBoundaries.cpp to TextBoundariesQt.cpp since
+        platform/text/TextBoundaries.cpp was compiled instead when compiling with nmake.
+
+        * WebCore.pro:
+        * platform/text/qt/TextBoundariesQt.cpp: Renamed from WebCore/platform/text/qt/TextBoundaries.cpp.
+        (WebCore::findNextWordFromIndex):
+        (WebCore::findWordBoundary):
+
+2009-11-26  Anton Muhin  <antonm@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Do not check if the thread is main or not when accessing DOMDataStore as currently in Chromium WebKit is used in main thread only.
+        https://bugs.webkit.org/show_bug.cgi?id=31877
+
+        Covered by layout tests and buildbots.
+
+        * bindings/v8/V8DOMMap.cpp:
+        (WebCore::getDOMNodeMap):
+        (WebCore::getDOMObjectMap):
+        (WebCore::getActiveDOMObjectMap):
+        (WebCore::getDOMSVGElementInstanceMap):
+        (WebCore::getDOMSVGObjectWithContextMap):
+
+2009-11-26  Girish Ramakrishnan  <girish@forwardbias.in>
+
+        Reviewed by Holger Freyther.
+
+        [Qt] Mac Plugins : Pass mouse position relative to the fake window
+        
+        When using off-screen rendering, we need to pass mouse events relative
+        to the fake window instead of the global position.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=31794
+
+        * plugins/mac/PluginViewMac.cpp:
+        (WebCore::PluginView::platformStart):
+        (WebCore::PluginView::handleMouseEvent):
+
+2009-11-24  Holger Hans Peter Freyther  <zecke@selfish.org>
+
+        Reviewed by Eric Seidel.
+
+        [Qt] Use QNetworkReply::rawHeaderPairs
+        https://bugs.webkit.org/show_bug.cgi?id=31826
+
+        The QNetworkReply is internally storing the HTTP headers
+        as a list of pairs. Currently we have to ask the QNetworkReply
+        to put all header names into a QStringList. Afterwards we will
+        iterate over this QStringList and ask the QNetworkReply to
+        give us the value for this header name. The current Qt implementation
+        is doing a linear to find the header value.
+
+        Use a new API to directly access the list of pairs and push
+        this into WebCore. This avoids doing some allocations and doing
+        linear searches from within a loop.
+
+        * platform/network/qt/QNetworkReplyHandler.cpp:
+        (WebCore::QNetworkReplyHandler::sendResponseIfNeeded):
+
+2009-11-21  Holger Hans Peter Freyther  <zecke@selfish.org>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Add Qt specific information of RenderPart
+        https://bugs.webkit.org/show_bug.cgi?id=31203
+
+        The WebCore::Widget of the RenderPart (RenderWidget) might be
+        backed with a platform widget. Print both the WebCore::Widget
+        and platform widget state. In the above bug we had a problem
+        that the WebCore::Widget was invisible but the QWidget was
+        visible.
+
+        * rendering/RenderTreeAsText.cpp:
+        (WebCore::operator<<): Add special case for RenderPart
+
+2009-11-17  Holger Hans Peter Freyther  <zecke@selfish.org>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Call Widget::setSelfVisible from hide/show
+        https://bugs.webkit.org/show_bug.cgi?id=31203
+
+        Call Widget::setSelfVisible from Widget::show and
+        Widget::hide and use isParentVisible to decide
+        if the widget should be shown. This way client
+        code can rely on isVisible.
+
+        Change PluginViewQt::show, PluginViewQt::hide to
+        call the base class as it is doing the right thing
+        now. Add an assert verify that platfomWidget and
+        platformPluginWidget are the same.
+
+        * manual-tests/qt/qtplugin.html: Modify manual test
+        * platform/qt/WidgetQt.cpp:
+        (WebCore::Widget::show):
+        (WebCore::Widget::hide):
+        * plugins/qt/PluginViewQt.cpp:
+        (WebCore::PluginView::show):
+        (WebCore::PluginView::hide):
+
+2009-11-24  Holger Hans Peter Freyther  <zecke@selfish.org>
+
+        Reviewed by Alexey Proskuryakov.
+
+        Fix compilation of REQUEST_DEBUG debug code
+        https://bugs.webkit.org/show_bug.cgi?id=31850
+
+        In r47907 the single parameter KURL constructor to parse
+        from a WebCore::String was replaced with a two parameter
+        constructor. I think in this debug case parsing the urls
+        again is no problem and I have changed the code to use the
+        two parameter version.
+
+        * loader/loader.cpp:
+        (WebCore::Loader::Host::didFinishLoading):
+
+2009-11-26  Søren Gjesse  <sgjesse@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        [V8] Avoid using JavaScript objects as context data
+        https://bugs.webkit.org/show_bug.cgi?id=31873
+
+        Change the context "data" from a JavaScript object holding the two properties type and value to
+        a string holding type and value separated by a comma.
+
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::setInjectedScriptContextDebugId):
+        (WebCore::V8Proxy::setContextDebugId):
+        (WebCore::V8Proxy::contextDebugId):
+
+2009-11-25  Dimitri Glazkov  <dglazkov@chromium.org>
+
+        Reviewed by David Levin.
+
+        [Chromium] Implement canSetValueAttribute in the API, the clean-up part.
+        https://bugs.webkit.org/show_bug.cgi?id=31894
+
+        * accessibility/chromium/AccessibilityObjectWrapper.h: Added RefCounted decl.
+        (WebCore::AccessibilityObjectWrapper::AccessibilityObjectWrapper): Removed mis-refcountingness.
+
+2009-11-25  Kenneth Russell  <kbr@google.com>
+
+        Reviewed by Oliver Hunt.
+
+        Off-by-one error in index validation for drawElements and drawArrays
+        https://bugs.webkit.org/show_bug.cgi?id=31891
+
+        Fixed computation of number of elements for bound array objects.
+
+        Test: fast/canvas/webgl/index-validation.html
+
+        * html/canvas/WebGLRenderingContext.cpp:
+        (WebCore::WebGLRenderingContext::vertexAttribPointer):
+
+2009-11-25  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by David Levin.
+
+        Update SharedScript to use eventNames() instead of EventNames()
+        https://bugs.webkit.org/show_bug.cgi?id=31890
+
+        * SharedScript/WebKitSharedScript.cpp:
+        (WebCore::LoadEventTask::performTask):
+
+2009-11-25  Eric Carlson  <eric.carlson@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        <rdar://problem/7409331> Windows: Support closed caption in <video> element
+
+        Enable closed captions in QuickTime/Windows media engine.
+
+        * platform/graphics/win/MediaPlayerPrivateQuickTimeWin.cpp:
+        (WebCore::MediaPlayerPrivate::hasClosedCaptions):
+        (WebCore::MediaPlayerPrivate::setClosedCaptionsVisible):
+            New, all through to m_qtMovie.
+
+        * platform/graphics/win/MediaPlayerPrivateQuickTimeWin.h:
+            Make all but the destructor private since MediaPlayer call through the media
+            engine interface.
+
+        * platform/graphics/win/QTMovieWin.cpp:
+        (QTMovieWin::disableUnsupportedTracks):
+            Use handy new constants for QuickTime track types.
+        (QTMovieWin::hasClosedCaptions):
+        (QTMovieWin::setClosedCaptionsVisible):
+            New, closed caption support.
+        * platform/graphics/win/QTMovieWin.h:
+
+        * rendering/RenderMediaControls.cpp:
+        (WebCore::RenderMediaControls::paintMediaControlsPart):
+            Deal with closed caption buttons.
+
+        * rendering/RenderThemeWin.cpp:
+        (WebCore::RenderThemeWin::shouldRenderMediaControlPart):
+            New, don't ask the media engine if it has closed captions unless the Safari theme will
+            be able to render the button.
+        (WebCore::RenderThemeWin::paintMediaToggleClosedCaptionsButton):
+            New.
+        * rendering/RenderThemeWin.h:
+
+2009-11-25  Drew Wilson  <atwilson@chromium.org>
+
+        Reviewed by David Levin.
+
+        MessagePorts always look remotely entangled even when closed.
+        https://bugs.webkit.org/show_bug.cgi?id=31698
+
+        Tests: Existing tests suffice, Chromium soak test passes now.
+
+        * bindings/v8/custom/V8CustomBinding.h:
+        Removed kMessagePortEntangledPortIndex which is no longer used.
+        * bindings/v8/V8GCController.cpp:
+        (WebCore::GCPrologueVisitor::visitDOMWrapper):
+        Simplified GC code to reflect the Chromium MessagePort implementation
+        (locallyEntangledPort() always returns false).
+        (WebCore::GCEpilogueVisitor::visitDOMWrapper):
+        Cleaned up epilogue code to handle the case where the port gets closed
+        in mid-GC (due to the parent context being freed).
+        * dom/MessagePort.cpp:
+        (WebCore::MessagePort::MessagePort):
+        (WebCore::MessagePort::close):
+        Now sets the closed flag.
+        (WebCore::MessagePort::disentanglePorts):
+        Updated to use new isCloned() API instead of relying on isEntangled(), which was incorrect.
+        * dom/MessagePort.h:
+        Added a m_closed flag and updated isEntangled() to check it.
+        (WebCore::MessagePort::isEntangled):
+        Now returns false if the port has been closed.
+        (WebCore::MessagePort::isCloned):
+        Added new API to differentiate between cloned and closed ports (closed ports can still be passed to postMessage).
+
+2009-11-25  Jocelyn Turcotte  <jocelyn.turcotte@nokia.com>
+
+        Reviewed by Simon Hausmann.
+
+        [Qt] Fix crash of QtWebKit on any page with Flash when compiled with MinGW.
+
+        Fix inline assembly, don't dereference the function pointer twice.
+
+        * plugins/win/PluginViewWin.cpp:
+        (WebCore::PluginView::hookedBeginPaint):
+        (WebCore::PluginView::hookedEndPaint):
+
+2009-11-22  Jakub Wieczorek  <faw217@gmail.com>
+
+        Reviewed by Adam Barth.
+
+        [Qt] Remove the Referer header when redirecting to a non-secure site
+        https://bugs.webkit.org/show_bug.cgi?id=31785
+
+        This makes Qt pass two tests introduced in r50226.
+
+        * platform/network/qt/QNetworkReplyHandler.cpp:
+        (WebCore::QNetworkReplyHandler::sendResponseIfNeeded):
+
+2009-11-25  Andrei Popescu  <andreip@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        The select elements do not reflect the actual choice the user makes.
+        https://bugs.webkit.org/show_bug.cgi?id=31831
+
+        Handle the drawing of the listboxes in Android code.
+
+        No new features, just fixing an Android problem. Existing layout tests are sufficient.
+
+        * platform/android/RenderThemeAndroid.cpp:
+        (WebCore::theme):
+        (WebCore::RenderThemeAndroid::platformActiveSelectionBackgroundColor):
+        (WebCore::RenderThemeAndroid::platformActiveListBoxSelectionBackgroundColor):
+        (WebCore::RenderThemeAndroid::platformInactiveListBoxSelectionBackgroundColor):
+        (WebCore::RenderThemeAndroid::platformActiveListBoxSelectionForegroundColor):
+        (WebCore::RenderThemeAndroid::platformInactiveListBoxSelectionForegroundColor):
+        (WebCore::RenderThemeAndroid::adjustButtonStyle):
+        (WebCore::RenderThemeAndroid::paintTextArea):
+        (WebCore::RenderThemeAndroid::adjustListboxStyle):
+        * platform/android/RenderThemeAndroid.h:
+
+2009-11-25  Alexander Pavlov  <apavlov@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Load InspectorResource mime type from CachedResource for 304 responses
+
+        For network libraries that do not merge cache data into 304 ResourceResponses,
+        the mime type for cached resources is unknown.
+        https://bugs.webkit.org/show_bug.cgi?id=31868
+
+        * inspector/InspectorResource.cpp:
+        (WebCore::InspectorResource::updateResponse):
+        (WebCore::InspectorResource::updateScriptObject):
+        (WebCore::InspectorResource::type):
+
+2009-11-25  Andrei Popescu  <andreip@google.com>
+
+        Reviewed by Eric Seidel.
+
+        Android is missing implementation of SSL Key generator functions.
+        https://bugs.webkit.org/show_bug.cgi?id=31825
+
+        This change adds the PlatformBridge class to platform/android.
+        PlarformBridge is used to access the embedding layer for things
+        such as key generator, cookies, plugins, etc.
+
+        No new tests required, this is platform code.
+
+        * platform/android/PlatformBridge.h: Added.
+        * platform/android/SSLKeyGeneratorAndroid.cpp: Added.
+        (WebCore::getSupportedKeySizes):
+        (WebCore::signedPublicKeyAndChallengeString):
+
+2009-11-25  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Eric Seidel.
+
+        [GTK] use gst_init_check() instead of gst_init()
+        https://bugs.webkit.org/show_bug.cgi?id=31864
+
+        Use gst_init_check() instead of gst_init() to prevent eventual
+        unexpected exit of the application.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::do_gst_init):
+        (WebCore::MediaPlayerPrivate::isAvailable):
+
+2009-11-25  Gustavo Noronha Silva  <gustavo.noronha@collabora.co.uk>
+
+        Reviewed by Xan Lopez.
+
+        Some tests are crashing from time to time
+        https://bugs.webkit.org/show_bug.cgi?id=31866
+
+        Make sure we do not notify the client of a finished load, if the
+        load has been cancelled, or the client is gone.
+
+        * platform/network/soup/ResourceHandleSoup.cpp:
+        (WebCore::):
+
+2009-11-24  Ben Murdoch  <benm@google.com>
+
+        Reviewed by Eric Seidel.
+
+        [Android] Upstream Android changes to WebCore/bridge/jni
+        https://bugs.webkit.org/show_bug.cgi?id=31824
+
+        No new tests required as no new functionality.
+
+        * bridge/jni/jni_class.cpp:
+        (JavaClass::JavaClass): Add calls to delete allocated references, to avoid potential leaks.
+        * bridge/jni/jni_instance.cpp: Add an Android include path.
+        * bridge/jni/jni_instance.h: Add getter/setter for JObjectWrapper::_instance and make the JavaInstance ctor and member variables protected. Both needed for the Android port, see bug for discussion.
+        (JSC::Bindings::JObjectWrapper::instance): Added.
+        (JSC::Bindings::JObjectWrapper::setInstance): Added.
+        * bridge/jni/jni_runtime.cpp:
+        (JavaMethod::JavaMethod): Delete an allocated reference to avoid a potential leak.
+        * bridge/jni/jni_utility.h:
+        (JSC::Bindings::callJNIMethodV): Delete an allocated reference to avoid a potential leak.
+
+2009-11-24  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        Allow custom memory allocation control for classes of the plugins and rendering directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=31827
+
+        Inherits the following classes from Noncopyable because these are instantiated
+        by 'new' and no need to be copyable:
+
+        class/struct name               - instantiated at: WebCore/'location'
+
+        class PluginRequest             - plugins/PluginView.cpp:521
+        class PluginMainThreadScheduler - plugins/PluginMainThreadScheduler.cpp:34
+        class PluginDatabase            - plugins/PluginDatabase.cpp:50
+        struct MimeClassInfo            - plugins/PluginInfoStore.cpp:50
+        struct PluginInfo               - plugins/PluginInfoStore.cpp:40
+        class RenderArena               - dom/Document.cpp:1401
+        class RenderImageScaleData      - rendering/RenderImage.cpp:149
+        class TableLayout               - (its child class) rendering/RenderTable.cpp:82
+        struct ColumnInfo               - rendering/RenderBlock.cpp:3590
+        struct FloatingObject           - rendering/RenderBlock.cpp:2300
+        struct MaxMargin                - rendering/RenderBlock.cpp:4794
+        class RenderMarquee             - rendering/RenderLayer.cpp:3277
+
+        * plugins/PluginData.h:
+        * plugins/PluginDatabase.h:
+        * plugins/PluginMainThreadScheduler.h:
+        * plugins/PluginView.h:
+        * rendering/RenderArena.h:
+        * rendering/RenderBlock.cpp:
+        * rendering/RenderBlock.h:
+        * rendering/RenderImage.cpp:
+        * rendering/RenderMarquee.h:
+        * rendering/TableLayout.h:
+
+2009-11-24  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by David Levin.
+
+        Initial implementation of WebKitSharedScript and SharedScriptContext
+        https://bugs.webkit.org/show_bug.cgi?id=31569
+
+        No new tests since there are no bindings yet (soon to come).
+
+        * DerivedSources.make: Add WebKitSharedScript and SharedScriptContext to a list of idl files.
+        * WebCore.xcodeproj/project.pbxproj:
+        * dom/Document.cpp:
+        (WebCore::Document::detach): Notify WebKitSharedScriptRepository that document is detaching.
+        * dom/EventTarget.cpp: Add new casting methods, since the new types are EventTargets.
+        (WebCore::EventTarget::toWebKitSharedScript):
+        (WebCore::EventTarget::toSharedScriptContext):
+        * dom/EventTarget.h: Ditto
+        * dom/ScriptExecutionContext.h:
+        (WebCore::ScriptExecutionContext::isSharedScriptContext): New virtual method, since there is a new type of context.
+
+        * SharedScript/SharedScriptContext.cpp: Added. Similar to WorkerContext, but w/o threading.
+        (WebCore::SharedScriptContext::SharedScriptContext):
+        (WebCore::SharedScriptContext::~SharedScriptContext):
+        (WebCore::SharedScriptContext::clearScript):
+        (WebCore::SharedScriptContext::virtualURL):
+        (WebCore::SharedScriptContext::virtualCompleteURL):
+        (WebCore::SharedScriptContext::reportException):
+        (WebCore::SharedScriptContext::addMessage):
+        (WebCore::SharedScriptContext::resourceRetrievedByXMLHttpRequest):
+        (WebCore::SharedScriptContext::scriptImported):
+        (WebCore::SharedScriptContext::matches):
+        (WebCore::SharedScriptContext::addToDocumentsList):
+        (WebCore::SharedScriptContext::destructionTimerFired):
+        (WebCore::SharedScriptContext::removeFromDocumentList):
+        (WebCore::SharedScriptContext::load):
+        (WebCore::SharedScriptContext::postTask):
+        (WebCore::SharedScriptContext::eventTargetData):
+        (WebCore::SharedScriptContext::ensureEventTargetData):
+        (WebCore::SharedScriptContext::scriptExecutionContext):
+        * SharedScript/SharedScriptContext.h: Added.
+        (WebCore::SharedScriptContext::create):
+        (WebCore::SharedScriptContext::isSharedScriptContext):
+        (WebCore::SharedScriptContext::userAgent):
+        (WebCore::SharedScriptContext::toSharedScriptContext):
+        (WebCore::SharedScriptContext::self):
+        (WebCore::SharedScriptContext::script):
+        (WebCore::SharedScriptContext::loaded):
+        (WebCore::SharedScriptContext::name):
+        (WebCore::SharedScriptContext::refEventTarget):
+        (WebCore::SharedScriptContext::derefEventTarget):
+        (WebCore::SharedScriptContext::refScriptExecutionContext):
+        (WebCore::SharedScriptContext::derefScriptExecutionContext):
+        * SharedScript/SharedScriptContext.idl: Added.
+
+        * SharedScript/SharedScriptController.h: 
+        Added. Empty implementation of a ScriptController, will come later as part of bindings. Needed to compile.
+
+        * SharedScript/WebKitSharedScript.cpp: Added. EventTarget-based DOM object.
+        (WebCore::WebKitSharedScript::WebKitSharedScript):
+        (WebCore::WebKitSharedScript::~WebKitSharedScript):
+        (WebCore::WebKitSharedScript::setContext):
+        (WebCore::LoadEventTask::create): Fires asynchronous 'load' event when underlying SharedScriptContext is initialized.
+        (WebCore::LoadEventTask::performTask):
+        (WebCore::LoadEventTask::LoadEventTask):
+        (WebCore::WebKitSharedScript::scheduleLoadEvent):
+        * SharedScript/WebKitSharedScript.h: Added.
+        (WebCore::WebKitSharedScript::create):
+        (WebCore::WebKitSharedScript::scriptExecutionContext):
+        (WebCore::WebKitSharedScript::toWebKitSharedScript):
+        (WebCore::WebKitSharedScript::context):
+        (WebCore::WebKitSharedScript::refEventTarget):
+        (WebCore::WebKitSharedScript::derefEventTarget):
+        (WebCore::WebKitSharedScript::eventTargetData):
+        (WebCore::WebKitSharedScript::ensureEventTargetData):
+        * SharedScript/WebKitSharedScript.idl: Added.
+
+        * SharedScript/WebKitSharedScriptRepository.cpp: Added. Implements a list of running SharedScriptContexts.
+        (WebCore::ScriptLoader::ScriptLoader): The helper class to load an initial script of SharedScriptContext.
+        (WebCore::ScriptLoader::load):
+        (WebCore::ScriptLoader::notifyFinished):
+        (WebCore::WebKitSharedScriptRepository::instance): Repository has a static global instance.
+        (WebCore::WebKitSharedScriptRepository::connect):
+        (WebCore::WebKitSharedScriptRepository::documentDetached): Called from Document::detach().
+        (WebCore::WebKitSharedScriptRepository::removeSharedScriptContext): Called from ~SharedScriptContext().
+        (WebCore::WebKitSharedScriptRepository::connectToSharedScript):
+        (WebCore::WebKitSharedScriptRepository::getSharedScriptContext):
+        * SharedScript/WebKitSharedScriptRepository.h: Added.
+        (WebCore::WebKitSharedScriptRepository::WebKitSharedScriptRepository):
+
+2009-11-24  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Add ENABLE_SHARED_SCRIPT feature define and flag for build-webkit
+        https://bugs.webkit.org/show_bug.cgi?id=31444
+
+        * Configurations/FeatureDefines.xcconfig:
+        * GNUmakefile.am:
+        * WebCore.pro:
+
+2009-11-24  Chris Marrin  <cmarrin@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        Implement accelerated compositing
+        https://bugs.webkit.org/show_bug.cgi?id=27314
+        
+        This part of the checkin adds the Windows specific GraphicsLayer support files.
+        It provides the interface between GraphicsLayer and CACF. It also deals with
+        the compositing loop, and provides the plumbing to pass the root layer up to
+        WebView.
+
+        * WebCore.vcproj/WebCore.vcproj:
+        * WebCore.vcproj/WebCoreCommon.vsprops:
+        * page/FrameView.cpp:
+        (WebCore::FrameView::syncCompositingStateRecursive):
+        * platform/graphics/GraphicsLayer.cpp:
+        (WebCore::GraphicsLayer::GraphicsLayer):
+        * platform/graphics/GraphicsLayer.h:
+        * platform/graphics/win/GraphicsLayerCACF.cpp: Added.
+        * platform/graphics/win/GraphicsLayerCACF.h: Added.
+        * platform/graphics/win/WKCACFContextFlusher.cpp: Added.
+        * platform/graphics/win/WKCACFContextFlusher.h: Added.
+        * platform/graphics/win/WKCACFContextFlusherWin.cpp: Added.
+        * platform/graphics/win/WKCACFLayer.cpp: Added.
+        * platform/graphics/win/WKCACFLayer.h: Added.
+        * platform/graphics/win/WKCACFLayerWindow.cpp: Added.
+        * platform/graphics/win/WKCACFLayerWindow.h: Added.
+
+2009-11-24  Chris Marrin  <cmarrin@apple.com>
+
+        Reviewed by Eric Seidel.
+
+        Do error checking of parameter to createShader
+        https://bugs.webkit.org/show_bug.cgi?id=31808
+
+        Test: fast/canvas/webgl/invalidPassedParams.html
+
+        * html/canvas/WebGLRenderingContext.cpp:
+        (WebCore::WebGLRenderingContext::createShader):
+        * html/canvas/WebGLRenderingContext.h:
+        * html/canvas/WebGLRenderingContext.idl:
+
+2009-11-24  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        [Chromium] Ignore line-height CSS property specified to a search field on
+        Windows and Linux.
+        https://bugs.webkit.org/show_bug.cgi?id=31820
+
+        LayoutTests/fast/forms/control-restrict-line-height.html checks that the
+        following controls should ignore line-height CSS property.
+         - <select>
+         - <input type=button>
+         - <input type=search>
+        This change addresses the <input type=search> issue with Chromium/Windows
+        and Chromium/Linux.
+
+        * rendering/RenderThemeChromiumSkia.cpp:
+        (WebCore::RenderThemeChromiumSkia::adjustSearchFieldStyle): Implement this to ignore line-height.
+        * rendering/RenderThemeChromiumSkia.h: Declare adjustSearchFieldStyle().
+
+2009-11-24  Simon Fraser  <simon.fraser@apple.com>
+
+        No review.
+
+        Stylistic fix: indent the member var initialisation.
+
+        * platform/graphics/mac/GraphicsLayerCA.mm:
+        (WebCore::GraphicsLayerCA::GraphicsLayerCA):
+
+2009-11-24  Gavin Barraclough  <barraclough@apple.com>
+
+        Reviewed by Geoff Garen.
+
+        Bug 31848 - Remove uses of mainThreadCurrentWorld, and of currentWorld using a globalData.
+
+        These methods get the world from the global data rather than from an execstate.
+        If the current world is always read from an exec state then it can be read
+        from the global object, and world entry can become automagical, rather than
+        being explicitly set by an EnterDOMWrapperWorld.
+
+        * bindings/js/JSCSSRuleCustom.cpp:
+        (WebCore::toJS):
+        * bindings/js/JSCSSValueCustom.cpp:
+        (WebCore::toJS):
+        * bindings/js/JSDOMBinding.cpp:
+        (WebCore::currentWorld):
+        (WebCore::DOMObjectWrapperMapFor):
+        (WebCore::hasCachedDOMObjectWrapper):
+        (WebCore::getCachedDOMObjectWrapper):
+        (WebCore::cacheDOMObjectWrapper):
+        (WebCore::hasCachedDOMNodeWrapper):
+        (WebCore::getCachedDOMNodeWrapper):
+        (WebCore::cacheDOMNodeWrapper):
+        * bindings/js/JSDOMBinding.h:
+        (WebCore::createDOMObjectWrapper):
+        (WebCore::getDOMObjectWrapper):
+        (WebCore::createDOMNodeWrapper):
+        (WebCore::getDOMNodeWrapper):
+        * bindings/js/JSDOMWindowCustom.cpp:
+        (WebCore::JSDOMWindow::history):
+        (WebCore::JSDOMWindow::location):
+        * bindings/js/JSDocumentCustom.cpp:
+        (WebCore::JSDocument::location):
+        (WebCore::toJS):
+        * bindings/js/JSElementCustom.cpp:
+        (WebCore::toJSNewlyCreated):
+        * bindings/js/JSEventCustom.cpp:
+        (WebCore::toJS):
+        * bindings/js/JSHTMLCollectionCustom.cpp:
+        (WebCore::toJS):
+        * bindings/js/JSImageDataCustom.cpp:
+        (WebCore::toJS):
+        * bindings/js/JSNodeCustom.cpp:
+        (WebCore::JSNode::markChildren):
+        (WebCore::createWrapper):
+        (WebCore::toJS):
+        * bindings/js/JSSVGPathSegCustom.cpp:
+        (WebCore::toJS):
+        * bindings/js/JSStyleSheetCustom.cpp:
+        (WebCore::toJS):
+        * xml/XMLHttpRequest.cpp:
+        (WebCore::XMLHttpRequest::dropProtection):
+
+2009-11-24  Alexey Proskuryakov  <ap@apple.com>
+
+        Windows build fix.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp: Also, don't include the wrong one!
+
+2009-11-24  Alexey Proskuryakov  <ap@apple.com>
+
+        Windows build fix.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp: Include the proper WKSI header.
+
+2009-11-24  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        SVGUseElement::toClipPath can crash
+        <rdar://problem/7385270>
+
+        Null-test m_shadowTreeRootElement again, because the call to buildPendingResource() may not
+        actually initialize it.
+
+        * svg/SVGUseElement.cpp:
+        (WebCore::SVGUseElement::toClipPath):
+
+2009-11-24  Simon Fraser  <simon.fraser@apple.com>
+
+        Windows build fix.
+
+        * page/win/FrameCGWin.cpp:
+        (WebCore::imageFromRect):
+        (WebCore::imageFromSelection):
+
+2009-11-24  Eric Carlson  <eric.carlson@apple.com>
+
+        Not reviewed. Revert r51351 until a new WebKitSupportLibrary is available.
+
+        * platform/graphics/win/MediaPlayerPrivateQuickTimeWin.cpp:
+        * platform/graphics/win/MediaPlayerPrivateQuickTimeWin.h:
+        * platform/graphics/win/QTMovieWin.cpp:
+        * platform/graphics/win/QTMovieWin.h:
+        * rendering/RenderMediaControls.cpp:
+        * rendering/RenderThemeWin.cpp:
+        * rendering/RenderThemeWin.h:
+
+2009-11-24  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Brady Eidson.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31844
+        SocketStreamHandleCFNet should support CONNECT proxy credentials
+
+        * WebCore.vcproj/WebCore.vcproj:
+        * WebCore.xcodeproj/project.pbxproj:
+        * platform/network/CredentialStorage.h:
+        * platform/network/mac/CredentialStorageMac.mm: Added.
+        (WebCore::CredentialStorage::getFromPersistentStorage):
+        * platform/network/cf/CredentialStorageCFNet.cpp: Added.
+        (WebCore::CredentialStorage::getFromPersistentStorage):
+        Add support for fetching credentials from persistent storage (CFNet version is currently
+        a stub).
+
+        * bindings/js/JSWebSocketCustom.cpp: Removed an unneeded include.
+
+        * platform/network/cf/SocketStreamHandle.h:
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::SocketStreamHandle):
+        (WebCore::SocketStreamHandle::createStreams):
+        (WebCore::getStoredCONNECTProxyCredentials):
+        (WebCore::authenticationSchemeFromAuthenticationMethod):
+        (WebCore::SocketStreamHandle::addCONNECTCredentials):
+        (WebCore::SocketStreamHandle::readStreamCallback):
+        Check if connection attempt was resulted in 407, and try stored credentials if it did.
+
+        * platform/mac/WebCoreSystemInterface.h:
+        * platform/mac/WebCoreSystemInterface.mm:
+        * WebCore.base.exp:
+        Updated WKSI.
+
+2009-11-24  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        Find highlight is drawn incorrectly on pages with compositing layers
+        <rdar://problem/7413925>
+        
+        Part 2: Add a new bit to the PaintBehavior flags, PaintBehaviorFlattenCompositingLayers,
+        and pass that down when painting into an image.
+        
+        When set, it forces painting of compositing layers to go down a software paint path
+        when all layers are painted, irrespective of compositing status, and where
+        3d transforms are flattened to 2d. When doing this, we also need to use temporary
+        clip rects for layers which are normally composited.
+        
+        * page/FrameView.h:
+        (WebCore::FrameView::paintBehavior):
+        * page/mac/FrameMac.mm:
+        (WebCore::Frame::imageFromRect):
+        * rendering/RenderLayer.cpp:
+        (WebCore::RenderLayer::renderableTransform):
+        (WebCore::expandClipRectForDescendantsAndReflection):
+        (WebCore::transparencyClipBox):
+        (WebCore::RenderLayer::beginTransparencyLayers):
+        (WebCore::RenderLayer::paintLayer):
+        * rendering/RenderLayer.h:
+        (WebCore::RenderLayer::paintsWithTransparency):
+        (WebCore::RenderLayer::paintsWithTransform):
+        * rendering/RenderLayerCompositor.cpp:
+        (WebCore::RenderLayerCompositor::calculateCompositedBounds):
+        * rendering/RenderObject.h:
+
+2009-11-24  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        Find highlight is drawn incorrectly on pages with compositing layers
+        <rdar://problem/7413925>
+        
+        Part 1: Rename PaintRestriction to PaintBehavior, and make it a bitmask, in
+        preparation for adding a new flag related to painting into an image.
+        
+        PaintBehaviorSelectionOnly and PaintBehaviorForceBlackText are now separate flags.
+
+        * page/FrameView.cpp:
+        (WebCore::FrameView::reset):
+        (WebCore::FrameView::paintContents):
+        (WebCore::FrameView::setPaintBehavior):
+        * page/FrameView.h:
+        * page/mac/FrameMac.mm:
+        (WebCore::Frame::selectionImage):
+        * rendering/RenderLayer.cpp:
+        (WebCore::RenderLayer::paint):
+        (WebCore::RenderLayer::paintLayer):
+        * rendering/RenderLayer.h:
+        * rendering/RenderLayerBacking.cpp:
+        (WebCore::RenderLayerBacking::paintIntoLayer):
+        (WebCore::RenderLayerBacking::paintContents):
+        * rendering/RenderLayerBacking.h:
+        * rendering/RenderObject.h:
+        * rendering/RenderReplica.cpp:
+        (WebCore::RenderReplica::paint):
+
+2009-11-24  Eric Carlson  <eric.carlson@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        <rdar://problem/7409331> Windows: Support closed caption in <video> element
+
+        Enable closed captions in QuickTime/Windows media engine.
+
+        * platform/graphics/win/MediaPlayerPrivateQuickTimeWin.cpp:
+        (WebCore::MediaPlayerPrivate::hasClosedCaptions):
+        (WebCore::MediaPlayerPrivate::setClosedCaptionsVisible):
+        * platform/graphics/win/MediaPlayerPrivateQuickTimeWin.h:
+        * platform/graphics/win/QTMovieWin.cpp:
+        (QTMovieWin::hasClosedCaptions):
+        (QTMovieWin::setClosedCaptionsVisible):
+        * platform/graphics/win/QTMovieWin.h:
+        * rendering/RenderMediaControls.cpp:
+        (WebCore::RenderMediaControls::paintMediaControlsPart):
+        * rendering/RenderThemeWin.cpp:
+        (WebCore::RenderThemeWin::paintMediaToggleClosedCaptionsButton):
+        * rendering/RenderThemeWin.h:
+
+2009-11-24  Darin Fisher  <darin@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        [Chromium] Renderer hang when using www.expedia.com
+        https://bugs.webkit.org/show_bug.cgi?id=31822
+
+        Test: http/tests/cache/subresource-failover-to-network.html
+
+        * loader/FrameLoader.cpp:
+        (WebCore::FrameLoader::loadResourceSynchronously): Use the originalRequest
+        when inheriting cache policy.  This matches SubresourceLoader::create.
+
+2009-11-23  Kenneth Russell  <kbr@google.com>
+
+        Reviewed by Oliver Hunt.
+
+        Change get... calls to latest spec
+        https://bugs.webkit.org/show_bug.cgi?id=30091
+
+        Removed old versions of get calls on WebGLRenderingContext and
+        added new ones per spec returning "any". New code simplifies
+        GraphicsContext3D and fixes previously unimplemented routines.
+        Added custom JS and V8 bindings. Added exhaustive test case
+        exercising all new code paths. Updated preexisting test cases for
+        new APIs. Fixed preexisting bugs in WebKit's and Chrome's WebGL
+        implementations.
+
+        Ran WebGL layout tests in WebKit (clean) and Chrome (couple of
+        preexisting known failures) and manual WebGL tests in both
+        browsers.
+
+        Test: fast/canvas/webgl/gl-object-get-calls.html
+
+        * WebCore.gypi:
+        * WebCore.xcodeproj/project.pbxproj:
+        * bindings/js/JSWebGLRenderingContextCustom.cpp:
+        (WebCore::toJS):
+        (WebCore::):
+        (WebCore::getObjectParameter):
+        (WebCore::getProgramParameterHelper):
+        (WebCore::JSWebGLRenderingContext::getBufferParameter):
+        (WebCore::JSWebGLRenderingContext::getFramebufferAttachmentParameter):
+        (WebCore::JSWebGLRenderingContext::getParameter):
+        (WebCore::JSWebGLRenderingContext::getProgramParameter):
+        (WebCore::JSWebGLRenderingContext::getRenderbufferParameter):
+        (WebCore::JSWebGLRenderingContext::getShaderParameter):
+        (WebCore::JSWebGLRenderingContext::getTexParameter):
+        (WebCore::JSWebGLRenderingContext::getUniform):
+        (WebCore::JSWebGLRenderingContext::getVertexAttrib):
+        * bindings/v8/custom/V8CustomBinding.h:
+        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
+        (WebCore::toV8):
+        (WebCore::):
+        (WebCore::getObjectParameter):
+        (WebCore::getProgramParameter):
+        (WebCore::CALLBACK_FUNC_DECL):
+        * html/canvas/CanvasObject.cpp:
+        (WebCore::CanvasObject::CanvasObject):
+        (WebCore::CanvasObject::setObject):
+        (WebCore::CanvasObject::deleteObject):
+        * html/canvas/CanvasObject.h:
+        * html/canvas/WebGLBuffer.cpp:
+        (WebCore::WebGLBuffer::create):
+        (WebCore::WebGLBuffer::WebGLBuffer):
+        * html/canvas/WebGLBuffer.h:
+        * html/canvas/WebGLGetInfo.cpp: Added.
+        (WebCore::WebGLGetInfo::WebGLGetInfo):
+        (WebCore::WebGLGetInfo::~WebGLGetInfo):
+        (WebCore::WebGLGetInfo::getType):
+        (WebCore::WebGLGetInfo::getBool):
+        (WebCore::WebGLGetInfo::getFloat):
+        (WebCore::WebGLGetInfo::getLong):
+        (WebCore::WebGLGetInfo::getString):
+        (WebCore::WebGLGetInfo::getUnsignedLong):
+        (WebCore::WebGLGetInfo::getWebGLBuffer):
+        (WebCore::WebGLGetInfo::getWebGLFloatArray):
+        (WebCore::WebGLGetInfo::getWebGLFramebuffer):
+        (WebCore::WebGLGetInfo::getWebGLIntArray):
+        (WebCore::WebGLGetInfo::getWebGLProgram):
+        (WebCore::WebGLGetInfo::getWebGLRenderbuffer):
+        (WebCore::WebGLGetInfo::getWebGLTexture):
+        (WebCore::WebGLGetInfo::getWebGLUnsignedByteArray):
+        * html/canvas/WebGLGetInfo.h: Added.
+        (WebCore::WebGLGetInfo::):
+        * html/canvas/WebGLRenderbuffer.cpp:
+        (WebCore::WebGLRenderbuffer::create):
+        (WebCore::WebGLRenderbuffer::WebGLRenderbuffer):
+        * html/canvas/WebGLRenderbuffer.h:
+        * html/canvas/WebGLRenderingContext.cpp:
+        (WebCore::WebGLStateRestorer::WebGLStateRestorer):
+        (WebCore::WebGLStateRestorer::~WebGLStateRestorer):
+        (WebCore::WebGLRenderingContext::WebGLRenderingContext):
+        (WebCore::WebGLRenderingContext::activeTexture):
+        (WebCore::WebGLRenderingContext::bindBuffer):
+        (WebCore::WebGLRenderingContext::bindFramebuffer):
+        (WebCore::WebGLRenderingContext::bindRenderbuffer):
+        (WebCore::WebGLRenderingContext::bindTexture):
+        (WebCore::WebGLRenderingContext::getBufferParameter):
+        (WebCore::WebGLRenderingContext::getFramebufferAttachmentParameter):
+        (WebCore::WebGLRenderingContext::getParameter):
+        (WebCore::WebGLRenderingContext::getProgramParameter):
+        (WebCore::WebGLRenderingContext::getProgramInfoLog):
+        (WebCore::WebGLRenderingContext::getRenderbufferParameter):
+        (WebCore::WebGLRenderingContext::getShaderParameter):
+        (WebCore::WebGLRenderingContext::getShaderInfoLog):
+        (WebCore::WebGLRenderingContext::getShaderSource):
+        (WebCore::WebGLRenderingContext::getString):
+        (WebCore::WebGLRenderingContext::getTexParameter):
+        (WebCore::WebGLRenderingContext::getUniform):
+        (WebCore::WebGLRenderingContext::getVertexAttrib):
+        (WebCore::WebGLRenderingContext::useProgram):
+        (WebCore::WebGLRenderingContext::getBooleanParameter):
+        (WebCore::WebGLRenderingContext::getFloatParameter):
+        (WebCore::WebGLRenderingContext::getIntParameter):
+        (WebCore::WebGLRenderingContext::getLongParameter):
+        (WebCore::WebGLRenderingContext::getUnsignedLongParameter):
+        (WebCore::WebGLRenderingContext::getWebGLFloatArrayParameter):
+        (WebCore::WebGLRenderingContext::getWebGLIntArrayParameter):
+        (WebCore::WebGLRenderingContext::getWebGLUnsignedByteArrayParameter):
+        * html/canvas/WebGLRenderingContext.h:
+        * html/canvas/WebGLRenderingContext.idl:
+        * html/canvas/WebGLTexture.cpp:
+        (WebCore::WebGLTexture::create):
+        (WebCore::WebGLTexture::WebGLTexture):
+        * html/canvas/WebGLTexture.h:
+        * manual-tests/webgl/resources/utils3d.js:
+        (initWebGL):
+        (loadShader):
+        (Framerate.prototype.snapshot):
+        * platform/graphics/GraphicsContext3D.h:
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::GraphicsContext3D::bindRenderbuffer):
+        (WebCore::GraphicsContext3D::getBooleanv):
+        (WebCore::GraphicsContext3D::getBufferParameteriv):
+        (WebCore::GraphicsContext3D::getFloatv):
+        (WebCore::GraphicsContext3D::getFramebufferAttachmentParameteriv):
+        (WebCore::GraphicsContext3D::getIntegerv):
+        (WebCore::GraphicsContext3D::getProgramiv):
+        (WebCore::GraphicsContext3D::getRenderbufferParameteriv):
+        (WebCore::GraphicsContext3D::getShaderiv):
+        (WebCore::GraphicsContext3D::getTexParameterfv):
+        (WebCore::GraphicsContext3D::getTexParameteriv):
+        (WebCore::GraphicsContext3D::getUniformfv):
+        (WebCore::GraphicsContext3D::getUniformiv):
+        (WebCore::GraphicsContext3D::getVertexAttribfv):
+        (WebCore::GraphicsContext3D::getVertexAttribiv):
+
+2009-11-24  Steve Falkenburg  <sfalken@apple.com>
+
+        Windows build fix.
+
+        * WebCore.vcproj/QTMovieWin.vcproj: Add additional search path for QuickTime SDK.
+
+2009-11-24  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Gustavo Noronha Silva.
+
+        [Gtk] GStreamer-CRITICAL's (and other warnings) on <video>
+        https://bugs.webkit.org/show_bug.cgi?id=26354
+
+        Implemented MediaPlayerPrivate::isAvailable by checking the
+        presence of the playbin2 GStreamer element.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::MediaPlayerPrivate::isAvailable):
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.h:
+
+2009-11-24  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Xan Lopez.
+
+        https://bugs.webkit.org/show_bug.cgi?id=25415
+        [GTK][ATK] Please implement support for get_text_at_offset
+
+        When building up the pango layout from text boxes, only append a
+        newline char after verifying there are no more boxes on this line.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (getPangoLayoutForAtk):
+
+2009-11-24  Joseph Pecoraro  <joepeck@webkit.org>
+
+        Reviewed by Pavel Feldman.
+
+        Web Inspector: Keyboard Shortcut to Clear Console Messages
+        https://bugs.webkit.org/show_bug.cgi?id=31780
+
+        All Platforms:  Ctrl+L  = Clear Console Messages
+        Mac Only:       Cmd+K   = Clear Console Messages
+
+        * inspector/front-end/ConsoleView.js:
+        (WebInspector.ConsoleView): create shortcuts
+        (WebInspector.ConsoleView.prototype._promptKeyDown): handle shortcuts
+        * inspector/front-end/KeyboardShortcut.js:
+        (WebInspector.KeyboardShortcut.makeKey): convenience conversion of "a-z" character to keyCode
+        * inspector/front-end/ScriptsPanel.js:
+        (WebInspector.ScriptsPanel): style fixes for keyboard shortcuts
+
+2009-11-24  Pavel Feldman  <pfeldman@chromium.org>
+
+        Not reviewed: touch inspector controller in order to
+        kick win bot inspector deploy. rs=aroben.
+
+        * inspector/InspectorController.cpp:
+
+2009-11-23  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Implement expandable compartments on timeline panel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31796
+
+        * inspector/front-end/TimelineOverviewPane.js:
+        (WebInspector.TimelineOverviewPane.prototype._setWindowPosition):
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel):
+        (WebInspector.TimelinePanel.prototype.addRecordToTimeline):
+        (WebInspector.TimelinePanel.prototype._innerAddRecordToTimeline):
+        (WebInspector.TimelinePanel.prototype._formatRecord):
+        (WebInspector.TimelinePanel.prototype._refreshRecords):
+        (WebInspector.TimelinePanel.prototype._addToRecordsWindow):
+        (WebInspector.TimelineRecordListRow):
+        (WebInspector.TimelineRecordListRow.prototype.update):
+        (WebInspector.TimelineRecordListRow.prototype.dispose):
+        (WebInspector.TimelineRecordGraphRow):
+        (WebInspector.TimelineRecordGraphRow.prototype.update):
+        (WebInspector.TimelineRecordGraphRow.prototype._onClick):
+        (WebInspector.TimelineRecordGraphRow.prototype.dispose):
+        * inspector/front-end/inspector.css:
+
+2009-11-24  Mark Rowe  <mrowe@apple.com>
+
+        Fix production builds where the source tree may be read-only.
+
+        * WebCore.xcodeproj/project.pbxproj:
+
+2009-11-23  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        Include "config.h" to meet Coding Style Guidelines
+        https://bugs.webkit.org/show_bug.cgi?id=31792
+
+        No new tests as there is no new functionality.
+
+        * platform/graphics/win/IntPointWin.cpp:
+        * platform/graphics/win/IntRectWin.cpp:
+        * platform/graphics/win/IntSizeWin.cpp:
+        * platform/network/chromium/ResourceRequest.cpp:
+        * platform/win/PlatformMouseEventWin.cpp:
+
+2009-11-23  Jian Li  <jianli@chromium.org>
+
+        Reviewed by NOBODY (Chromium build fix).
+
+        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * platform/graphics/GraphicsContext3D.h:
+
+2009-11-23  Aaron Golden  <agolden@apple.com>
+
+        Reviewed by Alexey Proskuryakov.
+
+        Prevent ResourceHandleMac's version of ResourceHandle::receivedCredential from stripping
+        identity and certificate information from a WebCore::Credential when receivedCredential
+        needs to modify the credential's persistence.
+
+        Adding a new constructor Credential(const Credential& original, CredentialPersistence)
+        that copies every field from original except for persistence.
+
+        * platform/network/Credential.cpp:
+        (WebCore::Credential::Credential):
+        * platform/network/Credential.h:
+        * platform/network/mac/ResourceHandleMac.mm:
+        (WebCore::ResourceHandle::receivedCredential):
+
+2009-11-23  Gavin Barraclough  <barraclough@apple.com>
+
+        Reviewed by Geoff Garen.
+
+        Part 2/3 of <rdar://problem/7377477> REGRESSION: Many web pages fail to render after interesting script runs in isolated world
+
+        Some clients of the JavaScriptCore API expect to be able to make callbacks over the JSC API,
+        and for this to automagically cause execution to take place in the world associated with the
+        global object associated with the ExecState (JSContextRef) passed.  However this is not how
+        things work - the world must be explicitly set within WebCore.
+
+        Making this work just for API calls to evaluate & call will be a far from perfect solution,
+        since direct (non-API) use of JSC still relies on WebCore setting the current world correctly.
+        A better solution would be to make this all work automagically all throughout WebCore, but this
+        will require more refactoring.
+
+        Add references from the JSDOMWindowShell and the JSDOMGlobalObject to the world that owns them,
+        so that we can get to the world from the lexical global object of an ExecState.  In the long-term
+        we should switch over to using this approach for all cases we want to get a world from an exec state.
+
+        * bindings/js/JSDOMBinding.cpp:
+        (WebCore::WebCoreJSClientData::beginningExecution):
+        (WebCore::WebCoreJSClientData::completedExecution):
+        * bindings/js/JSDOMBinding.h:
+        * bindings/js/JSDOMGlobalObject.h:
+        (WebCore::JSDOMGlobalObject::world):
+        (WebCore::JSDOMGlobalObject::JSDOMGlobalObjectData::JSDOMGlobalObjectData):
+        * bindings/js/JSDOMWindowBase.cpp:
+        (WebCore::JSDOMWindowBase::JSDOMWindowBaseData::JSDOMWindowBaseData):
+        * bindings/js/JSDOMWindowBase.h:
+        * bindings/js/JSDOMWindowShell.cpp:
+        (WebCore::JSDOMWindowShell::JSDOMWindowShell):
+        * bindings/js/JSDOMWindowShell.h:
+        (WebCore::JSDOMWindowShell::world):
+        * bindings/js/JSWorkerContextBase.cpp:
+        (WebCore::JSWorkerContextBase::JSWorkerContextBase):
+        * bindings/js/ScriptController.cpp:
+        (WebCore::ScriptController::initScript):
+
+2009-11-23  Chris Marrin  <cmarrin@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        Add range checks to rendering calls in WebGL
+        https://bugs.webkit.org/show_bug.cgi?id=31239
+
+        I am now tracking the size of the data in each CanvasBuffer object
+        and keeping track of the buffer size of each active vertex attrib.
+        In drawArrays and drawElements I make sure no attempt is made to
+        access elements outside the valid buffer ranges. The test at:
+
+            http://cs.helsinki.fi/u/ilmarihe/c3d/functions/drawArraysOutOfBounds.html
+
+        no longer crashes.
+
+        I also added all the WebGL enumerations to GraphicsContext3D to use them in the validation checks
+
+        Tests: fast/canvas/webgl/drawArraysOutOfBounds.html
+               fast/canvas/webgl/drawElementssOutOfBounds.html
+
+        * bindings/js/JSWebGLArrayCustom.cpp:
+        (WebCore::toJS):
+        * bindings/js/JSWebGLRenderingContextCustom.cpp:
+        (WebCore::JSWebGLRenderingContext::bufferData):
+        (WebCore::JSWebGLRenderingContext::bufferSubData):
+        (WebCore::JSWebGLRenderingContext::texSubImage2D):
+        * html/canvas/WebGLArrayBuffer.cpp:
+        (WebCore::WebGLArrayBuffer::create):
+        (WebCore::WebGLArrayBuffer::data):
+        * html/canvas/WebGLArrayBuffer.h:
+        * html/canvas/WebGLBuffer.cpp:
+        (WebCore::WebGLBuffer::WebGLBuffer):
+        (WebCore::WebGLBuffer::associateBufferData):
+        (WebCore::WebGLBuffer::associateBufferSubData):
+        (WebCore::WebGLBuffer::byteLength):
+        * html/canvas/WebGLBuffer.h:
+        (WebCore::WebGLBuffer::elementArrayBuffer):
+        * html/canvas/WebGLRenderingContext.cpp:
+        (WebCore::WebGLRenderingContext::WebGLRenderingContext):
+        (WebCore::WebGLRenderingContext::sizeInBytes):
+        (WebCore::WebGLRenderingContext::bindBuffer):
+        (WebCore::WebGLRenderingContext::bufferData):
+        (WebCore::WebGLRenderingContext::bufferSubData):
+        (WebCore::WebGLRenderingContext::createShader):
+        (WebCore::WebGLRenderingContext::disableVertexAttribArray):
+        (WebCore::WebGLRenderingContext::validateIndexArray):
+        (WebCore::WebGLRenderingContext::validateRenderingState):
+        (WebCore::WebGLRenderingContext::drawArrays):
+        (WebCore::WebGLRenderingContext::drawElements):
+        (WebCore::WebGLRenderingContext::enableVertexAttribArray):
+        (WebCore::WebGLRenderingContext::isFramebuffer):
+        (WebCore::WebGLRenderingContext::isProgram):
+        (WebCore::WebGLRenderingContext::isRenderbuffer):
+        (WebCore::WebGLRenderingContext::isShader):
+        (WebCore::WebGLRenderingContext::isTexture):
+        (WebCore::WebGLRenderingContext::useProgram):
+        (WebCore::WebGLRenderingContext::validateProgram):
+        (WebCore::WebGLRenderingContext::vertexAttribPointer):
+        (WebCore::WebGLRenderingContext::detachAndRemoveAllObjects):
+        * html/canvas/WebGLRenderingContext.h:
+        (WebCore::WebGLRenderingContext::VertexAttribState::VertexAttribState):
+        * html/canvas/WebGLRenderingContext.idl:
+        * html/canvas/WebGLShader.cpp:
+        (WebCore::WebGLShader::create):
+        (WebCore::WebGLShader::WebGLShader):
+        * html/canvas/WebGLShader.h:
+        * platform/graphics/GraphicsContext3D.h:
+        (WebCore::GraphicsContext3D::):
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::GraphicsContext3D::createShader):
+
+2009-11-23  Erik Arvidsson  <arv@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        JSC bindings for HasIndexGetter generates incorrect code (affects
+        MediaList and CSSStyleDeclaration).
+        This cleans up the edge cases for indexing out of range for style and
+        computed style objects to return an empty string according to the spec.
+        MediaList now returns null when indexed out of range.
+        https://bugs.webkit.org/show_bug.cgi?id=31683
+
+        Tests: fast/dom/CSSStyleDeclaration/css-computed-style-item.html
+               fast/dom/CSSStyleDeclaration/css-style-item.html
+               fast/dom/StyleSheet/css-medialist-item.html
+
+        * bindings/scripts/CodeGeneratorJS.pm: If IndexGetterReturnsString then
+                we do not check the length before calling the item function.
+        * css/CSSComputedStyleDeclaration.cpp:
+        (WebCore::CSSComputedStyleDeclaration::item):
+        * css/CSSMutableStyleDeclaration.cpp:
+        (WebCore::CSSMutableStyleDeclaration::item):
+        * css/CSSStyleDeclaration.idl:
+
+2009-11-23  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        DocumentMarkers need to be educated about transforms
+        https://bugs.webkit.org/show_bug.cgi?id=31751
+        
+        Find highlight is incorrect with transforms
+        <rdar://problem/6358394>
+
+        Allow callers to specify that Frame::selectionTextRects() takes transforms into account
+        when computing the set of rects that encompass a selection. For transformed elemenets, the
+        selection rect will be the bounding box of the selected content.
+        
+        Fix DocumentMarkers to cache rects in absolute coordinates, rather than painting coordinates.
+        
+        Test: editing/selection/transformed-selection-rects.html
+        
+        * WebCore.base.exp:
+        Frame::selectionTextRects() has a new parameter.
+        
+        * dom/Document.cpp:
+        (WebCore::Document::setRenderedRectForMarker):
+        * dom/Document.h:
+        Pass the marker as a const reference.
+        
+        * dom/Range.h:
+        * dom/Range.cpp:
+        (WebCore::Range::textQuads):
+        Add a new method, textQuads(), which returns a list of quads, respecting transforms.
+        
+        * page/Frame.h:
+        * page/Frame.cpp:
+        (WebCore::Frame::selectionTextRects):
+        Add a new parameter, respectTransforms, and when that is RespectTransforms, use the quad
+        method to get quads for ranges, and then take their bounding boxes.
+
+        * rendering/InlineTextBox.h:
+        * rendering/InlineTextBox.cpp:
+        (WebCore::InlineTextBox::paintSpellingOrGrammarMarker):
+        (WebCore::InlineTextBox::paintTextMatchMarker):
+        (WebCore::InlineTextBox::computeRectForReplacementMarker):
+        (WebCore::InlineTextBox::paintDocumentMarkers):
+        (WebCore::InlineTextBox::textPos):
+        (WebCore::InlineTextBox::offsetForPosition):
+        
+        Pass DocumentMarkers as a const references.
+        Convert the argument to setRenderedRectForMarker() into absolute coordinates.
+        
+        * rendering/RenderView.cpp:
+        (WebCore::RenderView::selectionBounds):
+
+2009-11-23  Dirk Schulze  <krit@webkit.org>
+
+        Reviewed by Oliver Hunt.
+
+        [Cairo] support blurred test-shadow
+        [https://bugs.webkit.org/show_bug.cgi?id=31797]
+
+        Support for blurred text-shadows on Cairo. This patch
+        reuses the code of blurred box-shadows, introduced in
+        bug 26102. For a full textshadow support, a filters enabled
+        build is needed.
+
+        * platform/graphics/cairo/FontCairo.cpp:
+        (WebCore::Font::drawGlyphs):
+
+2009-11-23  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Geoffrey Garen.
+
+        Change incorrect calls to the constructor "EventNames()" to the correct accessor
+        "eventNames()". This saves ~100 AtomicString lookups each time.
+        https://bugs.webkit.org/show_bug.cgi?id=31811
+
+        * dom/EventNames.h:  Make constructor private to prevent this from happening again.
+        * history/CachedFrame.cpp:
+        (WebCore::CachedFrameBase::restore):  EventNames() --> eventNames()
+        * html/HTMLFormControlElement.cpp:
+        (WebCore::HTMLFormControlElement::checkValidity):  EventNames() --> eventNames()
+        * loader/FrameLoader.cpp:
+        (WebCore::FrameLoader::stopLoading):  EventNames() --> eventNames()
+        (WebCore::FrameLoader::pageHidden):  EventNames() --> eventNames()
+        * page/DOMWindow.cpp:
+        (WebCore::DOMWindow::dispatchAllPendingUnloadEvents):  EventNames() --> eventNames()
+
+2009-11-23  Adam Langley  <agl@google.com>
+
+        Reviewed by Dmitry Titov.
+
+        Chromium Linux: Limit the stroke width and mitre limit.
+
+        Limit the stroke width and mitre limit that we'll pass into Skia to
+        avoid overflowing Skia's uint16_t glyph widths.
+
+        http://code.google.com/p/chromium/issues/detail?id=28250
+        https://bugs.webkit.org/show_bug.cgi?id=31747
+
+        * platform/graphics/skia/PlatformContextSkia.cpp:
+        (scalarBound):
+        (PlatformContextSkia::setupPaintForStroking):
+
+2009-11-23  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31812
+        WebSocket code uses RefPtr::get() where it shouldn't
+
+        No change in funcitonality, just coding style correction.
+
+        * websockets/WebSocket.cpp:
+        (WebCore::WebSocket::~WebSocket):
+        * websockets/WebSocketChannel.cpp:
+        (WebCore::WebSocketChannel::connect):
+        (WebCore::WebSocketChannel::send):
+        (WebCore::WebSocketChannel::bufferedAmount):
+        (WebCore::WebSocketChannel::close):
+        (WebCore::WebSocketChannel::disconnect):
+        (WebCore::WebSocketChannel::didOpen):
+        (WebCore::WebSocketChannel::didClose):
+        (WebCore::WebSocketChannel::didReceiveData):
+        (WebCore::WebSocketChannel::didFail):
+
+2009-11-23  Alexey Proskuryakov  <ap@apple.com>
+
+        Build fix.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::pacExecutionCallbackMainThread): pacExecutionCallbackMainThread
+        is static, so it can't use member variables directly.
+
+2009-11-23  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Brady Eidson.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31748
+        Make WebSocketHandleCFNet respect proxy auto-configuration files via CFProxySupport
+
+        * platform/network/cf/SocketStreamHandle.h: Removed names from some void* arguments, since
+        they didn't carry useful information.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::SocketStreamHandle): When we need an http-style URL, we actually
+        always need https.
+        (WebCore::SocketStreamHandle::scheduleStreams): Factored out from constructor, since streams
+        only get scheduled after PAC is fetched and executed asynchronously.
+        (WebCore::SocketStreamHandle::copyPACExecutionDescription): Return a description for event
+        source.
+        (WebCore::MainThreadPACCallbackInfo::MainThreadPACCallbackInfo): Forward callback to main thread.
+        (WebCore::SocketStreamHandle::pacExecutionCallback): Ditto.
+        (WebCore::SocketStreamHandle::pacExecutionCallbackMainThread): Ditto. To avoid code duplication,
+        we make the call even on Mac.
+        (WebCore::SocketStreamHandle::executePACFileURL): Make an async call to CFNetworkExecuteProxyAutoConfigurationURL.
+        (WebCore::SocketStreamHandle::removePACRunLoopSource): Once PAC execution is done or aborted,
+        we need to get rid of the event source.
+        (WebCore::SocketStreamHandle::chooseProxy): Use stored m_httpsURL.get.
+        (WebCore::SocketStreamHandle::chooseProxyFromArray): Factored out from chooseProxy - the
+        array may come directly from system configuration, or from PAC.
+        (WebCore::SocketStreamHandle::chooseProxy): Tiger version of this function is now completely
+        separate.
+        (WebCore::SocketStreamHandle::~SocketStreamHandle): Run loop source should be destroyed
+        before we get to the destructor.
+        (WebCore::SocketStreamHandle::platformClose): Destroy the run loop source, if PAC execution
+        is still in progress.
+
+2009-11-23  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Geoff Garen.
+
+        Don't leak the CGImage we create when drawing a sub image.
+
+        * platform/graphics/cg/ImageCG.cpp:
+        (WebCore::BitmapImage::draw):
+
+2009-11-23  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        [V8] Don't crash when OOM in creating isolated world
+        https://bugs.webkit.org/show_bug.cgi?id=31805
+
+        We need to add some more null checks to avoid crashing.  No new tests
+        because we don't have a good way to test out-of-memory bugs.
+
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::evaluateInIsolatedWorld):
+        (WebCore::V8Proxy::evaluateInNewContext):
+        (WebCore::V8Proxy::setInjectedScriptContextDebugId):
+        * bindings/v8/V8Proxy.h:
+
+2009-11-23  Dirk Schulze  <krit@webkit.org>
+
+        Reviewed by Nikolas Zimmermann.
+
+        This is the implementation of the filterRes attribute. It
+        helps the SVG developer to set the quality of a filter by
+        giving the width or height of filter.
+        This patch also sets the filter resolution to lower values
+        if a intermediate ImageBuffer size is bigger than the given
+        maximal size.
+        The maximal size is set to 5000x5000 by default. This is a
+        subjectiv decission. Everthing greater than this values gets
+        sensible slower. Values of 10000x10000 crashed on WebKitGtk.
+        For mobil devices a maximum size of 100x100 or 200x200 seems
+        to be reasonable.
+        The important fact on filter resolution is, that the output
+        size is still the size given by the <filter> element.
+
+        Tests: svg/filters/big-sized-filter-2.svg
+               svg/filters/big-sized-filter.svg
+               svg/filters/filterRes.svg
+
+        * platform/graphics/FloatRect.cpp:
+        (WebCore::FloatRect::scale): Add the abbility to scale a rect by x and y.
+        * platform/graphics/FloatRect.h:
+        (WebCore::FloatRect::scale): Add the abbility to scale a rect by x and y.
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (WebCore::GraphicsContext::createPlatformShadow): Use scaledSubRegion for
+        calculation.
+        * platform/graphics/filters/FEBlend.cpp:
+        (WebCore::FEBlend::apply): Use scaledSubRegion for effect intern calculations.
+        * platform/graphics/filters/FEColorMatrix.cpp:
+        (WebCore::FEColorMatrix::apply): Use scaledSubRegion for effect intern calculations.
+        * platform/graphics/filters/FEComponentTransfer.cpp:
+        (WebCore::FEComponentTransfer::apply): Use scaledSubRegion for effect intern
+        calculations.
+        * platform/graphics/filters/FEComposite.cpp:
+        (WebCore::FEComposite::apply): Use scaledSubRegion for effect intern calculations.
+        * platform/graphics/filters/FEGaussianBlur.cpp:
+        (WebCore::FEGaussianBlur::apply): Use scaledSubRegion for effect intern calculations.
+        * platform/graphics/filters/Filter.h: Add the abbility to change the quality
+        of a filter output.
+        (WebCore::Filter::filterResolution):
+        (WebCore::Filter::setFilterResolution):
+        (WebCore::Filter::calculateEffectSubRegion): Calculates the correct subRegion
+        as well as the scaledSubRegion. It also searches for the biggest effect size.
+        We have to change the filter resolution, if one intermediate ImageBuffer size
+        doesn't fit in the maximal image size.
+        * platform/graphics/filters/FilterEffect.cpp:
+        (WebCore::FilterEffect::calculateDrawingIntRect): Use scaledSubRegion to get
+        the right part of a previous effect result.
+        (WebCore::FilterEffect::calculateDrawingRect): Use scaledSubRegion to get
+        the right part of a previous effect result.
+        (WebCore::FilterEffect::getEffectContext): Use scaledSubRegion to create
+        a new intermediate ImageBuffer for the result of the current effect.
+        * platform/graphics/filters/FilterEffect.h:
+        (WebCore::FilterEffect::scaledSubRegion): The scaled subRegion of a the
+        filter effect.
+        (WebCore::FilterEffect::setScaledSubRegion):
+        (WebCore::FilterEffect::effectBoundaries): The original values of the
+        EffectElement for a second subRegion calculation.
+        (WebCore::FilterEffect::setEffectBoundaries):
+        * platform/graphics/filters/ImageBufferFilter.cpp:
+        (WebCore::ImageBufferFilter::ImageBufferFilter): Set the scale factor to one.
+        * platform/graphics/filters/ImageBufferFilter.h:
+        (WebCore::ImageBufferFilter::maxImageSize):
+        (WebCore::ImageBufferFilter::calculateEffectSubRegion):
+        * platform/graphics/filters/SourceAlpha.cpp:
+        (WebCore::SourceAlpha::calculateEffectRect): Use scaledSubRegion for effect
+        intern calculations.
+        * platform/graphics/filters/SourceGraphic.cpp:
+        (WebCore::SourceGraphic::calculateEffectRect): Use scaledSubRegion for effect
+        intern calculations.
+        * svg/SVGFilterElement.cpp:
+        (WebCore::SVGFilterElement::parseMappedAttribute): Parse filterRes attribute.
+        (WebCore::SVGFilterElement::buildFilter): Give SVGResourceFilter the current
+        filterResolution.
+        * svg/SVGFilterPrimitiveStandardAttributes.cpp:
+        (WebCore::SVGFilterPrimitiveStandardAttributes::setStandardAttributes): Save
+        values to effectBoundaries of the filter effect
+        * svg/graphics/SVGResourceFilter.cpp:
+        (WebCore::SVGResourceFilter::SVGResourceFilter):
+        (WebCore::shouldProcessFilter): Return signal if a neccessary value is zero.
+        (WebCore::SVGResourceFilter::fitsInMaximumImageSize): Checks if the given size
+        fits into the maximal image size, modifys scale factors if not and return a
+        bool: fits.
+        (WebCore::SVGResourceFilter::prepareFilter): Scale the SourceImage to
+        filterResolution (given by FilterElement or calculated on to big image sizes).
+        Set the scale level to SVGFilter.
+        (WebCore::SVGResourceFilter::applyFilter): Don't apply filters if shouldProcessFilter
+        is wrong.
+        * svg/graphics/SVGResourceFilter.h:
+        (WebCore::SVGResourceFilter::setFilterResolution): FilterResolution of FilterElement.
+        (WebCore::SVGResourceFilter::setHasFilterResolution): Does FilterElement provides
+        a FilterResolution?
+        (WebCore::SVGResourceFilter::scaleX): Current scale factor for horizontal.
+        (WebCore::SVGResourceFilter::scaleY): Current scale factor for vertical.
+        * svg/graphics/filters/SVGFEDisplacementMap.cpp:
+        (WebCore::FEDisplacementMap::apply): Use scaledSubRegion for effect intern calculations.
+        Kernel values are scaled to current filter resolution too.
+        * svg/graphics/filters/SVGFEFlood.cpp:
+        (WebCore::FEFlood::apply): Use scaledSubRegion for effect intern calculations.
+        * svg/graphics/filters/SVGFEMerge.cpp:
+        (WebCore::FEMerge::apply): Use scaledSubRegion for effect intern calculations.
+        Kernel values are scaled to current filter resolution too.
+        * svg/graphics/filters/SVGFEMorphology.cpp:
+        (WebCore::FEMorphology::apply): Use scaledSubRegion for effect intern calculations.
+        Kernel values are scaled to current filter resolution too.
+        * svg/graphics/filters/SVGFEOffset.cpp:
+        (WebCore::FEOffset::apply): Use scaledSubRegion for effect intern calculations.
+        * svg/graphics/filters/SVGFETile.cpp:
+        (WebCore::FETile::apply): Use scaledSubRegion for effect intern calculations.
+        * svg/graphics/filters/SVGFilter.cpp:
+        (WebCore::SVGFilter::calculateEffectSubRegion): Calculate subRegion for LayoutTests,
+        scaledSubRegion according to the current filterResolution and get the maximal image size.
+        * svg/graphics/filters/SVGFilter.h:
+        (WebCore::SVGFilter::effectBoundingBoxMode): Original values of the FilterElement. 
+        (WebCore::SVGFilter::filterRegion): Use virtual for clarification.
+        (WebCore::SVGFilter::sourceImageRect): Use virtual for clarification.
+        (WebCore::SVGFilter::maxImageSize): Get the maximal image size.
+
+2009-11-23  Simon Hausmann  <simon.hausmann@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Wrong runtime instance objects of wrapped QObjects may be used if
+        the wrapped object died before the gc removed the instance.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31681
+
+        Before using a cached instance, verify that its wrapped QObject is
+        still alive.
+
+        * bridge/qt/qt_instance.cpp:
+        (JSC::Bindings::QtInstance::getQtInstance):
+        * bridge/qt/qt_instance.h:
+        (JSC::Bindings::QtInstance::hashKey):
+
+2009-11-22  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        ARIA: support aria-flowto
+        https://bugs.webkit.org/show_bug.cgi?id=31762
+
+        Test: platform/mac/accessibility/aria-flowto.html
+
+        * accessibility/AccessibilityObject.h:
+        (WebCore::AccessibilityObject::ariaOwnsElements):
+        (WebCore::AccessibilityObject::supportsARIAFlowTo):
+        (WebCore::AccessibilityObject::ariaFlowToElements):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::linkedUIElements):
+        (WebCore::AccessibilityRenderObject::supportsARIAFlowTo):
+        (WebCore::AccessibilityRenderObject::ariaFlowToElements):
+        * accessibility/AccessibilityRenderObject.h:
+        * html/HTMLAttributeNames.in:
+
+2009-11-22  Nikolas Zimmermann  <nzimmermann@rim.com>
+
+        Not reviewed. Build fix for WML enabled builds.
+        Adopt WebCore API changes.
+
+        * wml/WMLAElement.cpp:
+        (WebCore::WMLAElement::defaultEventHandler):
+        * wml/WMLInputElement.cpp:
+        (WebCore::WMLInputElement::defaultEventHandler):
+
+2009-11-22  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Introduce sidebar background on timeline panel in order
+        to prevent it from flickering on scroll.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31789
+
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel):
+        (WebInspector.TimelinePanel.prototype.setSidebarWidth):
+        (WebInspector.TimelinePanel.prototype._onScroll):
+        (WebInspector.TimelinePanel.prototype._scheduleRefresh):
+        * inspector/front-end/inspector.css:
+
+2009-11-22  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Reimplement TimelinePanel to make it fast:
+        - Extract grid and overview into separate files
+        - Make timeline create only divs for visible rows
+
+        https://bugs.webkit.org/show_bug.cgi?id=31784
+
+        * WebCore.gypi:
+        * WebCore.vcproj/WebCore.vcproj:
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype.createInterface):
+        (WebInspector.AbstractTimelinePanel.prototype.refresh):
+        (WebInspector.AbstractTimelinePanel.prototype.set calculator):
+        * inspector/front-end/TimelineGrid.js: Added.
+        (WebInspector.TimelineGrid):
+        (WebInspector.TimelineGrid.prototype.get itemsGraphsElement):
+        (WebInspector.TimelineGrid.prototype.updateDividers):
+        (WebInspector.TimelineGrid.prototype.addEventDivider):
+        (WebInspector.TimelineGrid.prototype.setScrollAndDividerTop):
+        * inspector/front-end/TimelineOverviewPane.js: Added.
+        (WebInspector.TimelineOverviewPane):
+        (WebInspector.TimelineOverviewPane.prototype._onCheckboxClicked):
+        (WebInspector.TimelineOverviewPane.prototype.update):
+        (WebInspector.TimelineOverviewPane.prototype.setSidebarWidth):
+        (WebInspector.TimelineOverviewPane.prototype.updateMainViewWidth):
+        (WebInspector.TimelineOverviewPane.prototype.reset):
+        (WebInspector.TimelineOverviewPane.prototype._resizeWindow):
+        (WebInspector.TimelineOverviewPane.prototype._windowResizeDragging):
+        (WebInspector.TimelineOverviewPane.prototype._dragWindow):
+        (WebInspector.TimelineOverviewPane.prototype._windowDragging):
+        (WebInspector.TimelineOverviewPane.prototype._resizeWindowLeft):
+        (WebInspector.TimelineOverviewPane.prototype._resizeWindowRight):
+        (WebInspector.TimelineOverviewPane.prototype._setWindowPosition):
+        (WebInspector.TimelineOverviewPane.prototype._endWindowDragging):
+        (WebInspector.TimelineOverviewCalculator):
+        (WebInspector.TimelineOverviewCalculator.prototype.computeBarGraphPercentages):
+        (WebInspector.TimelineOverviewCalculator.prototype.reset):
+        (WebInspector.TimelineOverviewCalculator.prototype.updateBoundaries):
+        (WebInspector.TimelineOverviewCalculator.prototype.get boundarySpan):
+        (WebInspector.TimelineOverviewCalculator.prototype.formatValue):
+        (WebInspector.TimelineCategoryTreeElement):
+        (WebInspector.TimelineCategoryTreeElement.prototype.onattach):
+        (WebInspector.TimelineCategoryGraph):
+        (WebInspector.TimelineCategoryGraph.prototype.get graphElement):
+        (WebInspector.TimelineCategoryGraph.prototype.addChunk):
+        (WebInspector.TimelineCategoryGraph.prototype.clearChunks):
+        (WebInspector.TimelineCategoryGraph.prototype.set dimmed):
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel):
+        (WebInspector.TimelinePanel.prototype._toggleTimelineButtonClicked):
+        (WebInspector.TimelinePanel.prototype.addRecordToTimeline):
+        (WebInspector.TimelinePanel.prototype._formatRecord):
+        (WebInspector.TimelinePanel.prototype.setSidebarWidth):
+        (WebInspector.TimelinePanel.prototype.updateMainViewWidth):
+        (WebInspector.TimelinePanel.prototype.resize):
+        (WebInspector.TimelinePanel.prototype.reset):
+        (WebInspector.TimelinePanel.prototype.show):
+        (WebInspector.TimelinePanel.prototype._onScroll):
+        (WebInspector.TimelinePanel.prototype._scheduleRefresh):
+        (WebInspector.TimelinePanel.prototype._refresh):
+        (WebInspector.TimelinePanel.prototype._refreshRecords):
+        (WebInspector.TimelinePanel.prototype._adjustScrollPosition):
+        (WebInspector.TimelineCategory):
+        (WebInspector.TimelineCalculator):
+        (WebInspector.TimelineCalculator.prototype.get boundarySpan):
+        (WebInspector.TimelineRecordListRow):
+        (WebInspector.TimelineRecordListRow.prototype.update):
+        (WebInspector.TimelineRecordGraphRow):
+        (WebInspector.TimelineRecordGraphRow.prototype.update):
+        * inspector/front-end/WebKit.qrc:
+        * inspector/front-end/inspector.css:
+        * inspector/front-end/inspector.html:
+
+2009-11-22  Chris Evans  <cevans@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Disable access to file:/// directory listings
+        https://bugs.webkit.org/show_bug.cgi?id=31329
+
+        Deny access to directory listings. This needs doing in WebKit for
+        WebKit clients that do permit top-level navigation to file:///dir.
+        This matches Firefox, plus the existing Safari implementation (which
+        does not support any directory access at all). It will fix the
+        LayoutTest named below for Chromium.
+
+        Test: fast/xmlhttprequest/xmlhttprequest-nonexistent-file.html
+
+        * page/SecurityOrigin.cpp: Deny access to directory listings.
+        (WebCore::SecurityOrigin::SecurityOrigin):
+        (WebCore::SecurityOrigin::canRequest):
+
+2009-11-20  Joseph Pecoraro  <joepeck@webkit.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Support Ctrl+P and Ctrl+N, Readline keyboard shortcuts in the Console
+        https://bugs.webkit.org/show_bug.cgi?id=31400
+
+        Handle the following when on a Mac:
+
+          Ctrl+P = Previous (like Up arrow)
+          Ctrl+N = Next (like Down arrow)
+
+        No longer rerun autocompletion when just pushing a modifier key
+        like Control, Alt, Shift, or Meta.
+
+        Improved arrow key behavior with Multiline code in the Console, with the following behavior:
+
+          Up   = Previous Command if on First Line (caret moves to the end of the first line)
+                 otherwise default caret movement in text.
+          Down = Next Command if on Last Line (caret naturally moves to the end)
+                 otherwise default caret movement in text.
+
+        * inspector/front-end/TextPrompt.js:
+        (WebInspector.TextPrompt.prototype.handleKeyEvent): handle new keyboard shortcuts
+        (WebInspector.TextPrompt.prototype.isCaretOnFirstLine): check if the caret is on the top line
+        (WebInspector.TextPrompt.prototype.isCaretOnLastLine): check if the caret is on the bottom line
+        (WebInspector.TextPrompt.prototype._upKeyPressed):
+        (WebInspector.TextPrompt.prototype._downKeyPressed):
+        (WebInspector.TextPrompt.prototype._moveBackInHistory):
+        (WebInspector.TextPrompt.prototype._moveForwardInHistory):
+
+2009-11-21  Jessie Berlin  <jberlin@webkit.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Adds a tooltip containing the full url of the resource to each element
+        in the Resources panel so that it is possible to quickly see the query
+        parameters.
+        https://bugs.webkit.org/show_bug.cgi?id=19103
+
+        * inspector/front-end/ResourcesPanel.js:
+        (WebInspector.ResourceSidebarTreeElement.prototype.refresh):
+        Set the tooltip to be the resource's url.
+
+2009-11-21  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        CSSKeyframesRule::findRule() and deleteRule() should accept 'from' and 'to' as well as percentages
+        https://bugs.webkit.org/show_bug.cgi?id=31588
+        
+        In WebKitCSSKeyframesRule::findRuleIndex(), map 'from' to 0% an 'to' to 100%
+        so that findRule() and deleteRule() work with these keywords.
+
+        * css/WebKitCSSKeyframesRule.cpp:
+        (WebCore::WebKitCSSKeyframesRule::findRuleIndex):
+
+2009-11-21  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31647
+
+        Changed KeyboardEvent::m_keyEvent from a raw pointer to an OwnPtr.
+
+        No functionality was changed. So, no new tests.
+
+        * dom/KeyboardEvent.cpp:
+        (WebCore::KeyboardEvent::~KeyboardEvent):
+        * dom/KeyboardEvent.h: Changed m_keyEvent to OwnPtr.
+        (WebCore::KeyboardEvent::keyEvent):
+
+2009-11-20  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Beth Dakin.
+
+        WAI-ARIA: add support for aria-owns
+        https://bugs.webkit.org/show_bug.cgi?id=31702
+
+        Re-organized how accessibilityAttributeNames are returned so 
+        that it's possible for an element to add an attribute based on 
+        a dynamic value. In this case, we only want to add AXOwn if the 
+        element actually supports aria-owns.
+  
+        Test: platform/mac/accessibility/aria-owns.html
+
+        * accessibility/AccessibilityObject.h:
+        (WebCore::AccessibilityObject::supportsARIAOwns):
+        (WebCore::AccessibilityObject::ariaOwnsElements):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::ariaOwnsElements):
+        (WebCore::AccessibilityRenderObject::supportsARIAOwns):
+        * accessibility/AccessibilityRenderObject.h:
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+        (-[AccessibilityObjectWrapper additionalAccessibilityAttributeNames]):
+        (-[AccessibilityObjectWrapper accessibilityAttributeNames]):
+        (-[AccessibilityObjectWrapper accessibilityAttributeValue:]):
+        * html/HTMLAttributeNames.in:
+
+2009-11-20  Eric Carlson  <eric.carlson@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        <rdar://problem/7414396> Leopard & Tiger: Support closed caption in <video> element
+
+        * css/mediaControls.css:
+            Define closed caption toggle button.
+
+        * rendering/RenderMedia.cpp:
+        (WebCore::RenderMedia::updateControls):
+            Create closed caption toggle button in display order.
+
+        * rendering/RenderThemeMac.mm:
+        (WebCore::RenderThemeMac::shouldRenderMediaControlPart):
+            Don't require MediaControllerThemeQuickTime theme for captions toggle button.
+            No need to check if the movie has video, a closed captions track is a video
+            track.
+
+2009-11-20  Joseph Pecoraro  <joepeck@webkit.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Running code in the Console that ends with a
+        single line comment no longer produces a parse error.
+
+        * inspector/front-end/InjectedScript.js:
+        (InjectedScript._evaluateOn):
+
+2009-11-20  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Beth Dakin.
+
+        WAI-ARIA: add support for 'math' role
+        https://bugs.webkit.org/show_bug.cgi?id=31706
+
+        * accessibility/AccessibilityObject.cpp:
+        * accessibility/AccessibilityObject.h:
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+
+2009-11-20  Yael Aharon  <yael.aharon@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        NPN_ReloadPlugins does not reload the page even if reloadPages is true.
+        https://bugs.webkit.org/show_bug.cgi?id=30460
+
+        Replace call to PluginDatabase::installedPlugins()->refresh() with Page::refreshPlugins().
+        It already refreshes plugins and reloads pages when necessary.
+
+        Tests: plugins/reloadplugins-and-pages.html
+               plugins/reloadplugins-no-pages.html
+
+        * plugins/PluginInfoStore.cpp:
+        (WebCore::refreshPlugins):
+
+2009-11-20  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Dave Hyatt.
+
+        <rdar://7409188> WebKit needs to be able to serialize and deserialize objects.
+
+        Expose WebCore object serialization to WebKit.
+
+        * WebCore.base.exp:
+        * bindings/js/SerializedScriptValue.cpp:
+        (WebCore::SerializedScriptValue::~SerializedScriptValue):
+        (WebCore::SerializedScriptValue::create):
+        (WebCore::SerializedScriptValue::deserialize):
+        * bindings/js/SerializedScriptValue.h:
+
+2009-11-20  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Tim Hatcher.
+
+        Fixes <http://webkit.org/b/31741>.
+        Web Inspector: User Entered Data on the console should show up no matter what filters.
+        
+        Always show .console-user-command-result, no matter what the filter say
+        we should do with the other classes.
+
+        * inspector/front-end/inspector.css:
+
+2009-11-20  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Tim Hatcher.
+
+        Fixes <http://webkit.org/b/31700>.
+        Web Inspector: isMac should be in one central location + Cached.
+        
+        We should cache the value of isMac, and make the indexOf call in one
+        single location, because we are calling it from multiple places, and saving
+        the result can save us time, and make the call sites simpler.
+
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype._updateFilter):
+        * inspector/front-end/ConsoleView.js:
+        (WebInspector.ConsoleView.prototype._updateFilter):
+        * inspector/front-end/ElementsPanel.js:
+        (WebInspector.ElementsPanel.prototype.handleKeyEvent):
+        * inspector/front-end/ScriptsPanel.js:
+        (WebInspector.ScriptsPanel):
+        * inspector/front-end/SourceFrame.js:
+        (WebInspector.SourceFrame.prototype._loaded):
+        * inspector/front-end/inspector.js:
+        (WebInspector.documentKeyDown):
+        (WebInspector.isMac):
+
+2009-11-19  Joseph Pecoraro  <joepeck@webkit.org>
+
+        Removed .DS_Store accidentally added in last (r51245).
+
+2009-11-19  Joseph Pecoraro  <joepeck@webkit.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Add Console Only Layout Mode
+        https://bugs.webkit.org/show_bug.cgi?id=30282
+
+        Adds a Console Panel, which allows for a Full size Console. This
+        extends the Drawer to the size of a Panel. This also fixes previous
+        resize issues with the Drawer.
+
+        * inspector/front-end/ConsolePanel.js: added.
+        (WebInspector.ConsolePanel):
+        (WebInspector.ConsolePanel.prototype.toolbarItemClass.get toolbarItemLabel):
+        (WebInspector.ConsolePanel.prototype.show):
+        (WebInspector.ConsolePanel.prototype.hide):
+        * inspector/front-end/Drawer.js:
+        (WebInspector.Drawer):
+        (WebInspector.Drawer.prototype.set visibleView):
+        (WebInspector.Drawer.prototype.get savedHeight): access the saved height of the variable console.
+        (WebInspector.Drawer.prototype.show.animationFinished):
+        (WebInspector.Drawer.prototype.show):
+        (WebInspector.Drawer.prototype.hide.animationFinished):
+        (WebInspector.Drawer.prototype.hide):
+        (WebInspector.Drawer.prototype.resize): resize appropriately if full/non-full
+        (WebInspector.Drawer.prototype.enterPanelMode):
+        (WebInspector.Drawer.prototype.exitPanelMode):
+        (WebInspector.Drawer.prototype.immediatelyExitPanelMode):
+        (WebInspector.Drawer.prototype._cancelAnimationIfNeeded):
+        (WebInspector.Drawer.prototype._animateDrawerHeight.animationFinished):
+        (WebInspector.Drawer.prototype._animateDrawerHeight):
+        (WebInspector.Drawer.prototype._animationDuration):
+        (WebInspector.Drawer.prototype._startStatusBarDragging):
+        (WebInspector.Drawer.prototype._statusBarDragging):
+        (WebInspector.Drawer.prototype._endStatusBarDragging):
+
+        Miscellaneous changes and cleanup.
+
+        * English.lproj/localizedStrings.js: "Console" toolbar title.
+        * inspector/front-end/ConsoleView.js: removed unnecessary element reordering  
+        * inspector/front-end/Images/consoleIcon.png: added.
+        * inspector/front-end/inspector.css: added icon.
+        * inspector/front-end/inspector.html:
+        * inspector/front-end/inspector.js:
+        (WebInspector._createPanels): create console panel
+        (WebInspector.windowResize): resize drawer if necessary
+        (WebInspector.documentKeyDown): esc should not toggle the console when in panel mode
+        (WebInspector.animateStyle): start animation interval, returns the interval key
+        (WebInspector.toggleAttach): resize drawer if necessary
+        (WebInspector.showConsolePanel): restore the panel when the inspector restarts
+        (WebInspector.showProfileForURL): style fix
+
+        Restore the panel when the inspector restarts.
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::setWindowVisible):
+        (WebCore::InspectorController::specialPanelForJSName):
+        * inspector/InspectorFrontend.cpp:
+        (WebCore::InspectorFrontend::showPanel):
+
+        Build files.
+
+        * WebCore.gypi:
+        * WebCore.vcproj/WebCore.vcproj:
+        * inspector/front-end/WebKit.qrc:
+
+2009-11-20  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Tim Hatcher.
+
+        Fixes <http://webkit.org/b/31699>.
+        Web Inspector: Should Cache Values of InspectorController.platform() and port().
+
+        Refactor the Inspector to cache the value of InspectorController.platform
+        and InspectorController.port, because those need to call into C++, they are
+        being called more and more as we add platform specific keyboard shortcuts, and
+        they shouldn't change in the lifecycle of the Web Inspector.
+
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype._updateFilter):
+        * inspector/front-end/ConsoleView.js:
+        (WebInspector.ConsoleView.prototype._updateFilter):
+        * inspector/front-end/ElementsPanel.js:
+        (WebInspector.ElementsPanel.prototype.handleKeyEvent):
+        * inspector/front-end/ScriptsPanel.js:
+        (WebInspector.ScriptsPanel):
+        * inspector/front-end/SourceFrame.js:
+        (WebInspector.SourceFrame.prototype._loaded):
+        * inspector/front-end/inspector.js:
+        (WebInspector.get platform):
+        (WebInspector.get port):
+        (WebInspector.loaded):
+        (WebInspector.documentKeyDown):
+        (WebInspector.toolbarDragStart):
+
+2009-11-20  Dirk Schulze  <krit@webkit.org>
+
+        Unreviewed build fix for filters enabled builds.
+
+        * platform/graphics/filters/FEColorMatrix.cpp:
+        (WebCore::FEColorMatrix::apply):
+        * platform/graphics/filters/FEComposite.cpp:
+        (WebCore::FEComposite::apply):
+        * platform/graphics/filters/SourceGraphic.cpp:
+        (WebCore::SourceGraphic::apply):
+        * svg/graphics/SVGResourceFilter.cpp:
+        (WebCore::SVGResourceFilter::applyFilter):
+        * svg/graphics/filters/SVGFEMerge.cpp:
+        (WebCore::FEMerge::apply):
+        * svg/graphics/filters/SVGFEOffset.cpp:
+        (WebCore::FEOffset::apply):
+        * svg/graphics/filters/SVGFETile.cpp:
+        (WebCore::FETile::apply):
+
+2009-11-20  Eric Carlson  <eric.carlson@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        <rdar://problem/7389945> QTKit based media engine should not claim to support 
+        fullscreen on Leopard
+
+        * platform/graphics/mac/MediaPlayerPrivateQTKit.mm:
+        (WebCore::MediaPlayerPrivate::supportsFullscreen):
+            Only return true on SnowLeopard for now.
+
+        * rendering/RenderThemeMac.mm:
+        (WebCore::RenderThemeMac::shouldRenderMediaControlPart):
+            No need to special case MediaFullscreenButtonPart as the default implementation 
+            asks the media engine if it supports fullscreen.
+
+2009-11-18  Girish Ramakrishnan  <girish@forwardbias.in>
+
+        Reviewed by Simon Hausmann.
+
+        Patch by Yongjun Zhang <yongjun.zhang@nokia.com> and
+                 Girish Ramakrishnan <girish@forwardbias.in>
+        
+        [Qt] Implement support for rendering plugins on Qt/Mac when a page is used
+        without a QWebView or when inside QGraphicsWebView.
+        
+        Currently, the code provides the cgcontext of the PlatformPluginWidget to
+        the plugin. This approach does not work when we are printing, or using
+        QWebFrame::render() to render to a QImage/QPixmap since the plugin ends
+        up drawing on the QWebView (i.e platformPluginWidget's cgcontext) instead
+        of the QPaintDevice's context.
+        
+        To solve all cases and keep the code simple, we render the plugin to an
+        offscreen pixmap in all cases. This way, the plugin always renders to the
+        CGContext of the pixmap and we then use QPainter to blit the pixmap into
+        the QPaintDevice. We also create a fake window and set it's WindowRef in
+        NPWindow. Only with this WindowRef does Flash paint correctly to the QPixmap.
+        
+        Now, that's the theory. In practice, ATM, mouse events do not work when using
+        the fake window. So, setPlatformPluginWidget() is still called when using QWebView
+        so that there are no regressions after this patch. Once we get mouse events
+        working, setPlatformPluginWidget will be removed.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=31183
+
+        * plugins/PluginView.cpp:
+        (WebCore::PluginView::PluginView):
+        * plugins/PluginView.h:
+        * plugins/mac/PluginViewMac.cpp:
+        (WebCore::PluginView::platformStart):
+        (WebCore::PluginView::platformDestroy):
+        (WebCore::PluginView::setNPWindowIfNeeded):
+        (WebCore::PluginView::updatePluginWidget):
+        (WebCore::PluginView::paint):
+        (WebCore::PluginView::invalidateRect):
+
+2009-11-19  Joseph Pecoraro  <joepeck@webkit.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Resync Resources Backend and Frontend
+        https://bugs.webkit.org/show_bug.cgi?id=31705
+
+        * inspector/front-end/Resource.js: resync enum values with backend
+        (WebInspector.Resource.prototype._mimeTypeIsConsistentWithType): return false if all else fails, not true in all cases
+
+2009-11-19  Steve Block  <steveblock@google.com>
+
+        Reviewed by Darin Fisher.
+
+        Android port lacks configuration in Platform.h and config.h.
+        https://bugs.webkit.org/show_bug.cgi?id=31671
+
+        Build change only. No new tests possible.
+
+        * config.h: Modified. Added Android-specific configuration.
+
+2009-11-20  Roland Steiner  <rolandsteiner@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Change default stylesheet to reset text indentation for ruby elements by default.
+        (https://bugs.webkit.org/show_bug.cgi?id=31247)
+
+        Test: fast/ruby/ruby-text-indent.html
+
+        * css/html.css: reset text-indent on <ruby> and <rt> elements
+
+2009-11-19  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Fixes <http://webkit.org/b/22754>.
+        Web Inspector: Keyboard shortcut for Element finder.
+
+        Use Command + Shift + C as a shortcut for Node Search, to 
+        match the Firebug shortcut to do the same thing.
+
+        * inspector/front-end/ElementsPanel.js:
+        (WebInspector.ElementsPanel.prototype.handleKeyEvent):
+
+2009-11-19  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31690
+        Make SocketStreamHandleCFNet work on Windows
+
+        * WebCore.vcproj/WebCore.vcproj: Added LoaderRunLoopCF.
+
+        * platform/network/ResourceHandle.h: Removed loaderRunLoop().
+
+        * platform/network/cf/LoaderRunLoopCF.cpp: Added.
+        (WebCore::emptyPerform):
+        (WebCore::runLoaderThread):
+        (WebCore::loaderRunLoop):
+        * platform/network/cf/LoaderRunLoopCF.h: Added.
+        Moved the run loop that we use for CFNetwork from ResourceHandle to its own file, because
+        it's needed for more than just resource loading.
+
+        * platform/network/cf/ResourceHandleCFNet.cpp: Use loaderRunLoop() from its new location.
+
+        * platform/network/cf/DNSCFNet.cpp: (WebCore::DNSResolveQueue::resolve): Ditto.
+
+        * platform/network/cf/SocketStreamHandle.h: Added static callbacks for forwarding events to
+        main thread.
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::SocketStreamHandle): Use loaderRunLoop() on Windows instead of
+        inoperable main run loop.
+
+        (WebCore::MainThreadEventCallbackInfo::MainThreadEventCallbackInfo): 
+        (WebCore::SocketStreamHandle::readStreamCallback):
+        (WebCore::SocketStreamHandle::writeStreamCallback):
+        (WebCore::SocketStreamHandle::readStreamCallbackMainThread):
+        (WebCore::SocketStreamHandle::writeStreamCallbackMainThread):
+        Forward stream events to main thread on Windows.
+
+2009-11-19  Avi Drissman  <avi@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Quick style fix.
+        https://bugs.webkit.org/show_bug.cgi?id=27777
+
+        * platform/graphics/cg/PDFDocumentImage.cpp:
+
+2009-11-19  Beth Dakin  <bdakin@apple.com>
+
+       Build fix. No review needed.
+
+        * platform/chromium/ScrollbarThemeChromium.cpp:
+        (WebCore::ScrollbarThemeChromium::paintTickmarks):
+        * rendering/RenderMediaControlsChromium.cpp:
+        (WebCore::paintMediaButton):
+
+2009-11-19  Beth Dakin  <bdakin@apple.com>
+      
+       Build fix. No review needed.
+
+        * rendering/RenderThemeChromiumSkia.cpp:
+        (WebCore::RenderThemeChromiumSkia::paintCheckbox):
+        (WebCore::RenderThemeChromiumSkia::paintRadio):
+        (WebCore::RenderThemeChromiumSkia::paintSearchFieldCancelButton):
+        (WebCore::RenderThemeChromiumSkia::paintSearchFieldResultsDecoration):
+        (WebCore::RenderThemeChromiumSkia::paintSearchFieldResultsButton):
+
+2009-11-19  Beth Dakin  <bdakin@apple.com>
+
+       Build fix. No review needed.
+
+        * platform/graphics/qt/StillImageQt.cpp:
+        (WebCore::StillImage::draw):
+        * platform/graphics/qt/StillImageQt.h:
+
+2009-11-19  Beth Dakin  <bdakin@apple.com>
+
+       Build fix. No review needed.
+
+        * rendering/RenderThemeWin.cpp:
+        (WebCore::RenderThemeWin::paintSearchFieldCancelButton):
+        (WebCore::RenderThemeWin::paintSearchFieldResultsDecoration):
+        (WebCore::RenderThemeWin::paintSearchFieldResultsButton):
+
+2009-11-19  Beth Dakin  <bdakin@apple.com>
+
+       Build fix. No review needed.
+
+        * plugins/PluginView.cpp:
+        (WebCore::PluginView::paintMissingPluginIcon):
+
+2009-11-19  Beth Dakin  <bdakin@apple.com>
+
+        Build fix. No review needed.
+
+        * platform/graphics/win/ImageCGWin.cpp:
+        (WebCore::BitmapImage::getHBITMAPOfSize):
+        (WebCore::BitmapImage::drawFrameMatchingSourceSize):
+
+2009-11-19  Beth Dakin  <bdakin@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Fix for https://bugs.webkit.org/show_bug.cgi?id=31321 Make -webkit-
+        color-correction work with untagged images
+
+        Image's draw(), drawPattern(), and fillWithSolidColor() functions 
+        now take a ColorSpace. A bunch of classes inherit from Image, so 
+        draw() and drawPattern() functions there must also take a 
+        ColorSpace.
+        * platform/graphics/Image.cpp:
+        (WebCore::Image::fillWithSolidColor):
+        (WebCore::Image::drawTiled):
+        * platform/graphics/Image.h:
+        * platform/graphics/BitmapImage.h:
+        * platform/graphics/GeneratedImage.cpp:
+        (WebCore::GeneratedImage::draw):
+        (WebCore::GeneratedImage::drawPattern):
+        * platform/graphics/GeneratedImage.h:
+        * platform/graphics/cg/PDFDocumentImage.cpp:
+        (WebCore::PDFDocumentImage::draw):
+        * platform/graphics/cg/PDFDocumentImage.h:
+        * svg/graphics/SVGImage.cpp:
+        (WebCore::SVGImage::draw):
+        * svg/graphics/SVGImage.h:
+
+        All of the drawImage() functions and drawTiled() functions of 
+        GraphicsContext now take a ColorSpace.
+        * platform/graphics/GraphicsContext.cpp:
+        (WebCore::GraphicsContext::drawImage):
+        (WebCore::GraphicsContext::drawTiledImage):
+        * platform/graphics/GraphicsContext.h:
+
+        This is where the actual work is done.
+        * platform/graphics/cg/ImageCG.cpp:
+        (WebCore::imageWithColorSpace): New static function that returns a 
+        copy of the given image in the given ColorSpace *IF* we should use 
+        the given ColorSpace. We will ignore the color space if the image 
+        is tagged and return 0. 
+        (WebCore::BitmapImage::draw): Now takes a ColorSpace and uses it to 
+        call imageWithColorSpace(). 
+        (WebCore::Image::drawPattern): Same.
+
+        Attempt to keep all ports building. 
+        * platform/graphics/cairo/ImageCairo.cpp:
+        (WebCore::BitmapImage::draw):
+        (WebCore::Image::drawPattern):
+        * platform/graphics/haiku/ImageHaiku.cpp:
+        (WebCore::BitmapImage::draw):
+        (WebCore::Image::drawPattern):
+        * platform/graphics/qt/ImageQt.cpp:
+        (WebCore::Image::drawPattern):
+        (WebCore::BitmapImage::draw):
+        * platform/graphics/skia/BitmapImageSingleFrameSkia.h:
+        * platform/graphics/skia/ImageSkia.cpp:
+        (WebCore::Image::drawPattern):
+        (WebCore::BitmapImage::draw):
+        (WebCore::BitmapImageSingleFrameSkia::draw):
+        * platform/graphics/wx/ImageWx.cpp:
+        (WebCore::BitmapImage::draw):
+        (WebCore::BitmapImage::drawPattern):
+
+        Callers of GraphicsContext's drawImage() and drawTiled() functions 
+        now need to send a ColorSpace.
+        * html/HTMLCanvasElement.cpp:
+        (WebCore::HTMLCanvasElement::paint):
+        * html/canvas/CanvasRenderingContext2D.cpp:
+        (WebCore::CanvasRenderingContext2D::drawImage):
+        (WebCore::CanvasRenderingContext2D::drawImageFromRect):
+        * platform/ScrollView.cpp:
+        (WebCore::ScrollView::wheelEvent):
+        * platform/graphics/filters/FEColorMatrix.cpp:
+        (WebCore::FEColorMatrix::apply):
+        * platform/graphics/filters/FEComposite.cpp:
+        (WebCore::FEComposite::apply):
+        * platform/graphics/filters/SourceGraphic.cpp:
+        (WebCore::SourceGraphic::apply):
+        * platform/mac/ScrollbarThemeMac.mm:
+        (WebCore::ScrollbarThemeMac::paint):
+        * rendering/RenderBoxModelObject.cpp:
+        (WebCore::RenderBoxModelObject::paintFillLayerExtended):
+        (WebCore::RenderBoxModelObject::paintNinePieceImage):
+        * rendering/RenderImage.cpp:
+        (WebCore::RenderImage::paintReplaced):
+        * rendering/RenderLayer.cpp:
+        (WebCore::RenderLayer::paintResizer):
+        * rendering/RenderListMarker.cpp:
+        (WebCore::RenderListMarker::paint):
+        * rendering/RenderSVGImage.cpp:
+        (WebCore::RenderSVGImage::paint):
+        * rendering/RenderWidget.cpp:
+        (WebCore::RenderWidget::paint):
+        * svg/graphics/SVGPaintServerPattern.cpp:
+        (WebCore::SVGPaintServerPattern::setup):
+        * svg/graphics/SVGResourceFilter.cpp:
+        (WebCore::SVGResourceFilter::applyFilter):
+        * svg/graphics/filters/SVGFEMerge.cpp:
+        (WebCore::FEMerge::apply):
+        * svg/graphics/filters/SVGFEOffset.cpp:
+        (WebCore::FEOffset::apply):
+        * svg/graphics/filters/SVGFETile.cpp:
+        (WebCore::FETile::apply):
+
+2009-11-19  Avi Drissman  <avi@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Properly create a CGImageRef on non-PLATFORM(MAC).
+        https://bugs.webkit.org/show_bug.cgi?id=27777
+
+        * platform/graphics/cg/ImageSourceCG.cpp:
+        (WebCore::sharedBufferGetBytesAtPosition):
+        (WebCore::sharedBufferRelease):
+        (WebCore::ImageSource::setData):
+        * platform/graphics/cg/ImageSourceCG.h:
+        * platform/graphics/cg/PDFDocumentImage.cpp:
+        (WebCore::PDFDocumentImage::dataChanged):
+
+2009-11-19  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Dave Hyatt.
+
+        -webkit-user-drag: element Drag images include overflow decorations from incorrect nodes
+        https://bugs.webkit.org/show_bug.cgi?id=31656
+
+        Make sure we're a child of the painting root before drawing overflow features.
+
+        * manual-tests/user-drag-with-decorations.html: Added.
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::paint):
+
+2009-11-19  Dmitry Titov  <dimich@chromium.org>
+
+        Not reviewed, attempt to fix Chromium build.
+
+        * rendering/RenderMediaControlsChromium.cpp:
+        (WebCore::RenderMediaControlsChromium::paintMediaControlsPart): Add new enum values for Show/HideClosedCaptionButton to make it compile.
+
+2009-11-19  Rahul Kuchhal  <kuchhal@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Do not assert when a high number is used for roman numerals in lists.
+        https://bugs.webkit.org/show_bug.cgi?id=31652
+
+        Test: fast/lists/ol-start-roman.html
+
+        * rendering/RenderListMarker.cpp:
+        (WebCore::toRoman): Increase the char array size.
+
+2009-11-19  Gustavo Noronha Silva  <gustavo.noronha@collabora.co.uk>
+
+        Rubber-stamped by Oliver Hunt.
+
+        Add translatable strings to cover validationMessage, after
+        r51172. Already covered by existing test.
+
+        * platform/gtk/LocalizedStringsGtk.cpp:
+        (WebCore::validationMessageValueMissingText):
+        (WebCore::validationMessageTypeMismatchText):
+        (WebCore::validationMessagePatternMismatchText):
+        (WebCore::validationMessageTooLongText):
+        (WebCore::validationMessageRangeUnderflowText):
+        (WebCore::validationMessageRangeOverflowText):
+        (WebCore::validationMessageStepMismatchText):
+
+2009-11-19  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Darin Adler.
+
+        Remove HAVE(FLOAT_H) guard
+        https://bugs.webkit.org/show_bug.cgi?id=31661
+
+        WebCore has a dependency on float.h, there is
+        no need to guard float.h.
+
+        No new tests as there is no functional change.
+
+        * html/HTMLInputElement.cpp: Remove include directive
+        for float.h as it is included in MathExtras.h already.
+
+2009-11-19  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Pavel Feldman.
+
+        Instrumentation should account for painting in compositing layers
+        https://bugs.webkit.org/show_bug.cgi?id=31674
+
+        Add calls to InspectorTimelineAgent for painting into compositing layers,
+        which is not accounted for in FrameView::paintContents().
+
+        * rendering/RenderLayerBacking.cpp:
+        (WebCore::RenderLayerBacking::paintIntoLayer):
+        Avoid fetching the FrameView multiple times.
+        
+        (WebCore::inspectorTimelineAgent):
+        (WebCore::RenderLayerBacking::paintContents):
+
+2009-11-19  Eric Carlson  <eric.carlson@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        <rdar://problem/7035231>
+        Support closed caption in <video> element
+
+        Test: media/media-captions.html
+
+        * WebCore.base.exp:
+        * accessibility/AccessibilityMediaControls.cpp:
+        (WebCore::AccessibilityMediaControl::controlTypeName):
+            Define ShowClosedCaptionsButton and HideClosedCaptionsButton.
+
+        * css/CSSPrimitiveValueMappings.h:
+        (WebCore::CSSPrimitiveValue::CSSPrimitiveValue):
+            Add MediaToggleClosedCaptionsButtonPart.
+
+        * css/CSSSelector.cpp:
+        (WebCore::CSSSelector::extractPseudoType):
+            Define and match mediaControlsToggleClosedCaptionsButton.
+
+        * css/CSSSelector.h:
+        (WebCore::CSSSelector::):
+        * css/CSSStyleSelector.cpp:
+        (WebCore::CSSStyleSelector::SelectorChecker::checkOneSelector):
+            Define and match PseudoMediaControlsToggleClosedCaptions.
+
+        * css/CSSValueKeywords.in:
+            Define and use media-toggle-closed-captions-button.
+
+        * css/mediaControls.css:
+        * css/mediaControlsQuickTime.css:
+            Add webkit-media-controls-toggle-closed-captions-button.
+
+        * html/HTMLMediaElement.cpp:
+        (WebCore::HTMLMediaElement::HTMLMediaElement): 
+            Initialize m_closedCaptionsVisible.
+        (WebCore::HTMLMediaElement::loadInternal): 
+            Set m_closedCaptionsVisible to false.
+        (WebCore::HTMLMediaElement::hasClosedCaptions): 
+        (WebCore::HTMLMediaElement::closedCaptionsVisible): 
+        (WebCore::HTMLMediaElement::setClosedCaptionsVisible): 
+            New, captions internal methods.
+        (WebCore::HTMLMediaElement::setWebkitClosedCaptionsVisible): 
+        (WebCore::HTMLMediaElement::webkitClosedCaptionsVisible): 
+        (WebCore::HTMLMediaElement::webkitHasClosedCaptions): 
+            New, captions DOM API.
+
+        * html/HTMLMediaElement.h:
+        * html/HTMLMediaElement.idl:
+            Declare methods needed for captions API.
+
+        * platform/ThemeTypes.h:
+            Add MediaToggleClosedCaptionsButtonPart.
+
+        * platform/android/LocalizedStringsAndroid.cpp:
+        (WebCore::localizedMediaControlElementString):
+        (WebCore::localizedMediaControlElementHelpText):
+        (WebCore::localizedMediaTimeDescription):
+            Add empty implmentations.
+
+        * platform/graphics/MediaPlayer.cpp:
+        (WebCore::NullMediaPlayerPrivate::hasClosedCaptions):
+        (WebCore::NullMediaPlayerPrivate::setClosedCaptionsVisible):
+            New, empty implementations of media engine closed caption functions.
+        (WebCore::MediaPlayer::hasClosedCaptions):
+        (WebCore::MediaPlayer::setClosedCaptionsVisible):
+            New, call media engine closed caption functions.
+
+        * platform/graphics/MediaPlayer.h:
+        * platform/graphics/MediaPlayerPrivate.h:
+        (WebCore::MediaPlayerPrivateInterface::hasClosedCaptions):
+        (WebCore::MediaPlayerPrivateInterface::setClosedCaptionsVisible):
+            Declare new media engine methods.
+
+        * platform/graphics/mac/MediaPlayerPrivateQTKit.h:
+        * platform/graphics/mac/MediaPlayerPrivateQTKit.mm:
+        (WebCore::MediaPlayerPrivate::hasClosedCaptions):
+        (WebCore::MediaPlayerPrivate::setClosedCaptionsVisible):
+            New, QTKit implementation of closed caption methods.
+
+        * platform/gtk/LocalizedStringsGtk.cpp:
+        (WebCore::localizedMediaControlElementString):
+        (WebCore::localizedMediaControlElementHelpText):
+            Add help text for ShowClosedCaptionsButton and HideClosedCaptionsButton.
+
+        * platform/mac/WebCoreSystemInterface.h:
+        * platform/mac/WebCoreSystemInterface.mm:
+            Declare and initialize wkQTMovieHasClosedCaptions and wkQTMovieSetShowClosedCaptions.
+
+        * rendering/MediaControlElements.cpp:
+        (WebCore::MediaControlInputElement::MediaControlInputElement):
+            Deal with MEDIA_CONTROLS_TOGGLE_CLOSED_CAPTIONS_BUTTON.
+        (WebCore::MediaControlToggleClosedCaptionsButtonElement::MediaControlToggleClosedCaptionsButtonElement):
+        (WebCore::MediaControlToggleClosedCaptionsButtonElement::defaultEventHandler):
+        (WebCore::MediaControlToggleClosedCaptionsButtonElement::updateDisplayType):
+            New, implement the closed caption toggle button,
+
+        * rendering/MediaControlElements.h:
+            Define MediaShowClosedCaptionsButton and MediaHideClosedCaptionsButton,
+            declare MediaControlToggleClosedCaptionsButtonElement.
+
+        * rendering/RenderMedia.cpp:
+        (WebCore::RenderMedia::styleDidChange):
+        (WebCore::RenderMedia::createToggleClosedCaptionsButton):
+        (WebCore::RenderMedia::createStatusDisplay):
+        (WebCore::RenderMedia::updateControls):
+        (WebCore::RenderMedia::forwardEvent):
+        * rendering/RenderMedia.h:
+            Deal with m_toggleClosedCaptionsButton.
+
+        * rendering/RenderTheme.cpp:
+        (WebCore::RenderTheme::paint):
+            Deal with MediaToggleClosedCaptionsButtonPart.
+
+        * rendering/RenderTheme.h:
+        * rendering/RenderThemeMac.h:
+            Declare paintMediaToggleClosedCaptionsButton.
+
+        * rendering/RenderThemeMac.mm:
+        (WebCore::RenderThemeMac::paintMediaToggleClosedCaptionsButton):
+            New.
+        (WebCore::RenderThemeMac::shouldRenderMediaControlPart):
+            Don't render captions toggle button unless we are using the new theme, the
+            movie has captions, and the movie is in a <video> element since we currently
+            rely on QTKit to render the captions.
+
+        * rendering/style/RenderStyleConstants.h:
+            Define MEDIA_CONTROLS_TOGGLE_CLOSED_CAPTIONS_BUTTON.
+
+2009-11-19  Kevin Ollivier  <kevino@theolliviers.com>
+
+        wx build fix. Add missing header.
+
+        * platform/wx/LocalizedStringsWx.cpp:
+
+2009-11-19  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31634
+        Ignore realm for proxy protection spaces
+
+        Only affects WebSocket proxy authentication, cannot be tested in DRT.
+
+        * platform/network/ProtectionSpace.cpp:
+        (WebCore::operator==):
+        * platform/network/ProtectionSpaceHash.h:
+        (WebCore::ProtectionSpaceHash::hash):
+
+2009-11-19  Olivier Goffart  <ogoffart@trolltech.com>
+
+        Reviewed by Simon Hausmann.
+
+        [Qt] Normalize signal and slot signatures.
+
+        * platform/graphics/qt/MediaPlayerPrivatePhonon.cpp:
+        (WebCore::MediaPlayerPrivate::MediaPlayerPrivate):
+
+2009-11-19  Alexander Pavlov  <apavlov@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Store cookie domains in the WebInspector object
+
+        The cookie domains have been moved from StoragePanel into WebInspector.
+        Also, the document URLs are now passed inside the WebInspector.addResource()
+        payload rather than pushed directly from InspectorController.
+        https://bugs.webkit.org/show_bug.cgi?id=31627
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::populateScriptObjects):
+        (WebCore::InspectorController::didFinishLoading):
+        * inspector/InspectorFrontend.cpp:
+        * inspector/InspectorFrontend.h:
+        * inspector/InspectorResource.cpp:
+        (WebCore::InspectorResource::createScriptObject):
+        (WebCore::InspectorResource::updateScriptObject):
+        * inspector/front-end/StoragePanel.js:
+        (WebInspector.StoragePanel.prototype.reset):
+        (WebInspector.StoragePanel.prototype.addCookieDomain):
+        * inspector/front-end/inspector.js:
+        (WebInspector.addResource):
+        (WebInspector.addCookieDomain):
+        (WebInspector.reset):
+
+2009-11-19  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for the other part of platform directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=31585
+
+        Inherits the following classes from FastAllocBase because these are
+        instantiated by 'new':
+
+        class RegularExpression    - instantiated at: WebCore/page/Frame.cpp:415
+        class TransformationMatrix - instantiated at: WebCore/rendering/TransformState.cpp:62
+        class Path                 - instantiated at: WebCore/html/HTMLAreaElement.cpp:73
+        class FontPlatformData     - instantiated at: WebCore/platform/graphics/qt/FontCacheQt.cpp:188
+
+        Inherits the following classes from Noncopyable because these are
+        instantiated by 'new' and no need to be copyable:
+
+        class Cursors                         - instantiated at: WebCore/platform/qt/CursorQt.cpp:146
+        class NetworkStateNotifier            - instantiated at: WebCore/platform/network/NetworkStateNotifier.cpp:37
+        struct CrossThreadResourceRequestData - instantiated at: WebCore/platform/network/ResourceRequestBase.cpp:71
+
+        class ImageDecoder - its child class is instantiated at: WebCore/platform/graphics/qt/ImageDecoderQt.cpp:46
+        class MediaPlayerPrivateInterface - its child class is instantiated at: WebCore/platform/graphics/qt/MediaPlayerPrivatePhonon.cpp:119
+
+        * platform/graphics/MediaPlayerPrivate.h:
+        * platform/graphics/Path.h:
+        * platform/graphics/qt/FontPlatformData.h:
+        * platform/graphics/transforms/TransformationMatrix.h:
+        * platform/image-decoders/ImageDecoder.h:
+        * platform/network/NetworkStateNotifier.h:
+        * platform/network/ResourceRequestBase.h:
+        * platform/qt/CursorQt.cpp:
+        * platform/text/RegularExpression.h:
+
+2009-11-18  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Unreviewed.
+
+        [Qt] Build fix for QtWebKit after r51172.
+
+        * platform/qt/Localizations.cpp:
+        (WebCore::validationMessageValueMissingText):
+        (WebCore::validationMessageTypeMismatchText):
+        (WebCore::validationMessagePatternMismatchText):
+        (WebCore::validationMessageTooLongText):
+        (WebCore::validationMessageRangeUnderflowText):
+        (WebCore::validationMessageRangeOverflowText):
+        (WebCore::validationMessageStepMismatchText):
+
+2009-11-18  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        Fixed <rdar://problem/7398987> Assertion failure in
+        RenderLayer::updateClipRects when a plug-in’s enclosing layer is
+        enclosed by a transformed layer
+
+        Tests: fast/layers/clip-rects-transformed-2.html
+               fast/layers/clip-rects-transformed.html
+
+        * rendering/RenderLayer.cpp:
+        (WebCore::RenderLayer::clippingRoot): Added. Finds the nearest ancestor
+        that is either transformed or composited. During painting and hit
+        testing, when a transformed or composited layer is hit, it becomes the
+        new root layer, which ultimately gets passed to calculateRects().
+        (WebCore::RenderLayer::childrenClipRect): Pass the clipping root as the
+        root layer to calculateRects(), and return the bounding box of the
+        transformed rectangle.
+        (WebCore::RenderLayer::selfClipRect): Ditto.
+        * rendering/RenderLayer.h:
+
+2009-11-18  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Remove support for Qt v4.3 or older versions
+        https://bugs.webkit.org/show_bug.cgi?id=29469
+
+        No new tests as there is no change if compiled with 
+        Qt v4.4 or later version.
+
+        * WebCore.pro:
+        * dom/XMLTokenizerQt.cpp:
+        (WebCore::EntityResolver::resolveUndeclaredEntity):
+        (WebCore::XMLTokenizer::XMLTokenizer):
+        (WebCore::XMLTokenizer::~XMLTokenizer):
+        (WebCore::XMLTokenizer::doWrite):
+        (WebCore::XMLTokenizer::startDocument):
+        (WebCore::XMLTokenizer::parseDtd):
+        * platform/graphics/qt/FontQt.cpp:
+        * platform/graphics/qt/FontQt43.cpp: Removed.
+        * platform/graphics/qt/ImageQt.cpp:
+        * platform/network/ResourceHandleInternal.h:
+        * platform/network/qt/QNetworkReplyHandler.cpp:
+        * platform/network/qt/QNetworkReplyHandler.h:
+        * platform/network/qt/ResourceHandleQt.cpp:
+        (WebCore::ResourceHandle::start):
+        (WebCore::ResourceHandle::cancel):
+        (WebCore::ResourceHandle::loadResourceSynchronously):
+        (WebCore::ResourceHandle::setDefersLoading):
+        * platform/network/qt/ResourceRequest.h:
+        * platform/network/qt/ResourceRequestQt.cpp:
+        * platform/qt/ClipboardQt.cpp:
+        (WebCore::ClipboardQt::clearData):
+        * platform/qt/CookieJarQt.cpp:
+        (WebCore::cookieJar):
+        (WebCore::setCookies):
+        (WebCore::cookies):
+        (WebCore::cookiesEnabled):
+        * platform/qt/PlatformKeyboardEventQt.cpp:
+        (WebCore::keyIdentifierForQtKeyCode):
+        (WebCore::windowsKeyCodeForKeyEvent):
+        * platform/text/qt/TextBoundaries.cpp:
+        * platform/text/qt/TextBreakIteratorQt.cpp:
+        * plugins/qt/PluginDataQt.cpp:
+        (WebCore::PluginData::initPlugins):
+
+2009-11-18  Michelangelo De Simone  <micdesim@gmail.com>
+
+        Reviewed by Darin Adler.
+
+        Fix for <https://bugs.webkit.org/show_bug.cgi?id=27959>.
+        Support for validationMessage attribute, as per HTML5 specs.
+
+        Test: fast/forms/validationMessage.html
+
+        * html/HTMLButtonElement.idl: validationMessage attribute
+        * html/HTMLFieldSetElement.idl: validationMessage attribute
+        * html/HTMLFormControlElement.cpp:
+        * html/HTMLFormControlElement.h:
+        * html/HTMLInputElement.idl: validationMessage attribute
+        * html/HTMLSelectElement.idl: validationMessage attribute
+        * html/HTMLTextAreaElement.idl: validationMessage attribute
+        * html/ValidityState.cpp: new method to retrieve pertinent localized text
+        * html/ValidityState.h:
+        * page/mac/WebCoreViewFactory.h:
+        * platform/LocalizedStrings.h:
+        * platform/android/LocalizedStringsAndroid.cpp:
+        * platform/gtk/LocalizedStringsGtk.cpp:
+        * platform/haiku/LocalizedStringsHaiku.cpp:
+        * platform/mac/LocalizedStringsMac.mm:
+        * platform/wx/LocalizedStringsWx.cpp:
+
+2009-11-18  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Unreviewed.
+
+        Fix a typo. Remove the trailing semicolon
+        from an include directive after r51137.
+
+        No new tests as there is no functional change.
+
+        * platform/qt/QWebPageClient.h:
+
+2009-11-18  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Unreviewed.
+
+        [Qt] Build fix for QtWebKit after r51159.
+
+        Include float.h for DBL_MANT_DIG. Not sure why this
+        is not a problem for other ports.
+
+        * html/HTMLInputElement.cpp:
+
+2009-11-19  Roland Steiner  <rolandsteiner@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Bug 31574 -  Crashing bug when removing <ruby> element
+        (https://bugs.webkit.org/show_bug.cgi?id=31574)
+
+        Cause of the bug:
+        1.) RenderBlock::destroy() of the RenderRubyRun called destroyLeftoverChildren()
+        2.) that called destroy() of the RenderRubyBase(), which in RenderObject::destroy() calls remove()
+        3.) remove() is being redirected as parent()->removeChild() in RenderObject.h
+        4.) this triggers the special handling of child removal in RenderRubyRun that
+            causes it to destroy itself
+        5.) On returning from all this the renderer crashes when accessing a member
+            or virtual function on this now illegal object.
+
+        I therefore added a flag that tracks if the ruby run is being destroyed.
+        If so, avoid doing the special handling in removeChild that caused this.
+        It's not the most elegant solution, but the easiest to implement without
+        touching unrelated code. Also, it's self-documenting.
+
+        Test: fast/ruby/ruby-remove.html
+
+        * rendering/RenderRubyRun.cpp:
+        (WebCore::RenderRubyRun::RenderRubyRun):
+        (WebCore::RenderRubyRun::destroy):
+        (WebCore::RenderRubyRun::removeChild):
+        * rendering/RenderRubyRun.h:
+
+2009-11-18  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Remove WTF_USE_JAVASCRIPTCORE_BINDINGS as it is no longer used
+        https://bugs.webkit.org/show_bug.cgi?id=31643
+
+        No new tests as there is no functional change.
+
+        * WebCore.pro:
+
+2009-11-18  Yong Li  <yong.li@torchmobile.com>
+
+        Reviewed by Eric Seidel.
+
+        Implement TextBoundaries for WINCE port.
+        https://bugs.webkit.org/show_bug.cgi?id=27371
+
+        * platform/text/wince/TextBoundariesWince.cpp: Added.
+
+2009-11-18  Yong Li  <yong.li@torchmobile.com>
+
+        Reviewed by Eric Seidel.
+
+        Implement TextBreakIterator for WINCE port.
+        https://bugs.webkit.org/show_bug.cgi?id=27371
+
+        * platform/text/wince/TextBreakIteratorWince.cpp: Added.
+
+2009-11-18  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Add support for ValidityState.typeMismatch for the following INPUT types:
+          date datetime datetime-local month time week
+        https://bugs.webkit.org/show_bug.cgi?id=31342
+
+        Tests: fast/forms/ValidityState-typeMismatch-date.html
+               fast/forms/ValidityState-typeMismatch-datetime.html
+               fast/forms/ValidityState-typeMismatch-datetimelocal.html
+               fast/forms/ValidityState-typeMismatch-month.html
+               fast/forms/ValidityState-typeMismatch-time.html
+               fast/forms/ValidityState-typeMismatch-week.html
+
+        * html/HTMLInputElement.cpp:
+        (WebCore::HTMLInputElement::formStringToISODateTime): Check the type
+          validity of the specified type and string using the ISODateTime class.
+        * html/HTMLInputElement.h:
+        * html/ValidityState.cpp:
+        (WebCore::ValidityState::typeMismatch): Check the type validity
+          for date, datetime, datetime-local, month, time and week with
+          HTMLInputElemtn::formStringToISODateTime()
+
+2009-11-18  Maciej Stachowiak  <mjs@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        Fix REGRESSION (r47022): Performance of DocumentFragment.appendChild is 1000x slower sometimes
+        https://bugs.webkit.org/show_bug.cgi?id=31237
+        
+        Also speeds up Dromaeo DOM Core tests by 1.31x.
+
+        * bindings/js/JSNodeCustom.cpp:
+        (WebCore::JSNode::markChildren): Change marking algorithm to avoid O(N^2) behavior. The subtree
+        mark bit was no longer effective; instead I changed things so only a node that has no ancestors
+        with wrappers would do marking; there should be only one in the typical case (the root of the
+        detached subtree).
+        * dom/Node.cpp:
+        (WebCore::Node::Node): Remove now useless m_inSubtreeMark bit and related functions.
+        * dom/Node.h: ditto
+
+2009-11-18  Darin Adler  <darin@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        Get rid of the redundant strokeType and fillType data members on
+        a GraphicsContext as well as the FillOrStrokeType enum. Use
+        null pointers instead.
+
+        * platform/graphics/GraphicsContext.cpp:
+        (WebCore::GraphicsContext::setStrokeColor): Null out the pattern
+        and gradient.
+        (WebCore::GraphicsContext::setFillColor): Ditto.
+        (WebCore::GraphicsContext::setStrokePattern): Null out the graident.
+        (WebCore::GraphicsContext::setFillPattern): Ditto.
+        (WebCore::GraphicsContext::setStrokeGradient): Null out the pattern.
+        (WebCore::GraphicsContext::setFillGradient): Ditto.
+
+        * platform/graphics/GraphicsContextPrivate.h: Remove all that stuff.
+
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (WebCore::setPlatformFill): Use null checks on fillPattern and
+        fillGraident instead of a switch statement.
+        (WebCore::setPlatformStroke): Ditto.
+
+        * platform/graphics/cg/GraphicsContextCG.cpp:
+        (WebCore::GraphicsContext::applyStrokePattern): Removed unneeded get.
+        (WebCore::GraphicsContext::applyFillPattern): Ditto.
+        (WebCore::calculateDrawingMode): Use fillPattern and strokePattern
+        to see if there is a pattern instead of fillType and strokeType.
+        (WebCore::GraphicsContext::drawPath): Use fillGradient, strokeGradient,
+        fillPattern, and strokePattern instead of fillType and strokeType.
+        (WebCore::GraphicsContext::fillPath): Added FIXME about color space that
+        is used in the pattern and gradient case probably erroneously. Moved
+        gradient code inside an if statement. Streamlined pattern code and
+        use an if statement. No switch any more.
+        (WebCore::GraphicsContext::strokePath): Ditto.
+        (WebCore::GraphicsContext::fillRect): Ditto.
+        (WebCore::GraphicsContext::strokeRect): Ditto.
+
+        * platform/graphics/qt/GraphicsContextQt.cpp:
+        (WebCore::GraphicsContext::fillPath): Use null checks on fillPattern and
+        fillGraident instead of a switch statement.
+        (WebCore::GraphicsContext::strokePath): Ditto.
+        (WebCore::GraphicsContext::fillRect): Ditto.
+
+        * platform/graphics/wince/GraphicsContextWince.cpp:
+        (WebCore::GraphicsContext::fillPath): Removed unneeded check of fillType.
+        (WebCore::GraphicsContext::fillRect): Ditto.
+
+2009-11-18  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Support for step attribute and ValidityStae.stepMismatch for
+        type=number and range.  stepMismatch will be false if the
+        difference between the current value and a multiple of the step
+        value is very small.
+
+        Change the behavior of RenderSlider so that it always has a value
+        rounded to the step attribute value.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31331
+
+        Tests: fast/forms/ValidityState-stepMismatch-number.html
+               fast/forms/ValidityState-stepMismatch-range.html
+               fast/forms/ValidityState-stepMismatch-unsupported.html
+               fast/forms/input-step.html
+
+        * html/HTMLAttributeNames.in: Add "step".
+        * html/HTMLInputElement.cpp:
+        (WebCore::HTMLInputElement::stepMismatch):
+        (WebCore::HTMLInputElement::getStepParameters):
+        (WebCore::HTMLInputElement::getAllowedValueStep):
+        * html/HTMLInputElement.h:
+        * html/HTMLInputElement.idl: Add "step".
+        * html/ValidityState.cpp:
+        (WebCore::ValidityState::stepMismatch): Forward to HTMLInputElement::stepMismatch().
+        * html/ValidityState.h:
+        * rendering/RenderSlider.cpp:
+        (WebCore::SliderRange::SliderRange):
+        (WebCore::SliderRange::clampValue):
+
+2009-11-18  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Need to ASSERT(isMainThread()) in ThreadShared methods.
+        https://bugs.webkit.org/show_bug.cgi?id=31637
+
+        Added ASSERT(IsMainThread()) to all following methods:
+        * platform/TreeShared.h:
+        (WebCore::TreeShared::TreeShared):
+        (WebCore::TreeShared::~TreeShared):
+        (WebCore::TreeShared::ref):
+        (WebCore::TreeShared::deref):
+        (WebCore::TreeShared::setParent):
+        (WebCore::TreeShared::parent):
+
+2009-11-18  Girish Ramakrishnan  <girish@forwardbias.in>
+
+        Reviewed by Eric Seidel.
+
+        Add plugin visibility manual test
+
+        https://bugs.webkit.org/show_bug.cgi?id=31542
+
+        * manual-tests/plugins/windowed.html:
+        * manual-tests/plugins/windowless.html:
+
+2009-11-18  Patrick Mueller  <Patrick_Mueller@us.ibm.com>
+
+        Reviewed by Pavel Feldman.
+
+        Web Inspector - remember last script displayed in Scripts panel
+        https://bugs.webkit.org/show_bug.cgi?id=27552
+
+        Manual test added
+        
+        * inspector/front-end/ScriptsPanel.js:
+        (WebInspector.ScriptsPanel.prototype.showScript):
+        (WebInspector.ScriptsPanel.prototype.showResource):
+        (WebInspector.ScriptsPanel.prototype._showScriptOrResource):
+        (WebInspector.ScriptsPanel.prototype._addScriptToFilesMenu):
+        (WebInspector.ScriptsPanel.prototype._callFrameSelected):
+        (WebInspector.ScriptsPanel.prototype._goBack):
+        (WebInspector.ScriptsPanel.prototype._goForward):
+        * manual-tests/inspector/remember-last-script.html: Added.
+
+2009-11-18  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Win chromium is slow to draw transparent texts
+        https://bugs.webkit.org/show_bug.cgi?id=31258
+
+        Create bounded transparency layers instead of just clipping.
+
+        No new tests because this is just a performance improvement.
+
+        * platform/graphics/chromium/FontChromiumWin.cpp:
+        (WebCore::TransparencyAwareFontPainter::TransparencyAwareFontPainter::initializeForGDI):
+
+2009-11-18  Shu Chang  <Chang.Shu@nokia.com>
+
+        Reviewed by Eric Seidel.
+
+        [Qt] Add support for displaying deleteButton.
+        https://bugs.webkit.org/show_bug.cgi?id=31560
+
+        Test: LayoutTests/editing/deleting/5408255.html
+
+        * WebCore.qrc:
+        * platform/graphics/qt/ImageQt.cpp:
+        (loadResourcePixmap):
+
+2009-11-18  Mikhail Naganov  <mnaganov@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Fix Qt build without JavaScript debugger.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31575
+
+        * page/Console.idl:
+
+2009-11-18  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Dave Hyatt.
+
+        https://bugs.webkit.org/show_bug.cgi?id=24971
+        And
+        <rdar://problem/7138265>
+
+        Fixes an issue where setting the height of a table row programmatically
+        (via JavaScript) causes the table to be improperly rendered because the
+        height of each row in the table is not recalculated with respect to the
+        CSS height property.
+
+        In particular, programmatically setting the height of some table row causes
+        the rows of that table to be rendered with a height equal to the minimum
+        height required by the cells in that row, regardless of any specified cell
+        heights. Instead, when RenderTableSection::recalcCells is called, the height
+        of each row should be set to the CSS height property just as we do in
+        RenderTableSection::addChild.
+
+        Test: fast/table/row-height-recalc2.html
+
+        * rendering/RenderTableSection.cpp:
+        (WebCore::setRowHeightToRowStyleHeightIfNotRelative): Added.
+        (WebCore::RenderTableSection::addChild): Moved code that set row height into
+        method WebCore::setRowHeightToRowStyleHeightIfNotRelative.
+        (WebCore::RenderTableSection::recalcCells): Modified to call
+        WebCore::setRowHeightToRowStyleHeightIfNotRelative.
+
+2009-11-18  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for the part of platform directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=31473
+
+        Inherits the following classes from FastAllocBase because these are
+        instantiated by 'new':
+
+        class  AnimationList         - instantiated at WebCore/rendering/style/StyleRareNonInheritedData.cpp:85
+        class  Color                 - instantiated at WebCore/rendering/RenderTheme.cpp:48
+        struct Length                - instantiated at WebCore/platform/Length.cpp:103
+        class  PlatformKeyboardEvent - instantiated at WebCore/dom/KeyboardEvent.cpp:63
+        class  ContextMenuItem       - instantiated at WebCore/platform/ContextMenu.cpp:70
+        class  DeprecatedPtrList     - instantiated at WebCore/rendering/RenderBlock.cpp:2284
+
+        Inherits the following classes from Noncopyable because these are
+        instantiated by 'new' and no need to be copyable:
+
+        class  GraphicsContextPrivate - instantiated at WebCore/platform/graphics/GraphicsContext.cpp:78
+        class  FontCache              - instantiated at WebCore/platform/graphics/qt/FontCacheQt.cpp:43
+        struct MediaPlayerFactory     - instantiated at WebCore/platform/graphics/MediaPlayer.cpp:163
+        class  DeprecatedPtrListNode  - instantiated at WebCore/platform/DeprecatedPtrListImpl.cpp:53
+
+        * platform/ContextMenuItem.h:
+        * platform/DeprecatedPtrList.h:
+        * platform/DeprecatedPtrListImpl.cpp:
+        * platform/Length.h:
+        * platform/PlatformKeyboardEvent.h:
+        * platform/animation/AnimationList.h:
+        * platform/graphics/Color.h:
+        * platform/graphics/FontCache.h:
+        * platform/graphics/GraphicsContextPrivate.h:
+        * platform/graphics/MediaPlayer.cpp:
+
+2009-11-18  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31186
+
+        Renames RenderTextControl::m_edited and RenderTextControl::m_userEdited to
+        m_wasChangedSinceLastChangeEvent and m_lastChangeWasUserEdit, respectively.
+        These are more descriptive names so as to clear an ambiguity surrounding
+        their usage. Also, renames associated setters and getters so that they
+        coincide with the renamed fields.
+
+        No functionality was changed. So, no tests were included.
+
+        * bindings/objc/DOMHTML.mm:
+        (-[DOMHTMLInputElement _isEdited]):
+        (-[DOMHTMLTextAreaElement _isEdited]):
+        * dom/Document.cpp:
+        (WebCore::Document::setFocusedNode):
+        * html/HTMLInputElement.cpp:
+        (WebCore::HTMLInputElement::defaultEventHandler):
+        * rendering/RenderTextControl.cpp:
+        (WebCore::RenderTextControl::RenderTextControl):
+        (WebCore::RenderTextControl::setInnerTextValue):
+        (WebCore::RenderTextControl::setLastChangeWasUserEdit): Formerly named setUserEdited.
+        (WebCore::RenderTextControl::subtreeHasChanged):
+        * rendering/RenderTextControl.h:
+        (WebCore::RenderTextControl::wasChangedSinceLastChangeEvent): Formerly named isEdited.
+        (WebCore::RenderTextControl::setChangedSinceLastChangeEvent): Formerly named setEdited.
+        (WebCore::RenderTextControl::lastChangeWasUserEdit): Formerly named setUserEdited.
+        * rendering/RenderTextControlSingleLine.cpp:
+        (WebCore::RenderTextControlSingleLine::subtreeHasChanged):
+        * wml/WMLInputElement.cpp:
+        (WebCore::WMLInputElement::defaultEventHandler):
+
+2009-11-18  Tony Chang  <tony@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Remove V8CanvasPixelArrayCustom.cpp because it is no longer used by V8.
+        https://bugs.webkit.org/show_bug.cgi?id=31499
+
+        No new tests, just a build cleanup.
+
+        * WebCore.gypi:
+        * bindings/v8/custom/V8CanvasPixelArrayCustom.cpp: Removed.
+        * bindings/v8/custom/V8CustomBinding.h:
+
+2009-11-18  Kevin Watters  <kevinwatters@gmail.com>
+
+        Reviewed by Kevin Ollivier.
+
+        Enable wx plugin support using the Windows implementation as a base.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=31636
+
+        * platform/graphics/GraphicsContext.h:
+        (WebCore::GraphicsContext::inTransparencyLayer):
+        * platform/graphics/wx/GraphicsContextWx.cpp:
+        (WebCore::GraphicsContext::getWindowsContext):
+        (WebCore::GraphicsContext::releaseWindowsContext):
+        * platform/wx/FileSystemWx.cpp:
+        (WebCore::unloadModule):
+        (WebCore::listDirectory):
+        * plugins/PluginDatabase.cpp:
+        * plugins/PluginView.cpp:
+        (WebCore::PluginView::stop):
+        (WebCore::PluginView::PluginView):
+        * plugins/PluginView.h:
+        * plugins/win/PluginViewWin.cpp:
+        (windowHandleForPageClient):
+        (WebCore::PluginView::handleMouseEvent):
+        (WebCore::PluginView::platformStart):
+        (WebCore::PluginView::snapshot):
+        * wscript:
+
+2009-11-18  Andrei Popescu  <andreip@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        [Android] Add shared timer and sound utilities to platform/android
+        https://bugs.webkit.org/show_bug.cgi?id=31584
+
+        No new tests required, this is platform specific code.
+
+        * platform/android/SharedTimerAndroid.cpp: Added.
+        (WebCore::setSharedTimerFiredFunction):
+        (WebCore::setSharedTimerFireTime):
+        (WebCore::stopSharedTimer):
+        * platform/android/SoundAndroid.cpp: Added.
+        (WebCore::systemBeep):
+
+2009-11-18  Mikhail Naganov  <mnaganov@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Fix profile tree nodes loss after focus / restore actions.
+
+        Focusing on a node is currently implemented via nodes reattaching
+        with some caching involved. It seems that not all code was updated
+        to handle this scenario correctly.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31553
+
+        * inspector/front-end/BottomUpProfileDataGridTree.js:
+        (WebInspector.BottomUpProfileDataGridNode):
+        (WebInspector.BottomUpProfileDataGridNode.prototype._restore):
+        (WebInspector.BottomUpProfileDataGridNode.prototype._sharedPopulate):
+        (WebInspector.BottomUpProfileDataGridNode.prototype._willHaveChildren):
+        * inspector/front-end/DataGrid.js:
+        (WebInspector.DataGrid.prototype.insertChild):
+        (WebInspector.DataGridNode.prototype._detach):
+        (WebInspector.DataGridNode.prototype.savePosition):
+        (WebInspector.DataGridNode.prototype.restorePosition):
+        * inspector/front-end/TopDownProfileDataGridTree.js:
+        (WebInspector.TopDownProfileDataGridTree.prototype.focus):
+        (WebInspector.TopDownProfileDataGridTree.prototype.restore):
+
+2009-11-18  Carol Szabo  <carol.szabo@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] QWebPageClient.h needs in some cases QCursor, but it does not
+        include it 
+        https://bugs.webkit.org/show_bug.cgi?id=31527
+
+        No new tests as this is just a coding style fix that affects the 
+        build of some not yet submitted patches (i.e. for bug 30173).
+
+        * platform/qt/QWebPageClient.h:
+
+2009-11-18  Nicolas Roard   <nicolas@roard.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        InspectorTimelineAgent.h should be guarded by ENABLE(INSPECTOR)
+        https://bugs.webkit.org/show_bug.cgi?id=31504
+
+        * inspector/InspectorTimelineAgent.h:Added the guard.
+
+2009-11-18  Jens Alfke  <snej@chromium.org>
+
+        Build fix to my previous checkin, for Windows Chromium
+
+        * svg/SVGAnimatedProperty.h:
+        (WebCore::PropertySynchronizer::synchronize): Fix implicit-conversion error on AtomicString.
+
+2009-11-18  Joseph Pecoraro  <joepeck@webkit.org>
+
+        Reviewed by Pavel Feldman.
+
+        Web Inspector: Directly Access <head> Instead of Searching for It
+        https://bugs.webkit.org/show_bug.cgi?id=31641
+        
+        Changed old access of the head element (document.getElementsByTagName)
+        to just use the document.head accessor.
+
+        * inspector/front-end/FontView.js:
+        (WebInspector.FontView):
+        * inspector/front-end/InjectedScript.js:
+        (InjectedScript.addStyleSelector):
+        * inspector/front-end/SourceFrame.js:
+        (WebInspector.SourceFrame.prototype._loaded):
+        * inspector/front-end/inspector.js:
+        (windowLoaded):
+
+2009-11-18  Sam Weinig  <sam@webkit.org>
+
+        Reviewed by Anders Carlsson.
+
+        Fix two Geolocation assertions.
+
+        * page/Chrome.cpp:
+        (WebCore::Chrome::requestGeolocationPermissionForFrame): No need to use PageGroupLoadDeferrer since this
+        is not called from JS. 
+        * page/Geolocation.cpp:
+        (WebCore::Geolocation::Watchers::set): The PassRefPtr was getting nulled out, so we need to put it in
+        a RefPtr first.
+
+2009-11-18  Alexey Proskuryakov  <ap@apple.com>
+
+        Case sensitive file system build fix.
+
+        * platform/network/Credential.h: It's not WTF, just wtf.
+
+2009-11-18  Aaron Golden  <agolden@apple.com>
+
+        Reviewed by Alexey Proskuryakov.
+
+        Add support for certificates to WebCore::Credential so we can convert between NSURLCredential
+        objects and WebCore::Credential objects without losing certificate information.
+
+        * platform/network/Credential.cpp:
+        (WebCore::Credential::Credential):  Adding a constructor that takes an identity argument and a certificate chain argument
+        (WebCore::Credential::isEmpty):  Modifying isEmpty to support certificate based credentials (which don't have a username or password)
+        (WebCore::Credential::identity): Accessor for the m_identity property
+        (WebCore::Credential::certificates): Accessor for the m_certificates property
+        (WebCore::Credential::type):  Accessor for the m_type property
+        (WebCore::operator==):  Modifying == to compare the identity and certificate chains of certificate based credentials.
+        * platform/network/Credential.h:  Adding new fields to WebCore::Credential to support certificate based credentials.
+        * platform/network/mac/AuthenticationMac.mm:
+        (WebCore::mac):  Modifying the mac() conversion method to correctly convert certificate based WebCore::Credential objects.
+        (WebCore::core):  Modifying the core() conversion method to correctly convert certificate based NSURLCredential objects.
+
+2009-11-18  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Reverting r50919 that has introduced a non-thread-safe refcounting in ScriptExecutionContext::postTaskToMainThread.
+        https://bugs.webkit.org/show_bug.cgi?id=31615
+
+        * dom/Document.cpp:
+        (WebCore::ScriptExecutionContextTaskTimer::ScriptExecutionContextTaskTimer):
+        (WebCore::ScriptExecutionContextTaskTimer::fired):
+        (WebCore::PerformTaskContext::PerformTaskContext):
+        (WebCore::performTask):
+        (WebCore::Document::postTask):
+        * dom/ScriptExecutionContext.cpp:
+        * dom/ScriptExecutionContext.h:
+
+2009-11-18  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Eliminate unnecessary String-->AtomicString conversions from generated V8 bindings,
+        by causing the right v8-to-WebCore conversion function to be called for every parameter.
+        This no longer requires any IDL metadata, so I've removed the [HintAtomic] annotations.
+        To enforce correctness, I added a mode that disables implicit
+        String-->AtomicString conversions while compiling the generated bindings.
+        https://bugs.webkit.org/show_bug.cgi?id=31168
+
+        * bindings/scripts/CodeGeneratorV8.pm:  Generate usage of V8Parameter class.
+        * bindings/v8/DerivedSourcesAllInOne.cpp:  Enable NO_IMPLICIT_ATOMICSTRING.
+        * bindings/v8/V8Binding.h:  Add V8Parameter class.
+        * css/WebKitCSSKeyframesRule.h:  Make AtomicString conversions explicit.
+        * dom/Document.idl:  Remove obsolete [HintAtomic] annotation.
+        * platform/text/AtomicString.h:  Added NO_IMPLICIT_ATOMICSTRING option.
+        * svg/SVGAnimatedTemplate.h:  Change some return types to String to avoid implicit conversion.
+        * svg/SVGAnimatedProperty.h: Adapt to changed return types in SVGAnimatedTemplate.
+
+2009-11-18  Darin Adler  <darin@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        Move FillOrStrokeType out of public header.
+
+        * platform/graphics/GraphicsContext.h: Updated copyright date to cover
+        some years we published Apple changes, sorted forward declarations,
+        removed FillOrStrokeType enum.
+        * platform/graphics/GraphicsContextPrivate.h: Updated copyright date
+        to cover some years we published Apple changes, sorted includes,
+        moved FillOrStrokeType enum here.
+
+2009-11-18  Chris Marrin  <cmarrin@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        Add Settings for WebKitShowDebugBorders and WebKitShowRepaintCounter
+        https://bugs.webkit.org/show_bug.cgi?id=31601
+
+        These are used to debug accelerated compositing layers. I removed
+        the platform specific code from GraphicsLayerCA.mm and added calls
+        to GraphicsLayerClient to get it from the higher levels. The values 
+        now get cached in RenderLayerCompositing and are queried from there
+        by RenderLayerBacking (which implements the GraphicsLayerClient interface).
+
+        * WebCore.base.exp:
+        * page/FrameView.cpp:
+        (WebCore::FrameView::updateCompositingLayers):
+        * page/Settings.cpp:
+        (WebCore::Settings::Settings):
+        (WebCore::Settings::setShowDebugBorders):
+        (WebCore::Settings::setShowRepaintCounter):
+        * page/Settings.h:
+        (WebCore::Settings::showDebugBorders):
+        (WebCore::Settings::showRepaintCounter):
+        * platform/graphics/GraphicsLayer.h:
+        (WebCore::GraphicsLayer::showDebugBorders):
+        (WebCore::GraphicsLayer::showRepaintCounter):
+        * platform/graphics/GraphicsLayerClient.h:
+        * platform/graphics/mac/GraphicsLayerCA.mm:
+        * rendering/RenderLayerBacking.cpp:
+        (WebCore::RenderLayerBacking::showDebugBorders):
+        (WebCore::RenderLayerBacking::showRepaintCounter):
+        * rendering/RenderLayerBacking.h:
+        * rendering/RenderLayerCompositor.cpp:
+        (WebCore::RenderLayerCompositor::RenderLayerCompositor):
+        (WebCore::RenderLayerCompositor::cacheAcceleratedCompositingFlags):
+        * rendering/RenderLayerCompositor.h:
+        (WebCore::RenderLayerCompositor::showDebugBorders):
+        (WebCore::RenderLayerCompositor::showRepaintCounter):
+
+2009-11-18  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Get rid of metrics and properties sidebars'
+        flickering.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31629
+
+        * inspector/front-end/MetricsSidebarPane.js:
+        * inspector/front-end/PropertiesSidebarPane.js:
+
+2009-11-17  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Pavel Feldman.
+
+        Fixes <http://webkit.org/b/31606>.
+        Web Inspector: Enter/Return key should enter edit mode for Editable Fields.
+        
+        This implements Enter starting editing mode in an editable DataGrid. If the
+        DataGrid is editable and the user hits return, startEditing the first child
+        of the selected node. Also refactored some editing functions to take an 
+        event target instead of the event itself, because the functions only needed
+        the target. Lastly, added had return in editing mode stop propogation, because
+        when enter was hit to confirm text, it would propagate back to the datagrid
+        and try to start editing again.
+
+        * inspector/front-end/DataGrid.js:
+        (WebInspector.DataGrid.prototype._ondblclick):
+        (WebInspector.DataGrid.prototype._startEditing):
+        (WebInspector.DataGrid.prototype.handleKeyEvent):
+        (WebInspector.DataGrid.prototype.dataGridNodeFromEvent):
+        (WebInspector.DataGrid.prototype._mouseDownInDataTable):
+        (WebInspector.DataGrid.prototype._clickInDataTable):
+        * inspector/front-end/inspector.js:
+        (WebInspector.startEditing.element.handleKeyEvent):
+        (WebInspector.startEditing):
+
+2009-11-18  Ben Murdoch  <benm@google.com>
+
+        Reviewed by Darin Adler.
+
+        HTMLAnchorElement is inconsistent with its internal handling of the value returned for the href attribute.
+        https://bugs.webkit.org/show_bug.cgi?id=31593
+
+        Test: fast/dom/HTMLAnchorElement/set-href-attribute-whitespace.html
+
+        * html/HTMLAnchorElement.cpp:
+        (WebCore::HTMLAnchorElement::href): Add call to deprecatedParseURL.
+
+2009-11-18  Pavel Feldman  <pfeldman@chromium.org>
+
+        Not reviewed. Touch InspectorController so that frontend
+        JS files are deployed on Windows.
+
+        * inspector/InspectorController.cpp:
+
+2009-11-18  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: clone timeline records array instead of
+        copying reference on invalidate all.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31596
+
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype.invalidateAllItems):
+
+2009-11-18  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        Elements don't drop out of compositing layers when animation ends
+        https://bugs.webkit.org/show_bug.cgi?id=31613
+        <rdar://problem/7402913>
+
+        Avoid setting the mustOverlapCompositedLayers flag on RenderLayers which
+        are compositing anyway for other reasons. Doing so can cause those layers
+        to stay in compositing mode even after animations finish, because needsToBeComposited()
+        continues to return true.
+        
+        No new tests because it's not possible to determine which elements are in
+        compositing layers from DRT output.
+
+        * rendering/RenderLayerCompositor.cpp:
+        (WebCore::RenderLayerCompositor::computeCompositingRequirements):
+
+2009-11-18  Girish Ramakrishnan  <girish@forwardbias.in>
+
+        Reviewed by Tor Arne Vestbø.
+
+        [Qt] Mac Plugins: Remove null timer
+        
+        A null timer was used to send mouse move events. Instead, we now use
+        move events to send nullEvent. This brings down CPU usage by 20-30%.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=31624
+
+        * plugins/PluginView.h:
+        * plugins/mac/PluginViewMac.cpp:
+        (WebCore::PluginView::platformStart):
+        (WebCore::PluginView::handleMouseEvent):
+
+2009-11-18  Benjamin Poulain  <benjamin.poulain@nokia.com>
+
+        Reviewed by Simon Hausmann.
+
+        [Qt] WebKit crashes when loading certain SVG images
+
+        Check if the familly exist before creating the PlatformData from it.
+
+        https://bugs.webkit.org/show_bug.cgi?id=29443
+
+        Test: svg/text/text-font-invalid.html
+
+        * platform/graphics/qt/FontFallbackListQt.cpp:
+        (WebCore::FontFallbackList::fontDataAt):
+
+2009-11-17  Nicolas Weber  <thakis@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Fix crash in Chromium/Mac where dropdowns weren't dismissed correctly
+        after navigation.
+        https://bugs.webkit.org/show_bug.cgi?id=31609
+
+        * platform/chromium/PopupMenuChromium.cpp:
+        (WebCore::PopupContainer::showExternal): Set parent for external
+        dropdowns, so that |PopupListBox::hidePopup()| can successfully notify
+        its parent's client.
+
+2009-11-17  Hayato Ito  <hayato@google.com>
+
+        Reviewed by Darin Adler.
+
+        Avoid infinite mutual recursion when deeply nested tags are loaded
+        https://bugs.webkit.org/show_bug.cgi?id=30651
+
+        Test: fast/parser/block-nesting-cap-table.html
+
+        * html/HTMLParser.cpp:
+        (WebCore::HTMLParser::parseToken):
+        (WebCore::tagPriorityOfNode):
+        (WebCore::HTMLParser::limitBlockDepth):
+        (WebCore::HTMLParser::insertNodeAfterLimitBlockDepth):
+        (WebCore::HTMLParser::insertNode):
+        * html/HTMLParser.h:
+
+2009-11-17  Brent Fulgham  <bfulgham@webkit.org>
+
+        Rubber-stamped by Alexey Proskuryakov.
+
+        Final clean-ups for minor coding standard violations.
+        https://bugs.webkit.org/show_bug.cgi?id=26102.
+
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+
+2009-11-17  Johnny Ding  <jnd@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        In all valid script tags for JavaScript, the event handler in <script...for> should not get executed.
+        https://bugs.webkit.org/show_bug.cgi?id=31567
+
+        * dom/ScriptElement.cpp:
+        (WebCore::ScriptElementData::shouldExecuteAsJavaScript):
+
+2009-11-17  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Make DRT show web inspector for tests in inspector/ folder.
+        - Updated DRT to show/close inspector for all tests under /inspector
+        - Introduced LayoutTestController::setTimelineProfilingEnabled and
+          WebInspector::setTimelineProfilingEnabled beside setJavaScriptProfilingEnabled
+        - Removed reload on each inspector test
+        - Renamed fast/inspector to fast/inspector-support in order not to trigger
+        inspector for those.
+        - Reimplemented timeline tests in order to get rid of reload there.
+        - Moved tests that don't require harness into the fast group.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31472
+
+        * WebCore.Inspector.exp:
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._formatRecord):
+
+2009-11-17  Andrei Popescu  <andreip@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        [Android] Android is missing the implementation of the GeolocationService iface.
+        https://bugs.webkit.org/show_bug.cgi?id=31554
+
+        No new tests required as this is platform specific code.
+
+        * platform/android/GeolocationServiceAndroid.cpp: Added.
+        (WebCore::GeolocationServiceAndroid::create):
+        (WebCore::GeolocationServiceAndroid::GeolocationServiceAndroid):
+        (WebCore::GeolocationServiceAndroid::startUpdating):
+        (WebCore::GeolocationServiceAndroid::stopUpdating):
+        (WebCore::GeolocationServiceAndroid::suspend):
+        (WebCore::GeolocationServiceAndroid::resume):
+        (WebCore::GeolocationServiceAndroid::newPositionAvailable):
+        (WebCore::GeolocationServiceAndroid::newErrorAvailable):
+        (WebCore::GeolocationServiceAndroid::timerFired):
+        (WebCore::GeolocationServiceAndroid::isPositionMovement):
+        (WebCore::GeolocationServiceAndroid::isPositionMoreAccurate):
+        (WebCore::GeolocationServiceAndroid::isPositionMoreTimely):
+        * platform/android/GeolocationServiceAndroid.h: Added.
+        (WebCore::GeolocationServiceAndroid::~GeolocationServiceAndroid):
+        (WebCore::GeolocationServiceAndroid::lastPosition):
+        (WebCore::GeolocationServiceAndroid::lastError):
+        * platform/android/GeolocationServiceBridge.cpp: Added.
+        (WebCore::):
+        (WebCore::GeolocationServiceBridge::GeolocationServiceBridge):
+        (WebCore::GeolocationServiceBridge::~GeolocationServiceBridge):
+        (WebCore::GeolocationServiceBridge::start):
+        (WebCore::GeolocationServiceBridge::stop):
+        (WebCore::GeolocationServiceBridge::setEnableGps):
+        (WebCore::GeolocationServiceBridge::newLocationAvailable):
+        (WebCore::GeolocationServiceBridge::newErrorAvailable):
+        (WebCore::GeolocationServiceBridge::toGeoposition):
+        (WebCore::GeolocationServiceBridge::startJavaImplementation):
+        (WebCore::GeolocationServiceBridge::stopJavaImplementation):
+        * platform/android/GeolocationServiceBridge.h: Added.
+
+2009-11-16  Kent Tamura  <tkent@chromium.org>
+
+        Unreviewd build fix.
+
+        - Fix typo in WebCore.vcproj.
+        - Intlude limits.h for INT_MAX.
+        - Enclose with parenthesis to suspress warning.
+
+        * WebCore.vcproj/WebCore.vcproj:
+        * html/ISODateTime.cpp:
+        (WebCore::ISODateTime::addDay):
+
+2009-11-16  Robin Dunn  <robin@alldunn.com>
+
+        Reviewed by Kevin Ollivier.
+
+        Make sure wx scrollbar drawing code factors in transforms when switching backends,
+        fix calcs for scrollbar length, and tweak the Mac scrollbar tracking rects.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=31570
+
+        * platform/wx/ScrollbarThemeWx.cpp:
+        (WebCore::ScrollbarThemeWx::minimumThumbLength):
+        (WebCore::ScrollbarThemeWx::splitTrack):
+        (WebCore::ScrollbarThemeWx::forwardButtonRect):
+        * platform/wx/ScrollbarThemeWx.h:
+        * platform/wx/wxcode/gtk/scrollbar_render.cpp:
+        (wxRenderer_DrawScrollbar):
+        * platform/wx/wxcode/scrollbar_render.h:
+        (calcThumbStartAndLength):
+        * platform/wx/wxcode/win/scrollbar_render.cpp:
+        (wxRenderer_DrawScrollbar):
+
+2009-11-16  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by David Levin.
+
+        Introduce WebCore::ISODateTime class.
+        https://bugs.webkit.org/show_bug.cgi?id=31340
+
+        This class represents a value of date/time types of the HTML5 INPUT
+        element, and has some parsing methods for ISO 8601.
+
+        This change has no tests because the class is not used yet.
+
+        * GNUmakefile.am: Add ISODateTime.cpp and ISODateTime.h.
+        * WebCore.gypi: ditto.
+        * WebCore.pro: ditto.
+        * WebCore.vcproj/WebCore.vcproj: ditto.
+        * WebCore.xcodeproj/project.pbxproj: ditto.
+        * WebCoreSources.bkl: ditto.
+        * html/ISODateTime.cpp: Added. Implementation of WebCore::ISODateTime class.
+        (WebCore::isLeapYear):
+        (WebCore::maxDayOfMonth):
+        (WebCore::dayOfWeek):
+        (WebCore::ISODateTime::maxWeekNumberInYear):
+        (WebCore::countDigits):
+        (WebCore::toInt):
+        (WebCore::ISODateTime::parseYear): Private helper for parseDate() and parseWeek().
+        (WebCore::ISODateTime::addDay): Private helper for parseTimeZone().
+        (WebCore::ISODateTime::addMinute): ditto.
+        (WebCore::ISODateTime::parseTimeZone): Private helper for parseDateTime().
+        (WebCore::ISODateTime::parseMonth): Parser for <input type=month>.
+        (WebCore::ISODateTime::parseDate): Parser for <input type=date>.
+        (WebCore::ISODateTime::parseWeek): Parser for <input type=week>.
+        (WebCore::ISODateTime::parseTime): Parser for <input type=time>.
+        (WebCore::ISODateTime::parseDateTimeLocal): Parser for <input type=datetime-local>.
+        (WebCore::ISODateTime::parseDateTime): Parser for <input type=datetime>.
+        * html/ISODateTime.h: Added.  Declare WebCore::ISODateTime class.
+        (WebCore::ISODateTime::ISODateTime):
+        (WebCore::ISODateTime::millisecond):
+        (WebCore::ISODateTime::second):
+        (WebCore::ISODateTime::minute):
+        (WebCore::ISODateTime::hour):
+        (WebCore::ISODateTime::monthDay):
+        (WebCore::ISODateTime::month):
+        (WebCore::ISODateTime::fullYear):
+        (WebCore::ISODateTime::week):
+
+2009-11-16  Alexey Proskuryakov  <ap@apple.com>
+
+        Fix a typo in previous commit.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp: #ifdef, not #if.
+
+2009-11-16  Alexey Proskuryakov  <ap@apple.com>
+
+        Fix a typo in previous commit.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+
+2009-11-16  Alexey Proskuryakov  <ap@apple.com>
+
+        Tiger build fix.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp: Define CFN_EXPORT, as this macro was named
+        differently in Tiger CFNetwork.
+
+2009-11-16  Dimitri Glazkov  <dglazkov@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        [KURLGoogle] setHostAndPort doesn't handle arguments without port correctly.
+
+        Fix a bug in the code that was dormant until http://trac.webkit.org/changeset/50784.
+
+        Covered by existing test: LayoutTests/fast/dom/HTMLAnchorElement/set-href-attribute-host.html
+
+        * platform/KURLGoogle.cpp:
+        (WebCore::KURL::setHostAndPort): Added handling of arguments without port specified.
+
+2009-11-16  Alexey Proskuryakov  <ap@apple.com>
+
+        Rubber-stamped by Jon Honeycutt.
+
+        A better Windows build fix
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp: (WebCore::SocketStreamHandle::createStreams):
+        Use a macro that inserts __declspec(dllimport) when appropriate for CFNetwork imports.
+
+2009-11-16  Yael Aharon  <yael.aharon@nokia.com>
+
+        Reviewed by Darin Adler.
+
+        Rename protocolIsValid to isValidProtocol.
+        https://bugs.webkit.org/show_bug.cgi?id=31503
+
+        This name change was suggested in https://bugs.webkit.org/show_bug.cgi?id=29972#c19.
+
+        No new tests since no new functionality was introduced.
+
+        * html/HTMLAnchorElement.cpp:
+        (WebCore::HTMLAnchorElement::setProtocol):
+        * platform/KURL.cpp:
+        (WebCore::isValidProtocol):
+        * platform/KURL.h:
+        * platform/KURLGoogle.cpp:
+        (WebCore::isValidProtocol):
+
+2009-11-16  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Beth Dakin.
+
+        AX: aria-labelledby duplicates some of its WAI-ARIA label
+        https://bugs.webkit.org/show_bug.cgi?id=31565
+
+        Test: accessibility/aria-labelledby-overrides-label.html
+
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::hasTextAlternative):
+        (WebCore::AccessibilityRenderObject::exposesTitleUIElement):
+        (WebCore::AccessibilityRenderObject::accessibilityIsIgnored):
+        * accessibility/AccessibilityRenderObject.h:
+
+2009-11-16  Nate Chapin  <japhet@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Handle the case of a null NPObject* in NPN_SetException in
+        the V8 bindings.  This allow out of process plugins calling
+        NPN_SetException to just send null instead of sending an
+        NPObject* that would be an address in a different 
+        process's memory space.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31561
+
+        * bindings/v8/NPV8Object.cpp:
+        (_NPN_SetException): Allow null NPObject* and just throw a general error.
+
+2009-11-16  Alexey Proskuryakov  <ap@apple.com>
+
+        Windows build fix.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp: (WebCore::SocketStreamHandle::createStreams):
+        Disable CONNECT proxies on Windows until WebKitSupportLibrary includes support for those.
+
+2009-11-14  Yael Aharon  <yael.aharon@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] ASSERT failure while running DRT
+        https://bugs.webkit.org/show_bug.cgi?id=30978
+
+        Add needed Structure typeInfo flags to QtRuntimeObjectImpl and QtRuntimeMethod.
+        These flags are needed after r49649, where HasDefaultmark was changed to OverrideMarkChildren.
+
+        * bridge/qt/qt_instance.cpp:
+        (JSC::Bindings::QtRuntimeObjectImp::createStructure):
+        * bridge/qt/qt_runtime.h:
+        (JSC::Bindings::QtRuntimeMethod::createStructure):
+
+2009-11-16  Mark Rowe  <mrowe@apple.com>
+
+        Attempt to fix the build.  Land a file that was missing from r51049.
+
+        * bindings/js/JSWebGLArrayHelper.h: Copied from WebCore/html/canvas/WebGLByteArray.idl.
+        (WebCore::setWebGLArrayFromArray):
+
+2009-11-16  Kenneth Russell  <kbr@google.com>
+
+        Reviewed by Oliver Hunt.
+
+        Update API of WebGLArray and friends
+        https://bugs.webkit.org/show_bug.cgi?id=31175
+
+        * bindings/js/JSWebGLArrayCustom.cpp:
+        (WebCore::toJS):
+        * bindings/js/JSWebGLArrayHelper.h: Added.
+        (WebCore::setWebGLArrayFromArray):
+        * bindings/js/JSWebGLByteArrayCustom.cpp:
+        (WebCore::JSWebGLByteArray::set):
+        * bindings/js/JSWebGLFloatArrayCustom.cpp:
+        (WebCore::JSWebGLFloatArray::set):
+        * bindings/js/JSWebGLIntArrayCustom.cpp:
+        (WebCore::JSWebGLIntArray::set):
+        * bindings/js/JSWebGLShortArrayCustom.cpp:
+        (WebCore::JSWebGLShortArray::set):
+        * bindings/js/JSWebGLUnsignedByteArrayCustom.cpp:
+        (WebCore::JSWebGLUnsignedByteArray::set):
+        * bindings/js/JSWebGLUnsignedIntArrayCustom.cpp:
+        (WebCore::JSWebGLUnsignedIntArray::set):
+        * bindings/js/JSWebGLUnsignedShortArrayCustom.cpp:
+        (WebCore::JSWebGLUnsignedShortArray::set):
+        * bindings/scripts/CodeGeneratorV8.pm:
+        * bindings/v8/V8DOMWrapper.cpp:
+        (WebCore::V8DOMWrapper::convertToV8Object):
+        * bindings/v8/custom/V8CustomBinding.h:
+        * bindings/v8/custom/V8WebGLArrayBufferCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8WebGLArrayCustom.h:
+        (WebCore::constructWebGLArray):
+        (WebCore::getWebGLArrayElement):
+        (WebCore::setWebGLArrayFromArray):
+        (WebCore::setWebGLArray):
+        * bindings/v8/custom/V8WebGLByteArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8WebGLFloatArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8WebGLIntArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8WebGLShortArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8WebGLUnsignedByteArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8WebGLUnsignedIntArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8WebGLUnsignedShortArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * html/canvas/WebGLArray.cpp:
+        (WebCore::WebGLArray::WebGLArray):
+        (WebCore::WebGLArray::~WebGLArray):
+        (WebCore::WebGLArray::setImpl):
+        * html/canvas/WebGLArray.h:
+        (WebCore::WebGLArray::isByteArray):
+        (WebCore::WebGLArray::isUnsignedByteArray):
+        (WebCore::WebGLArray::isShortArray):
+        (WebCore::WebGLArray::isUnsignedShortArray):
+        (WebCore::WebGLArray::isIntArray):
+        (WebCore::WebGLArray::isUnsignedIntArray):
+        (WebCore::WebGLArray::isFloatArray):
+        (WebCore::WebGLArray::buffer):
+        (WebCore::WebGLArray::baseAddress):
+        (WebCore::WebGLArray::byteOffset):
+        * html/canvas/WebGLArray.idl:
+        * html/canvas/WebGLArrayBuffer.cpp:
+        (WebCore::WebGLArrayBuffer::create):
+        (WebCore::WebGLArrayBuffer::WebGLArrayBuffer):
+        (WebCore::WebGLArrayBuffer::data):
+        (WebCore::WebGLArrayBuffer::byteLength):
+        (WebCore::WebGLArrayBuffer::~WebGLArrayBuffer):
+        * html/canvas/WebGLArrayBuffer.h:
+        * html/canvas/WebGLByteArray.cpp:
+        (WebCore::WebGLByteArray::create):
+        (WebCore::WebGLByteArray::byteLength):
+        (WebCore::WebGLByteArray::slice):
+        (WebCore::WebGLByteArray::set):
+        * html/canvas/WebGLByteArray.h:
+        (WebCore::WebGLByteArray::isByteArray):
+        (WebCore::WebGLByteArray::data):
+        (WebCore::WebGLByteArray::set):
+        (WebCore::WebGLByteArray::get):
+        (WebCore::WebGLByteArray::item):
+        * html/canvas/WebGLByteArray.idl:
+        * html/canvas/WebGLFloatArray.cpp:
+        (WebCore::WebGLFloatArray::create):
+        (WebCore::WebGLFloatArray::WebGLFloatArray):
+        (WebCore::WebGLFloatArray::length):
+        (WebCore::WebGLFloatArray::byteLength):
+        (WebCore::WebGLFloatArray::slice):
+        (WebCore::WebGLFloatArray::set):
+        * html/canvas/WebGLFloatArray.h:
+        (WebCore::WebGLFloatArray::isFloatArray):
+        (WebCore::WebGLFloatArray::data):
+        (WebCore::WebGLFloatArray::set):
+        (WebCore::WebGLFloatArray::get):
+        (WebCore::WebGLFloatArray::item):
+        * html/canvas/WebGLFloatArray.idl:
+        * html/canvas/WebGLIntArray.cpp:
+        (WebCore::WebGLIntArray::create):
+        (WebCore::WebGLIntArray::WebGLIntArray):
+        (WebCore::WebGLIntArray::length):
+        (WebCore::WebGLIntArray::byteLength):
+        (WebCore::WebGLIntArray::slice):
+        (WebCore::WebGLIntArray::set):
+        * html/canvas/WebGLIntArray.h:
+        (WebCore::WebGLIntArray::isIntArray):
+        (WebCore::WebGLIntArray::data):
+        (WebCore::WebGLIntArray::set):
+        (WebCore::WebGLIntArray::get):
+        (WebCore::WebGLIntArray::item):
+        * html/canvas/WebGLIntArray.idl:
+        * html/canvas/WebGLShortArray.cpp:
+        (WebCore::WebGLShortArray::create):
+        (WebCore::WebGLShortArray::WebGLShortArray):
+        (WebCore::WebGLShortArray::length):
+        (WebCore::WebGLShortArray::byteLength):
+        (WebCore::WebGLShortArray::slice):
+        (WebCore::WebGLShortArray::set):
+        * html/canvas/WebGLShortArray.h:
+        (WebCore::WebGLShortArray::isShortArray):
+        (WebCore::WebGLShortArray::data):
+        (WebCore::WebGLShortArray::set):
+        (WebCore::WebGLShortArray::get):
+        (WebCore::WebGLShortArray::item):
+        * html/canvas/WebGLShortArray.idl:
+        * html/canvas/WebGLUnsignedByteArray.cpp:
+        (WebCore::WebGLUnsignedByteArray::create):
+        (WebCore::WebGLUnsignedByteArray::WebGLUnsignedByteArray):
+        (WebCore::WebGLUnsignedByteArray::length):
+        (WebCore::WebGLUnsignedByteArray::byteLength):
+        (WebCore::WebGLUnsignedByteArray::slice):
+        (WebCore::WebGLUnsignedByteArray::set):
+        * html/canvas/WebGLUnsignedByteArray.h:
+        (WebCore::WebGLUnsignedByteArray::isUnsignedByteArray):
+        (WebCore::WebGLUnsignedByteArray::data):
+        (WebCore::WebGLUnsignedByteArray::set):
+        (WebCore::WebGLUnsignedByteArray::get):
+        (WebCore::WebGLUnsignedByteArray::item):
+        * html/canvas/WebGLUnsignedByteArray.idl:
+        * html/canvas/WebGLUnsignedIntArray.cpp:
+        (WebCore::WebGLUnsignedIntArray::create):
+        (WebCore::WebGLUnsignedIntArray::WebGLUnsignedIntArray):
+        (WebCore::WebGLUnsignedIntArray::length):
+        (WebCore::WebGLUnsignedIntArray::byteLength):
+        (WebCore::WebGLUnsignedIntArray::slice):
+        (WebCore::WebGLUnsignedIntArray::set):
+        * html/canvas/WebGLUnsignedIntArray.h:
+        (WebCore::WebGLUnsignedIntArray::isUnsignedIntArray):
+        (WebCore::WebGLUnsignedIntArray::data):
+        (WebCore::WebGLUnsignedIntArray::set):
+        (WebCore::WebGLUnsignedIntArray::get):
+        (WebCore::WebGLUnsignedIntArray::item):
+        * html/canvas/WebGLUnsignedIntArray.idl:
+        * html/canvas/WebGLUnsignedShortArray.cpp:
+        (WebCore::WebGLUnsignedShortArray::create):
+        (WebCore::WebGLUnsignedShortArray::WebGLUnsignedShortArray):
+        (WebCore::WebGLUnsignedShortArray::length):
+        (WebCore::WebGLUnsignedShortArray::byteLength):
+        (WebCore::WebGLUnsignedShortArray::slice):
+        (WebCore::WebGLUnsignedShortArray::set):
+        * html/canvas/WebGLUnsignedShortArray.h:
+        (WebCore::WebGLUnsignedShortArray::isUnsignedShortArray):
+        (WebCore::WebGLUnsignedShortArray::data):
+        (WebCore::WebGLUnsignedShortArray::set):
+        (WebCore::WebGLUnsignedShortArray::get):
+        (WebCore::WebGLUnsignedShortArray::item):
+        * html/canvas/WebGLUnsignedShortArray.idl:
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::GraphicsContext3D::bufferData):
+        (WebCore::GraphicsContext3D::bufferSubData):
+
+2009-11-16  Alexey Proskuryakov  <ap@apple.com>
+
+        Windows build fix.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp: Declare constants as extern "C".
+
+2009-11-15  Brent Fulgham  <bfulgham@webkit.org>
+
+        Reviewed by Oliver Hunt.
+
+        Enable support for webkit-box-shadow in Cairo builds.
+        https://bugs.webkit.org/show_bug.cgi?id=26102.
+
+        Covered by existing fast/box-shadow tests.
+
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:  Add
+          support for fillRect shadows.
+
+2009-11-16  Alexey Proskuryakov  <ap@apple.com>
+
+        Windows build fix.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp: Don't try to include a file that's not
+        in WebKitSupportLibrary.
+
+2009-11-16  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31494
+        Add unauthenticated proxy support to SocketStreamHandleCFNet
+
+        Cannot be tested in DRT.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::chooseProxy): Fetch proxy information from OS.
+        (WebCore::SocketStreamHandle::createStreams): Apply it to the newly created streams.
+
+2009-11-14  Antonio Gomes  <tonikitoo@webkit.org>
+
+        Reviewed by Antti Koivisto.
+
+        [Qt] Broken back/forward after using ErrorPageExtension to set error page
+        https://bugs.webkit.org/show_bug.cgi?id=30573
+
+        Make FrameLoader::checkLoadCompleteForThisFrame method
+        to check for any working DocumentLoader instance (through
+        activeDocumentLoader()) instead of only checking for
+        'm_provisionalDocumentLoader' in order to decide to if
+        it is going to reset of not the back and forward history.
+        after an error page has been loaded.
+
+        Test: LayoutTests/fast/history/back-forward-reset-after-error-handling.html
+
+        * loader/FrameLoader.cpp:
+        (WebCore::FrameLoader::checkLoadCompleteForThisFrame):
+
+2009-11-14  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Need to implement ARIA role="directory"
+        https://bugs.webkit.org/show_bug.cgi?id=31516
+
+        Test: platform/mac/accessibility/aria-directory.html
+
+        * accessibility/AXObjectCache.cpp:
+        (WebCore::AXObjectCache::getOrCreate):
+        * accessibility/AccessibilityList.cpp:
+        (WebCore::AccessibilityList::isOrderedList):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::createARIARoleMap):
+
+2009-11-15  Dave Tapuska  <dtapuska@rim.com>
+
+        Reviewed by George Staikos.
+        
+        Compare UChars single unit at a time as opposed to the uint32_t
+        approach as casting to unaligned addresses may cause a bus failure
+        on ARMv5 and below. This change replicates the same defines that
+        exists in AtomicString.cpp
+
+        https://bugs.webkit.org/show_bug.cgi?id=31475
+        
+        * platform/text/StringHash.h:
+        (WebCore::StringHash::equal):
+
+2009-11-15  Evan Martin  <evan@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Wrap some SVG code in V8DOMWrapper with an ENABLE(SVG) test.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31490
+
+        * bindings/v8/V8DOMWrapper.cpp:
+
+2009-11-15  Maxime Simon  <simon.maxime@gmail.com>
+
+        Reviewed by Adam Barth.
+
+        [Haiku] Build fix. The FileChooser constructor doesn't need to be redefined.
+
+        * platform/haiku/FileChooserHaiku.cpp:
+
+2009-11-15  Maxime Simon  <simon.maxime@gmail.com>
+
+        Reviewed by Adam Barth.
+
+        [Haiku] Build fix. ColorSpace name had a wrong CamelCase.
+
+        * platform/graphics/haiku/GraphicsContextHaiku.cpp:
+        (WebCore::GraphicsContext::setPlatformStrokeColor):
+
+2009-11-15  Daniel Bates  <dbates@webkit.org>
+
+        No review, rolling out r50999.
+        http://trac.webkit.org/changeset/50999
+
+        Need to fix some issues in the Windows build. Missed some places where
+        RenderTextControl::isEdited is called.
+
+        * bindings/objc/DOMHTML.mm:
+        (-[DOMHTMLInputElement _isEdited]):
+        (-[DOMHTMLTextAreaElement _isEdited]):
+        * dom/Document.cpp:
+        (WebCore::Document::setFocusedNode):
+        * html/HTMLInputElement.cpp:
+        (WebCore::HTMLInputElement::defaultEventHandler):
+        * rendering/RenderTextControl.cpp:
+        (WebCore::RenderTextControl::RenderTextControl):
+        (WebCore::RenderTextControl::setInnerTextValue):
+        (WebCore::RenderTextControl::setUserEdited):
+        (WebCore::RenderTextControl::subtreeHasChanged):
+        * rendering/RenderTextControl.h:
+        (WebCore::RenderTextControl::isEdited):
+        (WebCore::RenderTextControl::setEdited):
+        (WebCore::RenderTextControl::isUserEdited):
+        * rendering/RenderTextControlSingleLine.cpp:
+        (WebCore::RenderTextControlSingleLine::subtreeHasChanged):
+        * wml/WMLInputElement.cpp:
+        (WebCore::WMLInputElement::defaultEventHandler):
+
+2009-11-15  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31186
+
+        Renames RenderTextControl::m_edited and RenderTextControl::m_userEdited to
+        m_wasChangedSinceLastChangeEvent and m_lastChangeWasUserEdit, respectively.
+        These are more descriptive names so as to clear an ambiguity surrounding
+        their usage. Also, renames associated setters and getters so that they
+        coincide with the renamed fields.
+
+        No functionality was changed. So, no tests were included.
+
+        * bindings/objc/DOMHTML.mm:
+        (-[DOMHTMLInputElement _isEdited]):
+        (-[DOMHTMLTextAreaElement _isEdited]):
+        * dom/Document.cpp:
+        (WebCore::Document::setFocusedNode):
+        * html/HTMLInputElement.cpp:
+        (WebCore::HTMLInputElement::defaultEventHandler):
+        * rendering/RenderTextControl.cpp:
+        (WebCore::RenderTextControl::RenderTextControl):
+        (WebCore::RenderTextControl::setInnerTextValue):
+        (WebCore::RenderTextControl::setLastChangeWasUserEdit): Formerly named setUserEdited.
+        (WebCore::RenderTextControl::subtreeHasChanged):
+        * rendering/RenderTextControl.h:
+        (WebCore::RenderTextControl::wasChangedSinceLastChangeEvent): Formerly named isEdited.
+        (WebCore::RenderTextControl::setChangedSinceLastChangeEvent): Formerly named setEdited.
+        (WebCore::RenderTextControl::lastChangeWasUserEdit): Formerly named setUserEdited.
+        * rendering/RenderTextControlSingleLine.cpp:
+        (WebCore::RenderTextControlSingleLine::subtreeHasChanged):
+        * wml/WMLInputElement.cpp:
+        (WebCore::WMLInputElement::defaultEventHandler):
+
+2009-11-14  Adele Peterson  <adele@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        Fix for <rdar://problem/6946165> Would like to be able to specify the number of visible lines when using -webkit-line-clamp
+
+        Test: fast/overflow/line-clamp.html
+
+        * css/CSSComputedStyleDeclaration.cpp: (WebCore::CSSComputedStyleDeclaration::getPropertyCSSValue): Updated to handle different types of values.
+        * css/CSSParser.cpp: (WebCore::CSSParser::parseValue): ditto.
+        * css/CSSStyleSelector.cpp: (WebCore::CSSStyleSelector::applyProperty): ditto.
+
+        * rendering/RenderFlexibleBox.cpp: (WebCore::RenderFlexibleBox::layoutVerticalBox):
+        Use the line count value if available.  Otherwise, convert the percentage to the line count, as we did before.  Also,
+        if there is anchor as the last child box, still allow adding the ellipsis.
+
+        * rendering/RenderLayer.cpp:
+        (WebCore::RenderLayer::scrollByRecursively): Call isNone on the LineClampValue to see if the line-clamp property has been set.
+        (WebCore::RenderLayer::scrollRectToVisible): ditto.
+
+        * WebCore.xcodeproj/project.pbxproj: Added LineClampValue.h
+        * rendering/style/LineClampValue.h: Added.
+        (WebCore::LineClampValue::LineClampValue):
+        (WebCore::LineClampValue::value):
+        (WebCore::LineClampValue::isPercentage):
+        (WebCore::LineClampValue::isNone):
+        (WebCore::LineClampValue::operator==):
+        (WebCore::LineClampValue::operator!=):
+        * rendering/style/RenderStyleConstants.h: (WebCore::): Define ELineClampType enum for percentage or line count.
+
+        * rendering/style/RenderStyle.h: Use LineClampValue.
+        (WebCore::InheritedFlags::lineClamp):
+        (WebCore::InheritedFlags::setLineClamp):
+        (WebCore::InheritedFlags::initialLineClamp):
+        * rendering/style/StyleRareNonInheritedData.h:
+
+2009-11-14  Eric Carlson  <eric.carlson@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        <rdar://problem/7287487> 
+        Do not use QuickTime version to detect media controller theme
+
+        * WebCore.base.exp: Export wkMediaControllerThemeAvailable
+        * platform/mac/WebCoreSystemInterface.h: Ditto.
+        * platform/mac/WebCoreSystemInterface.mm: Ditto.
+
+        * rendering/RenderThemeMac.mm:
+        (WebCore::mediaControllerTheme): Use wkMediaControllerThemeAvailable instead of the
+        QuickTime version to see if it is possible to use MediaControllerThemeQuickTime.
+
+2009-11-14  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        - Recognizes date/datetime/datetime-local/month/time/week types of INPUT element.
+          They have no dedicated UI and no type validation for now.
+        - Clean up setInputType() and formControlType() of HTMLInputElement.
+        https://bugs.webkit.org/show_bug.cgi?id=29004
+
+        Test: fast/forms/input-type-change3.html
+
+        * html/HTMLInputElement.cpp:
+        (WebCore::HTMLInputElement::valueMissing):
+        (WebCore::HTMLInputElement::patternMismatch):
+        (WebCore::HTMLInputElement::tooLong):
+        (WebCore::createTypeMap):
+        (WebCore::HTMLInputElement::setInputType):
+        (WebCore::createFormControlTypes):
+        (WebCore::HTMLInputElement::formControlType):
+        (WebCore::HTMLInputElement::saveFormControlState):
+        (WebCore::HTMLInputElement::restoreFormControlState):
+        (WebCore::HTMLInputElement::accessKeyAction):
+        (WebCore::HTMLInputElement::rendererIsNeeded):
+        (WebCore::HTMLInputElement::createRenderer):
+        (WebCore::HTMLInputElement::appendFormData):
+        (WebCore::HTMLInputElement::isTextField):
+        (WebCore::HTMLInputElement::valueWithDefault):
+        (WebCore::HTMLInputElement::storesValueSeparateFromAttribute):
+        (WebCore::HTMLInputElement::defaultEventHandler):
+        (WebCore::HTMLInputElement::isRequiredFormControl):
+        (WebCore::HTMLInputElement::dataList):
+        * html/HTMLInputElement.h:
+        (WebCore::HTMLInputElement::):
+
+2009-11-13  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Darin Adler.
+
+        WAI-ARIA: checkbox does not determine its label from text content
+        https://bugs.webkit.org/show_bug.cgi?id=31456
+
+        Test: accessibility/aria-checkbox-text.html
+
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::title):
+
+2009-11-13  Dimitri Glazkov  <dglazkov@chromium.org>
+
+        Unreviewed, build fix.
+
+        [Chromium] Fix build to catch up with http://trac.webkit.org/changeset/50973.
+        This is just enough changes to unbreak the port.
+
+        * bindings/v8/ScriptController.cpp:
+        (WebCore::mainThreadNormalWorld):
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::initContextIfNeeded):
+        * loader/FrameLoaderClient.h:
+
+2009-11-13  Aaron Boodman  <aa@chromium.org>
+
+        Unreviewed fix for Chromium build.
+
+        * loader/FrameLoaderClient.h:
+        (WebCore::FrameLoaderClient::dispatchDidClearWindowObjectInWorld):
+        Provide an empty implementation of this method because I don't know
+        what it is supposed to do on Chromium.
+
+2009-11-13  Aaron Boodman  <aa@chromium.org>
+
+        Unreviewed fix for Chromium build.
+
+        * loader/FrameLoader.h: Make dispatchDidClearWindowObjectsInAllWorlds()
+        public, as Chromium's V8Proxy calls it.
+
+2009-11-13  Aaron Boodman  <aa@chromium.org>
+
+        Unreviewed fix to Chromium build.
+
+        * bindings/v8/ScriptController.cpp:
+        (WebCore::ScriptController::getAllWorlds): 
+
+2009-11-13  Aaron Boodman  <aa@chromium.org>
+
+        Unreviewed fix for Chromium build.
+
+        * platform/text/TextBoundaries.cpp: Use longer path to refer to Unicode.h.
+
+2009-11-13  Adam Barth  <abarth@webkit.org>
+
+        Unreviewed partial build fix for Chromium.  Should fix failure #4.
+
+        * bindings/v8/ScriptController.cpp:
+        (WebCore::ScriptController::getAllWorlds):
+        * bindings/v8/ScriptController.h:
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::initContextIfNeeded):
+
+2009-11-13  Adam Barth  <abarth@webkit.org>
+
+        Unreviewed partial build fix for Chromium.
+
+        * bindings/v8/ScriptController.h:
+        (WebCore::ScriptController::getAllWorlds):
+
+2009-11-13  Eric Seidel  <eric@webkit.org>
+
+        No review, build fix only.
+
+        Fix Windows and Chromium builds after http://trac.webkit.org/changeset/50977.
+
+        Unify TextBoundaries implementations by only relying on WTF Unicode abstractions
+        https://bugs.webkit.org/show_bug.cgi?id=31468
+
+        * WebCore.gypi: Rename TextBoundariesICU -> TextBoundaries
+        * WebCore.vcproj/WebCore.vcproj: Rename TextBoundariesICU -> TextBoundaries
+
+2009-11-12  Jeremy Orlow  <jorlow@chromium.org>
+
+        Reviewed by Dmitry Titov.
+
+        LocalStorage quota should include key sizes in its count
+        https://bugs.webkit.org/show_bug.cgi?id=31451
+
+        * storage/StorageMap.cpp:
+        (WebCore::StorageMap::setItem):
+            Count keys in the quota when adding a new item.
+        (WebCore::StorageMap::removeItem):
+            Remove the key's length from the quota if we're removing the item.
+        (WebCore::StorageMap::importItem):
+            Assume that we're adding things for the first time.
+            Count keys in the quota.
+
+2009-11-13  Dominik Röttsches  <dominik.roettsches@access-company.com>
+
+        Reviewed by Eric Seidel.
+
+        Unify TextBoundaries implementations by only relying on WTF Unicode abstractions
+        https://bugs.webkit.org/show_bug.cgi?id=31468
+
+        Moving TextBoundariesICU.cpp to TextBoundaries.cpp
+        by removing the direct ICU dependency and replacing it
+        with WTF functions and WebCore's own TextBreakIterator
+        abstractions.
+
+        * GNUmakefile.am:
+        * platform/graphics/gtk/SimpleFontDataGtk.cpp:
+        * platform/text/TextBoundaries.cpp: Added.
+        (WebCore::findNextWordFromIndex):
+        (WebCore::findWordBoundary):
+        * platform/text/TextBoundariesICU.cpp: Removed.
+        * platform/text/TextBreakIterator.h:
+        * platform/text/TextBreakIteratorICU.cpp:
+        (WebCore::textBreakLast):
+        (WebCore::textBreakPrevious):
+
+2009-11-13  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        WebCore::externalRepresentation should update layout before getting render object
+        https://bugs.webkit.org/show_bug.cgi?id=31459
+
+        * rendering/RenderTreeAsText.cpp:
+        (WebCore::externalRepresentation):
+
+2009-11-13  Adam Roben  <aroben@apple.com>
+
+        Tell FrameLoaderClient when window objects in isolated worlds are
+        cleared
+
+        Fixes <http://webkit.org/b/31124> Tell the WebFrameLoadDelegate when
+        window objects in isolated worlds are cleared
+
+        Test: http/tests/security/isolatedWorld/didClearWindowObject.html
+
+        Reviewed by Dave Hyatt.
+
+        * bindings/js/JSDOMBinding.h:
+        (WebCore::WebCoreJSClientData::getAllWorlds): Added. Copies all the
+        worlds in m_worldSet to the passed-in Vector.
+
+        * bindings/js/ScriptController.cpp:
+        (WebCore::ScriptController::getAllWorlds): Added. Calls through to
+        WebCoreJSClientData.
+        (WebCore::ScriptController::initScript): Changed to call
+        FrameLoader::dispatchDidClearWindowObjectInWorld.
+
+        * bindings/js/ScriptController.h: Added getAllWorlds.
+
+        * loader/EmptyClients.h:
+        (WebCore::EmptyFrameLoaderClient::dispatchDidClearWindowObjectInWorld):
+        Updated for FrameLoaderClient change.
+
+        * loader/FrameLoader.cpp:
+        (WebCore::FrameLoader::receivedFirstData):
+        (WebCore::FrameLoader::begin):
+        Changed to call dispatchDidClearWindowObjectsInAllWorlds.
+
+        (WebCore::FrameLoader::dispatchDidClearWindowObjectsInAllWorlds):
+        Added. Retrieves all the worlds, then calls through to
+        dispatchDidClearWindowObjectInWorld for each one.
+        (WebCore::FrameLoader::dispatchDidClearWindowObjectInWorld): Replaces
+        dispatchWindowObjectAvailable. Calls up to the client, then, if the
+        world is the mainThreadNormalWorld(), tells the Inspector about it,
+        too.
+
+        * loader/FrameLoader.h: Replaced dispatchWindowObjectAvailable with
+        dispatchDidClearWindowObjectInWorld. Added
+        dispatchDidClearWindowObjectsInAllWorlds.
+
+        * loader/FrameLoaderClient.h: Replaced windowObjectCleared with
+        dispatchDidClearWindowObjectForWorld.
+
+2009-11-13  Vitaly Repeshko  <vitalyr@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        [V8] Fix SVG context assignment for pod types.
+        https://bugs.webkit.org/show_bug.cgi?id=31497
+
+        I broke this in r50958.
+
+        Tested by svg/custom/viewport-update2.svg.
+
+        * bindings/scripts/CodeGeneratorV8.pm:
+
+2009-11-13  Andrei Popescu  <andreip@google.com>
+
+        Reviewed by Dmitry Titov.
+
+        Bring the platform/android files inline with Android 2.0
+        https://bugs.webkit.org/show_bug.cgi?id=31423
+
+        No new tests required: these are all Android-specific files.
+
+        * platform/android/ClipboardAndroid.cpp:
+        (WebCore::ClipboardAndroid::files):
+        * platform/android/ClipboardAndroid.h:
+        * platform/android/FileChooserAndroid.cpp:
+        (WebCore::FileChooser::basenameForWidth):
+        (WebCore::fileButtonChooseFileLabel):
+        * platform/android/KeyEventAndroid.cpp:
+        (WebCore::PlatformKeyboardEvent::PlatformKeyboardEvent):
+        * platform/android/LocalizedStringsAndroid.cpp:
+        (WebCore::contextMenuItemTagOpenLinkInNewWindow):
+        (WebCore::contextMenuItemTagDownloadLinkToDisk):
+        (WebCore::contextMenuItemTagCopyLinkToClipboard):
+        (WebCore::contextMenuItemTagOpenImageInNewWindow):
+        (WebCore::contextMenuItemTagDownloadImageToDisk):
+        (WebCore::contextMenuItemTagCopyImageToClipboard):
+        (WebCore::contextMenuItemTagOpenFrameInNewWindow):
+        (WebCore::contextMenuItemTagCopy):
+        (WebCore::contextMenuItemTagGoBack):
+        (WebCore::contextMenuItemTagGoForward):
+        (WebCore::contextMenuItemTagStop):
+        (WebCore::contextMenuItemTagReload):
+        (WebCore::contextMenuItemTagCut):
+        (WebCore::contextMenuItemTagPaste):
+        (WebCore::contextMenuItemTagNoGuessesFound):
+        (WebCore::contextMenuItemTagIgnoreSpelling):
+        (WebCore::contextMenuItemTagLearnSpelling):
+        (WebCore::contextMenuItemTagSearchWeb):
+        (WebCore::contextMenuItemTagLookUpInDictionary):
+        (WebCore::contextMenuItemTagOpenLink):
+        (WebCore::contextMenuItemTagIgnoreGrammar):
+        (WebCore::contextMenuItemTagSpellingMenu):
+        (WebCore::contextMenuItemTagShowSpellingPanel):
+        (WebCore::contextMenuItemTagCheckSpelling):
+        (WebCore::contextMenuItemTagCheckSpellingWhileTyping):
+        (WebCore::contextMenuItemTagCheckGrammarWithSpelling):
+        (WebCore::contextMenuItemTagFontMenu):
+        (WebCore::contextMenuItemTagBold):
+        (WebCore::contextMenuItemTagItalic):
+        (WebCore::contextMenuItemTagUnderline):
+        (WebCore::contextMenuItemTagOutline):
+        (WebCore::contextMenuItemTagWritingDirectionMenu):
+        (WebCore::contextMenuItemTagTextDirectionMenu):
+        (WebCore::contextMenuItemTagDefaultDirection):
+        (WebCore::contextMenuItemTagLeftToRight):
+        (WebCore::contextMenuItemTagRightToLeft):
+        (WebCore::mediaElementLoadingStateText):
+        (WebCore::mediaElementLiveBroadcastStateText):
+        (WebCore::searchableIndexIntroduction):
+        (WebCore::resetButtonDefaultLabel):
+        (WebCore::submitButtonDefaultLabel):
+        (WebCore::inputElementAltText):
+        * platform/android/RenderThemeAndroid.cpp:
+        (WebCore::RenderTheme::themeForPage):
+        (WebCore::RenderThemeAndroid::baselinePosition):
+        (WebCore::RenderThemeAndroid::paintButton):
+        (WebCore::adjustMenuListStyleCommon):
+        (WebCore::RenderThemeAndroid::paintCombo):
+        * platform/android/ScreenAndroid.cpp:
+        * platform/android/ScrollViewAndroid.cpp:
+        (WebCore::ScrollView::platformOffscreenContentRectangle):
+        * platform/android/TemporaryLinkStubs.cpp:
+        (JSC::Bindings::dispatchJNICall):
+        * platform/android/WidgetAndroid.cpp:
+        (WebCore::Widget::setFrameRect):
+
+2009-11-13  Norbert Leser  <norbert.leser&nokia.com>
+
+        Reviewed by Eric Seidel.
+
+        Added macros for USERINCLUDE paths within symbian blocks
+        to guarantee inclusion of respective header files from local path
+        first (to avoid clashes with same names of header files in system include path).
+
+        * WebCore.pro:
+
+2009-11-13  Hironori Bono  <hbono@chromium.org>
+
+        Reviewed by Oliver Hunt.
+
+        Implement composition events introduced in DOM Level 3.
+        This change adds a new IDL which defines the composition events, adds a class which
+        implements the composition events, and sends the composition events according to
+        the specification.
+        https://bugs.webkit.org/show_bug.cgi?id=26310
+
+        Test: fast/events/ime-composition-events-001.html
+
+        * DerivedSources.make: Added CompositionEvent so we can compile "CompositionEvent.idl".
+        * GNUmakefile.am: Added "CompositionEvent.{cpp,h,idl}".
+        * WebCore.gypi: ditto.
+        * WebCore.pro: ditto
+        * WebCore.vcproj/WebCore.vcproj: ditto.
+        * WebCore.xcodeproj/project.pbxproj: Added "CompositionEvent.{cpp,h,idl}" and "JSCompositionEvent.{cpp,h}".
+        * WebCoreSources.bkl: Added "JSCompositionEvent.{cpp,h}".
+        * bindings/js/JSEventCustom.cpp:
+        (WebCore::toJS): Call isCompositionEvent() to create the CompositionEvent wrapper.
+        * bindings/v8/DOMObjectsInclude.h: Added "JSCompositionEvent.h".
+        * bindings/v8/DerivedSourcesAllInOne.cpp: Added "JSCompositionEvent.cpp".
+        * bindings/v8/V8DOMWrapper.cpp: Call isCompositionEvent() to identify an event as a CompositionEvent.
+        (WebCore::V8DOMWrapper::convertEventToV8Object):
+        * bindings/v8/V8Index.cpp: Added "V8CompositionEvent.h".
+        * bindings/v8/V8Index.h: Added V8Index::COMPOSITIONEVENT.
+        * dom/CompositionEvent.cpp: Implements the CompositionEvent class.
+        (WebCore::CompositionEvent::CompositionEvent):
+        (WebCore::CompositionEvent::~CompositionEvent):
+        (WebCore::CompositionEvent::initCompositionEvent):
+        (WebCore::CompositionEvent::isCompositionEvent):
+        * dom/CompositionEvent.h: Declares the CompositionEvent class.
+        (WebCore::CompositionEvent::create):
+        (WebCore::CompositionEvent::data):
+        * dom/CompositionEvent.idl: Added the IDL of DOM CompositionEvent.
+        * dom/Event.cpp:
+        (WebCore::Event::isCompositionEvent): Added a method to identify an event is a CompositionEvent.
+        * dom/Event.h:
+        * dom/EventNames.h: Added composition{start,update,end} to eventNames.
+        * editing/Editor.cpp:
+        (WebCore::Editor::confirmComposition): Sent a CompositionEnd event.
+        (WebCore::Editor::setComposition): Sent a Composition{Start,Update,End} event.
+
+2009-11-13  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Fix a link error in unofficial GCC 4.4 builds on Linux.
+        https://bugs.webkit.org/show_bug.cgi?id=31477
+
+        * bindings/v8/V8Binding.cpp:  Add explicit instantiations of v8StringToWebCoreString template.
+
+2009-11-13  Eric Seidel  <eric@webkit.org>
+
+        No review, build fix only.
+
+        Fix Debug build after http://trac.webkit.org/changeset/50960.
+
+        The CounterNode class does not support all methods necessary to efficiently update the counter tree as needed per CSS2.1
+        https://bugs.webkit.org/show_bug.cgi?id=31213
+
+        * rendering/CounterNode.cpp:
+        (WebCore::showTreeAndMark):
+        * rendering/RenderCounter.cpp:
+        (WebCore::destroyCounterNodeChildren):
+
+2009-11-13  Dirk Schulze  <krit@webkit.org>
+
+        Reviewed by Gustavo Noronha.
+
+        [CAIRO] shadow support for Canvas and SVG
+        [https://bugs.webkit.org/show_bug.cgi?id=30960]
+
+        We currently fill a path with solid color instead of filling
+        a clipping path. This causes problems on some composite operators,
+        since Cairo modifies the area outside the path.
+        This fixes the behavior of WebKitGtk on fast/canvas/canvas-composite-alpha.html
+
+        Thanks to Benjamin Otte for tracking the bug down.
+
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (WebCore::setPlatformFill):
+
+2009-11-12  Dumitru Daniliuc  <dumi@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Adding Chromium's DatabaseTracker implementation.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31440
+
+        * WebCore.gyp/WebCore.gyp:
+        * WebCore.gypi:
+        * storage/DatabaseTracker.h:
+        * storage/chromium/DatabaseTrackerChromium.cpp:
+        (WebCore::DatabaseTracker::fullPathForDatabase):
+        (WebCore::DatabaseTracker::getMaxSizeForDatabase):
+        * storage/chromium/QuotaTracker.cpp:
+        (WebCore::QuotaTracker::updateDatabaseSize):
+        * storage/chromium/QuotaTracker.h:
+
+2009-11-13  Carol Szabo  <carol.szabo@nokia.com>
+
+        Reviewed by Darin Adler.
+
+        The CounterNode class is missing some basic tree navigation methods common in other WebKit trees such as the rendering tree
+        https://bugs.webkit.org/show_bug.cgi?id=31213
+        Added tree navigation methods that permit full implementation of CSS2.1
+        counter feature without using recursion proportional to the counter
+        tree depth.
+        No new tests because I did not find any bug that is fixed by this
+        commit yet, this just reduces the size of the patch for 11031 and
+        helps respond to some concerns regarding that patch.
+
+        * rendering/CounterNode.cpp:
+        (WebCore::CounterNode::CounterNode):
+
+        (WebCore::CounterNode::nextInPreOrderAfterChildren):
+        (WebCore::CounterNode::nextInPreOrder):
+        Added to support non-recursive tree traversal necessary for
+        efficient full implementation of CSS2.1 counters.
+
+        (WebCore::CounterNode::lastDescendant):
+        (WebCore::CounterNode::previousInPreOrder):
+        Moved this methods such that they occupy a place similar to that of
+        identically named methods on the render tree. This allows for their
+        broader use needed in full implementation of CSS2.1 counters.
+
+        (WebCore::CounterNode::resetRenderer):
+        (WebCore::CounterNode::resetRenderers):
+        (WebCore::CounterNode::recount):
+        (WebCore::CounterNode::insertAfter):
+        (WebCore::CounterNode::removeChild):
+        Changed such that insertion/removal of a counter, triggers not only
+        recalculation of PrefixWidths, but also reassesment of values in
+        counter nodes. This is the basis full implementation of CSS2.1
+        counters. It does not change current behavior by much because of
+        changes needed to the recalculation algorithm, but those are comming
+        in the patch for 11031.
+        (WebCore::showTreeAndMark):
+        * rendering/CounterNode.h:
+        * rendering/RenderCounter.cpp:
+        (WebCore::counter):
+        Only changed argument type to prepare for implementation of Darin
+        Adler's recommendation for the patch to 11031.
+
+        (WebCore::RenderCounter::invalidate):
+        (WebCore::destroyCounterNodeChildren):
+        (WebCore::RenderCounter::destroyCounterNodes):
+        * rendering/RenderCounter.h:
+        * rendering/RenderObjectChildList.cpp:
+        (WebCore::invalidateCountersInContainer):
+        (WebCore::RenderObjectChildList::invalidateCounters):
+        * rendering/RenderObjectChildList.h:
+        Added the ability to restrict invalidation to counters with a given
+        identifier.
+        Also invalidated counters that are on the child container itself
+        which were missed by the previous algorithm, but were a valid case.
+
+2009-11-13  Vitaly Repeshko  <vitalyr@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        [V8] Protect SVG animated properties from destruction in bindings.
+        https://bugs.webkit.org/show_bug.cgi?id=31474
+
+        See http://crbug.com/26719.
+
+        Tested by LayoutTests/svg/custom/js-update-transform-addition.svg
+        under Valgrind.
+
+        Made sure we keep a reference to SVG properties while setting a
+        context:
+        * bindings/scripts/CodeGeneratorV8.pm:
+        * bindings/v8/V8Proxy.h:
+        (WebCore::V8Proxy::withSVGContext):
+
+2009-11-13  Brent Fulgham  <bfulgham@webkit.org>
+
+        Reviewed by Alexey Proskuryakov.
+
+        [CAIRO] shadow support for Canvas and SVG.
+        [https://bugs.webkit.org/show_bug.cgi?id=30960]
+
+        Incorporate Benjamin Otte's recommendations to avoid
+        a buffer overrun, and small performance improvement.
+
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (WebCore::copyContextProperties): Correctly size output
+         storage for cairo_get_dash to avoid buffer overrun.
+        (WebCore::drawPathShadow): Prefer cairo_fill_extents
+         to slower cairo_stroke_extents when not drawing shadows.
+
+2009-11-13  Dumitru Daniliuc  <dumi@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Do not register Chromium's HTML5 DB VFS as the default
+        VFS. Otherwise, other sqlite DB users in the same process will
+        stop working.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31462
+
+        * platform/sql/chromium/SQLiteFileSystemChromium.cpp:
+        (WebCore::SQLiteFileSystem::openDatabase):
+        * platform/sql/chromium/SQLiteFileSystemChromiumPosix.cpp:
+        (WebCore::SQLiteFileSystem::registerSQLiteVFS):
+        * platform/sql/chromium/SQLiteFileSystemChromiumWin.cpp:
+        (WebCore::SQLiteFileSystem::registerSQLiteVFS):
+
+2009-11-13  Alexey Proskuryakov  <ap@apple.com>
+
+        Windows build fix
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::SocketStreamHandle): Explicitly cast "-1" to CFOptionFlags,
+        avoiding a sign mismatch warning.
+
+2009-11-13  Alexey Proskuryakov  <ap@apple.com>
+
+        Release build fix.
+
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::readStreamCallback):
+        (WebCore::SocketStreamHandle::writeStreamCallback):
+        Use ASSERT_UNUSED for unused stream parameter.
+
+2009-11-12  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31441
+        Implement SocketStreamHandleCFNet
+
+        Existing WebSocket tests now pass on Mac. No proxy support yet.
+
+        * platform/network/SocketStreamHandleClient.h:
+        * platform/network/cf/SocketStreamHandle.h:
+        (WebCore::SocketStreamHandle::shouldUseSSL):
+        (WebCore::SocketStreamHandle::refAuthenticationClient):
+        (WebCore::SocketStreamHandle::derefAuthenticationClient):
+        (WebCore::SocketStreamHandle::):
+        * platform/network/cf/SocketStreamHandleCFNet.cpp:
+        (WebCore::SocketStreamHandle::SocketStreamHandle):
+        (WebCore::SocketStreamHandle::chooseProxy):
+        (WebCore::SocketStreamHandle::createStreams):
+        (WebCore::SocketStreamHandle::copyCFStreamDescription):
+        (WebCore::SocketStreamHandle::readStreamCallback):
+        (WebCore::SocketStreamHandle::writeStreamCallback):
+        (WebCore::SocketStreamHandle::~SocketStreamHandle):
+        (WebCore::SocketStreamHandle::platformSend):
+        (WebCore::SocketStreamHandle::platformClose):
+        (WebCore::SocketStreamHandle::receivedCredential):
+        (WebCore::SocketStreamHandle::receivedRequestToContinueWithoutCredential):
+        (WebCore::SocketStreamHandle::receivedCancellation):
+
+2009-11-12  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: preload status bar button glyphs
+        in order to prevent them from flickering (take 2).
+
+        https://bugs.webkit.org/show_bug.cgi?id=31439
+
+        * inspector/front-end/inspector.js:
+        (preloadImages):
+
+2009-11-13  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Chromium: [REGRESSION] Crash while stopping on a breakpoint.
+        Rolling back r50890.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31467
+
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::canAccessPrivate):
+
+2009-11-13  Dirk Schulze  <krit@webkit.org>
+
+        Reviewed by Gustavo Noronha.
+
+        [CAIRO] shadow support for Canvas and SVG
+        [https://bugs.webkit.org/show_bug.cgi?id=30960]
+        
+        This is the fix of a regression, caused by the shadow patch
+        from the bug above. Reinserted the save and restore calls
+        that were accidently removed by the previous patch.
+
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (WebCore::setPlatformFill):
+        (WebCore::setPlatformStroke):
+
+2009-11-13  Pavel Feldman  <pfeldman@chromium.org>
+
+        Not reviewed. Reverting r50908 since it makes inspector tests
+        time out.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31439
+
+        * inspector/front-end/inspector.js:
+
+2009-11-13  Mikhail Naganov  <mnaganov@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Enable 'console.profile()' and 'console.profileEnd()'
+        regardless of JAVASCRIPT_DEBUGGER.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31293
+
+        * WebCore.gypi:
+        * bindings/js/JSConsoleCustom.cpp:
+        (WebCore::JSConsole::profile):
+        (WebCore::JSConsole::profileEnd):
+        * bindings/v8/custom/V8ConsoleCustom.cpp: Added.
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8CustomBinding.h:
+        * page/Console.idl:
+
+2009-11-12  David Levin  <levin@chromium.org>
+
+        Reviewed by NOBODY.
+
+        Chromium build fix.
+
+        * bindings/v8/ScriptController.h:
+        (WebCore::ScriptController::evaluateInWorld): Add a dummy
+         method which isn't called in chromium to make things compile.
+
+2009-11-12  Anantanarayanan G Iyengar  <ananta@chromium.org>
+
+        Reviewed by Adam Barth.
+        
+        The document-open.html test was flaky at times. The test invokes the layout test plugin
+        which in its destroy stream handler opens a new document. This basically tears down the
+        stream and the associated plugin instance, which causes a crash when the plugin stream
+        dereferences an invalid m_client pointer which points to the PluginView instance which
+        is invalid at this time. Fix is to set the m_client pointer to NULL in the stop function
+        and check for the same.
+       
+        https://bugs.webkit.org/show_bug.cgi?id=31067
+
+        * plugins/PluginStream.cpp:
+        (WebCore::PluginStream::stop):
+        (WebCore::PluginStream::destroyStream):
+
+2009-11-12  Dumitru Daniliuc  <dumi@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Renaming some parameters passed to DB-related methods to better
+        indicate their purpose.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31449
+
+        * platform/chromium/ChromiumBridge.h:
+
+2009-11-12  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        Transformed reflected elements are clipped inside element with opacity
+        https://bugs.webkit.org/show_bug.cgi?id=30957
+        
+        transparencyClipBox() attemped to minimize the size of the transparency layer by mapping
+        each clip rect into painting space before taking the unions. This, however, did not work
+        correctly with combinations of reflections and transforms. Fixed by unioning the
+        clipRect and mapping through transforms along the way.
+        
+        Also leave some #ifdeffed code in beginTransparencyLayers() that makes it easy to see
+        where the transparency layers are.
+
+        Test: fast/reflections/opacity-reflection-transform.html
+
+        * rendering/RenderLayer.cpp:
+        (WebCore::expandClipRectForDescendantsAndReflection):
+        (WebCore::transparencyClipBox):
+        (WebCore::RenderLayer::beginTransparencyLayers):
+
+2009-11-12  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Darin Fisher.
+
+        Improve SecurityOrigin::toString comment
+        https://bugs.webkit.org/show_bug.cgi?id=31041
+
+        * page/SecurityOrigin.h:
+
+2009-11-12  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        externalRepresentation should take Frame as the argument
+        https://bugs.webkit.org/show_bug.cgi?id=31393
+
+        No new tests as this is just a refactoring.
+
+        * WebCore.base.exp:
+        * rendering/RenderTreeAsText.cpp:
+        (WebCore::externalRepresentation):
+        * rendering/RenderTreeAsText.h:
+
+2009-11-12  Ben Murdoch  <benm@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        [Android] The Android specific files in page/Android are out of date.
+        https://bugs.webkit.org/show_bug.cgi?id=31437
+
+        No tests required.
+
+        * page/android/DragControllerAndroid.cpp:
+        (WebCore::DragController::dragOperation): Added.
+        (WebCore::DragController::cleanupAfterSystemDrag):
+        * page/android/EventHandlerAndroid.cpp:
+        (WebCore::EventHandler::accessKeyModifiers): Added.
+        * page/android/InspectorControllerAndroid.cpp: Removed.
+
+2009-11-12  Brent Fulgham  <bfulgham@webkit.org>
+
+        Reviewed by Simon Fraser.
+
+        [CAIRO] shadow support for Canvas and SVG.
+        [https://bugs.webkit.org/show_bug.cgi?id=30960]
+
+        Implement Canvas/SVG shadow support for Cairo.  This patch
+        uses the filter code from SVG Filters.  That means that it is
+        necessary to activate filters to see the shadows.
+
+        Test: fast/canvas/canvas-shadow.html
+
+        * GNUmakefile.am:
+        * WebCore.vcproj/WebCore.vcproj: Add new ImageBufferFilter files.
+        * platform/graphics/GraphicsContext.h:
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (GraphicsContext::calculateShadowBufferDimensions): New helper routine.
+        (WebCore::setPlatformFill):
+        (WebCore::setPlatformStroke):
+        (WebCore::copyContextProperties):
+        (WebCore::drawPathShadow):
+        (WebCore::GraphicsContext::fillPath):
+        (WebCore::GraphicsContext::strokePath):
+        (WebCore::GraphicsContext::drawPath):
+        (WebCore::GraphicsContext::setPlatformShadow):
+        (WebCore::GraphicsContext::createPlatformShadow):
+        * platform/graphics/cairo/ImageCairo.cpp:
+        (WebCore::BitmapImage::draw): Add filter effect.
+        * platform/graphics/filters/Filter.h: Correct 'const' signatures.
+        * platform/graphics/filters/ImageBufferFilter.cpp: Added.
+        * platform/graphics/filters/ImageBufferFilter.h: Added.
+        * svg/graphics/filters/SVGFilter.cpp: Correct 'const' signatures.
+        * svg/graphics/filters/SVGFilter.h: Correct 'const' signatures.
+
+2009-11-12  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by Alexey Proskuryakov.
+
+        Add postTaskToMainThread to ScriptExecutionContext.
+        Move the code to post task to the main thread into a new method on ScriptExecutionContext,
+        to use as a helper implementation of the virtual ScriptExecutionContext::postTask(Task) in
+        contexts that live on the main thread.
+        https://bugs.webkit.org/show_bug.cgi?id=31427
+
+        No new tests - simply moving the code.
+
+        * dom/Document.cpp:
+        (WebCore::Document::postTask):
+        * dom/ScriptExecutionContext.cpp:
+        (WebCore::ScriptExecutionContextTaskTimer::ScriptExecutionContextTaskTimer):
+        (WebCore::ScriptExecutionContextTaskTimer::fired):
+        (WebCore::PerformTaskData::PerformTaskData):
+        (WebCore::PerformTaskData::performTask):
+        (WebCore::ScriptExecutionContext::postTaskToMainThread):
+        * dom/ScriptExecutionContext.h:
+
+2009-11-12  Simon Fraser  <simon.fraser@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Fix crash when removing compositing layers when GC is enabled
+        https://bugs.webkit.org/show_bug.cgi?id=31429
+
+        Workaround <rdar://problem/7390716> by special-casing the removal
+        of all sublayers when GC is enabled.
+
+        * platform/graphics/mac/GraphicsLayerCA.mm:
+        (WebCore::safeSetSublayers):
+        (WebCore::GraphicsLayerCA::updateSublayerList):
+        (WebCore::GraphicsLayerCA::swapFromOrToTiledLayer):
+
+2009-11-12  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        The last of the V8 binding optimizations.
+        - Replace string-valued element accessors with a shared getter/setter function.
+        - Change error handling flow of control to avoid extra branches and function calls.
+        https://bugs.webkit.org/show_bug.cgi?id=31443
+        
+        * bindings/scripts/CodeGeneratorV8.pm:
+        * bindings/v8/V8Binding.cpp:
+        (WebCore::getElementStringAttr):  Body of string-valued Element getter function.
+        (WebCore::setElementStringAttr):  Body of string-valued Element setter function.
+        * bindings/v8/V8Binding.h:
+
+2009-11-12  Sam Weinig  <sam@webkit.org>
+
+        Reviewed by Oliver Hunt.
+
+        Fix for <rdar://problem/7267951>
+        Canvas methods should reject uses of NaN and Infinity.
+
+        Test: fast/canvas/canvas-with-illegal-args.html
+
+        * html/canvas/CanvasRenderingContext2D.cpp:
+        (WebCore::CanvasRenderingContext2D::scale):
+        (WebCore::CanvasRenderingContext2D::rotate):
+        (WebCore::CanvasRenderingContext2D::translate):
+        (WebCore::CanvasRenderingContext2D::transform):
+        (WebCore::CanvasRenderingContext2D::setTransform):
+
+2009-11-12  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: profile timeline panel, fix obvious problems.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31432
+
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype.updateGraphDividersIfNeeded):
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._setWindowPosition):
+        (WebInspector.TimelineCalculator):
+        (WebInspector.TimelineCalculator.prototype.get minimumBoundary):
+        (WebInspector.TimelineCalculator.prototype.get maximumBoundary):
+        (WebInspector.TimelineCalculator.prototype.reset):
+        (WebInspector.TimelineCalculator.prototype.updateBoundaries):
+        (WebInspector.TimelineCalculator.prototype.formatValue):
+        (WebInspector.TimelineGraph):
+        (WebInspector.TimelineGraph.prototype.refresh):
+        * inspector/front-end/utilities.js:
+        (Element.prototype.hasStyleClass):
+
+2009-11-12  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: preload status bar button glyphs
+        in order to prevent them from flickering.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31439
+
+        * inspector/front-end/inspector.js:
+        (preloadImages):
+
+2009-11-12  Adam Roben  <aroben@apple.com>
+
+        Replace worldIDs with world objects
+
+        Part of <http://webkit.org/b/31414> Implement new SPI for dealing with
+        user scripts/stylesheets and isolated worlds
+
+        Reviewed by Sam Weinig.
+
+        Covered by existing tests.
+
+        * WebCore.base.exp: Update exported symbols to match what now exists
+        and is needed by WebKit.
+
+        * bindings/js/ScheduledAction.cpp:
+        (WebCore::ScheduledAction::execute): Updated for function rename.
+
+        * bindings/js/ScriptController.cpp: Removed code that dealt with
+        worldIDs.
+        (WebCore::ScriptController::createWorld): Added. Returns a new world
+        suitable for use on the main thread.
+        (WebCore::ScriptController::executeScriptInWorld): Renamed from
+        executeScriptInIsolatedWorld, since this works just fine with a
+        "normal" world.
+
+        * bindings/js/ScriptController.h: Added createWorld, removed functions
+        that took worldIDs, renamed executeScriptInIsolatedWorld to
+        executeScriptInWorld.
+
+        * page/Frame.cpp:
+        (WebCore::Frame::injectUserScripts):
+        (WebCore::Frame::injectUserScriptsForWorld):
+        Updated for changes to UserScriptMap and ScriptController.
+
+        * page/Frame.h: Changed injectUserScriptsForWorld to take a
+        DOMWrapperWorld* instead of a worldID.
+
+        * page/PageGroup.cpp:
+        (WebCore::PageGroup::addUserScriptToWorld):
+        (WebCore::PageGroup::addUserStyleSheetToWorld):
+        (WebCore::PageGroup::removeUserScriptFromWorld):
+        (WebCore::PageGroup::removeUserStyleSheetFromWorld):
+        (WebCore::PageGroup::removeUserScriptsFromWorld):
+        (WebCore::PageGroup::removeUserStyleSheetsFromWorld):
+        * page/PageGroup.h:
+        Changed these functions to take a DOMWrapperWorld* instead of a
+        worldID. Also updated for changes to UserScript and UserStyleSheet.
+
+        * page/UserScript.h:
+        * page/UserStyleSheet.h: Changed not to hold a worldID, since it was
+        never used.
+
+        * page/UserScriptTypes.h:
+        * page/UserStyleSheetTypes.h: Changed UserScriptMap and
+        UserStyleSheetMap to use a RefPtr<DOMWrapperWorld> instead of a
+        worldID as their key type.
+
+
+2009-11-12  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Tim Hatcher.
+
+        Fixes <http://webkit.org/b/31260>.
+        Web Inspector: Main Resources Other than HTML are mis-detected.
+        
+        Even if the resource is a main resource, look at its CachedResource type, 
+        because it might be an image, stylesheet, or JavaScript file, and we
+        want to show them all correctly.
+
+        * inspector/InspectorResource.cpp:
+        (WebCore::InspectorResource::cachedResourceType): Move this method out so it can be called in multiple places.
+        (WebCore::InspectorResource::type): 
+        * inspector/InspectorResource.h:
+
+2009-11-12  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Table-driven setup for V8 binding template callback functions. 100k in code savings.
+        https://bugs.webkit.org/show_bug.cgi?id=31420
+
+        * bindings/scripts/CodeGeneratorV8.pm:  Change generated ConfigureXXXTemplate fn
+            to call configureTemplate().
+        * bindings/v8/V8Binding.cpp:
+        (WebCore::configureTemplate):  New function; does all the standard configuration work.
+        (WebCore::createCallback):  De-inlined wrapper for FunctionTemplate creation.
+        * bindings/v8/V8Binding.h:
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::batchConfigureAttributes):  Just wrapped the very long fn parameter list.
+        (WebCore::batchConfigureCallbacks):  New function, used by configureTemplate.
+        (WebCore::batchConfigureConstants):  Just wrapped the very long fn parameter list.
+        * bindings/v8/V8Proxy.h:
+
+2009-11-12  Dumitru Daniliuc  <dumi@chromium.org>
+
+        Unreviewed, fix Chromium build after http://trac.webkit.org/changeset/50876.
+
+        * platform/sql/chromium/SQLiteFileSystemChromiumPosix.cpp:
+
+2009-11-12  Eric Carlson  <eric.carlson@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        <rdar://problem/7388969> Add DOM API for fullscreen video
+        
+        DOM API for fullscreen <video>.
+
+        Tests: media/media-fullscreen-inline.html
+               media/media-fullscreen-not-in-document.html
+
+        * dom/EventNames.h:
+            Add webkitbeginfullscreen and webkitendfullscreen.
+
+        * html/HTMLAttributeNames.in:
+            Add onwebkitbeginfullscreen and onwebkitendfullscreen.
+
+        * html/HTMLMediaElement.cpp:
+        (WebCore::HTMLMediaElement::parseMappedAttribute):
+            Deal with onwebkitbeginfullscreen and onwebkitendfullscreen.
+        (WebCore::HTMLMediaElement::enterFullscreen):
+            Schedule webkitbeginfullscreenEvent event, don't set m_isFullscreen unless we
+            actually do enter fullscreen.
+        (WebCore::HTMLMediaElement::exitFullscreen):
+            Schedule webkitendfullscreenEvent event.
+        (WebCore::HTMLMediaElement::webkitEnterFullScreen):
+        (WebCore::HTMLMediaElement::webkitExitFullScreen):
+        (WebCore::HTMLMediaElement::webkitSupportsFullscreen):
+        (WebCore::HTMLMediaElement::webkitDisplayingFullscreen):
+            New, access to fullscreen properties and methods.
+
+        * html/HTMLMediaElement.h:
+        * html/HTMLMediaElement.idl:
+            Declare methods needed for fullscreen API.
+
+        * html/HTMLVideoElement.cpp:
+        (WebCore::HTMLVideoElement::supportsFullscreen):
+            Return false if a movie does not have video.
+
+        * page/DOMWindow.h:
+            Add webkitbeginfullscreen and webkitendfullscreen.
+
+2009-11-12  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        [Chromium] Sify compose button alerts error
+        https://bugs.webkit.org/show_bug.cgi?id=31394
+
+        Test: http/tests/security/calling-versus-current.html
+
+        We're supposed to use the calling context for security checks.  In JSC
+        land, this is the lexicalGlobalObject.
+
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::canAccessPrivate):
+
+2009-11-12  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30291
+
+        Fixes an issue where the returned drop effect is incorrect when
+        effectAllowed == "uninitialized".
+
+        According to section 7.9.2 of the HTML 5 spec.
+        <http://dev.w3.org/html5/spec/Overview.html#the-dragevent-and-datatransfer-interfaces>
+        when effectAllowed = "uninitialized" the resulting dropEffect should be the
+        user-specified dropEffect (i.e. "copy", "move", "link") and "none" for any
+        other case.
+        
+        No test cases are included because we have an existing test case from
+        bug #24731.
+
+        * dom/Clipboard.cpp:
+        (WebCore::dragOpFromIEOp): Added case for op == "uninitialized".
+
+2009-11-12  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Do not highlight node on refresh.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31419
+
+        * inspector/front-end/ElementsPanel.js:
+        (WebInspector.ElementsPanel.prototype.reset):
+
+2009-11-12  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Minor timeline fixes.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31417
+
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._getRecordDetails):
+        (WebInspector.TimelineRecordTreeElement.prototype.onattach):
+        (WebInspector.TimelineRecordTreeElement.prototype._updateDetails):
+        (WebInspector.TimelineRecordTreeElement.prototype.refresh):
+
+2009-11-12  Alexey Proskuryakov  <ap@apple.com>
+
+        SnowLeopard build fix.
+
+        Renamed initWithClient to initWithAuthenticationClient.
+
+        * platform/network/mac/AuthenticationMac.mm:
+        (-[WebCoreAuthenticationClientAsChallengeSender initWithAuthenticationClient:]):
+        (WebCore::AuthenticationChallenge::setAuthenticationClient):
+
+2009-11-12  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Darin Adler.
+
+        ARIA: add alert type roles
+        https://bugs.webkit.org/show_bug.cgi?id=31392
+
+        Test: platform/mac/accessibility/aria-alerts.html
+
+        * accessibility/AccessibilityObject.h:
+        * accessibility/AccessibilityRenderObject.cpp:
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+
+2009-11-11  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31386
+        Make Mac AuthenticationChallenge usable from cross-platform code
+
+        No change in behavior, so no tests.
+
+        * platform/network/ResourceHandle.cpp:
+        (WebCore::ResourceHandle::clearAuthentication):
+        * platform/network/ResourceHandleInternal.h:
+        (WebCore::ResourceHandleInternal::ResourceHandleInternal):
+        Don't store m_currentCFChallenge, which was only used for a single assertion. Unlike the
+        NSURLConnection case, CF challenge doesn't carry a sender with it, so the copy in web challenge
+        is identical.
+
+        * platform/network/cf/AuthenticationChallenge.h:
+        (WebCore::AuthenticationChallenge::setAuthenticationClient): Added a setter to match the new
+        Mac interface. Previously, one had to create a new AuthenticationChallenge to replace client.
+
+        * platform/network/cf/ResourceHandleCFNet.cpp:
+        (WebCore::ResourceHandle::didReceiveAuthenticationChallenge): Fixed assertions after removal
+        of m_currentCFChallenge. Also, there is no need to set client now, as it's guaranteed to
+        be already set.
+
+        * platform/network/mac/AuthenticationChallenge.h:
+        (WebCore::AuthenticationChallenge::m_sender): Explained the existence of this member to the
+        best of my understanding.
+        (WebCore::AuthenticationChallenge::m_nsChallenge): Renamed from m_macChallenge to prevent
+        confusion with "mac" and "web" challenges in ResourceHandleInternal.
+
+        * platform/network/mac/AuthenticationMac.mm:
+        (WebCoreAuthenticationClientAsChallengeSender): Added a Obj-C wrapper for AuthenticationClient,
+        making it possible to use the latter with NSURLAuthenticationChallenge.
+        (WebCore::AuthenticationChallenge::AuthenticationChallenge): Updated for m_macChallenge ->
+        m_nsChallenge renaming.
+        (WebCore::AuthenticationChallenge::setAuthenticationClient): Wrap the client in Obj-C and
+        set it as sender (or unset, if client is null).
+
+        * platform/network/mac/ResourceHandleMac.mm:
+        (WebCoreResourceHandleAsDelegate) WebCoreResourceHandleAsDelegate no longer doubles as
+        authentication challenge sender.
+        (WebCore::ResourceHandle::~ResourceHandle): A navigation can happen underneath an
+        authentication sheet.
+        (WebCore::ResourceHandle::didReceiveAuthenticationChallenge): Form m_currentWebChallenge
+        using the new setAuthenticationClient() method.
+        (WebCore::ResourceHandle::didCancelAuthenticationChallenge): Fixed an incorrect assertion.
+        Since didCancelAuthenticationChallenge is called by connection, the passed challenge is
+        the original Mac one, not the one we created for use with authentication sheet. I don't
+        know when a connection would cancel authentication in practice, so I haven't tested this.
+
+2009-11-12  Patrick Mueller  <Patrick_Mueller@us.ibm.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: breakpoint sidebar entries should allow click over entire list item
+        https://bugs.webkit.org/show_bug.cgi?id=31411
+
+        No new tests; no new functionality, small usability change. 
+
+        * inspector/front-end/BreakpointsSidebarPane.js:
+        (WebInspector.BreakpointsSidebarPane.prototype._appendBreakpointElement):
+        (WebInspector.BreakpointsSidebarPane.prototype._appendBreakpointElement.breakpointClicked):
+
+2009-11-12  Patrick Mueller  <Patrick_Mueller@us.ibm.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: breakpoints in named evals are not restored after a reload
+        https://bugs.webkit.org/show_bug.cgi?id=31375
+
+        Manual test added
+
+        * inspector/front-end/ScriptsPanel.js:
+        (WebInspector.ScriptsPanel.prototype.addScript):
+        * manual-tests/inspector/bp-in-named-eval-after-reload.html: Added.
+
+2009-11-12  Benjamin Poulain  <benjamin.poulain@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        Custom printing shrink factors
+        https://bugs.webkit.org/show_bug.cgi?id=29042
+
+        This reverts commit r49769. The public API for this needs to be reviewed
+        before its inclusion in Qt.
+
+        * page/PrintContext.cpp:
+        (WebCore::PrintContext::begin):
+        * page/Settings.cpp:
+        (WebCore::Settings::Settings):
+        * page/Settings.h:
+
+2009-11-12  Alexander Pavlov  <apavlov@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Web Inspector: Resource errors/warnings not shown in the Resource tree.
+
+        Error/Warning bubbles are not displayed next to the resource in the 
+        Resources panel if those occur before the resource is attached to the tree.
+        https://bugs.webkit.org/show_bug.cgi?id=31404
+
+        Test: manual-tests/inspector/styled-error-bubbles-in-scripts.html
+
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype.removeItem):
+        * inspector/front-end/ResourcesPanel.js:
+        (WebInspector.ResourceSidebarTreeElement.prototype.onattach):
+
+2009-11-12  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31047
+        [GTK] Failing test media/video-played-ranges-1.html
+
+        Follow-up of r50726, don't block the UI thread when calling
+        gst_element_get_state(). Also fixed a compilation warning and some
+        static casts.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::playbackPosition):
+        (WebCore::MediaPlayerPrivate::seek):
+        (WebCore::MediaPlayerPrivate::setRate):
+
+2009-11-12  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31047
+        [GTK] Failing test media/video-played-ranges-1.html
+
+        don't pause pipeline if already paused, same for play()
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::MediaPlayerPrivate::play):
+        (WebCore::MediaPlayerPrivate::pause):
+
+2009-11-12  Kinuko Yasuda  <kinuko@google.com>
+
+        Reviewed by David Levin.
+
+        Support Gtk scrollwheel behavior for horizontal scrollbars on Linux
+        Chromium too.
+        https://bugs.webkit.org/show_bug.cgi?id=31292
+
+        No new tests. (Corresponding test for Gtk+ is
+        platform/gtk/scrollbars/overflow-scrollbar-horizontal-wheel-scroll.html)
+
+        * page/EventHandler.cpp:
+        * page/chromium/EventHandlerChromium.cpp:
+
+2009-11-12  Yuta Kitamura  <yutak@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Prevent text inside a multi-column block from being split into columns.
+        
+        If the tentative height of a multi-column block was too small, we need to
+        expand the block height and try to layout again, in order to prevent text
+        from being split into different columns.
+
+        CSS Multicolumn text is split awkwardly
+        https://bugs.webkit.org/show_bug.cgi?id=22249
+
+        Test: fast/multicol/single-line.html
+
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::layoutColumns):
+        * rendering/RenderBlock.h:
+        * rendering/RenderLineBoxList.cpp:
+        (WebCore::RenderLineBoxList::paint):
+        * rendering/RenderView.h:
+        (WebCore::RenderView::setTruncatedAt):
+        (WebCore::RenderView::setMinimumColumnHeight):
+        (WebCore::RenderView::minimumColumnHeight):
+
+2009-11-11  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Fix a bug that RenderFileUploadControl isn't initialized with multiple files.
+        https://bugs.webkit.org/show_bug.cgi?id=31195
+
+        Test: fast/forms/input-file-re-render.html
+
+        * rendering/RenderFileUploadControl.cpp:
+        (WebCore::RenderFileUploadControl::RenderFileUploadControl):
+
+2009-11-09  Dumitru Daniliuc  <dumi@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Fixing Chromium's POSIX VFS implementation, by adding the required
+        "used file descriptors" logic.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31275
+
+        * platform/sql/chromium/SQLiteFileSystemChromiumPosix.cpp:
+
+2009-11-11  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        need to implement aria tree roles
+        https://bugs.webkit.org/show_bug.cgi?id=31284
+
+        Tests: platform/mac/accessibility/aria-multiselectable.html
+               platform/mac/accessibility/aria-tree.html
+
+        * accessibility/AccessibilityList.cpp:
+        (WebCore::AccessibilityList::accessibilityIsIgnored):
+        * accessibility/AccessibilityObject.cpp:
+        (WebCore::AccessibilityObject::ariaTreeRows):
+        (WebCore::AccessibilityObject::ariaTreeItemContent):
+        (WebCore::AccessibilityObject::ariaTreeItemDisclosedRows):
+        * accessibility/AccessibilityObject.h:
+        (WebCore::):
+        (WebCore::AccessibilityObject::isTree):
+        (WebCore::AccessibilityObject::isTreeItem):
+        (WebCore::AccessibilityObject::setIsExpanded):
+        (WebCore::AccessibilityObject::canSetExpandedAttribute):
+        (WebCore::AccessibilityObject::hierarchicalLevel):
+        (WebCore::AccessibilityObject::setSelectedRows):
+        (WebCore::AccessibilityObject::performDefaultAction):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::hierarchicalLevel):
+        (WebCore::AccessibilityRenderObject::accessibilityIsIgnored):
+        (WebCore::AccessibilityRenderObject::isExpanded):
+        (WebCore::AccessibilityRenderObject::setElementAttributeValue):
+        (WebCore::AccessibilityRenderObject::elementAttributeValue):
+        (WebCore::AccessibilityRenderObject::setIsExpanded):
+        (WebCore::AccessibilityRenderObject::isSelected):
+        (WebCore::AccessibilityRenderObject::setSelected):
+        (WebCore::AccessibilityRenderObject::setSelectedRows):
+        (WebCore::createARIARoleMap):
+        (WebCore::AccessibilityRenderObject::canSetExpandedAttribute):
+        (WebCore::AccessibilityRenderObject::ariaTreeSelectedRows):
+        (WebCore::AccessibilityRenderObject::ariaListboxSelectedChildren):
+        (WebCore::AccessibilityRenderObject::selectedChildren):
+        * accessibility/AccessibilityRenderObject.h:
+        * accessibility/mac/AccessibilityObjectMac.mm:
+        (WebCore::AccessibilityObject::accessibilityPlatformIncludesObject):
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+        (-[AccessibilityObjectWrapper accessibilityAttributeNames]):
+        (RoleEntry::):
+        (-[AccessibilityObjectWrapper subrole]):
+        (-[AccessibilityObjectWrapper accessibilityAttributeValue:]):
+        (-[AccessibilityObjectWrapper accessibilityIsAttributeSettable:]):
+        (-[AccessibilityObjectWrapper accessibilityPerformShowMenuAction]):
+        (-[AccessibilityObjectWrapper accessibilitySetValue:forAttribute:]):
+        (-[AccessibilityObjectWrapper accessibilityArrayAttributeCount:]):
+        * html/HTMLAttributeNames.in:
+
+2009-11-11  Brent Fulgham  <bfulgham@webkit.org>
+
+        Build fix after @r50760 with ENABLE_FILTERS.
+
+        * platform/graphics/filters/SourceAlpha.cpp:
+        (WebCore::SourceAlpha::apply): Supply ColorSpace to fillRect.
+        * svg/graphics/filters/SVGFEFlood.cpp: Supply ColorSpace argument
+          to fillRect.
+
+2009-11-11  Fumitoshi Ukai  <ukai@chromium.org>
+
+        Reviewed by Alexey Proskuryakov.
+
+        Fix WebSocket frame parser of frame_type with high-order bit set.
+        https://bugs.webkit.org/show_bug.cgi?id=30668
+
+        If buffer is smaller than frame's length, it should break the loop
+        instead of reading next byte.
+
+        Tests: websocket/tests/frame-length-longer-than-buffer.html
+               websocket/tests/frame-length-skip.html
+
+        * websockets/WebSocketChannel.cpp:
+        (WebCore::WebSocketChannel::didReceiveData):
+
+2009-11-11  Yusuke Sato  <yusukes@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        [chromium] Remove t2embed.dll functions from FontCustomPlatformData.cpp for Chromium
+        https://bugs.webkit.org/show_bug.cgi?id=31345
+
+        Remove dependency on t2embed.dll so that Chromium for Windows can start even if t2embed.dll cannot be accessed.
+
+        * platform/graphics/chromium/FontCustomPlatformData.cpp:
+        (WebCore::FontCustomPlatformData::~FontCustomPlatformData): Remove TTDeleteEmbeddedFont() call. Always use RemoveFontMemResourceEx().
+        (WebCore::FontCustomPlatformData::fontPlatformData): Remove TTGetNewFontName() call.
+        (WebCore::createFontCustomPlatformData): Remove TTLoadEmbeddedFont() call. Always use AddFontMemResourceEx() via renameAndActivateFont() in opentype/OpenTypeUtility.h. Remove EOTStream class as well.
+
+2009-11-11  Beth Dakin  <bdakin@apple.com>
+
+        Build fix. No review needed.
+
+        * platform/graphics/gtk/FontGtk.cpp:
+        (WebCore::Font::drawComplexText):
+
+2009-11-11  Beth Dakin  <bdakin@apple.com>
+
+        Build fix. No review needed.
+
+        * platform/graphics/cairo/FontCairo.cpp:
+        (WebCore::Font::drawGlyphs):
+
+2009-11-11  Beth Dakin  <bdakin@apple.com>
+
+        Windows build fix. No review needed. 
+
+        * platform/graphics/win/FontCGWin.cpp:
+        (WebCore::Font::drawGlyphs):
+
+2009-11-11  Beth Dakin  <bdakin@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        Fix for https://bugs.webkit.org/show_bug.cgi?id=31382
+        Make -webkit-color-correction work with shadows
+
+        From canvas, just send DeviceColorSpace to setShadow() for now. 
+        Will fix soon when I address https://bugs.webkit.org/show_bug.cgi?id=31319
+        * html/canvas/CanvasRenderingContext2D.cpp:
+        (WebCore::CanvasRenderingContext2D::setShadow):
+        (WebCore::CanvasRenderingContext2D::applyShadow):
+
+        setShadow() and setPlatformShadow() now take a ColorSpace.
+        * platform/graphics/GraphicsContext.cpp:
+        (WebCore::GraphicsContext::setShadow):
+        * platform/graphics/GraphicsContext.h:
+        * platform/graphics/cg/GraphicsContextCG.cpp:
+        (WebCore::createCGColorWithColorSpace): New helper to create a 
+        color in a ColorSpace.
+        (WebCore::setCGFillColor): Call new helper.
+        (WebCore::setCGStrokeColor): Call new helper.
+        (WebCore::GraphicsContext::setPlatformShadow): Call new helper.
+        * platform/graphics/haiku/GraphicsContextHaiku.cpp:
+        (WebCore::GraphicsContext::setPlatformShadow):
+
+        Send appropriate ColorSpace to setShadow().
+        * platform/graphics/mac/FontMac.mm:
+        (WebCore::Font::drawGlyphs):
+        * rendering/EllipsisBox.cpp:
+        (WebCore::EllipsisBox::paint):
+        * rendering/InlineFlowBox.cpp:
+        (WebCore::InlineFlowBox::paintTextDecorations):
+        * rendering/InlineTextBox.cpp:
+        (WebCore::paintTextWithShadows):
+        (WebCore::InlineTextBox::paintDecoration):
+        * rendering/RenderBoxModelObject.cpp:
+        (WebCore::RenderBoxModelObject::paintBoxShadow):
+        * rendering/SVGInlineTextBox.cpp:
+        (WebCore::SVGInlineTextBox::paintCharacters):
+        * rendering/SVGRenderSupport.cpp:
+        (WebCore::SVGRenderBase::prepareToRenderSVGContent):
+
+        Attempt to keep ports building.
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (WebCore::GraphicsContext::setPlatformShadow):
+        * platform/graphics/qt/GraphicsContextQt.cpp:
+        (WebCore::GraphicsContext::setPlatformShadow):
+        * platform/graphics/skia/GraphicsContextSkia.cpp:
+        (WebCore::GraphicsContext::setPlatformShadow):
+        * platform/graphics/wince/GraphicsContextWince.cpp:
+        (WebCore::GraphicsContext::setPlatformShadow):
+        * platform/graphics/wx/GraphicsContextWx.cpp:
+        (WebCore::GraphicsContext::setPlatformShadow):
+
+2009-11-11  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Print the file text of a file upload control in DumpRenderTree for ease of tests.
+        https://bugs.webkit.org/show_bug.cgi?id=31195
+
+        * rendering/RenderFileUploadControl.cpp:
+        (WebCore::RenderFileUploadControl::paintObject):
+        (WebCore::RenderFileUploadControl::fileTextValue):
+        * rendering/RenderFileUploadControl.h:
+        (WebCore::RenderFileUploadControl::isFileUploadControl):
+        (WebCore::toRenderFileUploadControl):
+        * rendering/RenderObject.h:
+        (WebCore::RenderObject::isFileUploadControl):
+        * rendering/RenderTreeAsText.cpp:
+        (WebCore::operator<<):
+
+2009-11-11  Gavin Barraclough  <barraclough@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        DOM Wrappers for some nodes may not be marked.
+        https://bugs.webkit.org/show_bug.cgi?id=31380
+
+        Some markChildren methods are calling getCachedDOMNodeWrapper, which will find
+        the wrapper for the current world only.  This means that wrappers may be GC'ed
+        prematurely, and properties lost.
+
+        Move to a model more like markDOMObjectWrapper, mark wrappers for all worlds.
+
+        * bindings/js/JSAttrCustom.cpp:
+        (WebCore::JSAttr::markChildren):
+        * bindings/js/JSDOMBinding.cpp:
+        (WebCore::markDOMNodeWrapper):
+        * bindings/js/JSDOMBinding.h:
+        * bindings/js/JSNamedNodeMapCustom.cpp:
+        (WebCore::JSNamedNodeMap::markChildren):
+        * bindings/js/JSNodeCustom.cpp:
+        (WebCore::JSNode::markChildren):
+        * bindings/js/JSSVGElementInstanceCustom.cpp:
+        (WebCore::JSSVGElementInstance::markChildren):
+        * bindings/js/JSStyleSheetCustom.cpp:
+        (WebCore::JSStyleSheet::markChildren):
+
+2009-11-11  Ben Murdoch  <benm@google.com>
+
+        Reviewed by Darin Adler.
+
+        bindings/js/ScriptObject.cpp is missing and ENABLE(INSPECTOR) guard.
+        https://bugs.webkit.org/show_bug.cgi?id=31384
+
+        No functionality change so no tests required.
+
+        * bindings/js/ScriptObject.cpp: Add ENABLE(INSPECTOR) guard around the JSInspectorBackend.h include.
+
+2009-11-11  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        The Big De-Inlining. 450k code size reduction (32-bit x86.)
+        - Various inline functions in V8Binding.h made non-inline.
+        - Some renaming for consistency.
+        - New function createRawTemplate().
+        https://bugs.webkit.org/show_bug.cgi?id=31383
+
+        * bindings/scripts/CodeGeneratorV8.pm:
+        * bindings/v8/V8Binding.cpp:
+        (WebCore::v8DOMWrapperToNative):
+        (WebCore::v8ValueToWebCoreString):
+        (WebCore::v8ValueToAtomicWebCoreString):
+        (WebCore::toInt32):
+        (WebCore::toWebCoreString):
+        (WebCore::toWebCoreStringWithNullCheck):
+        (WebCore::toAtomicWebCoreStringWithNullCheck):
+        (WebCore::toWebCoreStringWithNullOrUndefinedCheck):
+        (WebCore::isUndefinedOrNull):
+        (WebCore::v8Boolean):
+        (WebCore::v8UndetectableString):
+        (WebCore::v8StringOrNull):
+        (WebCore::v8StringOrUndefined):
+        (WebCore::v8StringOrFalse):
+        (WebCore::v8StringToWebCoreString):
+        (WebCore::v8ExternalString):
+        (WebCore::createRawTemplate):  New function.
+        * bindings/v8/V8Binding.h:
+        (WebCore::v8DOMWrapperTo):
+        (WebCore::v8DOMWrapperToNode):
+        (WebCore::v8StringToWebCoreString):
+        (WebCore::v8StringToAtomicWebCoreString):
+
+2009-11-11  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        More V8 de-inlining (outlining?) Abstracted a chunk of boilerplate code from every
+        event-listener setter into a new subroutine transferHiddenDependency().
+        https://bugs.webkit.org/show_bug.cgi?id=31377
+
+        * bindings/scripts/CodeGeneratorV8.pm:  Replace boilerplate with call to transferHiddenDependency().
+        * bindings/v8/V8Utilities.cpp:
+        (WebCore::transferHiddenDependency):  New.
+        * bindings/v8/V8Utilities.h:  Declaration of transferHiddenDependency.
+
+2009-11-11  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Beth Dakin.
+
+        If we are on Windows, don't try and get the kCGColorSpaceSRGB ColorSpace,
+        because there is a CG bug preventing this from working.
+
+        * platform/graphics/cg/GraphicsContextCG.cpp:
+        (WebCore::sRGBColorSpaceRef):
+
+2009-11-11  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Check that if Storage panel exists before calling its methods
+
+        https://bugs.webkit.org/show_bug.cgi?id=31343
+
+        * inspector/front-end/inspector.js:
+        (WebInspector.addDatabase):
+        (WebInspector.addCookieDomain):
+        (WebInspector.addDOMStorage):
+        (WebInspector.updateDOMStorage):
+
+2009-11-11  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        De-inline convertNodeToV8Object(), which expands to a lot of asm code and is inlined 136
+        times in the generated V8 bindings.
+        https://bugs.webkit.org/show_bug.cgi?id=31368
+
+        * bindings/v8/V8DOMWrapper.cpp:
+        (WebCore::V8DOMWrapper::convertNodeToV8Object):  Moved body here from .h file
+        * bindings/v8/V8DOMWrapper.h:  Removed inline method body.
+
+2009-11-11  Jessie Berlin  <jberlin@webkit.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Display the correct summary in the web inspector for the shorthands
+        border-color, border-width, border-style, margin, and padding.
+        https://bugs.webkit.org/show_bug.cgi?id=7987
+
+        Test: fast/css/shorthands-four-values.html
+
+        * css/CSSMutableStyleDeclaration.cpp:
+        (WebCore::CSSMutableStyleDeclaration::get4Values):
+        Display the summary information in the same way the shorthand would be
+        specified in a css rule.
+
+2009-11-11  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Make V8 bindings return NULL handles instead of calling v8::Undefined(). This has equivalent
+        meaning to the caller, saves code, and appears to save a few cycles at runtime too.
+        https://bugs.webkit.org/show_bug.cgi?id=31367
+
+        * bindings/scripts/CodeGeneratorV8.pm: Change "v8::Undefined()" to "v8::Handle<v8::Value>()"
+
+2009-11-11  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Optimize V8 getDOMNodeMap(), a hot function in Dromaeo DOM tests, by increasing inlining.
+
+        * bindings/v8/DOMData.cpp:
+        (WebCore::DOMData::getCurrent):  Moved getCurrentMainThread to MainThreadDOMData::getCurrent
+            so it can be inlined by its caller.
+        * bindings/v8/DOMData.h:
+        * bindings/v8/MainThreadDOMData.cpp:
+        (WebCore::MainThreadDOMData::getCurrent):  Moved here from DOMData.cpp.
+        (WebCore::MainThreadDOMData::getMainThreadStore):  Added UNLIKELY macro to improve codegen.
+        (WebCore::MainThreadDOMData::getCurrentMainThreadStore):  Combination of getCurrentMainThread
+            and getStore, which inline both calls together.
+        * bindings/v8/MainThreadDOMData.h:
+        (WebCore::MainThreadDOMData::getStore):  Broke out nonvirtual getMainThreadStore for inlineability.
+        * bindings/v8/V8DOMMap.cpp:
+        (WebCore::getDOMNodeMap):  Call new getCurrentMainThreadStore, which is faster.
+
+2009-11-11  Nate Chapin  <japhet@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Add methods to KURLGoogle.cpp declared in http://trac.webkit.org/changeset/50784 but not defined when using KURLGoogle.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31357
+
+        * platform/KURLGoogle.cpp:
+        (WebCore::isSchemeFirstChar):
+        (WebCore::isSchemeChar):
+        (WebCore::KURL::hasPort):
+        (WebCore::KURL::removePort):
+        (WebCore::protocolIsValid):
+
+2009-11-11  Brent Fulgham  <bfulgham@webkit.org>
+
+        Build fix, no reviewed.
+
+        Correct setPlatformFillColor and setPlatformStrokeColor calls
+        to match new ColorSpace-supporting signatures.
+
+        * platform/graphics/win/GraphicsContextCairoWin.cpp:  Add the
+          color space to the set[...]Color calls.
+
+2009-11-10  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31327
+        Clean up SocketStreamHandleClient interface
+
+        No change in behavior.
+
+        * platform/network/SocketStreamHandleClient.h: Removed willOpenStream and willSendData.
+        (WebCore::SocketStreamHandleClient::willOpenStream): Removed. This is currently not used by
+        the only client (WebSocketChannel), and it's not clear what this callback's semantics
+        should be.
+        (WebCore::SocketStreamHandleClient::willSendData): Ditto.
+        (WebCore::SocketStreamHandleClient::receivedCancellation): Removed, because it was misplaced.
+        For ResourceHandle, this method is called when the user cancels authentication sheet,
+        not when something happens with the stream.
+
+        * websockets/WebSocketChannel.h: Some WebSocketChannel methods were virtual without any
+        reason. Also, added didReceiveAuthenticationChallenge/didCancelAuthenticationChallenge.
+
+        * websockets/WebSocketChannel.cpp: Adjusted for the above change. Authentication-related
+        callbacks have no real implementation yet.
+
+2009-11-11  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        Allow custom memory allocation control for the part of page directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=31350
+
+        Inherits the following classes from Noncopyable because these are instantiated
+        by 'new' and these are no need to be copyable:
+
+        class DragController         - instantiated at: WebCore/page/Page.cpp:107
+        class FocusController        - instantiated at: WebCore/page/Page.cpp:109
+        class Settings               - instantiated at: WebCore/page/Page.cpp:116
+        class PluginHalter           - instantiated at: WebCore/page/Page.cpp:160
+        struct ScheduledEvent        - instantiated at: WebCore/page/FrameView.cpp:1275
+        class UserScript             - instantiated at: WebCore/page/PageGroup.cpp:208
+        struct EventHandlerDragState - instantiated at: WebCore/page/EventHandler.cpp:182
+        class XSSAuditor             - instantiated at: WebCore/bindings/js/ScriptController.cpp:70
+        class UserStyleSheet         - instantiated at: WebCore/page/PageGroup.cpp:222
+
+        Inherits PropertyWrapperBase class from Noncopyable because (its child class) 
+        PropertyWrapper is instantiated by 'new' in 
+        WebCore/page/animation/AnimationBase.cpp:564 it is no need to be copyable.
+
+        * page/DragController.h:
+        * page/EventHandler.h:
+        * page/FocusController.h:
+        * page/FrameView.cpp:
+        * page/PluginHalter.h:
+        * page/Settings.h:
+        * page/UserScript.h:
+        * page/UserStyleSheet.h:
+        * page/XSSAuditor.h:
+        * page/animation/AnimationBase.cpp:
+
+2009-11-11  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31323
+        Fix a few compiler warnings
+
+        No new tests as there is no new functionality.
+
+        * editing/htmlediting.cpp:
+        (WebCore::isRenderedAsNonInlineTableImageOrHR): Use explicit
+        parentheses to silence gcc 4.4 -Wparentheses warnings
+
+2009-11-11  Kenneth Rohde Christiansen  <kenneth@webkit.org>
+
+        Reviewed by Mark Rowe.
+
+        Set m_hasPendingGeometryChange to true by default, so that
+        at least one call to NPP_SetWindow is executed, which is
+        needed by the DRT plugin testing framework.
+
+        * plugins/PluginView.cpp:
+        (WebCore::PluginView::PluginView):
+
+2009-11-11  Csaba Osztrogonác  <ossy@webkit.org>
+
+        Rubber-stamped by Kenneth Rohde Christiansen.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31348
+        [Qt] Remove unnecessary LUT creator from WebCore.pro
+
+        * WebCore.pro:
+
+2009-11-11  Simon Hausmann  <simon.hausmann@nokia.com>
+
+        Reviewed by Tor Arne Vestbø.
+
+        Introduce a function for querying the input method status
+        in QWebPageClient.
+
+        * platform/qt/QWebPageClient.h:
+
+2009-11-11  Benjamin Otte  <otte@gnome.org>
+
+        Reviewed by Jan Alonzo.
+
+        [GTK] Black artifacts in youtube.com/html5
+
+        Paint the video to the given size. It's the job of the callers to keep
+        track of aspect ratio. RenderVideo.cpp does it for the <video>
+        element.
+        https://bugs.webkit.org/show_bug.cgi?id=30925
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::MediaPlayerPrivate::paint):
+
+2009-11-11  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30901
+        [Gtk] Need to de-lint the Atk a11y code
+
+        Cleaned up some missed capitalization style-guideline violations.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+
+2009-11-11  Jocelyn Turcotte  <jocelyn.turcotte@nokia.com>
+
+        Reviewed by Eric Seidel.
+
+        [Qt] Make the default style background color valid.
+        Currently the color is transparent but invalid, this causes
+        list boxes in QtWebKit to be drawn with a black background
+        since r49242.
+        https://bugs.webkit.org/show_bug.cgi?id=31295
+
+        * rendering/style/RenderStyle.h:
+        (WebCore::InheritedFlags::initialBackgroundColor):
+        * rendering/style/StyleBackgroundData.cpp:
+        (WebCore::StyleBackgroundData::StyleBackgroundData):
+
+2009-11-10  Gavin Barraclough  <barraclough@apple.com>
+
+        Reviewed by Geoff Garen.
+
+        Simplify the ownership model for worlds - rather than having a pair of weak references
+        between DOMWrapperWorld and ScriptController/ScriptCachedFrameData, give the latter an
+        ref pointer to the former.  This reduces complexity & cost of the caching entries in the
+        back forward cache.
+
+        * WebCore.base.exp:
+        * bindings/js/JSDOMBinding.cpp:
+        (WebCore::DOMWrapperWorld::~DOMWrapperWorld):
+        * bindings/js/JSDOMBinding.h:
+        (WebCore::DOMWrapperWorld::forgetDocument):
+        * bindings/js/ScriptCachedFrameData.cpp:
+        (WebCore::ScriptCachedFrameData::ScriptCachedFrameData):
+        (WebCore::ScriptCachedFrameData::restore):
+        (WebCore::ScriptCachedFrameData::clear):
+        * bindings/js/ScriptCachedFrameData.h:
+        * bindings/js/ScriptController.cpp:
+        (WebCore::ScriptController::~ScriptController):
+        (WebCore::ScriptController::clearWindowShell):
+        (WebCore::ScriptController::initScript):
+        (WebCore::ScriptController::updateDocument):
+        * bindings/js/ScriptController.h:
+
+2009-11-10  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        rename counter to makeCounterNode in RenderCounter.cpp
+        https://bugs.webkit.org/show_bug.cgi?id=31289
+
+        No new test because this is just a small refactoring.
+
+        * rendering/RenderCounter.cpp:
+        (WebCore::findPlaceForCounter):
+        (WebCore::makeCounterNode):
+        (WebCore::RenderCounter::originalText):
+
+2009-11-10  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Oliver Hunt.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30754
+
+        Patch 2 of 2.
+
+        Removed method EventHandler::dragSourceMovedTo, since it is no longer
+        needed. This method fired a drag event whenever the mouse moved, but
+        section 7.9.4 of the HTML 5 spec. defines the drag-and-drop processing
+        model independent of when the mouse moves. See "Among other changes..."
+        in the change log for patch 1 for more details.
+
+        * WebCore.DragSupport.exp:
+        * page/EventHandler.cpp: Removed method EventHandler::dragSourceMovedTo.
+        (WebCore::EventHandler::handleDrag): Updated comment about reentrancy issue.
+        * page/EventHandler.h:
+
+2009-11-10  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Oliver Hunt.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30754
+
+        Patch 1 of 2.
+
+        As per Section 7.9.4 of the HTML 5 spec. <http://dev.w3.org/html5/spec/Overview.html#drag-and-drop-processing-model>,
+        the drag event should always fire before the dragover event.
+
+        In fixing this bug, this patch also makes our drag processing model
+        conform to the HTML 5 spec.
+
+        Among the changes, this patch ensures that the drag event isn't fired outside
+        of the drag-and-drop processing loop, WebCore::EventHandler::updateDragAndDrop.
+        Currently, the drag event is fired whenever the mouse button is down and the OS
+        detects the mouse moved. But, as per the spec, the drag event should
+        fire approx. every 350ms so long as the mouse button is down.
+
+        Test: fast/events/drag-and-drop-fire-drag-dragover.html
+
+        * page/EventHandler.cpp:
+        (WebCore::EventHandler::clear):
+        (WebCore::EventHandler::canHandleDragAndDropForTarget): Formerly named handleDragAndDropForTarget.
+        Modified to determine when we are in the correct instance of EventHandler to service the drag
+        and drop operation.
+        (WebCore::EventHandler::updateDragAndDrop): Moved code from WebCore::EventHandler::dragSourceMovedTo
+        into this method.
+        (WebCore::EventHandler::cancelDragAndDrop):
+        (WebCore::EventHandler::performDragAndDrop):
+        (WebCore::EventHandler::clearDragState):
+        * page/EventHandler.h: Added field m_shouldOnlyFireDragOverEvent to determine whether
+        we should fire both drag and dragover events or only the dragover event.
+
+2009-11-10  Vitaly Repeshko  <vitalyr@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        [V8] Fix crash in V8CustomXPathNSResolver (http://crbug.com/26726).
+        https://bugs.webkit.org/show_bug.cgi?id=31301
+
+        Tested by new fast/xpath/xpath-detached-iframe-resolver-crash.html.
+
+        Allowed passing V8Proxy for the calling JS context:
+        * bindings/v8/V8DOMWrapper.h:
+        (WebCore::V8DOMWrapper::getXPathNSResolver):
+        * bindings/v8/custom/V8CustomXPathNSResolver.cpp:
+        (WebCore::V8CustomXPathNSResolver::create):
+        (WebCore::V8CustomXPathNSResolver::V8CustomXPathNSResolver):
+        (WebCore::V8CustomXPathNSResolver::lookupNamespaceURI):
+        * bindings/v8/custom/V8CustomXPathNSResolver.h:
+        * bindings/v8/custom/V8DocumentCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+
+2009-11-10  Yael Aharon  <yael.aharon@nokia.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Implement URL decomposition IDL attributes for HTMLAnchorElement.
+        https://bugs.webkit.org/show_bug.cgi?id=29972.
+
+        Add methods for setting different parts of the URL in href attribute.
+
+        Tests: fast/dom/HTMLAnchorElement/set-href-attribute-hash.html
+               fast/dom/HTMLAnchorElement/set-href-attribute-host.html
+               fast/dom/HTMLAnchorElement/set-href-attribute-hostname.html
+               fast/dom/HTMLAnchorElement/set-href-attribute-pathname.html
+               fast/dom/HTMLAnchorElement/set-href-attribute-port.html
+               fast/dom/HTMLAnchorElement/set-href-attribute-protocol.html
+               fast/dom/HTMLAnchorElement/set-href-attribute-search.html
+
+        * bindings/js/JSLocationCustom.cpp:
+        (WebCore::JSLocation::setPort):
+        * html/HTMLAnchorElement.cpp:
+        (WebCore::parsePortFromStringPosition):
+        (WebCore::HTMLAnchorElement::setHash):
+        (WebCore::HTMLAnchorElement::setHost):
+        (WebCore::HTMLAnchorElement::setHostname):
+        (WebCore::HTMLAnchorElement::setPathname):
+        (WebCore::HTMLAnchorElement::setPort):
+        (WebCore::HTMLAnchorElement::setProtocol):
+        (WebCore::HTMLAnchorElement::setSearch):
+        * html/HTMLAnchorElement.h:
+        * html/HTMLAnchorElement.idl:
+        * loader/FrameLoader.cpp:
+        (WebCore::FrameLoader::iconURL):
+        * platform/KURL.cpp:
+        (WebCore::KURL::removePort):
+        (WebCore::KURL::setPort):
+        (WebCore::KURL::prettyURL):
+        (WebCore::protocolIsValid):
+        * platform/KURL.h:
+        (WebCore::KURL::canSetHostOrPort):
+        (WebCore::KURL::canSetPathname):
+        (WebCore::KURL::hasPort):
+        * platform/network/soup/ResourceHandleSoup.cpp:
+        (WebCore::):
+
+2009-11-10  Nate Chapin  <japhet@chromium.org>
+
+        Unreviewed, fix Chromium build after http://trac.webkit.org/changeset/50760.
+
+        * platform/chromium/PopupMenuChromium.cpp:
+        (WebCore::PopupContainer::paintBorder):
+        (WebCore::PopupListBox::paint):
+        (WebCore::PopupListBox::paintRow):
+        * platform/graphics/chromium/TransparencyWin.cpp:
+        (WebCore::TransparencyWin::setupLayerForWhiteLayer):
+        * platform/graphics/skia/GraphicsContextSkia.cpp:
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::fillRoundedRect):
+        (WebCore::GraphicsContext::setPlatformFillColor):
+        (WebCore::GraphicsContext::setPlatformStrokeColor):
+        * rendering/RenderMediaControlsChromium.cpp:
+        (WebCore::paintMediaSlider):
+        (WebCore::paintMediaVolumeSlider):
+        (WebCore::paintMediaTimelineContainer):
+        * rendering/RenderThemeChromiumMac.mm:
+        (WebCore::RenderThemeChromiumMac::paintMenuListButton):
+
+2009-11-10  Brady Eidson  <beidson@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        Repro crash saving pcmag.com article as a webarchive.
+        <rdar://problem/7381219> and https://webkit.org/b/31322
+
+        Test: http/tests/webarchive/cross-origin-stylesheet-crash.html
+
+        * css/CSSStyleSheet.cpp:
+        (WebCore::CSSStyleSheet::addSubresourceStyleURLs): Walk the stylesheet itself instead
+          of creating a CSSRuleList (and subjecting ourselves to the security origin check)
+
+2009-11-10  Beth Dakin  <bdakin@apple.com>
+
+        Attempt 2 to fix Tiger build. No review needed.
+
+        * platform/graphics/cg/GraphicsContextCG.cpp:
+        (WebCore::deviceRGBColorSpaceRef):
+        (WebCore::sRGBColorSpaceRef):
+
+2009-11-10  Kevin Ollivier  <kevino@theolliviers.com>
+
+        wx build fix. Changes needed after r50760.
+
+        * platform/graphics/wx/GraphicsContextWx.cpp:
+        (WebCore::GraphicsContext::GraphicsContext):
+        * platform/wx/wxcode/mac/carbon/non-kerned-drawing.cpp:
+        (WebCore::drawTextWithSpacing):
+
+2009-11-10  Alexey Proskuryakov  <ap@apple.com>
+
+        Qt build fix.
+
+        * platform/network/ResourceHandle.h: Only inherit from AuthenticationClient on platforms
+        that use ResourceHandle as a delegate (Mac, CFNetwork, Curl).
+
+2009-11-10  Beth Dakin  <bdakin@apple.com>
+
+        Tiger build fix. No review needed.
+
+        * platform/graphics/cg/GraphicsContextCG.cpp:
+        (WebCore::sRGBColorSpaceRef):
+
+2009-11-10  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31312
+        Decouple authentication panel callbacks from ResourceHandle
+
+        No change in functionality.
+
+        SocketStreamHandle also needs to request credentials, so it's not appropriate to store
+        ResourceHandle as delegate.
+
+        * WebCore.vcproj/WebCore.vcproj:
+        * platform/network/AuthenticationClient.h: Added.
+        Added a new interface for listening to authentication panel notifications.
+
+        * WebCore.xcodeproj/project.pbxproj: Added AuthenticationClient.h. Let Visual Studio do what
+        it wants with the project file.
+
+        (WebCore::AuthenticationClient::ref): Using our usual method of exposing refcounting on an
+        interface class.
+        (WebCore::AuthenticationClient::deref): Ditto.
+
+        * platform/network/ResourceHandle.h:
+        (WebCore::ResourceHandle::refAuthenticationClient): Ditto.
+        (WebCore::ResourceHandle::derefAuthenticationClient): Ditto.
+
+        * platform/network/cf/AuthenticationCF.cpp:
+        (WebCore::AuthenticationChallenge::AuthenticationChallenge):
+        (WebCore::AuthenticationChallenge::platformCompare):
+        * platform/network/cf/AuthenticationChallenge.h:
+        (WebCore::AuthenticationChallenge::authenticationClient):
+        * platform/network/chromium/AuthenticationChallenge.h:
+        (WebCore::AuthenticationChallenge::authenticationClient):
+        * platform/network/curl/AuthenticationChallenge.h:
+        (WebCore::AuthenticationChallenge::authenticationClient):
+        Keeping a reference to AuthenticationClient, not to ResourceHandle.
+
+2009-11-10  Beth Dakin  <bdakin@apple.com>
+
+       Second attempted gtk build fix. No review needed.
+
+        * html/canvas/CanvasStyle.cpp:
+        (WebCore::CanvasStyle::applyStrokeColor):
+
+
+2009-11-10  Gavin Barraclough  <barraclough@apple.com>
+
+        Reviewed by Geoff Garen.
+
+        Fix back/forwards cache with JSC isolated worlds.
+        https://bugs.webkit.org/show_bug.cgi?id=31310
+        <rdar://problem/7328111> Cached back navigation doesn't restore global object in extension isolated world
+
+        Store the global object for all worlds, not just the normal world.
+        Also maintain bidirectional weak references between the ScriptCachedFrameData and the DOMWrapperWorld,
+        so we can forget global objects if a world goes away.
+
+        * bindings/js/JSDOMBinding.cpp:
+        (WebCore::DOMWrapperWorld::~DOMWrapperWorld):
+        * bindings/js/JSDOMBinding.h:
+        (WebCore::DOMWrapperWorld::rememberScriptCachedFrameData):
+        (WebCore::DOMWrapperWorld::forgetScriptCachedFrameData):
+        * bindings/js/ScriptCachedFrameData.cpp:
+        (WebCore::ScriptCachedFrameData::ScriptCachedFrameData):
+        (WebCore::ScriptCachedFrameData::forgetWorld):
+        (WebCore::ScriptCachedFrameData::domWindow):
+        (WebCore::ScriptCachedFrameData::restore):
+        (WebCore::ScriptCachedFrameData::clear):
+        * bindings/js/ScriptCachedFrameData.h:
+        * bindings/js/ScriptController.h:
+
+2009-11-10  Csaba Osztrogonác  <ossy@webkit.org>
+
+        [Qt] Unreviewed buildfix after r50760.
+
+        * platform/graphics/qt/GraphicsContextQt.cpp:
+        (WebCore::GraphicsContext::GraphicsContext):
+
+2009-11-10  Beth Dakin  <bdakin@apple.com>
+
+        Attempted build fix. (No review needed.)
+
+        * GNUmakefile.am: Adding ColorSpace.h
+
+2009-11-10  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by NOBODY - Build Fix.
+
+        Updated function calls to take a ColorSpace argument, passing
+        in DeviceColorSpace for now - this should be fixed. Also added
+        ColorSpace.h to WebCore project.
+
+        * WebCore.vcproj/WebCore.vcproj:
+        * platform/graphics/win/FontCGWin.cpp:
+        (WebCore::Font::drawGlyphs):
+        * platform/graphics/win/GraphicsContextCGWin.cpp:
+        (WebCore::GraphicsContext::GraphicsContext):
+        * platform/win/PopupMenuWin.cpp:
+        (WebCore::PopupMenu::paint):
+        * platform/win/WebCoreTextRenderer.cpp:
+        (WebCore::doDrawTextAtPoint):
+        * rendering/RenderThemeSafari.cpp:
+        (WebCore::RenderThemeSafari::paintMenuListButton):
+
+2009-11-10  Jens Alfke  <snej@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Optimizations to Element::getAttribute
+        https://bugs.webkit.org/show_bug.cgi?id=30926
+
+        * dom/Element.cpp:
+        (WebCore::Element::getAttribute):  User case-insensitive compare instead of lowercasing the name.
+        * dom/NamedAttrMap.cpp:
+        (WebCore::NamedNodeMap::getAttributeItem):  Avoid redundant compares, and do fast/likely compares first.
+        * platform/text/PlatformString.h:
+        (WebCore::equalPossiblyIgnoringCase):  New inline method, used by both of the above.
+
+2009-11-10  Beth Dakin  <bdakin@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Fix for <rdar://problem/7059710> 
+        -and corresponding-
+        https://bugs.webkit.org/show_bug.cgi?id=31196 Implement -webkit-
+        color-correction for CSS colors
+
+        New exported symbol for GraphicsContext::fillColor() which now 
+        accepts a ColorSpace as an optional parameter.
+        * WebCore.base.exp:
+
+        Added a new file, ColorSpace.h, to define the ColorSpace enum.
+        * WebCore.xcodeproj/project.pbxproj:
+
+        Computed Style for -webkit-color-correction
+        * css/CSSComputedStyleDeclaration.cpp:
+        (WebCore::):
+        (WebCore::CSSComputedStyleDeclaration::getPropertyCSSValue):
+
+        Parse -webkit-color-correction
+        * css/CSSParser.cpp:
+        (WebCore::CSSParser::parseValue):
+
+       Map CSS identifiers to the appropriate values of the ColorSpace enum
+        * css/CSSPrimitiveValueMappings.h:
+        (WebCore::CSSPrimitiveValue::CSSPrimitiveValue):
+        (WebCore::CSSPrimitiveValue::operator ColorSpace):
+
+        New property -webkit-color-correction
+        * css/CSSPropertyNames.in:
+
+        Map -webkit-color-correction into the RenderStyle.
+        * css/CSSStyleSelector.cpp:
+        (WebCore::CSSStyleSelector::applyProperty):
+
+        Add new value sRGB.
+        * css/CSSValueKeywords.in:
+
+        Comment out the reference to sRGB since it will now be inherited as 
+        a value from CSSValueKeywords.
+        * css/SVGCSSValueKeywords.in:
+
+        Definition of the ColorSpace enum.
+        * platform/graphics/ColorSpace.h: Added.
+        (WebCore::):
+
+        These functions all now take a ColorSpace as a parameter.
+        * platform/graphics/GraphicsContext.cpp:
+        (WebCore::GraphicsContext::setStrokeColor):
+        (WebCore::GraphicsContext::setFillColor):
+        (WebCore::GraphicsContext::drawHighlightForText):
+
+        Return the appropriate ColorSpace.
+        (WebCore::GraphicsContext::strokeColorSpace):
+        (WebCore::GraphicsContext::fillColorSpace):
+
+        These functions all call other functions which require a ColorSpace 
+        as a parameter.
+        (WebCore::GraphicsContext::setStrokePattern):
+        (WebCore::GraphicsContext::setFillPattern):
+        (WebCore::GraphicsContext::setStrokeGradient):
+        (WebCore::GraphicsContext::setFillGradient):
+
+        All of the GraphicsContext functions that take a Color should now 
+        also take a ColorSpace.
+        * platform/graphics/GraphicsContext.h:
+
+        Added new member variables stokeColorSpace and fillColorSpace.
+        * platform/graphics/GraphicsContextPrivate.h:
+        (WebCore::GraphicsContextState::GraphicsContextState):
+
+        Attempt to keep the Cairo port building with all of the massive 
+        changes to GraphicsContext.        
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::setPlatformFillColor):
+        (WebCore::GraphicsContext::setPlatformStrokeColor):
+        (WebCore::GraphicsContext::fillRoundedRect):
+
+        
+        * platform/graphics/cg/GraphicsContextCG.cpp:
+        (WebCore::sRGBColorSpaceRef): New static function that returns a 
+        CGColorSpaceRef for the sRGB color space.
+        (WebCore::deviceRGBColorSpaceRef): New static function that returns 
+        a CGColorSpaceRef for the device RGB color space.
+
+        (WebCore::setCGFillColor): Now takes a ColorSpace parameter and 
+        sets the fill color to the specified color in the given ColorSpace.
+        (WebCore::setCGStrokeColor): Same, but for stroke.
+
+        (WebCore::setCGFillColorSpace): New static to set the 
+        CGFillColorSpace to the given ColorSpace
+        (WebCore::setCGStrokeColorSpace): Same, but for stroke.
+
+        Send ColorSpaces when appropriate, set ColorSpaces when 
+        appropriate, and check ColorSpaces when appropriate.
+        (WebCore::GraphicsContext::GraphicsContext):
+        (WebCore::GraphicsContext::drawRect):
+        (WebCore::GraphicsContext::drawLine):
+        (WebCore::GraphicsContext::fillPath):
+        (WebCore::GraphicsContext::strokePath):
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::fillRoundedRect):
+        (WebCore::GraphicsContext::strokeRect):
+        (WebCore::GraphicsContext::drawLineForText):
+        (WebCore::GraphicsContext::setPlatformStrokeColor):
+        (WebCore::GraphicsContext::setPlatformFillColor):
+
+        Attempt to keep Haiku building.
+        * platform/graphics/haiku/GraphicsContextHaiku.cpp:
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::fillRoundedRect):
+        (WebCore::GraphicsContext::setPlatformStrokeColor):
+        (WebCore::GraphicsContext::setPlatformFillColor):
+
+        Attempt to keep QT building.
+        * platform/graphics/qt/GraphicsContextQt.cpp:
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::fillRoundedRect):
+        (WebCore::GraphicsContext::setPlatformStrokeColor):
+        (WebCore::GraphicsContext::setPlatformFillColor):
+
+        Attempt to keep Wince building.
+        * platform/graphics/wince/GraphicsContextWince.cpp:
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::setPlatformFillColor):
+        (WebCore::GraphicsContext::setPlatformStrokeColor):
+        (WebCore::GraphicsContext::clearRect):
+        (WebCore::GraphicsContext::fillRoundedRect):
+        (WebCore::GraphicsContext::setPlatformShadow):
+
+        Attempt to keep WX building.
+        * platform/graphics/wx/GraphicsContextWx.cpp:
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::fillRoundedRect):
+        (WebCore::GraphicsContext::setPlatformStrokeColor):
+        (WebCore::GraphicsContext::setPlatformFillColor):
+
+        Added functions colorSpace() and setColorSpace()
+        * rendering/style/RenderStyle.h:
+        (WebCore::InheritedFlags::colorSpace):
+        (WebCore::InheritedFlags::setColorSpace):
+
+        The ColorSpace is stored here.
+        * rendering/style/StyleRareInheritedData.cpp:
+        (WebCore::StyleRareInheritedData::StyleRareInheritedData):
+        (WebCore::StyleRareInheritedData::operator==):
+        * rendering/style/StyleRareInheritedData.h:
+
+        All of these call sites call GraphicsContext functions which now 
+        require ColorSpaces.
+        * editing/SelectionController.cpp:
+        (WebCore::SelectionController::paintCaret):
+        * html/canvas/CanvasRenderingContext2D.cpp:
+        (WebCore::CanvasRenderingContext2D::drawTextInternal):
+        * html/canvas/CanvasStyle.cpp:
+        (WebCore::CanvasStyle::applyStrokeColor):
+        (WebCore::CanvasStyle::applyFillColor):
+        * inspector/InspectorController.cpp:
+        (WebCore::drawOutlinedQuad):
+        * page/FrameView.cpp:
+        (WebCore::FrameView::paintContents):
+        * platform/ScrollbarTheme.h:
+        (WebCore::ScrollbarTheme::paintScrollCorner):
+        * platform/ScrollbarThemeComposite.cpp:
+        (WebCore::ScrollbarThemeComposite::paintScrollCorner):
+        * platform/graphics/Image.cpp:
+        (WebCore::Image::fillWithSolidColor):
+        * platform/graphics/mac/FontMac.mm:
+        (WebCore::Font::drawGlyphs):
+        * platform/graphics/mac/MediaPlayerPrivateQTKit.mm:
+        (WebCore::MediaPlayerPrivate::paint):
+        * rendering/EllipsisBox.cpp:
+        (WebCore::EllipsisBox::paint):
+        * rendering/InlineFlowBox.cpp:
+        (WebCore::InlineFlowBox::paintTextDecorations):
+        * rendering/InlineTextBox.cpp:
+        (WebCore::updateGraphicsContext):
+        (WebCore::paintTextWithShadows):
+        (WebCore::InlineTextBox::paint):
+        (WebCore::InlineTextBox::paintSelection):
+        (WebCore::InlineTextBox::paintCompositionBackground):
+        (WebCore::InlineTextBox::paintDecoration):
+        (WebCore::InlineTextBox::paintTextMatchMarker):
+        (WebCore::InlineTextBox::paintCompositionUnderline):
+        * rendering/InlineTextBox.h:
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::fillHorizontalSelectionGap):
+        (WebCore::RenderBlock::fillVerticalSelectionGap):
+        (WebCore::RenderBlock::fillLeftSelectionGap):
+        (WebCore::RenderBlock::fillRightSelectionGap):
+        * rendering/RenderBoxModelObject.cpp:
+        (WebCore::RenderBoxModelObject::paintFillLayerExtended):
+        (WebCore::RenderBoxModelObject::paintBoxShadow):
+        * rendering/RenderFileUploadControl.cpp:
+        (WebCore::RenderFileUploadControl::paintObject):
+        * rendering/RenderFrameSet.cpp:
+        (WebCore::RenderFrameSet::paintColumnBorder):
+        (WebCore::RenderFrameSet::paintRowBorder):
+        * rendering/RenderImage.cpp:
+        (WebCore::RenderImage::paintReplaced):
+        * rendering/RenderLayer.cpp:
+        (WebCore::RenderLayer::paintScrollCorner):
+        (WebCore::RenderLayer::paintResizer):
+        * rendering/RenderListBox.cpp:
+        (WebCore::RenderListBox::paintItemForeground):
+        (WebCore::RenderListBox::paintItemBackground):
+        * rendering/RenderListMarker.cpp:
+        (WebCore::RenderListMarker::paint):
+        * rendering/RenderObject.cpp:
+        (WebCore::RenderObject::drawLineForBoxSide):
+        (WebCore::RenderObject::drawArcForBoxSide):
+        * rendering/RenderReplaced.cpp:
+        (WebCore::RenderReplaced::paint):
+        * rendering/RenderScrollbarTheme.cpp:
+        (WebCore::RenderScrollbarTheme::paintScrollCorner):
+        * rendering/RenderThemeMac.mm:
+        (WebCore::RenderThemeMac::paintMenuListButton):
+        * rendering/RenderView.cpp:
+        (WebCore::RenderView::paintBoxDecorations):
+        * rendering/RenderWidget.cpp:
+        (WebCore::RenderWidget::paint):
+        * rendering/SVGInlineTextBox.cpp:
+        (WebCore::SVGInlineTextBox::paintSelection):
+        * svg/graphics/SVGPaintServerGradient.cpp:
+        (WebCore::SVGPaintServerGradient::setup):
+        * svg/graphics/SVGPaintServerSolid.cpp:
+        (WebCore::SVGPaintServerSolid::setup):
+
+2009-11-10  Keishi Hattori  <casey.hattori@gmail.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Speed up syntax highlighter
+        https://bugs.webkit.org/show_bug.cgi?id=31291
+
+        * inspector/front-end/SourceFrame.js:
+        (WebInspector.SourceFrame.prototype._loaded):
+        (WebInspector.SourceSyntaxHighlighter.prototype.process.moveToNextLine): Replace the line content node.
+        (WebInspector.SourceSyntaxHighlighter.prototype.process):
+        (WebInspector.SourceSyntaxHighlighter.prototype.appendNonToken):
+        (WebInspector.SourceSyntaxHighlighter.prototype.syntaxHighlightNode):
+        (WebInspector.CSSSourceSyntaxHighlighter):
+        (WebInspector.JavaScriptSourceSyntaxHighlighter):
+
+2009-11-09  Jeremy Orlow  <jorlow@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Remove session storage setting
+        https://bugs.webkit.org/show_bug.cgi?id=31279
+
+        Remove session storage from Settings.  It was added temporarily so we could
+        disable it by default at runtime in Chromium.  We now disable these things in a
+        different way, so it's time to remove it.  Qt also depended on this setting for
+        a short period of time, but after talking to them we agreed that it should be
+        removed.
+
+        This bug is the second half of https://bugs.webkit.org/show_bug.cgi?id=30602
+
+        * page/DOMWindow.cpp:
+        (WebCore::DOMWindow::sessionStorage):
+        * page/Settings.cpp:
+        (WebCore::Settings::Settings):
+        * page/Settings.h:
+
+2009-11-10  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Eric Carlson and Darin Adler.
+
+        WebCore part of making full-screen video pause during scrubbing.
+
+        * WebCore.Video.exp: Sorted and added HTMLMediaElement::beginScrubbing()
+        and HTMLMediaElement::endScrubbing().
+
+2009-11-10  Anton Muhin  <antonm@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Reapply 50562 reverted by 50588 due to issues with sandboxing (should be fine now).
+        https://bugs.webkit.org/show_bug.cgi?id=31051
+
+        * bindings/v8/V8GCController.cpp:
+        (WebCore::V8GCController::gcEpilogue):
+        (WebCore::V8GCController::checkMemoryUsage):
+        * bindings/v8/V8GCController.h:
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::evaluate):
+        (WebCore::V8Proxy::runScript):
+        (WebCore::V8Proxy::callFunction):
+
+2009-11-10  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for the part of loader directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=31161
+
+        Inherits the following classes from Noncopyable because these are instantiated
+        by 'new' and these are no need to be copyable:
+
+        class Request - WebCore/loader/loader.cpp:100
+        struct ScheduledRedirection - WebCore/loader/RedirectScheduler.cpp:164
+        class ApplicationCacheStorage - WebCore/loader/appcache/ApplicationCacheStorage.cpp:1121
+        class ApplicationCacheHost -  WebCore/loader/DocumentLoader.cpp:151
+        class ImageEventSender - WebCore/loader/ImageLoader.cpp:54
+        struct ProgressItem - WebCore/loader/ProgressTracker.cpp:169
+
+        Inherits ThreadableLoaderClient class from Noncopyable because (its child class) 
+        MainThreadBridge is instantiated by 'new' in 
+        WebCore/loader/WorkerThreadableLoader.cpp:59 it is no need to be copyable.
+
+        ThreadableLoaderClient's inheriting has been changed to public.
+
+        * loader/ImageLoader.cpp:
+        * loader/ProgressTracker.cpp:
+        * loader/RedirectScheduler.cpp:
+        * loader/Request.h:
+        * loader/ThreadableLoaderClient.h:
+        * loader/WorkerThreadableLoader.h:
+        * loader/appcache/ApplicationCacheHost.h:
+        * loader/appcache/ApplicationCacheStorage.h:
+
+2009-11-10  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Eric Seidel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31047
+        [GTK] Failing test media/video-played-ranges-1.html
+
+        WebKit coding style fixes.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::mediaPlayerPrivateMessageCallback):
+        (WebCore::MediaPlayerPrivate::naturalSize):
+        (WebCore::MediaPlayerPrivate::paint):
+        (WebCore::mimeTypeCache):
+
+2009-11-10  Oliver Hunt  <oliver@apple.com>
+
+        Remove build failure introduced by earlier build fix.
+
+        * bindings/v8/custom/V8WebGLIntArrayCustom.cpp:
+
+2009-11-10  Oliver Hunt  <oliver@apple.com>
+
+        Is this the last build fix? grep tells me yes.
+
+        * bindings/v8/custom/V8DocumentCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+
+2009-11-10  Oliver Hunt  <oliver@apple.com>
+
+        Hopefully the last one.  Why aren't these autogenerated?
+
+        * bindings/v8/V8DOMWrapper.cpp:
+        (WebCore::V8DOMWrapper::setIndexedPropertiesToExternalArray):
+        (WebCore::V8DOMWrapper::getTemplate):
+        (WebCore::V8DOMWrapper::convertToV8Object):
+
+2009-11-10  Oliver Hunt  <oliver@apple.com>
+
+        Another chrome build fix.
+
+        * bindings/v8/custom/V8HTMLCanvasElementCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+
+2009-11-10  Oliver Hunt  <oliver@apple.com>
+
+        Yet another chrome buildfix
+
+        * bindings/v8/custom/V8WebGLArrayBufferCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8WebGLArrayCustom.h:
+        (WebCore::constructCanvasArray):
+        * bindings/v8/custom/V8WebGLByteArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::INDEXED_PROPERTY_GETTER):
+        (WebCore::INDEXED_PROPERTY_SETTER):
+        * bindings/v8/custom/V8WebGLFloatArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::INDEXED_PROPERTY_GETTER):
+        (WebCore::INDEXED_PROPERTY_SETTER):
+        * bindings/v8/custom/V8WebGLIntArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::INDEXED_PROPERTY_GETTER):
+        (WebCore::INDEXED_PROPERTY_SETTER):
+        * bindings/v8/custom/V8WebGLRenderingContextCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::vertexAttribAndUniformHelperf):
+        (WebCore::uniformHelperi):
+        (WebCore::uniformMatrixHelper):
+        * bindings/v8/custom/V8WebGLShortArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::INDEXED_PROPERTY_GETTER):
+        (WebCore::INDEXED_PROPERTY_SETTER):
+        * bindings/v8/custom/V8WebGLUnsignedByteArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::INDEXED_PROPERTY_GETTER):
+        (WebCore::INDEXED_PROPERTY_SETTER):
+        * bindings/v8/custom/V8WebGLUnsignedIntArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::INDEXED_PROPERTY_GETTER):
+        (WebCore::INDEXED_PROPERTY_SETTER):
+        * bindings/v8/custom/V8WebGLUnsignedShortArrayCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        (WebCore::INDEXED_PROPERTY_GETTER):
+        (WebCore::INDEXED_PROPERTY_SETTER):
+
+2009-11-10  Oliver Hunt  <oliver@apple.com>
+
+        Chrome build fix.
+
+        * bindings/v8/V8Index.h:
+
+2009-11-10  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30901
+        [Gtk] Need to de-lint the Atk a11y code
+
+        Removal of various and sundry style-violating nits.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+
+2009-11-10  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31047
+        [GTK] Failing test media/video-played-ranges-1.html
+
+        Fix playback rate setter by remembering the rate was changed. Also
+        correctly handle reverse playback by doing a seek from end to
+        beginning of the media.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::MediaPlayerPrivate::MediaPlayerPrivate):
+        (WebCore::MediaPlayerPrivate::currentTime):
+        (WebCore::MediaPlayerPrivate::seek):
+        (WebCore::MediaPlayerPrivate::hasAudio):
+        (WebCore::MediaPlayerPrivate::setVolume):
+        (WebCore::MediaPlayerPrivate::setRate):
+        (WebCore::MediaPlayerPrivate::updateStates):
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.h:
+
+2009-11-10  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Maciej Stachowiak.
+
+        Rename 3D Canvas related classes to use WebGL prefix
+        https://bugs.webkit.org/show_bug.cgi?id=29095
+
+        Automatic rename of all WebGL related types from Canvas* to
+        WebGL* per more recent version of the WebGL spec.
+
+        Due to the automatic rename I've removed the 600+ line change list.
+
+2009-11-09  Dirk Schulze  <krit@webkit.org>
+
+        Reviewed by Oliver Hunt.
+
+        SVG feDisplacementMap is not implemented
+        [https://bugs.webkit.org/show_bug.cgi?id=31255]
+
+        This is the implementation of the SVG filter effect
+        feDisplacementMap. 
+
+        Test: svg/filters/feDisplacementMap.svg
+
+        * svg/graphics/filters/SVGFEDisplacementMap.cpp:
+        (WebCore::FEDisplacementMap::apply):
+
+2009-11-09  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Add a comment about null strings and hash functions.
+        https://bugs.webkit.org/show_bug.cgi?id=29118
+
+        * platform/text/StringHash.h:
+
+2009-11-09  Martin Robinson  <martin.james.robinson@gmail.com>
+
+        Reviewed by Darin Adler.
+
+        Compiler warnings in InspectorResource.h
+        https://bugs.webkit.org/show_bug.cgi?id=29231
+
+        Fix compilation warnings by removing addition operation on an enum type.
+
+        * inspector/InspectorResource.h:
+        (WebCore::InspectorResource::):
+        (WebCore::InspectorResource::Changes::hasChange):
+        (WebCore::InspectorResource::Changes::set):
+        (WebCore::InspectorResource::Changes::setAll):
+
+2009-11-09  Anders Carlsson  <andersca@apple.com>
+
+        Reviewed by Darin Adler and Dan Bernstein.
+
+        <rdar://problem/7328395>
+        https://bugs.webkit.org/show_bug.cgi?id=31277
+
+        When an object tag's style changes (for example when child nodes are added/removed),
+        reuse its Frame (if it has one) instead of creating multiple Frames.
+
+        Test: fast/dom/HTMLObjectElement/children-changed.html
+
+        * loader/FrameLoader.cpp:
+        (WebCore::FrameLoader::requestObject):
+
+2009-11-09  Norbert Leser  <norbert.leser@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        Moved macro MMP_RULES (LINKEROPTION) into symbian instead of symbian-sbsv2,
+        since adjustment of RW-section base address will be needed for all new symbian
+        tool chains, specifically for arm and gcc compilation targets.
+        Also, change target address to 0xE00000 to be sufficient for all targets.
+
+        * WebCore.pro:
+
+2009-11-09  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Crash when inspecting
+        WebCore\manual-tests\inspector\dom-mutation.html
+
+        https://bugs.webkit.org/show_bug.cgi?id=31259
+
+        * inspector/InspectorDOMAgent.cpp:
+        (WebCore::InspectorDOMAgent::handleEvent):
+
+2009-11-09  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Few classes have virtual functions but non-virtual destructor
+        https://bugs.webkit.org/show_bug.cgi?id=31269
+
+        No new tests as there is no functional change.
+
+        * platform/qt/QWebPageClient.h:
+        (QWebPageClient::~QWebPageClient): Add virtual destructor.
+
+2009-11-09  Yael Aharon  <yael.aharon@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Allow setting HTTP headers with empty value in XMLHTTPRequest
+        https://bugs.webkit.org/show_bug.cgi?id=31140
+
+        QtNetwork interprets null string as request to remove the header, not add it.
+        Replace null values with empty values before passing them to QtNetwork.
+
+        Test: http/tests/xmlhttprequest/xmlhttprequest-setrequestheader-no-value.html
+
+        * platform/network/qt/ResourceRequestQt.cpp:
+        (WebCore::ResourceRequest::toNetworkRequest):
+
+2009-11-09  Vadim Zeitlin  <vadim@wxwidgets.org>
+
+        Reviewed by Kevin Ollivier.
+
+        [wx] Fix handling of alpha channel when using wxWidgets 2.9: it was
+        simply ignored before resulting in transparent areas being black in PNG
+        images for example.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=30823
+
+        * platform/image-decoders/wx/ImageDecoderWx.cpp:
+        (WebCore::RGBA32Buffer::asNewNativeImage):
+
+2009-11-09  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        Use explicit parentheses to silence gcc 4.4 -Wparentheses warnings
+        https://bugs.webkit.org/show_bug.cgi?id=31040
+
+        No new tests as there is no functional change.
+
+        * dom/Document.cpp:
+        (WebCore::Document::recalcStyleSelector):
+        * editing/TextIterator.cpp:
+        (WebCore::pushFullyClippedState):
+        * editing/VisibleSelection.cpp:
+        (WebCore::VisibleSelection::appendTrailingWhitespace):
+        * html/HTMLLinkElement.cpp:
+        (WebCore::HTMLLinkElement::process):
+        * loader/RedirectScheduler.cpp:
+        (WebCore::RedirectScheduler::mustLockBackForwardList):
+        * loader/appcache/ApplicationCacheGroup.cpp:
+        (WebCore::ApplicationCacheGroup::didFinishLoadingManifest):
+        * platform/graphics/qt/FontCacheQt.cpp:
+        (WebCore::FontPlatformDataCacheKey::computeHash):
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::handleRunInChild):
+        * rendering/RenderBox.cpp:
+        (WebCore::RenderBox::calcHeight):
+        * rendering/RenderTextControlMultiLine.cpp:
+        (WebCore::RenderTextControlMultiLine::nodeAtPoint):
+        * rendering/style/RenderStyle.cpp:
+        (WebCore::RenderStyle::diff):
+        * svg/SVGAnimateElement.cpp:
+        (WebCore::parseNumberValueAndUnit):
+        * svg/SVGAnimationElement.cpp:
+        (WebCore::SVGAnimationElement::startedActiveInterval):
+        * svg/SVGPreserveAspectRatio.cpp:
+        (WebCore::SVGPreserveAspectRatio::getCTM):
+
+2009-11-09  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Win chromium is slow to draw transparent texts
+        https://bugs.webkit.org/show_bug.cgi?id=31258
+
+        Clip graphics context to reduce calculation.
+
+        No new tests because this change only affects performance.
+
+        * platform/graphics/chromium/FontChromiumWin.cpp:
+        (WebCore::TransparencyAwareFontPainter::TransparencyAwareFontPainter::initializeForGDI):
+        (WebCore::TransparencyAwareFontPainter::TransparencyAwareFontPainter::~TransparencyAwareFontPainter):
+
+2009-11-09  Carol Szabo  <carol.szabo@nokia.com>
+
+        Reviewed by Darin Adler.
+
+        showTree(CounterNode*) generates too little info and has too many spaces.
+        https://bugs.webkit.org/show_bug.cgi?id=31212
+
+        No new tests as the change has no functional effect it is just for
+        improved debugging.
+
+        * rendering/CounterNode.cpp:
+        (WebCore::showTreeAndMark):
+        Changed to also show addresses of parent, next and previous
+        siblings.
+
+2009-11-09  Stuart Morgan  <stuartmorgan@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Moves Mac implementation of setUseSecureKeyboardEntry to Frame.cpp and
+        enables it PLATFORM(CHROMIUM) in addition to PLATFORM(MAC).
+
+        https://bugs.webkit.org/show_bug.cgi?id=31083
+
+        No new tests; implementation is unchanged.
+
+        * page/Frame.cpp:
+        (WebCore::Frame::setUseSecureKeyboardEntry):
+        * page/mac/FrameMac.mm:
+
+2009-11-09  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Jan Alonzo.
+
+        Make XP_UNIX tests consistent
+        https://bugs.webkit.org/show_bug.cgi?id=31250
+
+        No new tests as there is no functional change.
+
+        * plugins/PluginView.cpp:
+        (WebCore::PluginView::setFrameRect): Test if XP_UNIX is defined
+        instead of the value of the macro
+
+        * plugins/gtk/PluginViewGtk.cpp:
+        (WebCore::PluginView::setNPWindowIfNeeded): Test if the XP_UNIX is
+        defined instead of using the PLATFORM macro to be consistent
+        (WebCore::PluginView::getValue): Ditto.
+
+2009-11-09  Kevin Watters  <kevinwatters@gmail.com>
+
+        Reviewed by Darin Adler.
+
+        Thunk to the main thread from ~Database to deref Database's m_document.
+
+        If the Database was the Document's last referrer, then ~Document occurs on the
+        Database thread, and ASSERT(!m_styleRecalcTimer.isActive()) hits a main thread
+        ASSERT in debug builds.
+
+        * storage/Database.cpp:
+        (WebCore::derefDocument):
+        (WebCore::Database::~Database):
+
+2009-11-09  Mark Mentovai  <mark@chromium.org>
+
+        Reviewed by Dan Bernstein.
+
+        Track "can have scrollbar" state within FrameView independently of the
+        individual scrollbar states in ScrollView.
+
+        rdar://problem/7215132, https://bugs.webkit.org/show_bug.cgi?id=29167
+        REGRESSION (r48064): mint.com loses scrollbars after coming out of
+        edit mode.
+
+        rdar://problem/7314421, https://bugs.webkit.org/show_bug.cgi?id=30517
+        REGRESSION (r48064): Extra scroll bars in GarageBand Lesson Store.
+
+        Test: fast/overflow/scrollbar-restored.html
+
+        * WebCore.base.exp:
+        * page/FrameView.cpp:
+        (WebCore::FrameView::FrameView):
+        (WebCore::FrameView::resetScrollbars):
+        (WebCore::FrameView::setCanHaveScrollbars):
+        (WebCore::FrameView::updateCanHaveScrollbars):
+        (WebCore::FrameView::layout):
+        * page/FrameView.h:
+        * platform/ScrollView.h:
+
+2009-11-09  Keishi Hattori  <casey.hattori@gmail.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: CSS syntax highlighter doesn't recognize negative numbers
+        https://bugs.webkit.org/show_bug.cgi?id=31257
+
+        * inspector/front-end/SourceFrame.js:
+
+2009-11-09  Alexander Pavlov  <apavlov@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Debugger shortcuts (F8, F10, F11) have no effect if the Console view is open
+        https://bugs.webkit.org/show_bug.cgi?id=31252
+
+        Route F1-F12 keypresses in the Console view to the current panel if there is one.
+
+        Test: manual-tests/inspector/debugger-shortcuts-with-console-opened.html
+
+        * inspector/front-end/ConsoleView.js:
+        (WebInspector.ConsoleView.prototype._promptKeyDown):
+        * inspector/front-end/utilities.js:
+        ():
+        * manual-tests/inspector/debugger-shortcuts-with-console-opened.html: Added.
+
+2009-11-09  Yael Aharon  <yael.aharon@nokia.com>
+
+        Reviewed by Kenneth Rohde Christiansen.
+
+        [Qt] Pass credentials provided by XMLHTTPRequest to the network request.
+        https://bugs.webkit.org/show_bug.cgi?id=31208
+
+        After r42483, the credentials are no longer passed to the network request
+        in the URL of the request.
+        Pass the credentials from XMLHTTPRequest to the network request, the same
+        way that other ports do.
+
+        After this patch LayoutTests/http/xmlhttprequest/basic-auth.html passes.
+
+        * platform/network/qt/ResourceHandleQt.cpp:
+        (WebCore::ResourceHandle::start):
+        (WebCore::ResourceHandle::loadResourceSynchronously):
+
+2009-11-09  Zoltan Horvath  <zoltan@webkit.org>
+
+        Unreviewed.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31161
+
+        Roll back r50657 because it breaks the MAC builds.
+
+        * loader/ImageLoader.cpp:
+        * loader/ProgressTracker.cpp:
+        * loader/RedirectScheduler.cpp:
+        * loader/Request.h:
+        * loader/ThreadableLoaderClient.h:
+        * loader/WorkerThreadableLoader.h:
+        * loader/appcache/ApplicationCacheHost.h:
+        * loader/appcache/ApplicationCacheStorage.h:
+        * loader/icon/IconDatabaseClient.h:
+
+2009-11-09  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for the part of loader directory in WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=31161
+
+        Inherits the following classes from Noncopyable because these are instantiated
+        by 'new' and these are no need to be copyable:
+
+        class Request - WebCore/loader/loader.cpp:100
+        struct ScheduledRedirection - WebCore/loader/RedirectScheduler.cpp:164
+        class IconDatabaseClient - WebCore/loader/icon/IconDatabase.cpp:89
+        class ApplicationCacheStorage - WebCore/loader/appcache/ApplicationCacheStorage.cpp:1121
+        class ApplicationCacheHost -  WebCore/loader/DocumentLoader.cpp:151
+        class ImageEventSender - WebCore/loader/ImageLoader.cpp:54
+        struct ProgressItem - WebCore/loader/ProgressTracker.cpp:169
+
+        Inherits ThreadableLoaderClient class from Noncopyable because (its child class) 
+        MainThreadBridge is instantiated by 'new' in 
+        WebCore/loader/WorkerThreadableLoader.cpp:59 it is no need to be copyable.
+
+        ThreadableLoaderClient's inheriting has been changed to public.
+
+        * loader/ImageLoader.cpp:
+        * loader/ProgressTracker.cpp:
+        * loader/RedirectScheduler.cpp:
+        * loader/Request.h:
+        * loader/ThreadableLoaderClient.h:
+        * loader/WorkerThreadableLoader.h:
+        * loader/appcache/ApplicationCacheHost.h:
+        * loader/appcache/ApplicationCacheStorage.h:
+        * loader/icon/IconDatabaseClient.h:
+
+2009-11-09  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's DocLoader
+        https://bugs.webkit.org/show_bug.cgi?id=31163
+
+        Inherits DocLoader class from Noncopyable because it is
+        instantiated by 'new' in WebCore/dom/Document.cpp:370 and 
+        it is no need to be copyable.
+
+        * loader/DocLoader.h:
+
+2009-11-09  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's Tokenizer
+        https://bugs.webkit.org/show_bug.cgi?id=31162
+
+        Inherits Tokenizer class from Noncopyable because (its child class)
+        ImageTokenizer instantiated by 'new' in WebCore/loader/ImageDocument.cpp:178 
+        and it is no need to be copyable.
+
+        * dom/Tokenizer.h:
+
+2009-11-09  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's DeleteButtonController
+        https://bugs.webkit.org/show_bug.cgi?id=31105
+
+        Inherits DeleteButtonController class from Noncopyable because it is 
+        instantiated by 'new' in WebCore/editing/Editor.cpp:919 and
+        it is no need to be copyable.  
+
+        * editing/DeleteButtonController.h:
+
+2009-11-09  Martin Robinson  <martin.james.robinson@gmail.com>
+
+        Reviewed by Jan Alonzo.
+
+        [GTK] Expose Page::tabKeyCyclesThroughElements in the API
+        https://bugs.webkit.org/show_bug.cgi?id=30482
+
+        Expose Page::tabKeyCyclesThroughElements as a property of
+        WebKitWebView.
+
+        No new tests; fast/events/keypress-insert-tab.html is no longer skipped.
+
+        * platform/gtk/KeyEventGtk.cpp: Correct m_text for tab key presses.
+        (WebCore::singleCharacterString):
+
+2009-11-09  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Xan Lopez.
+
+        https://bugs.webkit.org/show_bug.cgi?id=25415
+        [GTK][ATK] Please implement support for get_text_at_offset
+
+        Fix a crasher that occurred with text which included newline
+        chars in the markup.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (convertUniCharToUTF8):
+
+2009-11-05  Jakub Wieczorek  <faw217@gmail.com>
+
+        Reviewed by Holger Freyther.
+
+        [Qt] The XML tokenizer reports a parse error twice if it occurs before the document element is found.
+        https://bugs.webkit.org/show_bug.cgi?id=31144
+
+        XMLTokenizer::doEnd() uses an additional logic to report a parse failure in
+        documents that end prematurely but are not considered invalid by QXmlStream.
+        This is to stay compatible with the libxml2 implementation.
+        However, that code path would be also hit in situations when it should not,
+        i.e. the error would have already been caught and handled. As a result, the
+        same error would be reported twice.
+
+        No new tests, because the problem is already covered by
+        fast/parser/xml-declaration-missing-ending-mark.html.
+
+        * dom/XMLTokenizerQt.cpp:
+        (WebCore::XMLTokenizer::doEnd):
+
+2009-11-08  Keishi Hattori  <casey.hattori@gmail.com>
+
+        Reviewed by Pavel Feldman.
+
+        Web Inspector: Inspector should support copy() in the command line
+        https://bugs.webkit.org/show_bug.cgi?id=31238
+
+        * inspector/InspectorBackend.cpp:
+        (WebCore::InspectorBackend::copyText): Added.
+        * inspector/InspectorBackend.h: Added copyText
+        * inspector/InspectorBackend.idl: Added copyText
+        * inspector/front-end/InjectedScript.js:
+        (InjectedScript._copy): Added.
+        (InjectedScript._ensureCommandLineAPIInstalled):
+
+2009-11-08  Drew Wilson  <atwilson@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        V8 WorkerContextExecutionProxy does not handle SharedWorkers
+        https://bugs.webkit.org/show_bug.cgi?id=31226
+
+        Now checks to see what type of context is active and creates the
+        appropriate wrapper (DEDICATEDWORKERCONTEXT vs SHAREDWORKERCONTEXT).
+
+        Added support for converting to SharedWorkers and SharedWorkerContexts.
+
+        Test: Existing layout tests cover this case (start passing in Chrome).
+
+        * bindings/v8/WorkerContextExecutionProxy.cpp:
+        (WebCore::WorkerContextExecutionProxy::initContextIfNeeded):
+        Now generates the right type of DOMWrapper for SharedWorkerContexts.
+        (WebCore::WorkerContextExecutionProxy::convertToV8Object):
+        Added support for SHAREDWORKERCONTEXT.
+        (WebCore::WorkerContextExecutionProxy::convertEventTargetToV8Object):
+        Added support for SharedWorker and SharedWorkerContext.
+
+2009-11-08  Johnny Ding  <johnnyding.webkit@gmail.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31224
+        [V8] Return StyleSheet object instead of HTMLStyleElement w/document.styleSheets named property getter.
+
+        Test: fast/dom/StyleSheet/get-stylesheet-byname.html
+
+        * bindings/v8/custom/V8StyleSheetListCustom.cpp:
+        (WebCore::NAMED_PROPERTY_GETTER):
+
+2009-11-08  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: "Search again" on scripts panel switches
+        to the script this search started with.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31243
+
+        * inspector/front-end/Panel.js:
+        (WebInspector.Panel.prototype.jumpToNextSearchResult):
+
+2009-11-08  Kent Tamura  <tkent@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Simplify Icon interface.
+        https://bugs.webkit.org/show_bug.cgi?id=31154
+
+        - Remove Icon::createIconForFile().  createIconForFiles() covers
+          createIconForFile()'s role.
+        - Remove FileChooser::chooseIcon()
+        - Change the parameter types of FileChooser constructor and the
+          factory method, String -> const Vector<String>&, in order to
+          support initialization with multiple files.
+        - Remove the icon loading code in IconChromiumWin.cpp, which
+          doesn't work because of the sandbox.
+
+        No tests because it's just a refactoring.
+
+        * platform/FileChooser.cpp:
+        (WebCore::FileChooser::FileChooser):
+        (WebCore::FileChooser::create):
+        (WebCore::FileChooser::chooseFile):
+        (WebCore::FileChooser::chooseFiles):
+        * platform/FileChooser.h:
+        * platform/graphics/Icon.h:
+        * platform/graphics/chromium/IconChromiumLinux.cpp:
+        * platform/graphics/chromium/IconChromiumMac.cpp:
+        * platform/graphics/chromium/IconChromiumWin.cpp:
+        (WebCore::Icon::createIconForFiles):
+        * platform/graphics/gtk/IconGtk.cpp:
+        (WebCore::Icon::createIconForFiles):
+        * platform/graphics/haiku/IconHaiku.cpp:
+        * platform/graphics/mac/IconMac.mm:
+        (WebCore::Icon::createIconForFiles):
+        * platform/graphics/qt/IconQt.cpp:
+        (WebCore::Icon::createIconForFiles):
+        * platform/graphics/win/IconWin.cpp:
+        (WebCore::Icon::createIconForFiles):
+        * platform/graphics/wx/IconWx.cpp:
+        * rendering/RenderFileUploadControl.cpp:
+        (WebCore::RenderFileUploadControl::RenderFileUploadControl):
+
+2009-11-08  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Adam Barth.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31098
+
+        Allows same-origin plugin-based content to load.
+
+        Test: http/tests/security/xssAuditor/object-src-inject.html
+
+        * page/XSSAuditor.cpp:
+        (WebCore::XSSAuditor::canLoadExternalScriptFromSrc): Modified to call XSSAuditor::isSameOriginResource.
+        (WebCore::XSSAuditor::canLoadObject): Ditto.
+        (WebCore::XSSAuditor::canSetBaseElementURL): Ditto. 
+        (WebCore::XSSAuditor::isSameOriginResource): Added.
+        * page/XSSAuditor.h:
+
+2009-11-08  David Levin  <levin@chromium.org>
+
+        Reviewed by NOBODY (chromium build fix).
+
+        * platform/network/HTTPParsers.cpp:
+        (WebCore::parseDate): Changed this to not
+        use a date parser that needs ExecState passed.
+        
+2009-11-08  David Levin  <levin@chromium.org>
+
+        Unreviewed build fix for chromium.
+
+        * platform/graphics/skia/GraphicsContextSkia.cpp:
+        (WebCore::GraphicsContext::fillPath):
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::strokePath):
+        (WebCore::GraphicsContext::strokeRect):
+
+2009-11-08  David Levin  <levin@chromium.org>
+
+        Unreviewed build fix for chromium.
+
+        Build fix for https://bugs.webkit.org/show_bug.cgi?id=31219
+        Clean up GraphicsContext's current concept of ColorSpace
+
+        * platform/graphics/skia/GraphicsContextSkia.cpp:
+        (WebCore::GraphicsContext::fillPath):
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::strokePath):
+        (WebCore::GraphicsContext::strokeRect):
+
+2009-11-08  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: [REGRESSION] committing style edit
+        clears elements panel selection.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31242
+
+        * inspector/front-end/ElementsTreeOutline.js:
+        (WebInspector.ElementsTreeOutline.prototype.update):
+        * inspector/front-end/StylesSidebarPane.js:
+        (WebInspector.StylePropertyTreeElement.prototype.):
+        (WebInspector.StylePropertyTreeElement.prototype):
+
+2009-11-08  Janne Koskinen  <janne.p.koskinen@digia.com>
+
+        Reviewed by Holger Freyther.
+
+        ResourceRequest to be class instead of struct
+        https://bugs.webkit.org/show_bug.cgi?id=30670
+
+        Started as a compilation fix for Symbian where the compiler makes a distinction between
+        class and struct in function argument signatures.
+        Changed all forward declarations of ResourceRequest to have class in the forward
+        declaration instead of struct and changed the definition of ResourceRequest to be class
+        and added access qualifiers where missing. Additionally two references of friend
+        struct ResourceRequestBase changed to class instead.
+
+        * history/HistoryItem.h:
+        * inspector/InspectorController.h:
+        * inspector/InspectorResource.h:
+        * loader/DocumentThreadableLoader.h:
+        * loader/FrameLoaderClient.h:
+        * loader/MainResourceLoader.h:
+        * loader/ResourceLoadNotifier.h:
+        * loader/SubresourceLoader.h:
+        * loader/SubresourceLoaderClient.h:
+        * loader/ThreadableLoader.h:
+        * loader/WorkerThreadableLoader.h:
+        * loader/appcache/ApplicationCache.h:
+        * loader/appcache/ApplicationCacheHost.h:
+        * platform/CrossThreadCopier.h:
+        * platform/network/ResourceHandle.h:
+        * platform/network/ResourceHandleClient.h:
+        * platform/network/ResourceRequestBase.h:
+        * platform/network/cf/ResourceRequest.h:
+        * platform/network/cf/ResourceRequestCFNet.h:
+        * platform/network/chromium/ResourceRequest.h:
+        * platform/network/curl/ResourceRequest.h:
+        * platform/network/qt/ResourceRequest.h:
+        * platform/network/soup/ResourceRequest.h:
+        * xml/XMLHttpRequest.h:
+
+2009-11-08  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Simon Fraser.
+
+        <rdar://problem/7363434> Crash inside RenderObject::localToAbsolute
+        below FrameView::layout
+        https://bugs.webkit.org/show_bug.cgi?id=31093
+
+        Test: fast/block/positioning/relative-positioned-inline-container.html
+
+        In <http://trac.webkit.org/changeset/19148>, setStaticY() was changed
+        to mark the object for layout, doing so without marking its ancestors.
+        However, RenderBlock::skipLeadingWhitespace and
+        RenderBlock::skipTrailingWhitespace() call setStaticY() on a relative-
+        positioned inline container, causing it to be marked for layout without
+        ever going back to give it layout, and thus layout could end with a
+        dirty object still in the tree, leading to all sorts of badness.
+
+        The fix is to revert setStaticY() to not marking the object dirty, and
+        instead do it in the call sites that require it, which are in
+        RenderBlock and RenderFlexibleBox.
+
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::adjustPositionedBlock):
+        * rendering/RenderFlexibleBox.cpp:
+        (WebCore::RenderFlexibleBox::layoutHorizontalBox):
+        (WebCore::RenderFlexibleBox::layoutVerticalBox):
+        * rendering/RenderLayer.cpp:
+        * rendering/RenderLayer.h:
+        (WebCore::RenderLayer::setStaticY):
+
+2009-11-07  Daniel Bates  <dbates@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=20780
+        
+        Fixes an issue where the onchange event handler is not fired when the 
+        input field is autocompleted.
+        
+        We cannot test this using DRT since DRT cannot emulate autocompletion.
+        So, a manual-test is included.
+
+        Tests: manual-tests/autocompletion-fire-onchange.html
+
+        * manual-tests/autocompletion-fire-onchange.html: Added.
+        * rendering/RenderTextControl.cpp:
+        (WebCore::RenderTextControl::setInnerTextValue):
+
+2009-11-07  Benjamin Otte  <otte@gnome.org>
+
+        Reviewed by Holger Freyther.
+
+        Mark redrawn areas on image surfaces as dirty.
+
+        This is required to conform to the Cairo API, but is currently only
+        used by debugging tools like cairo-trace.
+
+        * platform/graphics/cairo/ImageBufferCairo.cpp:
+        (WebCore::ImageBuffer::platformTransformColorSpace):
+        (WebCore::putImageData):
+
+2009-11-07  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Xan Lopez.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30878
+        [Gtk] atk_text_get_text() fails in entries when the end_offset is -1
+
+        If the end_offset is -1, use the String length as the end_offset.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (webkit_accessible_text_get_text):
+
+2009-11-06  Beth Dakin  <bdakin@apple.com>
+
+        Reviewed by Adele Peterson.
+
+        Fix for https://bugs.webkit.org/show_bug.cgi?id=31219 Clean up 
+        GraphicsContext's current concept of ColorSpace
+
+        ColorSpace is now called ColorType. The variables on the state we 
+        appropriately re-named as well. I removed strokeColorSpace() and 
+        fillColorSpace() from GraphicsContext since they were never called. 
+
+        * platform/graphics/GraphicsContext.cpp:
+        (WebCore::GraphicsContext::setStrokeColor):
+        (WebCore::GraphicsContext::setFillColor):
+        (WebCore::GraphicsContext::setStrokePattern):
+        (WebCore::GraphicsContext::setFillPattern):
+        (WebCore::GraphicsContext::setStrokeGradient):
+        (WebCore::GraphicsContext::setFillGradient):
+        * platform/graphics/GraphicsContext.h:
+        (WebCore::):
+        * platform/graphics/GraphicsContextPrivate.h:
+        (WebCore::GraphicsContextState::GraphicsContextState):
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (WebCore::GraphicsContext::fillPath):
+        (WebCore::GraphicsContext::strokePath):
+        * platform/graphics/cg/GraphicsContextCG.cpp:
+        (WebCore::calculateDrawingMode):
+        (WebCore::GraphicsContext::drawPath):
+        (WebCore::GraphicsContext::fillPath):
+        (WebCore::GraphicsContext::strokePath):
+        (WebCore::GraphicsContext::fillRect):
+        (WebCore::GraphicsContext::strokeRect):
+        * platform/graphics/qt/GraphicsContextQt.cpp:
+        (WebCore::GraphicsContext::fillPath):
+        (WebCore::GraphicsContext::strokePath):
+        (WebCore::GraphicsContext::fillRect):
+        * platform/graphics/wince/GraphicsContextWince.cpp:
+        (WebCore::GraphicsContext::fillPath):
+        (WebCore::GraphicsContext::fillRect):
+
+2009-11-06  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Tim Hatcher.
+
+        Fixes <http://webkit.org/b/31177>.
+        Web Inspector: Bind backspace to delete cookies and DOM Storage.
+        
+        Refactor editing code from DOMStorageDataGrid to DataGrid, so other
+        places in the inspector can use editing in DataGrid (added a FIXME for
+        some stuff that needs to be generalized).
+        
+        Also added deleting functionality to DataGrid, and implemented it for
+        Cookies and DOM Storage. The reason this patch is so big is because of
+        the refactoring of editing code, which won't be used yet in a cross-datagrid
+        way, but should be able to.
+        
+        Additionally, moved the callbacks members from DOMStorageDataGrid to
+        DOMStorageItemsView, which allowed us to delete DOMStorageDataGrid, to 
+        make the architecture of DOM Storage look a lot more like the Cookies view.
+        
+        Lastly, added a preventDefault call in ElementsTreeOutline to prevent the 
+        inspector from beeping at you when you delete an element.
+
+        * WebCore.gypi: Removed DOMStorageDataGrid.
+        * WebCore.vcproj/WebCore.vcproj: Removed DOMStorageDataGrid.
+        * inspector/front-end/CookieItemsView.js:
+        (WebInspector.CookieItemsView.prototype.dataGridForCookies):
+        (WebInspector.CookieItemsView.prototype._deleteButtonClicked):
+        (WebInspector.CookieItemsView.prototype._deleteCookieCallback):
+        * inspector/front-end/DOMStorageDataGrid.js: Removed.
+        * inspector/front-end/DOMStorageItemsView.js:
+        (WebInspector.DOMStorageItemsView.prototype._dataGridForDOMStorageEntries):
+        (WebInspector.DOMStorageItemsView.prototype._deleteButtonClicked):
+        (WebInspector.DOMStorageItemsView.prototype._refreshButtonClicked):
+        (WebInspector.DOMStorageItemsView.prototype._editingCallback):
+        (WebInspector.DOMStorageItemsView.prototype.deleteSelectedRow):
+        (WebInspector.DOMStorageItemsView.prototype._deleteCallback):
+        * inspector/front-end/DataGrid.js:
+        (WebInspector.DataGrid):
+        (WebInspector.DataGrid.prototype._ondblclick): Moved from DOMStorageDataGrid to DataGrid + Refactoring.
+        (WebInspector.DataGrid.prototype._startEditingColumnOfDataGridNode): Ditto.
+        (WebInspector.DataGrid.prototype._startEditing): Ditto.
+        (WebInspector.DataGrid.prototype._editingCommitted.moveToNextIfNeeded): Ditto.
+        (WebInspector.DataGrid.prototype._editingCommitted): Ditto.
+        (WebInspector.DataGrid.prototype._editingCancelled): Ditto.
+        (WebInspector.DataGrid.prototype.handleKeyEvent): Added case for delete/backspace.
+        * inspector/front-end/ElementsTreeOutline.js:
+        (WebInspector.ElementsTreeOutline.prototype.handleKeyEvent): Added preventDefault call.
+        * inspector/front-end/WebKit.qrc: Removed DOMStorageDataGrid.
+        * inspector/front-end/inspector.html: Removed DOMStorageDataGrid.
+
+2009-11-06  Geoffrey Garen  <ggaren@apple.com>
+
+        Qt build fix: added an ExecState parameter.
+
+        * bridge/qt/qt_runtime.cpp:
+        (JSC::Bindings::convertValueToQVariant):
+        (JSC::Bindings::convertQVariantToValue):
+
+2009-11-06  Geoffrey Garen  <ggaren@apple.com>
+
+        https://bugs.webkit.org/show_bug.cgi?id=31197
+        Implemented a timezone cache not based on Mac OS X's notify_check API.
+
+        Updated for JavaScriptCore internal API change.
+
+        * bridge/qt/qt_runtime.cpp:
+        (JSC::Bindings::convertValueToQVariant):
+        (JSC::Bindings::convertQVariantToValue): Updated for namespace change.
+
+        * platform/network/HTTPParsers.cpp:
+        (WebCore::parseDate): Pass 0 for ExecState, since we don't have one.
+        (This function probably shouldn't be using a JavaScript date parser
+        to begin with, but oh well.)
+
+2009-11-06  Anantanarayanan G Iyengar  <ananta@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        The associated webkit bug is https://bugs.webkit.org/show_bug.cgi?id=31067,
+        which affects Chromium only.
+        
+        Changes to V8HTMLDocumentCustom.cpp are as below:-
+        1. The HTMLDocumentOpen function would cause a crash in Chromium if
+           there was no calling javascript context. We now check for this case
+           and pass in NULL to the HTMLDocument::open function which can handle
+           a NULL document parameter.
+        2. The other functions like HTMLDocumentWrite, HTMLDocumentWriteln, etc
+           had ASSERTS for a NULL caller frame, which was bogus as it would crash
+           anyway. We now check for this case and return a failure.
+           
+        Changes to V8DOMWindowCustom.cpp are as below:-
+        1. Instead of failing the window.open call made by NPAPI for lack of a
+           calling javascript context, we now use the entered context as the calling
+           context.
+
+        Tests: plugins/document-open.html
+               plugins/window-open.html
+
+        * bindings/v8/custom/V8DOMWindowCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        * bindings/v8/custom/V8HTMLDocumentCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+
+2009-11-06  Steve Block  <steveblock@google.com>
+
+        Reviewed by Eric Seidel.
+
+        Geolocation error code UNKNOWN_ERROR is deprecated.
+        https://bugs.webkit.org/show_bug.cgi?id=31184
+
+        Remove this error code from PositionError, both for use from C++ code and from the JS object.
+
+        Updated fast/dom/Geolocation/error.html to test this.
+
+        * page/PositionError.h: Modified.
+        (WebCore::PositionError::): Remove ErrorCode::UNKNOWN_ERROR.
+        * page/PositionError.idl: Modified. Remove UNKNOWN_ERROR constant.
+        * page/Geolocation.cpp: Modified.
+        (WebCore::Geolocation::startRequest): Replace UNKNOWN_ERROR with POSITION_UNAVAILABLE.
+        * platform/gtk/GeolocationServiceGtk.cpp: Modified.
+        (WebCore::GeolocationServiceGtk::startUpdating): Replace UNKNOWN_ERROR with POSITION_UNAVAILABLE.
+
+2009-11-06  Dirk Schulze  <krit@webkit.org>
+
+        Reviewed by Nikolas Zimmermann.
+
+        feMorphology filter is not implemented
+        [https://bugs.webkit.org/show_bug.cgi?id=5863]
+
+        The Implementation of feMorphology.
+        
+        Test: We have allready a test for feMorphology
+              svg/W3C-SVG-1.1/filters-morph-01-f.svg
+
+        * svg/graphics/filters/SVGFEMorphology.cpp:
+        (WebCore::FEMorphology::apply):
+
+2009-11-06  Steve Block  <steveblock@google.com>
+
+        Reviewed by Eric Seidel.
+
+        V8DOMWindowCustom.cpp is missing WEB_SOCKETS guard on include.
+        https://bugs.webkit.org/show_bug.cgi?id=31209
+
+        Build fix only. No new tests possible.
+
+        * bindings/v8/custom/V8DOMWindowCustom.cpp: Modified. Added WEB_SOCKETS guard on inclue of WebSockets.h.
+
+2009-11-06  Drew Wilson  <atwilson@chromium.org>
+
+        Reviewed by David Levin.
+
+        V8 bindings do not support SharedWorkers as event targets
+        https://bugs.webkit.org/show_bug.cgi?id=31199
+
+        No new tests because existing layout tests suffice (they currently
+        crash on Chromium)
+
+        * bindings/v8/V8DOMWrapper.cpp:
+        (WebCore::V8DOMWrapper::convertEventTargetToV8Object):
+        Added clause to create a DOM wrapper for SharedWorkers.
+
+2009-11-06  Anton Muhin  <antonm@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Do not unnecessarly synchronzie in weak reference callbacks.
+        https://bugs.webkit.org/show_bug.cgi?id=31191
+
+        * bindings/v8/DOMData.h:
+        (WebCore::DOMData::handleWeakObject):
+
+2009-11-06  Alexander Pavlov  <apavlov@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Fix resource content search.
+        https://bugs.webkit.org/show_bug.cgi?id=31202
+
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype.refresh):
+        (WebInspector.AbstractTimelinePanel.prototype.removeItem):
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelineGraph.prototype.refresh):
+
+2009-11-05  Yuta Kitamura  <yutak@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Fix ASSERT(currentStyle = renderStyle()).
+        https://bugs.webkit.org/show_bug.cgi?id=31152
+
+        * dom/Element.cpp:
+        (WebCore::Element::pseudoStyleCacheIsInvalid): We should have used "==" instead of "=".
+
+2009-11-05  Alpha Lam  <hclam@chromium.org>
+
+        Revert 50562 because it broke Chromium. Not reviewed since this is a build fix and revert.
+
+        * bindings/v8/V8GCController.cpp:
+        (WebCore::V8GCController::gcEpilogue):
+        * bindings/v8/V8GCController.h:
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::evaluate):
+        (WebCore::V8Proxy::runScript):
+        (WebCore::V8Proxy::callFunction):
+
+2009-11-05  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Sam Weinig.
+
+        Cross-domain access to stylesheet text should not be allowed
+        https://bugs.webkit.org/show_bug.cgi?id=20527
+
+        Check whether whether the current document can read the cssRules from
+        the style sheet.  Firefox throws a security error here, but we return
+        null instead because that's what we usually do in these cases.
+
+        Test: http/tests/security/cannot-read-cssrules-redirect.html
+              http/tests/security/cannot-read-cssrules.html
+
+        * css/CSSStyleSheet.cpp:
+        (WebCore::CSSStyleSheet::cssRules):
+
+2009-11-05  Steve Block  <steveblock@google.com>
+
+        Reviewed by Eric Seidel.
+
+        If the Geolocation service fails to start, invoke the error callback asynchronously.
+        https://bugs.webkit.org/show_bug.cgi?id=28276
+
+        All Geolocation callbacks must be invoked asynchronously.
+        See http://www.w3.org/TR/geolocation-API/#geolocation_interface
+
+        No new tests possible with current LayoutTestController.
+
+        * page/Geolocation.cpp:
+        (WebCore::Geolocation::getCurrentPosition): Modified. Asserts that startRequest returned a notifier.
+        (WebCore::Geolocation::watchPosition): Modified. Asserts that startRequest returned a notifier.
+        (WebCore::Geolocation::startRequest): Modified. If the Geolocation service fails to start, set a fatal error on the notifier.
+
+2009-11-05  Chris Jerdonek  <chris.jerdonek@gmail.com>
+
+        Reviewed by Eric Seidel.
+
+        Removed the "this is part of the KDE project" comments from 
+        all *.h, *.cpp, *.idl, and *.pm files.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=31167
+        
+        The maintenance and architecture page in the project wiki lists
+        this as a task.
+        
+        This change includes no changes or additions to test cases 
+        since the change affects only comments.
+
+        * bindings/scripts/CodeGeneratorV8.pm:
+        * bindings/scripts/IDLParser.pm:
+        * bindings/scripts/IDLStructure.pm:
+        * css/CSSInheritedValue.cpp:
+        * css/CSSInitialValue.cpp:
+        * css/CSSMediaRule.cpp:
+        * css/CSSNamespace.h:
+        * css/CSSProperty.cpp:
+        * css/CSSProperty.h:
+        * css/CSSRuleList.cpp:
+        * css/CSSRuleList.h:
+        * css/CSSSelector.h:
+        * css/CSSValueList.cpp:
+        * css/FontValue.cpp:
+        * css/MediaFeatureNames.cpp:
+        * css/MediaFeatureNames.h:
+        * css/Pair.h:
+        * css/SVGCSSStyleSelector.cpp:
+        * css/ShadowValue.cpp:
+        * css/StyleSheet.cpp:
+        * css/StyleSheetList.cpp:
+        * css/maketokenizer:
+        * dom/BeforeUnloadEvent.cpp:
+        * dom/BeforeUnloadEvent.h:
+        * dom/CSSMappedAttributeDeclaration.cpp:
+        * dom/EventNames.cpp:
+        * dom/EventTarget.cpp:
+        * dom/MappedAttributeEntry.h:
+        * dom/MouseRelatedEvent.h:
+        * dom/RangeException.h:
+        * dom/StyleElement.h:
+        * dom/Tokenizer.h:
+        * html/HTMLHeadElement.h:
+        * html/HTMLHeadingElement.cpp:
+        * html/HTMLHeadingElement.h:
+        * html/HTMLHtmlElement.h:
+        * html/HTMLImageLoader.h:
+        * html/HTMLMetaElement.h:
+        * html/HTMLModElement.cpp:
+        * html/HTMLModElement.h:
+        * html/HTMLOptionsCollection.cpp:
+        * html/HTMLPlugInElement.cpp:
+        * html/HTMLPreElement.cpp:
+        * html/HTMLPreElement.h:
+        * html/HTMLTableCellElement.cpp:
+        * html/HTMLTableCellElement.h:
+        * html/HTMLTableColElement.cpp:
+        * html/HTMLTableColElement.h:
+        * html/HTMLTablePartElement.cpp:
+        * html/HTMLTablePartElement.h:
+        * html/HTMLTitleElement.h:
+        * page/MouseEventWithHitTestResults.h:
+        * platform/StaticConstructors.h:
+        * platform/text/AtomicStringImpl.h:
+        * platform/text/qt/TextBreakIteratorQt.cpp:
+        * rendering/AutoTableLayout.h:
+        * rendering/CounterNode.cpp:
+        * rendering/EllipsisBox.cpp:
+        * rendering/EllipsisBox.h:
+        * rendering/FixedTableLayout.cpp:
+        * rendering/FixedTableLayout.h:
+        * rendering/HitTestRequest.h:
+        * rendering/HitTestResult.h:
+        * rendering/InlineRunBox.h:
+        * rendering/PointerEventsHitRules.cpp:
+        * rendering/PointerEventsHitRules.h:
+        * rendering/RenderBR.cpp:
+        * rendering/RenderBR.h:
+        * rendering/RenderButton.cpp:
+        * rendering/RenderButton.h:
+        * rendering/RenderFieldset.cpp:
+        * rendering/RenderFrameSet.cpp:
+        * rendering/RenderListItem.cpp:
+        * rendering/RenderTableRow.cpp:
+        * rendering/RenderView.h:
+        * rendering/RootInlineBox.h:
+        * rendering/SVGInlineTextBox.cpp:
+        * rendering/SVGInlineTextBox.h:
+        * rendering/TableLayout.h:
+        * rendering/break_lines.h:
+        * rendering/style/SVGRenderStyle.cpp:
+        * rendering/style/SVGRenderStyle.h:
+        * rendering/style/SVGRenderStyleDefs.cpp:
+        * rendering/style/SVGRenderStyleDefs.h:
+        * svg/GradientAttributes.h:
+        * svg/LinearGradientAttributes.h:
+        * svg/PatternAttributes.h:
+        * svg/RadialGradientAttributes.h:
+        * svg/SVGAElement.cpp:
+        * svg/SVGAngle.idl:
+        * svg/SVGAnimateColorElement.cpp:
+        * svg/SVGAnimateColorElement.h:
+        * svg/SVGAnimateElement.cpp:
+        * svg/SVGAnimateElement.h:
+        * svg/SVGAnimateTransformElement.h:
+        * svg/SVGAnimatedPathData.cpp:
+        * svg/SVGAnimatedPathData.h:
+        * svg/SVGAnimatedPoints.cpp:
+        * svg/SVGAnimatedPoints.h:
+        * svg/SVGAnimationElement.cpp:
+        * svg/SVGCircleElement.cpp:
+        * svg/SVGClipPathElement.cpp:
+        * svg/SVGColor.cpp:
+        * svg/SVGColor.idl:
+        * svg/SVGComponentTransferFunctionElement.cpp:
+        * svg/SVGComponentTransferFunctionElement.h:
+        * svg/SVGCursorElement.cpp:
+        * svg/SVGDefsElement.cpp:
+        * svg/SVGDescElement.cpp:
+        * svg/SVGDescElement.h:
+        * svg/SVGDocument.idl:
+        * svg/SVGElement.idl:
+        * svg/SVGElementInstanceList.cpp:
+        * svg/SVGElementInstanceList.h:
+        * svg/SVGEllipseElement.cpp:
+        * svg/SVGExternalResourcesRequired.cpp:
+        * svg/SVGFEBlendElement.cpp:
+        * svg/SVGFEBlendElement.h:
+        * svg/SVGFEColorMatrixElement.cpp:
+        * svg/SVGFEColorMatrixElement.h:
+        * svg/SVGFEComponentTransferElement.cpp:
+        * svg/SVGFEComponentTransferElement.h:
+        * svg/SVGFECompositeElement.cpp:
+        * svg/SVGFECompositeElement.h:
+        * svg/SVGFEFloodElement.cpp:
+        * svg/SVGFEFloodElement.h:
+        * svg/SVGFEFuncAElement.cpp:
+        * svg/SVGFEFuncAElement.h:
+        * svg/SVGFEFuncBElement.cpp:
+        * svg/SVGFEFuncBElement.h:
+        * svg/SVGFEFuncGElement.cpp:
+        * svg/SVGFEFuncGElement.h:
+        * svg/SVGFEFuncRElement.cpp:
+        * svg/SVGFEFuncRElement.h:
+        * svg/SVGFEGaussianBlurElement.cpp:
+        * svg/SVGFEGaussianBlurElement.h:
+        * svg/SVGFEImageElement.cpp:
+        * svg/SVGFEMergeElement.cpp:
+        * svg/SVGFEMergeElement.h:
+        * svg/SVGFEMergeNodeElement.cpp:
+        * svg/SVGFEOffsetElement.cpp:
+        * svg/SVGFEOffsetElement.h:
+        * svg/SVGFETileElement.cpp:
+        * svg/SVGFETileElement.h:
+        * svg/SVGFETurbulenceElement.cpp:
+        * svg/SVGFETurbulenceElement.h:
+        * svg/SVGFilterElement.cpp:
+        * svg/SVGGElement.cpp:
+        * svg/SVGGradientElement.cpp:
+        * svg/SVGHKernElement.idl:
+        * svg/SVGLangSpace.cpp:
+        * svg/SVGLangSpace.h:
+        * svg/SVGLength.cpp:
+        * svg/SVGLength.h:
+        * svg/SVGLength.idl:
+        * svg/SVGLengthList.cpp:
+        * svg/SVGLengthList.h:
+        * svg/SVGLineElement.cpp:
+        * svg/SVGLinearGradientElement.h:
+        * svg/SVGList.h:
+        * svg/SVGListTraits.h:
+        * svg/SVGLocatable.h:
+        * svg/SVGMaskElement.cpp:
+        * svg/SVGMatrix.idl:
+        * svg/SVGMetadataElement.cpp:
+        * svg/SVGMetadataElement.h:
+        * svg/SVGMetadataElement.idl:
+        * svg/SVGNumber.idl:
+        * svg/SVGNumberList.cpp:
+        * svg/SVGNumberList.h:
+        * svg/SVGPaint.cpp:
+        * svg/SVGPathElement.cpp:
+        * svg/SVGPathSeg.h:
+        * svg/SVGPathSegArc.cpp:
+        * svg/SVGPathSegArc.h:
+        * svg/SVGPathSegClosePath.cpp:
+        * svg/SVGPathSegClosePath.h:
+        * svg/SVGPathSegCurvetoCubic.cpp:
+        * svg/SVGPathSegCurvetoCubic.h:
+        * svg/SVGPathSegCurvetoCubicSmooth.cpp:
+        * svg/SVGPathSegCurvetoCubicSmooth.h:
+        * svg/SVGPathSegCurvetoQuadratic.cpp:
+        * svg/SVGPathSegCurvetoQuadratic.h:
+        * svg/SVGPathSegCurvetoQuadraticSmooth.cpp:
+        * svg/SVGPathSegCurvetoQuadraticSmooth.h:
+        * svg/SVGPathSegLineto.cpp:
+        * svg/SVGPathSegLineto.h:
+        * svg/SVGPathSegLinetoHorizontal.cpp:
+        * svg/SVGPathSegLinetoHorizontal.h:
+        * svg/SVGPathSegLinetoVertical.cpp:
+        * svg/SVGPathSegLinetoVertical.h:
+        * svg/SVGPathSegMoveto.cpp:
+        * svg/SVGPathSegMoveto.h:
+        * svg/SVGPatternElement.cpp:
+        * svg/SVGPoint.idl:
+        * svg/SVGPointList.cpp:
+        * svg/SVGPointList.h:
+        * svg/SVGPolyElement.cpp:
+        * svg/SVGPolygonElement.cpp:
+        * svg/SVGPolygonElement.h:
+        * svg/SVGPolylineElement.cpp:
+        * svg/SVGPolylineElement.h:
+        * svg/SVGPreserveAspectRatio.cpp:
+        * svg/SVGPreserveAspectRatio.h:
+        * svg/SVGRadialGradientElement.h:
+        * svg/SVGRect.idl:
+        * svg/SVGRectElement.cpp:
+        * svg/SVGRenderingIntent.h:
+        * svg/SVGSVGElement.idl:
+        * svg/SVGScriptElement.cpp:
+        * svg/SVGSetElement.cpp:
+        * svg/SVGSetElement.h:
+        * svg/SVGStopElement.cpp:
+        * svg/SVGStringList.cpp:
+        * svg/SVGStringList.h:
+        * svg/SVGStylable.cpp:
+        * svg/SVGStylable.h:
+        * svg/SVGStyleElement.cpp:
+        * svg/SVGStyleElement.h:
+        * svg/SVGStyledElement.h:
+        * svg/SVGStyledLocatableElement.cpp:
+        * svg/SVGStyledLocatableElement.h:
+        * svg/SVGStyledTransformableElement.cpp:
+        * svg/SVGStyledTransformableElement.h:
+        * svg/SVGSwitchElement.cpp:
+        * svg/SVGSymbolElement.cpp:
+        * svg/SVGTRefElement.cpp:
+        * svg/SVGTSpanElement.cpp:
+        * svg/SVGTSpanElement.h:
+        * svg/SVGTests.h:
+        * svg/SVGTextElement.cpp:
+        * svg/SVGTextElement.h:
+        * svg/SVGTextPathElement.cpp:
+        * svg/SVGTextPositioningElement.cpp:
+        * svg/SVGTextPositioningElement.h:
+        * svg/SVGTitleElement.cpp:
+        * svg/SVGTitleElement.h:
+        * svg/SVGTransform.cpp:
+        * svg/SVGTransform.h:
+        * svg/SVGTransform.idl:
+        * svg/SVGTransformList.cpp:
+        * svg/SVGTransformList.h:
+        * svg/SVGTransformable.h:
+        * svg/SVGURIReference.h:
+        * svg/SVGUnitTypes.h:
+        * svg/SVGUseElement.cpp:
+        * svg/SVGViewElement.cpp:
+        * svg/SVGZoomAndPan.cpp:
+        * svg/SVGZoomAndPan.h:
+        * svg/SVGZoomEvent.cpp:
+
+2009-11-05  Jeremy Orlow  <jorlow@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        REGRESSION Clean up security origin usage in DOM Storage.
+        https://bugs.webkit.org/show_bug.cgi?id=31188
+
+        Clean up security origin usage in DOM Storage.  This fixes a bug in my
+        refactoring here: https://bugs.webkit.org/show_bug.cgi?id=31149
+
+        Instead of having StorageAreaSync's constructor (which is called in the
+        constructor for StorageAreaImpl) calling a method on StoargeAreaImpl to get the
+        database identifier, simply have StorageAreaImpl pass the identifier into
+        StorageAreaSync.
+
+        No test because there's no change in externally observable behavior.
+
+        * storage/StorageAreaImpl.cpp:
+        (WebCore::StorageAreaImpl::StorageAreaImpl):
+        * storage/StorageAreaImpl.h:
+        * storage/StorageAreaSync.cpp:
+        (WebCore::StorageAreaSync::create):
+        (WebCore::StorageAreaSync::StorageAreaSync):
+        * storage/StorageAreaSync.h:
+
+2009-11-05  Scott Violet  <sky@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        Need notification of scrolling frame
+        https://bugs.webkit.org/show_bug.cgi?id=31145
+
+        Adds FrameLoaderClient::didChangeScrollOffset that is called when
+        the frame scrolls. This will be used to know when history state
+        needs to be updated.
+
+        * loader/FrameLoaderClient.h:
+        (WebCore::FrameLoaderClient::didChangeScrollOffset):
+        * page/FrameView.cpp:
+        (WebCore::FrameView::valueChanged):
+
+2009-11-05  Kenneth Russell  <kbr@google.com>
+
+        Reviewed by Dimitri Glazkov.
+
+        [V8] Update bindings to use new API for external arrays
+        https://bugs.webkit.org/show_bug.cgi?id=31181
+
+        No new tests; covered by existing WebGL tests.
+
+        * bindings/v8/V8DOMWrapper.cpp:
+        (WebCore::V8DOMWrapper::setIndexedPropertiesToExternalArray):
+        (WebCore::V8DOMWrapper::getTemplate):
+        (WebCore::V8DOMWrapper::convertToV8Object):
+        * bindings/v8/V8DOMWrapper.h:
+        * bindings/v8/custom/V8CanvasArrayCustom.h:
+        (WebCore::constructCanvasArray):
+
+2009-11-05  Alpha Lam  <hclam@chromium.org>
+
+        Not reviewed, Chromium build fix.
+
+        50561 introduces a custom method for SVGMatrix, we need to implement
+        this in V8.
+
+        * bindings/v8/custom/V8CustomBinding.h:
+        Adding definition for V8SVGMatrixMultiply.
+        * bindings/v8/custom/V8SVGMatrixCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+        Implement V8SVGMatrixMultiply according to the same method in JSC.
+
+2009-11-05  Jeremy Orlow  <jorlow@chromium.org>
+
+        Revert 50569 since it broke QT.  Build fix and just a revert, so no review.
+
+        * page/DOMWindow.cpp:
+        (WebCore::DOMWindow::sessionStorage):
+        * page/Settings.cpp:
+        (WebCore::Settings::Settings):
+        (WebCore::Settings::setSessionStorageEnabled):
+        * page/Settings.h:
+        (WebCore::Settings::sessionStorageEnabled):
+
+2009-11-05  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        REGRESSION: Web Inspector doesn't show CSS rules properly for iframes
+
+        https://bugs.webkit.org/show_bug.cgi?id=30884
+
+        Test: inspector/styles-iframe.html
+
+        * inspector/front-end/DOMAgent.js:
+        (WebInspector.DOMNode):
+        * inspector/front-end/InjectedScript.js:
+        (InjectedScript.getStyles):
+        (InjectedScript.getComputedStyle):
+        (InjectedScript.addStyleSelector):
+        * inspector/front-end/TestController.js:
+        (WebInspector.TestController.prototype.notifyDone):
+        (WebInspector.TestController.prototype.runAfterPendingDispatches):
+        (WebInspector.evaluateForTestInFrontend.invokeMethod):
+        (WebInspector.evaluateForTestInFrontend):
+
+2009-11-05  Vitaly Repeshko  <vitalyr@chromium.org>
+
+        Reviewed by Geoffrey Garen and Dimitri Glazkov.
+
+        Rehashing of EventListenerMap leads to loss of EvenListenerList.
+        https://bugs.webkit.org/show_bug.cgi?id=31027
+
+        Tested by new fast/events/event-listener-map-rehash-crash.html.
+
+        EventListenerMap modified to store pointers to listener vectors:
+        * dom/EventTarget.cpp:
+        (WebCore::EventTargetData::~EventTargetData):
+        (WebCore::EventTarget::addEventListener):
+        (WebCore::EventTarget::removeEventListener):
+        (WebCore::EventTarget::fireEventListeners):
+        (WebCore::EventTarget::getEventListeners):
+        (WebCore::EventTarget::removeAllEventListeners):
+        * dom/EventTarget.h:
+
+        Usages updated after interface changes:
+        * inspector/InspectorDOMAgent.cpp:
+        (WebCore::InspectorDOMAgent::getEventListenersForNode):
+        * svg/SVGUseElement.cpp:
+        (WebCore::SVGUseElement::transferEventListenersToShadowTree):
+
+2009-11-05  Dan Kegel  <dank@chromium.org>
+
+        Reviewed by Dmitri Titov.
+
+        Add missing initialization for m_createdByParser.
+        https://bugs.webkit.org/show_bug.cgi?id=31089
+
+        Test: fast/dom/beforeload/pi-before-load.xhtml in Valgrind
+
+        * dom/ProcessingInstruction.cpp:
+        (WebCore::ProcessingInstruction::ProcessingInstruction):
+
+2009-11-04  Jeremy Orlow  <jorlow@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        DOM Storage runtime flag changes
+        https://bugs.webkit.org/show_bug.cgi?id=30602
+
+        Part 2/2.
+
+        Revert my changes to Settings and instead implement DOM Storage enabling via
+        the methods agreed upon in https://bugs.webkit.org/show_bug.cgi?id=30240
+
+        This stuff was (intentionally) never exposed to web pages or DRT, so there's no
+        LayoutTest visible changes and thus no tests.
+
+        * bindings/v8/custom/V8CustomBinding.h:
+        * bindings/v8/custom/V8DOMWindowCustom.cpp:
+        (WebCore::ACCESSOR_RUNTIME_ENABLER):
+        * page/DOMWindow.cpp:
+        (WebCore::DOMWindow::sessionStorage):
+        * page/DOMWindow.idl:
+        * page/Settings.cpp:
+        (WebCore::Settings::Settings):
+        * page/Settings.h:
+        * storage/Storage.cpp:
+        (WebCore::Storage::setLocalStorageAvailable):
+        (WebCore::Storage::localStorageAvailable):
+        (WebCore::Storage::setSessionStorageAvailable):
+        (WebCore::Storage::sessionStorageAvailable):
+        * storage/Storage.h:
+
+2009-11-05  Jian Li  <jianli@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Bug 31108 - [V8] REGRESSION: Pause on exception is broken
+        https://bugs.webkit.org/show_bug.cgi?id=31108
+
+        * bindings/v8/V8AbstractEventListener.cpp:
+        (WebCore::V8AbstractEventListener::invokeEventHandler):
+        * bindings/v8/V8Utilities.cpp:
+        (WebCore::reportException):
+
+2009-11-05  Jian Li  <jianli@chromium.org>
+
+        Reviewed by Dmitri Titov.
+
+        We should not bubble up events if we drag something to an iframe that
+        has an invalid source.
+        https://bugs.webkit.org/show_bug.cgi?id=30469
+
+        Test: http/tests/misc/bubble-drag-events.html
+
+        * page/EventHandler.cpp:
+        (WebCore::EventHandler::handleDragAndDropForTarget):
+        (WebCore::EventHandler::updateDragAndDrop):
+        (WebCore::EventHandler::cancelDragAndDrop):
+        (WebCore::EventHandler::performDragAndDrop):
+        * page/EventHandler.h:
+        (WebCore::EventHandler::):
+
+2009-11-05  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: speed up Timelines Clear by a factor of thousands.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31160
+
+        * inspector/front-end/utilities.js:
+        (Element.prototype.removeChildren):
+
+2009-11-05  Anton Muhin  <antonm@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        If high memory usage is detected, hint to V8 that it might be due
+        to external objects retained by V8 objects.
+        https://bugs.webkit.org/show_bug.cgi?id=31051
+
+        * bindings/v8/V8GCController.cpp:
+        (WebCore::GetMemoryUsageInMB):
+        (WebCore::V8GCController::gcEpilogue):
+        (WebCore::V8GCController::checkMemoryUsage):
+        * bindings/v8/V8GCController.h:
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::evaluate):
+        (WebCore::V8Proxy::runScript):
+        (WebCore::V8Proxy::callFunction):
+
+2009-11-05  Jeff Schiller  <codedread@gmail.com>
+
+        Reviewed by Simon Fraser.
+
+        Correct order of matrix multiplication for SVGMatrix.
+        https://bugs.webkit.org/show_bug.cgi?id=16062
+
+        Test: svg/dom/SVGMatrix-interface.xhtml
+
+        * bindings/js/JSSVGMatrixCustom.cpp:
+        (WebCore::JSSVGMatrix::multiply):
+        * svg/SVGMatrix.idl:
+
+2009-11-04  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Make resource-related records in timeline
+        actually take some time.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31139
+
+        * English.lproj/localizedStrings.js:
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel):
+        (WebInspector.TimelinePanel.prototype._formatRecord):
+        (WebInspector.TimelinePanel.prototype._getRecordDetails):
+        (WebInspector.TimelinePanel.prototype.reset):
+
+2009-11-04  Jeremy Orlow  <jorlow@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Simplify LocalStorageThread
+        https://bugs.webkit.org/show_bug.cgi?id=30935
+
+        This is a re-submit of 50519.  LocalStorageTask should have never been ref
+        counted.  I've removed that and switched a PassRefPtr over to a PassOwnPtr.
+
+        On LocalStoragethread: Remove reference counting. Get rid of locking. Make some
+        of the method names a bit more clear. Assert proper thread usage. Join rather
+        than detaching the thread and doing an ad-hoc form of join. Avoid touching
+        variables on the background thread when simple to do so.  Also create a generic
+        scheduleTask function rather than one for each task.
+
+        No behavior should have changed.
+
+        * storage/LocalStorageTask.h:
+        * storage/LocalStorageThread.cpp:
+        (WebCore::LocalStorageThread::create):
+        (WebCore::LocalStorageThread::LocalStorageThread):
+        (WebCore::LocalStorageThread::~LocalStorageThread):
+        (WebCore::LocalStorageThread::start):
+        (WebCore::LocalStorageThread::threadEntryPointCallback):
+        (WebCore::LocalStorageThread::threadEntryPoint):
+        (WebCore::LocalStorageThread::scheduleTask):
+        (WebCore::LocalStorageThread::terminate):
+        (WebCore::LocalStorageThread::performTerminate):
+        * storage/LocalStorageThread.h:
+        * storage/StorageSyncManager.cpp:
+        (WebCore::StorageSyncManager::StorageSyncManager):
+        (WebCore::StorageSyncManager::~StorageSyncManager):
+        (WebCore::StorageSyncManager::scheduleImport):
+        (WebCore::StorageSyncManager::scheduleSync):
+        * storage/StorageSyncManager.h:
+
+2009-11-04  Jeremy Orlow  <jorlow@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Calling databaseIdentifier on LocalStorage's background thread is not safe.
+        https://bugs.webkit.org/show_bug.cgi?id=31149
+
+        Calling SecurityOrigin::databaseIdentifier on LocalStorage's background thread
+        is not safe.  databaseIdentifier does a bunch of string concatenation which
+        ref-counts StringImpls in some cases.  This was caught by valgrind thread
+        sanitizer: http://code.google.com/p/chromium/issues/detail?id=25645
+
+        There's no way to test for such racyness, unfortunately.
+
+        * storage/StorageAreaSync.cpp:
+        (WebCore::StorageAreaSync::StorageAreaSync):
+        (WebCore::StorageAreaSync::performImport):
+        * storage/StorageAreaSync.h:
+        * storage/StorageSyncManager.cpp:
+        (WebCore::StorageSyncManager::fullDatabaseFilename):
+        * storage/StorageSyncManager.h:
+
+2009-11-03  Jeremy Orlow  <jorlow@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Clean up StorageAreaSync
+        https://bugs.webkit.org/show_bug.cgi?id=31100
+
+        Major fixes: Break the ref count cycle for StorageArea on the main
+        thread, not the background thread since the latter is not safe.
+        Length() needs to block on the import completing.
+
+        Small fixes: setItem needs to handle the copy on write case even if it
+        has an exception.  setItem and removeItem should just bail from the
+        the function if the value hasn't changed rather than wrapping the end
+        in an if block.  Clear should only send an event if it wasn't already
+        cleared.  StorageAreaSync should assert that the final sync was
+        scheduled.
+
+        * storage/StorageAreaImpl.cpp:
+        (WebCore::StorageAreaImpl::length):
+          Forgot to block on the import.
+        (WebCore::StorageAreaImpl::key):
+        (WebCore::StorageAreaImpl::setItem):
+          Handle the copy on write case even when there's an exception.
+        (WebCore::StorageAreaImpl::removeItem):
+        (WebCore::StorageAreaImpl::clear):
+        * storage/StorageAreaSync.cpp:
+        (WebCore::StorageAreaSync::~StorageAreaSync):
+        (WebCore::StorageAreaSync::scheduleFinalSync):
+        (WebCore::StorageAreaSync::performImport):
+        (WebCore::StorageAreaSync::markImported):
+        (WebCore::StorageAreaSync::blockUntilImportComplete):
+        * storage/StorageAreaSync.h:
+
+2009-11-05  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        Allow custom memory allocation control for WebCore's CachedResource
+        https://bugs.webkit.org/show_bug.cgi?id=31114
+
+        Inherits CachedResource class from Noncopyable because its (its child
+        class) CachedCSSStyleSheet instantiated by 'new' in WebCore/loader/Cache.cpp:75 
+        and it is no need to be copyable.
+
+        * loader/CachedResource.h:
+
+2009-11-04  Mark Mentovai  <mark@chromium.org>
+
+        Reviewed by Mark Rowe.
+
+        Separate the difference between HAVE(CGINTERPOLATION_MEDIUM), which
+        is true when building on 10.6 or later, and USE(CGINTERPOLATION_MEDIUM)
+        which is true when targeting 10.6 or later.
+
+        HAVE(CGINTERPOLATION_MEDIUM) indicates that kCGInterpolationMedium
+        is present in the CGInterpolationQuality enum, and must be handled
+        by a switch that has cases for each enumerated value.
+
+        USE(CGINTERPOLATION_MEDIUM) indicates that the product will only run
+        on 10.6 or later, and that CoreGraphics will understand when
+        InterpolationMedium is mapped to kCGInterpolationMedium at runtime.
+
+        * platform/graphics/cg/GraphicsContextCG.cpp:
+        (WebCore::GraphicsContext::setImageInterpolationQuality):
+        (WebCore::GraphicsContext::imageInterpolationQuality):
+
+2009-11-04  Dan Kegel  <dank@chromium.org>
+
+        Reviewed by Alexey Proskuryakov.
+
+        Fix buffer overrun in WebCore::Page::userStyleSheetLocationChanged()
+        https://bugs.webkit.org/show_bug.cgi?id=31138
+
+        Test: LayoutTests/platform/mac/fast/loader/user-stylesheet-fast-path.html in Valgrind
+
+        * page/Page.cpp:
+        (WebCore::Page::userStyleSheetLocationChanged):
+
+2009-11-04  Timothy Hatcher  <timothy@apple.com>
+
+        Update the Web Inspector Timeline panel to better match the mock-up.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31150
+
+        Reviewed by Pavel Feldman.
+
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._getRecordDetails):
+        (WebInspector.TimelinePanel.prototype._dragWindow):
+        (WebInspector.TimelinePanel.prototype._resizeWindowLeft):
+        (WebInspector.TimelinePanel.prototype._resizeWindowRight):
+        (WebInspector.TimelineCategoryTreeElement.prototype.onattach):
+        (WebInspector.TimelineRecordTreeElement.prototype.onattach):
+        (WebInspector.TimelineRecordTreeElement.prototype.refresh):
+        (WebInspector.TimelineCategoryGraph):
+        * inspector/front-end/inspector.css:
+
+2009-11-05  Justin Garcia  <justin.garcia@apple.com>
+
+        Reviewed by Adele Peterson.
+
+        https://bugs.webkit.org/show_bug.cgi?id=25439
+        Deleting when in front of a block image removes character from previous paragraph
+
+        Added editing/deleting/25439-{1,2,3}.html
+
+        * editing/DeleteSelectionCommand.cpp:
+        (WebCore::DeleteSelectionCommand::mergeParagraphs): Block images, tables and HRs cannot 
+        be made inline with other content.  Instead of merging, just move the caret to just before 
+        the selection we deleted.
+        * editing/htmlediting.cpp:
+        (WebCore::firstInSpecialElement): Added a FIXME.  This function begins iterating up from pos.node(), which 
+        doesn't necessarily contain pos (suppose pos was [img, 0]).
+        (WebCore::lastInSpecialElement): Ditto.
+        (WebCore::isRenderedAsNonInlineTableImageOrHR): Moved from visible_units.cpp.  Added a check for non-inline images.
+        * editing/htmlediting.h:
+        * editing/visible_units.cpp:
+        (WebCore::startOfParagraph): Use moved/renamed function.  Removed FIXME.  The problem causing 
+        5027702 is now squarely in first/lastInSpecialElement
+        (WebCore::endOfParagraph): Ditto.
+        
+2009-11-04  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by Adele Peterson.
+
+        Hang in Mail on attempting to change indent level.
+        <rdar://problem/7131805>
+        https://bugs.webkit.org/show_bug.cgi?id=31127
+
+        The hang was caused by an infinite loop inside outdentRegion.
+        The code did not account for the fact that, when a list item
+        contains multiple paragraphs, outdent moves all paragraphs at
+        once, invalidating some of the positions we keep track of in the loop.
+        Some code refactoring has also been done to minimize duplicated code.
+        
+        Test: editing/execCommand/outdent-multiparagraph-list.html
+
+        * editing/IndentOutdentCommand.cpp:
+        (WebCore::IndentOutdentCommand::indentRegion): Moved code in common with
+        outdentRegion to doApply.
+        (WebCore::IndentOutdentCommand::outdentRegion): Fixed endless loop.
+        (WebCore::IndentOutdentCommand::doApply): Some code refactoring.
+        * editing/IndentOutdentCommand.h: Added VisiblePosition parameters to
+        indentRegion and outdentRegion.
+
+2009-11-04  Alpha Lam  <hclam@chromium.org>
+
+        Reviewed by Eric Carlson.
+
+        Volume slider doesn't have a thumb
+        https://bugs.webkit.org/show_bug.cgi?id=31135
+
+        Fixed an incorrect if statement that prevents volume slider
+        being updated.
+
+        The statement checks if the slider value equals to the current
+        volume value of the media control to avoid updating the volume
+        slider. Updating the volume slider control shouldn't be within
+        this condition because we explicitly set them to be equals
+        during creation of the controls and also when mouse events are
+        received on the volume control.
+
+        No new tests because existing code breaks:
+        LayoutTests/media/video-volume-slider.html
+
+        It should now start passing on Chromium.
+
+        * rendering/MediaControlElements.cpp:
+        (WebCore::MediaControlVolumeSliderElement::update):
+        Update the volume slider regardless of the current volume value
+        of the media control.
+
+2009-11-04  Jenn Braithwaite  <jennb@chromium.org>
+
+        Reviewed by David Levin.
+
+        Need to properly disable applicationCache at runtime
+        https://bugs.webkit.org/show_bug.cgi?id=30417
+
+        Adding applicationCacheEnabled bit to V8 RuntimeEnabledFeatures.
+
+        No new exposed functionality, so no new tests.
+
+        * bindings/v8/RuntimeEnabledFeatures.cpp:
+        * bindings/v8/RuntimeEnabledFeatures.h:
+        (WebCore::RuntimeEnabledFeatures::setApplicationCacheEnabled):
+        (WebCore::RuntimeEnabledFeatures::applicationCacheEnabled):
+        * bindings/v8/custom/V8CustomBinding.h:
+        * bindings/v8/custom/V8DOMWindowCustom.cpp:
+        (WebCore::ACCESSOR_RUNTIME_ENABLER):
+        * page/DOMWindow.idl:
+
+2009-11-04  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31143
+        Assertion failure in CredentialStorage::set() when proxy credentials are being set
+
+        No test, cannot test proxy behavior.
+
+        * platform/network/CredentialStorage.cpp: (WebCore::CredentialStorage::set): Account for the
+        possibility of null url. Release mode changes are likely inconsequential - e.g. we used to
+        add "://" to origin set, which is weird, but safe.
+
+2009-11-04  Patrick Mueller  <Patrick_Mueller@us.ibm.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Leftover Breakpoints in the Sidebar Pane
+        https://bugs.webkit.org/show_bug.cgi?id=30659
+
+        No new tests.
+
+        * inspector/front-end/ScriptsPanel.js:
+        (WebInspector.ScriptsPanel.prototype.addScript):
+
+2009-11-04  Jocelyn Turcotte  <jocelyn.turcotte@nokia.com>
+
+        Reviewed by Timothy Hatcher.
+
+        WebInspector: Use a different method to identify the webkit port in
+        InspectorBackent::platform().
+        This corrects the inspector expected behavior with Qt on Windows.
+        https://bugs.webkit.org/show_bug.cgi?id=31116
+
+        * inspector/InspectorBackend.cpp:
+        (WebCore::InspectorBackend::platform):
+        (WebCore::InspectorBackend::port):
+        * inspector/InspectorBackend.h:
+        * inspector/InspectorBackend.idl:
+        * inspector/front-end/InspectorControllerStub.js:
+        (.WebInspector.InspectorControllerStub.prototype.port):
+        * inspector/front-end/inspector.css:
+        * inspector/front-end/inspector.js:
+        (WebInspector.loaded):
+        (WebInspector.toolbarDragStart):
+
+2009-11-04  Benjamin Otte  <otte@gnome.org>
+
+        Reviewed by Gustavo Noronha.
+
+        Update Cairo requirement to 1.6.
+
+        Also remove all conditional code and workarounds for older versions of
+        Cairo.
+        In particular, gain image quality by removing the use of
+        CAIRO_FILTER_NEAREST when rendering images and use the default
+        bilinear filter instead.
+        https://bugs.webkit.org/show_bug.cgi?id=19266
+
+        * platform/graphics/cairo/GraphicsContextCairo.cpp:
+        (WebCore::GraphicsContext::clipOut):
+        * platform/graphics/cairo/ImageCairo.cpp:
+        (WebCore::BitmapImage::draw):
+        (WebCore::BitmapImage::drawPattern):
+        * platform/graphics/cairo/PathCairo.cpp:
+        (WebCore::Path::isEmpty):
+        (WebCore::Path::boundingRect):
+        * platform/gtk/RenderThemeGtk.cpp:
+        (WebCore::paintMozWidget):
+
+2009-11-04  Kevin Ollivier  <kevino@theolliviers.com>
+
+        wx build fix. Restore removed string conversion after cleanup.
+
+        * platform/graphics/wx/FontPlatformDataWx.cpp:
+        (WebCore::FontPlatformData::computeHash):
+
+2009-11-04  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Beth Dakin.
+
+        Need to implement ARIA role="combobox"
+        https://bugs.webkit.org/show_bug.cgi?id=31096
+
+        Test: accessibility/aria-combobox.html
+
+        * accessibility/AccessibilityObject.h:
+        (WebCore::AccessibilityObject::isComboBox):
+        (WebCore::AccessibilityObject::isExpanded):
+        (WebCore::AccessibilityObject::expandObject):
+        (WebCore::AccessibilityObject::increment):
+        (WebCore::AccessibilityObject::decrement):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::expandObject):
+        (WebCore::AccessibilityRenderObject::isExpanded):
+        (WebCore::createARIARoleMap):
+        * accessibility/AccessibilityRenderObject.h:
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+        (-[AccessibilityObjectWrapper accessibilityAttributeNames]):
+        (-[AccessibilityObjectWrapper accessibilityAttributeValue:]):
+        (-[AccessibilityObjectWrapper accessibilityPerformShowMenuAction]):
+        * html/HTMLAttributeNames.in:
+
+2009-11-04  Kelly Norton  <knorton@google.com>
+
+        Reviewed by Pavel Feldman.
+
+        Fixes naming inconsistencies in TimelineRecordFactory.
+        https://bugs.webkit.org/show_bug.cgi?id=31132
+
+        * inspector/InspectorTimelineAgent.cpp:
+        (WebCore::InspectorTimelineAgent::willPaint):
+        (WebCore::InspectorTimelineAgent::willChangeXHRReadyState):
+        (WebCore::InspectorTimelineAgent::willLoadXHR):
+        (WebCore::InspectorTimelineAgent::willEvaluateScript):
+        (WebCore::InspectorTimelineAgent::willSendResourceRequest):
+        (WebCore::InspectorTimelineAgent::didReceiveResourceResponse):
+        (WebCore::InspectorTimelineAgent::didFinishLoadingResource):
+        * inspector/TimelineRecordFactory.cpp:
+        (WebCore::TimelineRecordFactory::createXHRReadyStateChangeRecord):
+        (WebCore::TimelineRecordFactory::createXHRLoadRecord):
+        (WebCore::TimelineRecordFactory::createEvaluateScriptRecord):
+        (WebCore::TimelineRecordFactory::createMarkTimelineRecord):
+        (WebCore::TimelineRecordFactory::createResourceSendRequestRecord):
+        (WebCore::TimelineRecordFactory::createResourceReceiveResponseRecord):
+        (WebCore::TimelineRecordFactory::createResourceFinishRecord):
+        (WebCore::TimelineRecordFactory::createPaintRecord):
+        * inspector/TimelineRecordFactory.h:
+
+2009-11-04  Eric Z. Ayers  <zundel@google.com>
+
+        Reviewed by Pavel Feldman.
+
+        Followon to bug 31080, which protects Timeline
+        instrumentation in the case where InspectorTimelineAgent
+        is enabled or disabled during an event dispatch.
+        
+        https://bugs.webkit.org/show_bug.cgi?id=31121
+
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::evaluate):
+        * dom/Document.cpp:
+        (WebCore::Document::recalcStyle):
+        * dom/Node.cpp:
+        (WebCore::Node::dispatchGenericEvent):
+        * html/HTMLTokenizer.cpp:
+        (WebCore::HTMLTokenizer::write):
+        * page/DOMWindow.cpp:
+        (WebCore::DOMWindow::inspectorTimelineAgent):
+        (WebCore::DOMWindow::dispatchEvent):
+        * page/DOMWindow.h:
+        * page/FrameView.cpp:
+        (WebCore::FrameView::layout):
+        (WebCore::FrameView::paintContents):
+        * xml/XMLHttpRequest.cpp:
+        (WebCore::XMLHttpRequest::callReadyStateChangeListener):
+
+2009-11-04  Jeremy Orlow  <jorlow@chromium.org>
+
+        Revert 50519 while I work out what went wrong.
+
+        * storage/LocalStorageThread.cpp:
+        (WebCore::LocalStorageThread::create):
+        (WebCore::LocalStorageThread::LocalStorageThread):
+        (WebCore::LocalStorageThread::start):
+        (WebCore::LocalStorageThread::localStorageThreadStart):
+        (WebCore::LocalStorageThread::localStorageThread):
+        (WebCore::LocalStorageThread::scheduleImport):
+        (WebCore::LocalStorageThread::scheduleSync):
+        (WebCore::LocalStorageThread::terminate):
+        (WebCore::LocalStorageThread::performTerminate):
+        * storage/LocalStorageThread.h:
+        * storage/StorageSyncManager.cpp:
+        (WebCore::StorageSyncManager::StorageSyncManager):
+        (WebCore::StorageSyncManager::~StorageSyncManager):
+        (WebCore::StorageSyncManager::scheduleImport):
+        (WebCore::StorageSyncManager::scheduleSync):
+        * storage/StorageSyncManager.h:
+
+2009-11-04  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Add basic support for resource events and marks.
+        Couple of drive-by fixes. Enabling the panel!
+
+        https://bugs.webkit.org/show_bug.cgi?id=31130
+
+        * English.lproj/localizedStrings.js:
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel):
+        (WebInspector.TimelinePanel.prototype._formatRecord):
+        (WebInspector.TimelinePanel.prototype._getRecordDetails):
+        (WebInspector.TimelinePanel.prototype.reset):
+        (WebInspector.TimelineCategoryTreeElement.prototype._onCheckboxClicked):
+        (WebInspector.TimelineRecordTreeElement.prototype.onattach):
+        * inspector/front-end/inspector.js:
+        (WebInspector._createPanels):
+
+2009-11-03  Jeremy Orlow  <jorlow@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Simplify LocalStorageThread
+        https://bugs.webkit.org/show_bug.cgi?id=30935
+
+        On LocalStoragethread: Remove reference counting. Get rid of locking. Make some
+        of the method names a bit more clear. Assert proper thread usage. Join rather
+        than detaching the thread and doing an ad-hoc form of join. Avoid touching
+        variables on the background thread when simple to do so.  Also create a generic
+        scheduleTask function rather than one for each task.
+
+        No behavior should have changed.
+
+        * storage/LocalStorageThread.cpp:
+        (WebCore::LocalStorageThread::create):
+        (WebCore::LocalStorageThread::LocalStorageThread):
+        (WebCore::LocalStorageThread::~LocalStorageThread):
+        (WebCore::LocalStorageThread::start):
+        (WebCore::LocalStorageThread::threadEntryPointCallback):
+        (WebCore::LocalStorageThread::threadEntryPoint):
+        (WebCore::LocalStorageThread::scheduleTask):
+        (WebCore::LocalStorageThread::terminate):
+        (WebCore::LocalStorageThread::performTerminate):
+        * storage/LocalStorageThread.h:
+        * storage/StorageSyncManager.cpp:
+        (WebCore::StorageSyncManager::StorageSyncManager):
+        (WebCore::StorageSyncManager::~StorageSyncManager):
+        (WebCore::StorageSyncManager::scheduleImport):
+        (WebCore::StorageSyncManager::scheduleSync):
+        * storage/StorageSyncManager.h:
+
+2009-11-04  Vadim Zeitlin  <vadim@wxwidgets.org>
+
+        Reviewed by Eric Seidel.
+
+        [wx] Small cleanup: avoid unnecessary wxString::mb_str() calls.
+
+        * platform/graphics/wx/FontPlatformDataWx.cpp:
+        (WebCore::FontPlatformData::computeHash):
+
+2009-11-04  Kelly Norton  <knorton@google.com>
+
+        Reviewed by Pavel Feldman.
+
+        Adds lightweight network resources to InspectorTimelineAgent.
+        https://bugs.webkit.org/show_bug.cgi?id=31065
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::willSendRequest):
+        (WebCore::InspectorController::didReceiveResponse):
+        (WebCore::InspectorController::didFinishLoading):
+        (WebCore::InspectorController::didFailLoading):
+        * inspector/InspectorTimelineAgent.cpp:
+        (WebCore::InspectorTimelineAgent::willSendResourceRequest):
+        (WebCore::InspectorTimelineAgent::didReceiveResourceResponse):
+        (WebCore::InspectorTimelineAgent::didFinishLoadingResource):
+        * inspector/InspectorTimelineAgent.h:
+        (WebCore::):
+        * inspector/TimelineRecordFactory.cpp:
+        (WebCore::TimelineRecordFactory::createResourceSendRequestTimelineRecord):
+        (WebCore::TimelineRecordFactory::createResourceReceiveResponseTimelineRecord):
+        (WebCore::TimelineRecordFactory::createResourceFinishTimelineRecord):
+        * inspector/TimelineRecordFactory.h:
+        * inspector/front-end/TimelineAgent.js:
+
+2009-11-04  Yael Aharon  <yael.aharon@nokia.com>
+
+        Reviewed by Tor Arne Vestbø.
+
+        [Qt] ASSERT failure when receiving 401 HTTP Authentication response.
+        https://bugs.webkit.org/show_bug.cgi?id=31077
+
+        Allow sending the response body under the same conditions that we
+        allow it to finish without reporting an error.
+
+        * platform/network/qt/QNetworkReplyHandler.cpp:
+        (WebCore::QNetworkReplyHandler::sendResponseIfNeeded):
+
+2009-11-04  Adam Roben  <aroben@apple.com>
+
+        Sort WebCore.base.exp
+
+        Rubber-stamped by Dan Bernstein.
+
+        * WebCore.base.exp: Sorted.
+
+2009-11-04  Csaba Osztrogonác  <ossy@webkit.org>
+
+        Unreviewed rollout.
+
+        Revert r50496 because it broke all layout tests on QtBuildBot.
+
+        * WebCore.pro:
+        * platform/graphics/qt/FontCacheQt.cpp:
+        (WebCore::fontCache):
+        (WebCore::FontCache::FontCache):
+        (WebCore::FontCache::getTraitsInFamily):
+        (WebCore::FontPlatformDataCacheKey::FontPlatformDataCacheKey):
+        (WebCore::FontPlatformDataCacheKey::isHashTableDeletedValue):
+        (WebCore::FontPlatformDataCacheKey::):
+        (WebCore::FontPlatformDataCacheKey::operator==):
+        (WebCore::FontPlatformDataCacheKey::hash):
+        (WebCore::FontPlatformDataCacheKey::computeHash):
+        (WebCore::FontPlatformDataCacheKey::hashTableDeletedSize):
+        (WebCore::FontPlatformDataCacheKeyHash::hash):
+        (WebCore::FontPlatformDataCacheKeyHash::equal):
+        (WebCore::FontPlatformDataCacheKeyTraits::emptyValue):
+        (WebCore::FontPlatformDataCacheKeyTraits::constructDeletedValue):
+        (WebCore::FontPlatformDataCacheKeyTraits::isDeletedValue):
+        (WebCore::FontCache::getCachedFontPlatformData):
+        (WebCore::FontCache::getCachedFontData):
+        (WebCore::FontCache::getLastResortFallbackFont):
+        (WebCore::FontCache::releaseFontData):
+        (WebCore::FontCache::purgeInactiveFontData):
+        (WebCore::FontCache::addClient):
+        (WebCore::FontCache::removeClient):
+        (WebCore::FontCache::invalidate):
+        * platform/graphics/qt/FontFallbackListQt.cpp: Added.
+        (WebCore::FontFallbackList::FontFallbackList):
+        (WebCore::FontFallbackList::invalidate):
+        (WebCore::FontFallbackList::releaseFontData):
+        (WebCore::FontFallbackList::determinePitch):
+        (WebCore::FontFallbackList::fontDataAt):
+        (WebCore::FontFallbackList::fontDataForCharacters):
+        (WebCore::FontFallbackList::setPlatformFont):
+        * platform/graphics/qt/FontPlatformData.h:
+        (WebCore::FontPlatformData::pixelSize):
+        * platform/graphics/qt/FontPlatformDataQt.cpp:
+        (WebCore::FontPlatformData::FontPlatformData):
+
+2009-11-04  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31044
+        [Gtk] assertion when webkit_accessible_get_index_in_parent attempts to get parent of the web view
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (atkParentOfWebView):
+        (webkit_accessible_get_index_in_parent):
+        (webkit_accessible_get_parent):
+
+2009-11-04  Dominik Röttsches  <dominik.roettsches@access-company.com>
+
+        Reviewed by Eric Seidel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=15914
+        [GTK] Implement Unicode functionality using GLib
+
+        Initial version of this patch by Jürg Billeter and Naiem Shaik.
+        Patch 2/4 - Moving TextCodecs to GLib
+        
+        Added probing for a hard-coded lists of text encodings.
+        The basis of this list is taken from the encodings supported by iconv,
+        then extended by e.g. tis-620, windows-1251, euc-kr, windows-1253 and
+        a number of Chinese ones.
+
+        Probing is necessary with the current design of text codecs
+        as iconv/GLib do not support enumerating available encodings.
+
+        * GNUmakefile.am:
+        * platform/ThreadGlobalData.cpp:
+        (WebCore::ThreadGlobalData::ThreadGlobalData):
+        (WebCore::ThreadGlobalData::~ThreadGlobalData):
+        * platform/text/TextEncoding.cpp:
+        (WebCore::TextEncoding::encode):
+        * platform/text/TextEncodingRegistry.cpp:
+        (WebCore::buildBaseTextCodecMaps):
+        (WebCore::extendTextCodecMaps):
+        * platform/text/gtk/TextCodecGtk.cpp: Added.
+        (WebCore::):
+        (WebCore::newTextCodecGtk):
+        (WebCore::TextCodecGtk::isEncodingAvailable):
+        (WebCore::TextCodecGtk::registerEncodingNames):
+        (WebCore::TextCodecGtk::registerCodecs):
+        (WebCore::TextCodecGtk::registerBaseEncodingNames):
+        (WebCore::TextCodecGtk::registerBaseCodecs):
+        (WebCore::TextCodecGtk::registerExtendedEncodingNames):
+        (WebCore::TextCodecGtk::registerExtendedCodecs):
+        (WebCore::TextCodecGtk::TextCodecGtk):
+        (WebCore::TextCodecGtk::~TextCodecGtk):
+        (WebCore::TextCodecGtk::releaseIConv):
+        (WebCore::TextCodecGtk::createIConvDecoder):
+        (WebCore::TextCodecGtk::createIConvEncoder):
+        (WebCore::TextCodecGtk::decode):
+        (WebCore::TextCodecGtk::encode):
+        * platform/text/gtk/TextCodecGtk.h: Added.
+
+2009-11-04  Martin Robinson  <martin.james.robinson@gmail.com>
+
+        Reviewed by Jan Alonzo.
+
+        [GTK] Enable DOM clipboard and drag-and-drop access
+        https://bugs.webkit.org/show_bug.cgi?id=30623
+
+        Unify redudant methods which will always return the same value.
+
+        * platform/gtk/PasteboardGtk.cpp:
+        (WebCore::Pasteboard::writeSelection):
+        * platform/gtk/PasteboardHelper.h:
+
+2009-11-04  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31035
+        [GTK] some accessibility tests hitting assertion in debug builds
+
+        Removes the assertions in webkit_accessible_ref_child; adds sanity checks.
+        Any app or AT can attempt to ref a child at a bogus index.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (webkit_accessible_ref_child):
+
+2009-11-04  Benjamin Otte  <otte@gnome.org>
+
+        Reviewed by Jan Alonzo.
+
+        [gtk] Use gst_element_class_set_details_simple()
+
+        Cosmetic change, just code simplification
+
+        * platform/graphics/gtk/VideoSinkGStreamer.cpp:
+        (webkit_video_sink_base_init):
+2009-11-04  Kelly Norton  <knorton@google.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Adds paint rectangle information to TimelineAgent's didPaint callback.
+        https://bugs.webkit.org/show_bug.cgi?id=31087
+
+        * inspector/InspectorTimelineAgent.cpp:
+        (WebCore::InspectorTimelineAgent::willPaint):
+        * inspector/InspectorTimelineAgent.h:
+        * inspector/TimelineRecordFactory.cpp:
+        (WebCore::TimelineRecordFactory::createPaintTimelineRecord):
+        * inspector/TimelineRecordFactory.h:
+        * page/FrameView.cpp:
+        (WebCore::FrameView::paintContents):
+
+2009-11-04  Jaime Yap  <jaimeyap@google.com>
+
+        Reviewed by Timothy Hatcher.
+
+        This patch adds API to the console object for annotating the
+        inspector timeline. This allows developers to mark logical
+        checkpoints in their apps and have them overlaid in the event
+        record tree.
+
+        tests updated: LayoutTests/fast/dom/Window/window-properties.html
+        https://bugs.webkit.org/show_bug.cgi?id=31082
+
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::markTimeline):
+        * inspector/InspectorController.h:
+        * inspector/InspectorTimelineAgent.cpp:
+        (WebCore::InspectorTimelineAgent::didMarkTimeline):
+        * inspector/InspectorTimelineAgent.h:
+        (WebCore::):
+        * inspector/TimelineRecordFactory.cpp:
+        (WebCore::TimelineRecordFactory::createMarkTimelineRecord):
+        * inspector/TimelineRecordFactory.h:
+        * inspector/front-end/TimelineAgent.js:
+        * page/Console.cpp:
+        (WebCore::Console::markTimeline):
+        * page/Console.h:
+        * page/Console.idl:
+
+2009-11-03  Simon Hausmann  <hausmann@webkit.org>
+
+        Unreviewed build fix for WebInspector with Qt build.
+
+        Simply re-generate the Qt resource file by running
+        WebKitTools/Scripts/generate-qt-inspector-resource
+
+        * inspector/front-end/WebKit.qrc:
+
+2009-11-02  Benjamin Poulain  <benjamin.poulain@nokia.com>
+
+        Reviewed by Simon Hausmann.
+
+        [Qt] Handle fonts like the other ports
+
+        Remove FontFallbackListQt and rely on the common FontFallbackList
+        to handle the fonts. FontCache and FontPlatformData have been
+        updated to work with the common FontFallbackList.
+
+        In the previous implementation, FontPlatformDataCacheKey
+        was a clone of FontPlatformData with the hashing
+        capabilities added in order to use it as a key in the cache's
+        hashmap. FontPlatformData has been modified to handle the hashing
+        function directly so the data are not copied twice in memory.
+
+        FontFallbackList::fontDataAt() from FontFallbackListQt was a copy of
+        code from FontCache::getFontData() and FontFallbackList::fontDataAt().
+        The behavior is similar except currFamily->family().length() was
+        not tested and the fallback fonts selector were not used.
+
+        https://bugs.webkit.org/show_bug.cgi?id=29856
+
+        Test: svg/text/text-font-invalid.html
+
+        * WebCore.pro:
+        * platform/graphics/qt/FontCacheQt.cpp:
+        (WebCore::FontCache::platformInit):
+        (WebCore::FontCache::getFontDataForCharacters):
+        (WebCore::FontCache::getSimilarFontPlatformData):
+        (WebCore::FontCache::getLastResortFallbackFont):
+        (WebCore::FontCache::getTraitsInFamily):
+        (WebCore::FontCache::createFontPlatformData):
+        * platform/graphics/qt/FontFallbackListQt.cpp:
+        Removed. We now use the implementation from FontFallbackList.cpp
+        * platform/graphics/qt/FontPlatformData.h:
+        Add hashing capabilities to be able to use the data with the FontCache.
+        This was previously done in FontCacheQt.cpp
+        (WebCore::FontPlatformData::FontPlatformData):
+        Added a boolean to identify deleted value in the hash table.
+        (WebCore::FontPlatformData::isHashTableDeletedValue):
+        (WebCore::FontPlatformData::hash):
+        (WebCore::FontPlatformData::operator==):
+        * platform/graphics/qt/FontPlatformDataQt.cpp:
+        (WebCore::FontPlatformData::FontPlatformData):
+
+2009-11-03  Dan Bernstein  <mitz@apple.com>
+
+        Leopard build fix
+
+        * platform/network/mac/AuthenticationMac.mm:
+        (WebCore::mac):
+        (WebCore::core):
+
+2009-11-03  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Alexey Proskuryakov.
+
+        Fix an assertion failure in core(NSURLProtectionSpace *) by handling NTLM
+        authentication in AuthenticationMac
+
+        * platform/network/mac/AuthenticationMac.mm:
+
+2009-11-03  Eric Z. Ayers  <zundel@google.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Fixes a problem where the timeline instrumentation crashes if
+        timeline profiling is enabled or disabled in the middle of an
+        event dispatch.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31080
+
+        Test: inspector/timeline-trivial.html
+
+        * bindings/js/ScriptController.cpp:
+        (WebCore::ScriptController::evaluateInWorld):
+        (WebCore::ScriptController::processingUserGestureEvent):
+        * inspector/InspectorTimelineAgent.cpp:
+        (WebCore::InspectorTimelineAgent::didCompleteCurrentRecord):
+        * page/DOMTimer.cpp:
+        (WebCore::DOMTimer::fired):
+
+2009-11-03  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Dave Hyatt.
+
+        Allow a frame to go back to copy-on-scroll when it ceases being overlapped
+
+        The code was not testing slow-scrolling frames for overlappedness, thinking the answer
+        would not matter. That is not the case if the only reason for the slow-scrolling is
+        being overlapped.
+
+        * page/FrameView.cpp:
+        (WebCore::FrameView::useSlowRepaintsIfNotOverlapped): Added. Returns whether there is any
+        reason besides being overlapped that the frame would need to fully repaint on scroll.
+        * page/FrameView.h:
+        * rendering/RenderWidget.cpp:
+        (WebCore::RenderWidget::paint): Use useSlowRepaintsIfNotOverlapped().
+
+2009-11-03  Dmitry Titov  <dimich@chromium.org>
+
+        Not reviewed, Qt build fix.
+
+        Need to use right capitalization for include file.
+
+        * page/Navigator.cpp:
+
+2009-11-03  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Migrate from top bar filters to check boxes in Timeline.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31081
+
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype.showCategory):
+        (WebInspector.AbstractTimelinePanel.prototype.hideCategory):
+        (WebInspector.AbstractTimelinePanel.prototype.filter):
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel):
+        (WebInspector.TimelineCategoryTreeElement.prototype.onattach):
+        (WebInspector.TimelineCategoryTreeElement.prototype._onCheckboxClick):
+        (WebInspector.TimelineCategoryGraph.prototype.clearChunks):
+        (WebInspector.TimelineCategoryGraph.prototype.set dimmed):
+        * inspector/front-end/inspector.css:
+
+2009-11-03  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: clear overview on Clear action and panel reset.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31078
+
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._getRecordDetails):
+        (WebInspector.TimelinePanel.prototype.reset):
+
+2009-11-03  Yaar Schnitman  <yaar@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Imported action and rules python files that WebCore.gyp depends on. 
+        These files used to live in chromium.org and deal mostly with auto-generation
+        of code by wrapping existing webkit perl scripts.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31071
+
+        * WebCore.gyp/WebCore.gyp: Fixed paths in actions and rules.
+        * WebCore.gyp/scripts/action_csspropertynames.py: Added.
+        * WebCore.gyp/scripts/action_cssvaluekeywords.py: Added.
+        * WebCore.gyp/scripts/action_makenames.py: Added.
+        * WebCore.gyp/scripts/action_maketokenizer.py: Added.
+        * WebCore.gyp/scripts/action_useragentstylesheets.py: Added.
+        * WebCore.gyp/scripts/rule_binding.py: Added.
+        * WebCore.gyp/scripts/rule_bison.py: Added.
+        * WebCore.gyp/scripts/rule_gperf.py: Added.
+
+2009-11-03  Bradley Green  <brg@chromium.org>
+
+        Reviewed by Dmitry Titov.
+
+        Implement window.navigator.registerProtocolHandler in webkit,
+        https://bugs.webkit.org/b/29651
+
+        Also implemented its sister API window.navigator.registerContentHandler.
+
+        These methods are as described in the HTML5 specification which can be
+        found here,
+        http://dev.w3.org/html5/spec/Overview.html#dom-navigator-registerprotocolhandler
+        http://dev.w3.org/html5/spec/Overview.html#dom-navigator-registercontenthandler
+
+        As specified in the document, the behavior of the browser is determined
+        by the current registered handler.  The state of a registered handler
+        can change at any time, with the user clearing a registered handler,
+        registering a different page as handler, or deferring the hander to the
+        OS.  If webkit was to track the state of the currently registered
+        handlers, it would need more APIs and complexity to keep in sync with
+        user actions reported to webkit from the UA.  For simplicity, the state
+        of protocol handlers should be kept isolated from webkit and webkit only
+        notifies the UA that a page has made the call.  The UA is then
+        responsible for correctly handling the registerProtocolHandler call and
+        the redirects which result from registration.
+
+        We do however follow the specification in insuring that the reserved
+        schemes and mimeTypes are not passed to the UA as custom handler
+        registration tests.  We also insure that the "%s" token is present as
+        required by the specification.
+
+        Updated test expectations for window.clientInformation and navigator
+        objects.
+
+        Tests: fast/dom/registerContentHandler.html
+               fast/dom/registerProtocolHandler.html
+
+        * page/Chrome.cpp:
+        (WebCore::Chrome::registerProtocolHandler):
+        (WebCore::Chrome::registerContentHandler):
+        * page/Chrome.h:
+        * page/ChromeClient.h:
+        (WebCore::ChromeClient::registerProtocolHandler):
+        (WebCore::ChromeClient::registerContentHandler):
+        * page/Navigator.cpp:
+        (WebCore::verifyCustomHandlerURL):
+        (WebCore::verifyProtocolHandlerScheme):
+        (WebCore::Navigator::registerProtocolHandler):
+        (WebCore::verifyProtocolHandlerMimeType):
+        (WebCore::Navigator::registerContentHandler):
+        * page/Navigator.h:
+        * page/Navigator.idl:
+
+2009-11-03  Brady Eidson  <beidson@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31079 - Remove #include "Page.h" from Document.h
+
+        No new tests. (No change in functionality)
+
+        * dom/Document.cpp:
+        (WebCore::Document::inspectorTimelineAgent): Moved from Document.h
+        * dom/Document.h:
+
+        Include "Page.h" directly:
+        * html/HTMLVideoElement.cpp:
+        * loader/RedirectScheduler.cpp:
+        * page/History.cpp:
+        * rendering/MediaControlElements.cpp:
+        * storage/StorageAreaImpl.cpp:
+
+2009-11-03  Keishi Hattori  <casey.hattori@gmail.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: hover over JS "things" in source and see their values
+        https://bugs.webkit.org/show_bug.cgi?id=30913
+
+        * inspector/front-end/SourceFrame.js:
+
+2009-11-03  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: update timeline content boundaries on timer.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31072
+
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype.refresh):
+        (WebInspector.TimelinePanel.prototype._setWindowPosition):
+
+2009-11-03  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Anders Carlsson and Beth Dakin.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31070
+        Fix <rdar://problem/7194735> Crashes at RenderText::RenderText()
+        Fix <rdar://problem/6937089> Crashes at RenderWidget::destroy()
+
+        Tests: plugins/attach-during-destroy.html
+               plugins/destroy-reentry.html
+
+        These crashes were caused by plug-in code running during detach(),
+        causing re-entry into RenderWidget::destroy() in one case and a call
+        into attach() in the other. The fix is to prevent plug-in code from
+        being called at certain unsafe times (during attach(), detach(), and
+        recalcStyle()) by deferring changes to the widget hierarchy.
+
+        * dom/Document.cpp:
+        (WebCore::Document::recalcStyle): Suspend widget hierarchy updates
+            during style recalculation.
+
+        * dom/Element.cpp:
+        (WebCore::Element::attach): Suspend widget hierarchy updates during
+            attach().
+        (WebCore::Element::detach): Suspend widget hierarchy updates during
+            detach().
+
+        * rendering/RenderWidget.cpp:
+        (WebCore::widgetNewParentMap): Returns a static map of pending changes
+            to the widget hierarchy.
+        (WebCore::RenderWidget::suspendWidgetHierarchyUpdates): Increments the
+            suspend count.
+        (WebCore::RenderWidget::resumeWidgetHierarchyUpdates): Decrements the
+            suspend count. If the count is going to be zero, updates the widget
+            hierarchy by executing the pending changes stored in the map.
+        (WebCore::moveWidgetToParentSoon): Updates the widget hierarchy
+            immediately or makes or updates an entry in the map, depending on
+            whether updates are suspended.
+        (WebCore::RenderWidget::destroy): Removed earlier bandaid fix for
+            <rdar://problem/6937089>.
+        (WebCore::RenderWidget::setWidgetGeometry): Assert that widget updates
+            are not suspended, because this function updates the widget’s
+            bounds, which can result in arbitrary native and JavaScript code
+            execution. I think this assertion is true thanks to some deferred-
+            update mechanisms that have already been deployed in other places
+            in the code.
+        (WebCore::RenderWidget::setWidget): Call moveWidgetToParentSoon instead
+            of changing the widget hierarchy directly.
+        * rendering/RenderWidget.h: Declared suspendWidgetHierarchyUpdates()
+            and resumeWidgetHierarchyUpdates().
+
+2009-11-03  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: only show timeline records that contribute
+        to the current window.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31069
+
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype.refresh):
+        (WebInspector.TimelineGraph):
+        (WebInspector.TimelineGraph.prototype.refresh):
+
+2009-11-03  Patrick Mueller  <Patrick_Mueller@us.ibm.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Watch expression editor should stay open after Add button was clicked
+        https://bugs.webkit.org/show_bug.cgi?id=31049
+
+        No new tests, was a regression, use existing manual test.
+
+        * inspector/front-end/WatchExpressionsSidebarPane.js:
+        (WebInspector.WatchExpressionsSection.prototype.update):
+        (WebInspector.WatchExpressionsSection.prototype.addExpression):
+
+2009-11-03  Evan Martin  <evan@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Fix an off-by-one in the CSS lexer that causes memory corruption in
+        hard-to-trigger circumstances.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30827
+
+        Test: fast/css/end-of-buffer-crash.html
+
+        * css/maketokenizer: Add comments, fix off-by-one.
+
+2009-11-02  Darin Adler  <darin@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        Crash due to double-destroy related to CSS run-in property
+        https://bugs.webkit.org/show_bug.cgi?id=31034
+        rdar://problem/7328458
+
+        Test: fast/css/run-in-crash.html
+
+        * rendering/RenderBlock.cpp:
+        (WebCore::RenderBlock::destroy): Reorder destruction so the
+        continuation is destroyed after anonymous children. See comment
+        in the code for more details of why this is right.
+        * rendering/RenderInline.cpp:
+        (WebCore::RenderInline::destroy): Ditto.
+
+2009-11-03  Alexander Pavlov  <apavlov@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Fix exception in ElementsPanel.js when moving pointer out of crumbs and window
+
+        There might be no new node under mouse if the pointer is moved out of the window
+        in which case we get an exception.
+        https://bugs.webkit.org/show_bug.cgi?id=31061
+
+        * inspector/front-end/ElementsPanel.js:
+        (WebInspector.ElementsPanel.prototype._mouseMovedOutOfCrumbs):
+
+2009-11-03  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for the dom directory of WebCore
+        https://bugs.webkit.org/show_bug.cgi?id=31053
+
+        Inherits the following classes from Noncopyable because these are
+        instantiated by 'new' and these are no need to be copyable:
+
+        class EventNames - 'new' call: WebCore/platform/ThreadGlobalData.cpp:73
+        struct PerformTaskContext - 'new' call: WebCore/dom/Document.cpp:4581
+        class EventData - 'new' call: WebCore/dom/MessagePortChannel.cpp:38
+        struct NodeListsNodeData - 'new' call: WebCore/dom/NodeRareData.h:51 
+        struct EventTargetData - 'new' call: WebCore/dom/NodeRareData.h:100
+        class NodeRareData - 'new' call: WebCore/dom/Node.cpp:552
+
+        Inherits QualifiedName class from FastAllocBase because it is
+        instantiated by 'new' in WebCore/editing/markup.cpp:319
+
+        * dom/Document.cpp:
+        * dom/EventNames.h:
+        * dom/EventTarget.h:
+        * dom/MessagePortChannel.h:
+        * dom/NodeRareData.h:
+        * dom/QualifiedName.h:
+
+2009-11-03  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Implement timeline summary panel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31064
+
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._createOverview):
+        (WebInspector.TimelinePanel.prototype.refresh):
+        (WebInspector.TimelineCategoryGraph):
+        (WebInspector.TimelineCategoryGraph.prototype.get graphElement):
+        (WebInspector.TimelineCategoryGraph.prototype.addChunk):
+        (WebInspector.TimelineCategoryGraph.prototype.clearChunks):
+        (WebInspector.TimelineGraph.prototype.refresh):
+        * inspector/front-end/inspector.css:
+
+2009-11-03  Alexander Pavlov  <apavlov@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Toggle off 'Search for node' when the Inspector window is closing
+
+        Searching for node should be toggled off when the Inspector window is closed,
+        in a platform-independent manner.
+        https://bugs.webkit.org/show_bug.cgi?id=31059
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::setWindowVisible):
+
+2009-11-03  Mikhail Naganov  <mnaganov@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Prepare for heap profiles upstreaming:
+        - pass profile type id from InspectorController;
+        - this makes WebInspector.CPUProfile redundant---removed;
+        - support multiple profile types when populating profiles.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31052
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::createProfileHeader):
+        * inspector/front-end/ProfileView.js:
+        (WebInspector.CPUProfileView.profileCallback):
+        (WebInspector.CPUProfileView):
+        (WebInspector.CPUProfileView.prototype._sortData):
+        * inspector/front-end/ProfilesPanel.js:
+        (WebInspector.ProfilesPanel.prototype.addProfileHeader):
+        * inspector/front-end/inspector.js:
+        (WebInspector.addProfileHeader):
+
+2009-11-03  Dan Kegel  <dank@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        UMR in WebCore::AccessibilityRenderObject::children(); m_childrenDirty uninitialized in constructor
+        https://bugs.webkit.org/show_bug.cgi?id=31063
+
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::AccessibilityRenderObject):
+
+2009-11-03  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Implement Timeline Window, wire it to the bottom timeline.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31056
+
+        * English.lproj/localizedStrings.js:
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype.get items):
+        (WebInspector.AbstractTimelinePanel.prototype.createInterface):
+        (WebInspector.AbstractTimelinePanel.prototype.updateGraphDividersIfNeeded):
+        (WebInspector.AbstractTimelinePanel.prototype._updateDividersLabelBarPosition):
+        (WebInspector.AbstractTimelinePanel.prototype.invalidateAllItems):
+        (WebInspector.AbstractTimelinePanel.prototype.refresh):
+        (WebInspector.AbstractTimelinePanel.prototype.adjustScrollPosition):
+        (WebInspector.AbstractTimelinePanel.prototype.addExtraDivider):
+        (WebInspector.TimelineGrid):
+        (WebInspector.TimelineGrid.prototype.get itemsGraphsElement):
+        (WebInspector.TimelineGrid.prototype.updateDividers):
+        (WebInspector.TimelineGrid.prototype.addExtraDivider):
+        (WebInspector.TimelineGrid.prototype.setScrollAndDividerTop):
+        * inspector/front-end/ResourcesPanel.js:
+        (WebInspector.ResourcesPanel):
+        (WebInspector.ResourcesPanel.prototype.updateGraphDividersIfNeeded):
+        (WebInspector.ResourcesPanel.prototype.get _resources):
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel):
+        (WebInspector.TimelinePanel.prototype.get categories):
+        (WebInspector.TimelinePanel.prototype._formatRecord):
+        (WebInspector.TimelinePanel.prototype.reset):
+        (WebInspector.TimelinePanel.prototype._createOverview):
+        (WebInspector.TimelinePanel.prototype.setSidebarWidth):
+        (WebInspector.TimelinePanel.prototype.updateMainViewWidth):
+        (WebInspector.TimelinePanel.prototype.updateGraphDividersIfNeeded):
+        (WebInspector.TimelinePanel.prototype.refresh):
+        (WebInspector.TimelinePanel.prototype._resizeWindow):
+        (WebInspector.TimelinePanel.prototype._windowResizeDragging):
+        (WebInspector.TimelinePanel.prototype._dragWindow):
+        (WebInspector.TimelinePanel.prototype._windowDragging):
+        (WebInspector.TimelinePanel.prototype._resizeWindowLeft):
+        (WebInspector.TimelinePanel.prototype._resizeWindowRight):
+        (WebInspector.TimelinePanel.prototype._setWindowPosition):
+        (WebInspector.TimelinePanel.prototype._endWindowDragging):
+        (WebInspector.TimelineCategoryTreeElement):
+        (WebInspector.TimelineCategoryTreeElement.prototype.onattach):
+        (WebInspector.TimelineCalculator.prototype.computeBarGraphPercentages):
+        (WebInspector.TimelineCalculator.prototype.get minimumBoundary):
+        (WebInspector.TimelineCalculator.prototype.get maximumBoundary):
+        (WebInspector.TimelineCalculator.prototype.reset):
+        (WebInspector.TimelineCalculator.prototype.updateBoundaries):
+        (WebInspector.TimelineCalculator.prototype.formatValue):
+        * inspector/front-end/inspector.css:
+
+2009-11-03  Simon Hausmann  <hausmann@webkit.org>
+
+        Reviewed by Tor Arne Vestbø.
+
+        Make QWebPluginDatabase private API for now.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30775
+
+        * WebCore.pro:
+
+2009-11-03  Simon Hausmann  <hausmann@webkit.org>
+
+        Reviewed by Tor Arne Vestbø.
+
+        Extended the conversion of the WebCore ResourceRequest to the
+        QNetworkRequest with a mandatory originating object argument,
+        which is meant to be the QWebFrame the request belongs to.
+
+        https://bugs.webkit.org/show_bug.cgi?id=29975
+
+        * platform/network/qt/QNetworkReplyHandler.cpp:
+        (WebCore::QNetworkReplyHandler::QNetworkReplyHandler):
+        (WebCore::QNetworkReplyHandler::sendResponseIfNeeded):
+        (WebCore::QNetworkReplyHandler::start):
+        * platform/network/qt/ResourceRequest.h:
+        * platform/network/qt/ResourceRequestQt.cpp:
+        (WebCore::ResourceRequest::toNetworkRequest):
+
+2009-11-03  Keishi Hattori  <casey.hattori@gmail.com>
+
+        Reviewed by Pavel Feldman.
+
+        Web Inspector: monitorEvent should be monitorEvents
+        https://bugs.webkit.org/show_bug.cgi?id=31042
+
+        * inspector/front-end/InjectedScript.js:
+        (InjectedScript._ensureCommandLineAPIInstalled):
+
+2009-11-02  Tor Arne Vestbø  <tor.arne.vestbo@nokia.com>
+
+        Rubber-stamped by Antti Koivisto.
+
+        [Qt] Build fix for Windows CE
+
+        * plugins/PluginDatabase.cpp:
+
+2009-11-02  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by David Levin.
+
+        fix accessibility webkit-style-check errors
+        https://bugs.webkit.org/show_bug.cgi?id=29672
+
+        * accessibility/AXObjectCache.cpp:
+        (WebCore::AXObjectCache::getOrCreate):
+        (WebCore::AXObjectCache::remove):
+        (WebCore::AXObjectCache::platformGenerateAXID):
+        (WebCore::AXObjectCache::removeAXID):
+        * accessibility/AXObjectCache.h:
+        (WebCore::AXObjectCache::enableAccessibility):
+        (WebCore::AXObjectCache::enableEnhancedUserInterfaceAccessibility):
+        (WebCore::AXObjectCache::accessibilityEnabled):
+        (WebCore::AXObjectCache::accessibilityEnhancedUserInterfaceEnabled):
+        (WebCore::AXObjectCache::isIDinUse):
+        (WebCore::AXObjectCache::objectFromAXID):
+        (WebCore::AXObjectCache::):
+        (WebCore::AXObjectCache::handleActiveDescendantChanged):
+        (WebCore::AXObjectCache::handleAriaRoleChanged):
+        (WebCore::AXObjectCache::detachWrapper):
+        (WebCore::AXObjectCache::attachWrapper):
+        (WebCore::AXObjectCache::selectedChildrenChanged):
+        (WebCore::AXObjectCache::postNotification):
+        (WebCore::AXObjectCache::postPlatformNotification):
+        (WebCore::AXObjectCache::handleFocusedUIElementChanged):
+        (WebCore::AXObjectCache::handleScrolledToAnchor):
+        * accessibility/AccessibilityARIAGrid.cpp:
+        (WebCore::AccessibilityARIAGrid::cellForColumnAndRow):
+        * accessibility/AccessibilityAllInOne.cpp:
+        * accessibility/AccessibilityImageMapLink.cpp:
+        * accessibility/AccessibilityList.h:
+        (WebCore::AccessibilityList::isList):
+        * accessibility/AccessibilityListBox.cpp:
+        * accessibility/AccessibilityListBox.h:
+        (WebCore::AccessibilityListBox::isListBox):
+        * accessibility/AccessibilityListBoxOption.cpp:
+        * accessibility/AccessibilityListBoxOption.h:
+        (WebCore::AccessibilityListBoxOption::isListBoxOption):
+        * accessibility/AccessibilityMediaControls.h:
+        (WebCore::AccessibilityMediaControl::~AccessibilityMediaControl):
+        (WebCore::AccessibilityMediaTimeline::~AccessibilityMediaTimeline):
+        (WebCore::AccessibilityMediaTimeline::isMediaTimeline):
+        (WebCore::AccessibilityMediaControlsContainer::~AccessibilityMediaControlsContainer):
+        (WebCore::AccessibilityMediaControlsContainer::roleValue):
+        (WebCore::AccessibilityMediaControlsContainer::accessibilityIsIgnored):
+        (WebCore::AccessibilityMediaTimeDisplay::~AccessibilityMediaTimeDisplay):
+        (WebCore::AccessibilityMediaTimeDisplay::roleValue):
+        * accessibility/AccessibilityObject.cpp:
+        (WebCore::AccessibilityObject::parentObjectUnignored):
+        (WebCore::AccessibilityObject::rightLineVisiblePositionRange):
+        (WebCore::replacedNodeNeedsCharacter):
+        (WebCore::AccessibilityObject::stringForVisiblePositionRange):
+        (WebCore::AccessibilityObject::lengthForVisiblePositionRange):
+        (WebCore::AccessibilityObject::actionVerb):
+        * accessibility/AccessibilityObject.h:
+        (WebCore::PlainTextRange::isNull):
+        (WebCore::AccessibilityObject::isAccessibilityRenderObject):
+        (WebCore::AccessibilityObject::isAnchor):
+        (WebCore::AccessibilityObject::isAttachment):
+        (WebCore::AccessibilityObject::isHeading):
+        (WebCore::AccessibilityObject::isLink):
+        (WebCore::AccessibilityObject::isImage):
+        (WebCore::AccessibilityObject::isNativeImage):
+        (WebCore::AccessibilityObject::isImageButton):
+        (WebCore::AccessibilityObject::isPasswordField):
+        (WebCore::AccessibilityObject::isTextControl):
+        (WebCore::AccessibilityObject::isNativeTextControl):
+        (WebCore::AccessibilityObject::isWebArea):
+        (WebCore::AccessibilityObject::isCheckboxOrRadio):
+        (WebCore::AccessibilityObject::isListBox):
+        (WebCore::AccessibilityObject::isFileUploadButton):
+        (WebCore::AccessibilityObject::isProgressIndicator):
+        (WebCore::AccessibilityObject::isSlider):
+        (WebCore::AccessibilityObject::isControl):
+        (WebCore::AccessibilityObject::isList):
+        (WebCore::AccessibilityObject::isDataTable):
+        (WebCore::AccessibilityObject::isTableRow):
+        (WebCore::AccessibilityObject::isTableColumn):
+        (WebCore::AccessibilityObject::isTableCell):
+        (WebCore::AccessibilityObject::isFieldset):
+        (WebCore::AccessibilityObject::isGroup):
+        (WebCore::AccessibilityObject::isChecked):
+        (WebCore::AccessibilityObject::isEnabled):
+        (WebCore::AccessibilityObject::isSelected):
+        (WebCore::AccessibilityObject::isFocused):
+        (WebCore::AccessibilityObject::isHovered):
+        (WebCore::AccessibilityObject::isIndeterminate):
+        (WebCore::AccessibilityObject::isLoaded):
+        (WebCore::AccessibilityObject::isMultiSelect):
+        (WebCore::AccessibilityObject::isOffScreen):
+        (WebCore::AccessibilityObject::isPressed):
+        (WebCore::AccessibilityObject::isReadOnly):
+        (WebCore::AccessibilityObject::isVisited):
+        (WebCore::AccessibilityObject::isRequired):
+        (WebCore::AccessibilityObject::canSetFocusAttribute):
+        (WebCore::AccessibilityObject::canSetTextRangeAttributes):
+        (WebCore::AccessibilityObject::canSetValueAttribute):
+        (WebCore::AccessibilityObject::hasIntValue):
+        (WebCore::AccessibilityObject::accessibilityShouldUseUniqueId):
+        (WebCore::AccessibilityObject::accessibilityIsIgnored):
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::AccessibilityRenderObject::parentObjectIfExists):
+        (WebCore::AccessibilityRenderObject::parentObject):
+        (WebCore::AccessibilityRenderObject::isMenuRelated):
+        (WebCore::AccessibilityRenderObject::accessibilityDescription):
+        (WebCore::AccessibilityRenderObject::accessibilityIsIgnored):
+        (WebCore::AccessibilityRenderObject::isFocused):
+        (WebCore::AccessibilityRenderObject::visiblePositionRangeForLine):
+        (WebCore::AccessibilityRenderObject::setSelectedVisiblePositionRange):
+        (WebCore::AccessibilityRenderObject::doAXRangeForLine):
+        (WebCore::AccessibilityRenderObject::doAXStringForRange):
+        (WebCore::AccessibilityRenderObject::accessibilityImageMapHitTest):
+        (WebCore::AccessibilityRenderObject::determineAriaRoleAttribute):
+        (WebCore::AccessibilityRenderObject::determineAccessibilityRole):
+        (WebCore::AccessibilityRenderObject::isPresentationalChildOfAriaRole):
+        (WebCore::AccessibilityRenderObject::canSetFocusAttribute):
+        (WebCore::AccessibilityRenderObject::canHaveChildren):
+        (WebCore::AccessibilityRenderObject::actionVerb):
+        (WebCore::shouldReturnTagNameAsRoleForMSAA):
+        * accessibility/AccessibilityRenderObject.h:
+        (WebCore::AccessibilityRenderObject::isAccessibilityRenderObject):
+        * accessibility/AccessibilitySlider.cpp:
+        (WebCore::AccessibilitySlider::orientation):
+        * accessibility/AccessibilitySlider.h:
+        (WebCore::AccessibilitySlider::~AccessibilitySlider):
+        (WebCore::AccessibilitySlider::roleValue):
+        (WebCore::AccessibilitySlider::accessibilityIsIgnored):
+        (WebCore::AccessibilitySlider::isSlider):
+        (WebCore::AccessibilitySlider::canSetValueAttribute):
+        (WebCore::AccessibilitySliderThumb::~AccessibilitySliderThumb):
+        (WebCore::AccessibilitySliderThumb::roleValue):
+        (WebCore::AccessibilitySliderThumb::accessibilityIsIgnored):
+        (WebCore::AccessibilitySliderThumb::setParentObject):
+        (WebCore::AccessibilitySliderThumb::parentObject):
+        * accessibility/AccessibilityTable.cpp:
+        (WebCore::AccessibilityTable::isTableExposableThroughAccessibility):
+        * accessibility/AccessibilityTableColumn.cpp:
+        * accessibility/AccessibilityTableHeaderContainer.cpp:
+        (WebCore::AccessibilityTableHeaderContainer::addChildren):
+        * accessibility/AccessibilityTableRow.cpp:
+        * accessibility/mac/AccessibilityObjectWrapper.h:
+
+2009-11-02  Darin Fisher  <darin@chromium.org>
+
+        Fixing JSC build bustage.
+
+        * bindings/js/ScriptController.cpp: Added missing #include
+
+2009-10-30  Darin Fisher  <darin@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        Give the FrameLoaderClient the ability to override Settings::isJavaScriptEnabled.
+        https://bugs.webkit.org/show_bug.cgi?id=30967
+
+        * bindings/js/ScriptController.cpp:
+        (WebCore::ScriptController::isEnabled):
+        * bindings/v8/ScriptController.cpp:
+        (WebCore::ScriptController::isEnabled):
+        * bindings/v8/V8Proxy.cpp: Move implementation of isEnabled to ScriptController
+        * bindings/v8/V8Proxy.h: Ditto
+        * loader/FrameLoaderClient.h:
+        (WebCore::FrameLoaderClient::allowJavaScript):
+        * platform/chromium/ChromiumBridge.h: Delete uiResourceProtocol function
+
+2009-11-02  Brady Eidson  <beidson@apple.com>
+
+        Rubberstamped by Mark Rowe.
+
+        Fix a typo in Mark's last commit.
+
+        * loader/archive/ArchiveFactory.cpp:
+        (WebCore::archiveMIMETypes):
+
+2009-11-02  Mark Rowe  <mrowe@apple.com>
+
+        Rubber-stamped by Brady Eidson.
+
+        Re-enable support for web archives on Windows.  It was mistakenly disabled in r50438.
+
+        * loader/archive/ArchiveFactory.cpp:
+        (WebCore::archiveMIMETypes):
+
+2009-11-02  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Darin Adler.
+
+        PLATFORM(CF) should be set when building for Qt on Darwin
+        https://bugs.webkit.org/show_bug.cgi?id=23671
+
+        * WebCore.pro: Add SharedBufferCF.cpp and SmartReplaceCF.cpp
+        to the Darwin build.
+        * loader/archive/ArchiveFactory.cpp: Change the support for 
+        legacy WebArchive from all CF platforms to Mac and Chromium 
+        CF platforms.
+        (WebCore::archiveMIMETypes):
+        * platform/text/AtomicString.h: Remove PLATFORM(QT) &&
+        PLATFORM(DARWIN) test as it is redundant now.
+        * platform/text/PlatformString.h: Ditto.
+        * platform/text/StringImpl.h: Ditto.
+        * platform/text/cf/StringCF.cpp: Ditto.
+        * platform/text/cf/StringImplCF.cpp: Ditto.
+
+2009-11-02  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by David Levin.
+
+        [Chromium] Actually declare getPluginMimeTypeFromExtension in a header.
+        https://bugs.webkit.org/show_bug.cgi?id=30985
+
+        Our current code does not conform to our style guide.
+
+        * WebCore.gyp/WebCore.gyp:
+        * WebCore.gypi:
+        * platform/chromium/MIMETypeRegistryChromium.cpp:
+        * plugins/chromium/PluginDataChromium.cpp:
+        * plugins/chromium/PluginDataChromium.h: Added.
+
+2009-11-02  Adele Peterson  <adele@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Fix for <rdar://problem/7038305> REGRESSION (Safari 4.0.2 - ToT): After navigating back to a known phishy page, the "Ignore warning" button appears highlighted (along with the "Go Back" button)
+
+        This bug is timing dependent, and not always reproducible.  I could not think of a way to add a 
+        layout test that would demonstrate the problem and fix.
+
+        * platform/mac/ThemeMac.mm:
+        (WebCore::checkbox): Update style.
+        (WebCore::paintCheckbox): ditto.
+        (WebCore::radio): ditto.
+        (WebCore::paintRadio): ditto.
+        (WebCore::setupButtonCell): Added convenience method.
+        (WebCore::button): Use a separate NSButtonCell for defaultButtons and regular buttons.
+        (WebCore::paintButton): Don't check for the key window here.  Consider that when deciding if the button should have the default style in RenderTheme.
+        * rendering/RenderTheme.cpp: (WebCore::RenderTheme::isDefault): Only consider a button to be default if the page is active.  This fixes 
+        a problem I noticed where the button would flicker crazily if the page with the default button was in the background.
+
+2009-11-02  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Anders Carlsson.
+
+        Minor RenderWidget clean-up in preparation for deferring widget tree
+        mutation when it is not safe.
+
+        * rendering/RenderWidget.cpp:
+        (WebCore::RenderWidget::RenderWidget): Initialize m_refCount to 1
+        instead of calling ref().
+        (WebCore::RenderWidget::destroy): Call setWidget(0) instead of
+        repeating what it does.
+        (WebCore::RenderWidget::setWidgetGeometry): Now returns a boolean
+        indicating whether the bounds have changed.
+        (WebCore::RenderWidget::setWidget): Replaced all-encompassing if
+        statement with an early return.
+        (WebCore::RenderWidget::updateWidgetPosition): Call setWidgetGeometry().
+        * rendering/RenderWidget.h:
+
+2009-11-02  Dumitru Daniliuc  <dumi@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        Adding Chromium's DatabaseTracker and SQLTransactionClient
+        implementations.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30701
+
+        * storage/chromium: Added.
+        * storage/chromium/DatabaseObserver.h: Added.
+        * storage/chromium/DatabaseTrackerChromium.cpp: Added.
+        * storage/chromium/QuotaTracker.cpp: Added.
+        * storage/chromium/QuotaTracker.h: Added.
+        * storage/chromium/SQLTransactionClientChromium.cpp: Added.
+
+2009-11-02  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by Adele Peterson and Dan Bernstein.
+
+        Safari crashes when calling execCommand on formatted html in special case
+        <rdar://problem/7318656>
+        https://bugs.webkit.org/show_bug.cgi?id=31023
+
+        Test: editing/execCommand/align-in-span.html
+
+        * rendering/RenderObject.cpp:
+        (WebCore::RenderObject::containingBlock): Modified comment on containingBlock returning NULL.
+        * rendering/RenderText.cpp:
+        (WebCore::RenderText::setSelectionState): Added check for NULL return from containingBlock,
+        since it is possible when dealing with orphaned trees.
+
+2009-11-02  Chris Marrin  <cmarrin@apple.com>
+
+        Reviewed by Oliver Hunt.
+
+        Exception checks were being too aggressive
+        https://bugs.webkit.org/show_bug.cgi?id=31005
+
+        Several calls in CanvasRenderingContext3D are allowed to
+        have a null value passed, which indicated that the 
+        object is being unbound. Handle this case and the corresponding
+        null handling in GraphicsContext3DMac.
+
+        * html/canvas/CanvasRenderingContext3D.cpp:
+        (WebCore::CanvasRenderingContext3D::bindBuffer):
+        (WebCore::CanvasRenderingContext3D::bindFramebuffer):
+        (WebCore::CanvasRenderingContext3D::bindRenderbuffer):
+        (WebCore::CanvasRenderingContext3D::bindTexture):
+        (WebCore::CanvasRenderingContext3D::framebufferRenderbuffer):
+        (WebCore::CanvasRenderingContext3D::framebufferTexture2D):
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::GraphicsContext3D::framebufferRenderbuffer):
+        (WebCore::GraphicsContext3D::framebufferTexture2D):
+
+2009-11-02  Patrick Mueller  <Patrick_Mueller@us.ibm.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Each JS execution in console adds extra item into "scripts" combo
+        https://bugs.webkit.org/show_bug.cgi?id=30212
+
+        Added manual test
+
+        * inspector/front-end/ScriptsPanel.js:
+        (WebInspector.ScriptsPanel.prototype._showScriptOrResource):
+        * manual-tests/inspector/hidden-evals.html: Added.
+
+2009-11-02  Kelly Norton  <knorton@google.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Adds a missed case for InspectorTimeline, DOMWindow dispatch of DOM events.
+        https://bugs.webkit.org/show_bug.cgi?id=31030
+
+        * dom/Node.cpp:
+        (WebCore::eventHasListeners): Checks DOMWindow for listeners.
+        (WebCore::Node::dispatchGenericEvent):
+
+2009-11-02  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by David Levin.
+
+        Remove threadsafe refcounting from tasks used with WTF::MessageQueue.
+        https://bugs.webkit.org/show_bug.cgi?id=30612
+
+        No new tests since no new functionality. Storage, MessagePorts and Workers tests cover this.
+
+        There are a lot of files but most changes are simply replace RefPtr and PassRefPtr with
+        OwnPtr and PassOwnPtr when dealing with Tasks.
+
+        ScriptExecutionContext::Task, DatabaseTask and WorkerRunLoop::Task are no longer
+        threadsafe refcounted, but simply Noncopyable.
+
+        * dom/Document.cpp:
+        (WebCore::ScriptExecutionContextTaskTimer::ScriptExecutionContextTaskTimer):
+        (WebCore::PerformTaskContext::PerformTaskContext):
+        (WebCore::Document::postTask):
+        * dom/Document.h:
+        * dom/ScriptExecutionContext.cpp:
+        (WebCore::ProcessMessagesSoonTask::create):
+        * dom/ScriptExecutionContext.h:
+        * dom/default/PlatformMessagePortChannel.cpp:
+        (WebCore::PlatformMessagePortChannel::tryGetMessageFromRemote):
+        * dom/default/PlatformMessagePortChannel.h:
+        (WebCore::PlatformMessagePortChannel::MessagePortQueue::tryGetMessage):
+        (WebCore::PlatformMessagePortChannel::MessagePortQueue::appendAndCheckEmpty):
+        * loader/FrameLoader.cpp:
+        (WebCore::HashChangeEventTask::create):
+        * loader/appcache/ApplicationCacheGroup.cpp:
+        (WebCore::CallCacheListenerTask::create):
+        * storage/Database.cpp:
+        (WebCore::Database::openAndVerifyVersion):
+        (WebCore::Database::markAsDeletedAndClose):
+        (WebCore::Database::scheduleTransaction):
+        (WebCore::Database::scheduleTransactionStep):
+        (WebCore::Database::tableNames):
+        * storage/DatabaseTask.h:
+        (WebCore::DatabaseOpenTask::create):
+        (WebCore::DatabaseCloseTask::create):
+        (WebCore::DatabaseTransactionTask::create):
+        (WebCore::DatabaseTableNamesTask::create):
+        * storage/DatabaseThread.cpp:
+        (WebCore::DatabaseThread::databaseThread):
+        (WebCore::DatabaseThread::scheduleTask):
+        (WebCore::DatabaseThread::scheduleImmediateTask):
+        (WebCore::SameDatabasePredicate::operator()):
+        * storage/DatabaseThread.h:
+        * storage/LocalStorageTask.h:
+        (WebCore::LocalStorageTask::createImport):
+        (WebCore::LocalStorageTask::createSync):
+        (WebCore::LocalStorageTask::createTerminate):
+        * storage/LocalStorageThread.cpp:
+        (WebCore::LocalStorageThread::localStorageThread):
+        * storage/LocalStorageThread.h:
+        * websockets/WebSocket.cpp:
+        (WebCore::ProcessWebSocketEventTask::create):
+        * workers/DefaultSharedWorkerRepository.cpp:
+        (WebCore::SharedWorkerProxy::postTaskToLoader):
+        (WebCore::SharedWorkerProxy::postTaskForModeToWorkerContext):
+        (WebCore::SharedWorkerConnectTask::create):
+        * workers/GenericWorkerTask.h:
+        (WebCore::GenericWorkerTask1::create):
+        (WebCore::GenericWorkerTask2::create):
+        (WebCore::GenericWorkerTask3::create):
+        (WebCore::GenericWorkerTask4::create):
+        (WebCore::GenericWorkerTask5::create):
+        (WebCore::GenericWorkerTask6::create):
+        (WebCore::GenericWorkerTask7::create):
+        (WebCore::GenericWorkerTask8::create):
+        (WebCore::createCallbackTask):
+        * workers/WorkerContext.cpp:
+        (WebCore::WorkerContext::postTask):
+        * workers/WorkerContext.h:
+        * workers/WorkerLoaderProxy.h:
+        * workers/WorkerMessagingProxy.cpp:
+        (WebCore::MessageWorkerContextTask::create):
+        (WebCore::MessageWorkerTask::create):
+        (WebCore::WorkerExceptionTask::create):
+        (WebCore::WorkerContextDestroyedTask::create):
+        (WebCore::WorkerTerminateTask::create):
+        (WebCore::WorkerThreadActivityReportTask::create):
+        (WebCore::WorkerMessagingProxy::postTaskForModeToWorkerContext):
+        (WebCore::WorkerMessagingProxy::postTaskToLoader):
+        (WebCore::WorkerMessagingProxy::workerThreadCreated):
+        * workers/WorkerMessagingProxy.h:
+        * workers/WorkerRunLoop.cpp:
+        (WebCore::ModePredicate::operator()):
+        (WebCore::WorkerRunLoop::runInMode):
+        (WebCore::WorkerRunLoop::postTask):
+        (WebCore::WorkerRunLoop::postTaskForMode):
+        (WebCore::WorkerRunLoop::Task::create):
+        (WebCore::WorkerRunLoop::Task::performTask):
+        (WebCore::WorkerRunLoop::Task::Task):
+        * workers/WorkerRunLoop.h:
+        (WebCore::WorkerRunLoop::Task::~Task):
+        (WebCore::WorkerRunLoop::Task::mode):
+
+2009-11-02  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Jan Alonzo.
+
+        [GTK] Failing media/video-played-reset.html
+        https://bugs.webkit.org/show_bug.cgi?id=30589
+
+        new m_seekTime attribute to keep track of the seek position
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::MediaPlayerPrivate::currentTime):
+        (WebCore::MediaPlayerPrivate::seek):
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.h:
+
+2009-11-02  Xan Lopez  <xlopez@igalia.com>
+
+        Reviewed by Jan Alonzo.
+
+        [GTK] Remove Referer when redirecting to non-secure site
+        https://bugs.webkit.org/show_bug.cgi?id=31021
+
+        Remove referer from HTTP headers when redirecting to a non-secure
+        site.
+
+        * platform/network/soup/ResourceHandleSoup.cpp:
+        (WebCore::restartedCallback):
+
+2009-11-02  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        https://bugs.webkit.org/show_bug.cgi?id=18539
+        multipart/form-data not being parsed correctly on server due to '+' in boundary string
+
+        No test - the characters that the boundary is made of are not deterministic.
+
+        * platform/network/FormDataBuilder.cpp: (WebCore::FormDataBuilder::generateUniqueBoundaryString):
+        Don't ever put a '+' in boundary string, either. Removed a FIXME to bring '/' back once
+        GMail is fixed - I don't think we'll ever want to allow non-alphanumeric characters, as
+        they cause problems on many web sites.
+
+2009-10-30  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Darin Adler.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30969
+        A no-prefix XPath node test should not match no-namespace elements in HTML document
+
+        Test: fast/xpath/null-namespace-in-html.html
+
+        * xml/XPathStep.cpp: (WebCore::XPath::nodeMatchesBasicTest): Special case non-HTML elements
+        in HTML documents (as these are the ones that can have null namespace).
+
+2009-11-02  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: [REGRESSION] No timeline marks on resources panel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31013
+
+        * inspector/front-end/AbstractTimelinePanel.js:
+        (WebInspector.AbstractTimelinePanel.prototype.updateGraphDividersIfNeeded):
+
+2009-11-02  David Levin  <levin@chromium.org>
+
+        Reviewed by Dan Bernstein.
+
+        Possible crash in RenderSlider::layout.
+        https://bugs.webkit.org/show_bug.cgi?id=31016
+
+        Fix out of place line of code.
+
+        Test: scrollbars/overflow-scrollbar-combinations.html
+        This crash only seems to repro when WebKit draws the play controls,
+        so the crash repros in chromium running this test but not WebKit
+        nightlies which use QuickTime to draw the controls.
+
+        * rendering/RenderSlider.cpp:
+        (WebCore::RenderSlider::layout):
+
+2009-11-02  Jocelyn Turcotte  <jocelyn.turcotte@nokia.com>
+
+        Reviewed by Tor Arne Vestbø.
+
+        [Qt] Fix Qt build on Windows.
+        https://bugs.webkit.org/show_bug.cgi?id=30905
+
+        * WebCore.pro:
+        * platform/graphics/BitmapImage.h:
+        * platform/graphics/qt/ImageQt.cpp:
+        (WebCore::BitmapImage::BitmapImage):
+        (WebCore::BitmapImage::create):
+
+2009-11-02  Jedrzej Nowacki  <jedrzej.nowacki@nokia.com>
+
+        Reviewed by Adam Barth.
+
+        QWebView crash fix.
+
+        The QWebView should not crash if the stop() method is called from
+        a function triggered by the loadProgress signal.
+
+        A null pointer protection was added in the ProgressTracker::incrementProgress.
+
+        New autotest was created.
+
+        https://bugs.webkit.org/show_bug.cgi?id=29425
+
+        * loader/ProgressTracker.cpp:
+        (WebCore::ProgressTracker::incrementProgress):
+
+2009-11-02  Mikhail Naganov  <mnaganov@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Fix a leftover from profiles panel generalization.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31010
+
+        * inspector/front-end/ProfilesPanel.js:
+        (WebInspector.ProfilesPanel.prototype.get searchableViews):
+
+2009-11-02  Kai Koehne  <kai.koehne@nokia.com>
+
+        Reviewed by Holger Freyther.
+
+        Remove implementation of ImageDecocerQt::clearFrameBufferCache.
+        The implementation was buggy, and will visually break repeating
+        animations anyway.
+
+        https://bugs.webkit.org/show_bug.cgi?id=31009
+
+        * platform/graphics/qt/ImageDecoderQt.cpp:
+        (WebCore::ImageDecoderQt::clearFrameBufferCache):
+
+2009-11-02  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30964
+        [Gtk] Implemment AtkDocument
+
+        Provides access to the reported content language.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (webkit_accessible_document_get_locale):
+
+2009-11-02  Keishi Hattori  <casey.hattori@gmail.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Rewrite CSSSourceSyntaxHighlighter so it shares more code
+        https://bugs.webkit.org/show_bug.cgi?id=30907
+
+        Test: inspector/css-syntax-highlight.html
+
+        * inspector/front-end/ElementsTreeOutline.js:
+        * inspector/front-end/SourceFrame.js:
+        (WebInspector.SourceFrame.prototype.syntaxHighlightCSS):
+        (WebInspector.SourceSyntaxHighlighter):
+        (WebInspector.SourceSyntaxHighlighter.prototype.process.processChunk):
+        (WebInspector.SourceSyntaxHighlighter.prototype.process.moveToNextLine):
+        (WebInspector.SourceSyntaxHighlighter.prototype.process):
+        (WebInspector.SourceSyntaxHighlighter.prototype.lex):
+        (WebInspector.SourceSyntaxHighlighter.prototype.appendNonToken):
+        (WebInspector.SourceSyntaxHighlighter.prototype.syntaxHighlightNode):
+        (WebInspector.CSSSourceSyntaxHighlighter):
+        * inspector/front-end/inspectorSyntaxHighlight.css:
+
+2009-11-02  Chris Fleizach  <cfleizach@apple.com>
+
+        Reviewed by Beth Dakin.
+
+        Support ARIA "tab" roles
+        https://bugs.webkit.org/show_bug.cgi?id=30842
+
+        Implement support for ARIA "tab", "tabpanel" and "tablist".
+        As a consequence, we also needed to implement aria-selected
+        and aria-controls.
+
+        Tests: accessibility/aria-controls-with-tabs.html
+               accessibility/aria-tab-roles.html
+
+        * accessibility/AXObjectCache.cpp:
+        * accessibility/AccessibilityObject.h:
+        * accessibility/AccessibilityRenderObject.cpp:
+        * accessibility/AccessibilityRenderObject.h:
+        * accessibility/mac/AccessibilityObjectWrapper.mm:
+        * html/HTMLAttributeNames.in:
+
+2009-10-27  Stephen White  <senorblanco@chromium.org>
+
+        Reviewed by Dmitry Titov.
+
+        This is the WebKit-side change needed to fix canvas.getImageData() for
+        Chromium.  The unpremultiply code in Skia assumes that unpremultiplied
+        values should be rounded, while CG does not.  In addition, the fixed
+        point inversion used by Skia introduces slight inaccuracies that make
+        us fail this test.  This change brings Chromium in line with
+        the CG path.
+        https://bugs.webkit.org/show_bug.cgi?id=30825
+
+        Covered by LayoutTests/fast/canvas/canvas-getImageData.html
+
+        * platform/graphics/skia/ImageBufferSkia.cpp:
+        (WebCore::getImageData):
+
+2009-11-01  Kelly Norton  <knorton@google.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Adds window event dispatches to InspectorTimelineAgent.
+        https://bugs.webkit.org/show_bug.cgi?id=31002
+
+        * English.lproj/localizedStrings.js:
+        * dom/Node.cpp: Updated call site to willDispatchEvent and didDispatchEvent.
+        (WebCore::Node::dispatchGenericEvent):
+        * inspector/InspectorTimelineAgent.cpp:
+        (WebCore::InspectorTimelineAgent::willDispatchEvent): Renamed.
+        (WebCore::InspectorTimelineAgent::didDispatchEvent): Renamed.
+        * inspector/InspectorTimelineAgent.h:
+        (WebCore::):
+        * inspector/TimelineRecordFactory.cpp:
+        (WebCore::TimelineRecordFactory::createEventDispatchRecord): Renamed.
+        * inspector/TimelineRecordFactory.h:
+        * inspector/front-end/TimelineAgent.js:
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._formatRecord):
+        (WebInspector.TimelinePanel.prototype._getRecordDetails):
+        * page/DOMWindow.cpp:
+        (WebCore::DOMWindow::dispatchEvent):
+
+2009-11-01  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Convert script tag event into a more generic
+        script eval event in timeline.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30999
+
+        * bindings/js/ScriptController.cpp:
+        (WebCore::ScriptController::evaluateInWorld):
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::evaluate):
+        * html/HTMLTokenizer.cpp:
+        (WebCore::HTMLTokenizer::scriptExecution):
+        * inspector/InspectorTimelineAgent.cpp:
+        (WebCore::InspectorTimelineAgent::willEvaluateScript):
+        (WebCore::InspectorTimelineAgent::didEvaluateScript):
+        * inspector/InspectorTimelineAgent.h:
+        (WebCore::):
+        * inspector/TimelineRecordFactory.cpp:
+        (WebCore::TimelineRecordFactory::createEvaluateScriptTimelineRecord):
+        * inspector/TimelineRecordFactory.h:
+        * inspector/front-end/TimelineAgent.js:
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._formatRecord):
+        (WebInspector.TimelinePanel.prototype._getRecordDetails):
+
+2009-11-01  Brian Weinstein  <bweinstein@apple.com>
+
+        Rubber-stamped by Mark Rowe.
+
+        Fix for loop to use an size_t instead of unsigned and some spacing
+        style fixes.
+
+        * dom/Node.cpp:
+        (WebCore::eventHasListeners):
+
+2009-11-01  Kelly Norton  <knorton@google.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Does not send DOM dispatches to the InspectorTimelineAgent if there
+        are no event listeners.
+        https://bugs.webkit.org/show_bug.cgi?id=30995
+
+        * dom/Node.cpp:
+        (WebCore::eventHasListeners):
+        (WebCore::Node::dispatchGenericEvent):
+        * xml/XMLHttpRequest.cpp:
+        (WebCore::XMLHttpRequest::callReadyStateChangeListener):
+
+2009-11-01  Roland Steiner  <rolandsteiner@chromium.org>
+
+        No review (build fix).
+
+        Add missing files for Ruby implementation to WebCore.vcproj
+        (Fix build break after 50397)
+        https://bugs.webkit.org/show_bug.cgi?id=31001
+
+        No new tests. (No functional change)
+
+        * WebCore.vcproj/WebCore.vcproj:
+
+2009-11-02  Roland Steiner  <rolandsteiner@chromium.org>
+
+        Reviewed by Dave Hyatt.
+
+        Bug 28420 -  Implement HTML5 <ruby> rendering
+        (https://bugs.webkit.org/show_bug.cgi?id=28420)
+
+        First rudimentary implementation of HTML5 ruby rendering support.
+
+        Following the HTML 5 spec, the box object model for a <ruby> element allows several runs of ruby
+        bases with their respective ruby texts looks as follows:
+
+        1 RenderRuby object, corresponding to the whole <ruby> HTML element
+             1+ RenderRubyRun (anonymous)
+                 0 or 1 RenderRubyText - shuffled to the front in order to re-use existing block layouting
+                     0-n inline object(s)
+                 0 or 1 RenderRubyBase - contains the inline objects that make up the ruby base
+                     1-n inline object(s)
+
+        Note: <rp> elements are defined as having 'display:none' and thus normally are not assigned a renderer.
+        
+        New layout tests will be committed in a follow-up patch under fast/ruby.
+
+        Makefiles, etc.
+        * GNUmakefile.am:
+        * WebCore.gypi:
+        * WebCore.pro:
+        * WebCore.xcodeproj/project.pbxproj:
+
+        CSS
+        * css/html.css: Added <ruby> and <rt>
+
+        Existing render files:
+        * rendering/RenderBlock.cpp: make moveChild a member function moveChildTo
+        (WebCore::RenderBlock::moveChildTo):
+        (WebCore::RenderBlock::makeChildrenNonInline):
+        (WebCore::RenderBlock::removeChild):
+        * rendering/RenderBlock.h:
+        * rendering/RenderObject.cpp:
+        (WebCore::RenderObject::createObject): instantiate ruby renderers based on element name
+        * rendering/RenderObject.h: add query methods for ruby renderers
+        (WebCore::RenderObject::isRuby):
+        (WebCore::RenderObject::isRubyBase):
+        (WebCore::RenderObject::isRubyRun):
+        (WebCore::RenderObject::isRubyText):
+
+        New ruby renderers:
+        * rendering/RenderRuby.cpp: Added.
+        (WebCore::lastRubyRun):
+        (WebCore::findRubyRunParent):
+        (WebCore::RenderRubyAsInline::RenderRubyAsInline):
+        (WebCore::RenderRubyAsInline::~RenderRubyAsInline):
+        (WebCore::RenderRubyAsInline::isChildAllowed):
+        (WebCore::RenderRubyAsInline::addChild):
+        (WebCore::RenderRubyAsInline::removeChild):
+        (WebCore::RenderRubyAsBlock::RenderRubyAsBlock):
+        (WebCore::RenderRubyAsBlock::~RenderRubyAsBlock):
+        (WebCore::RenderRubyAsBlock::isChildAllowed):
+        (WebCore::RenderRubyAsBlock::addChild):
+        (WebCore::RenderRubyAsBlock::removeChild):
+        * rendering/RenderRuby.h: Added.
+        (WebCore::RenderRubyAsInline::renderName):
+        (WebCore::RenderRubyAsInline::isRuby):
+        (WebCore::RenderRubyAsBlock::renderName):
+        (WebCore::RenderRubyAsBlock::isRuby):
+        * rendering/RenderRubyBase.cpp: Added.
+        (WebCore::RenderRubyBase::RenderRubyBase):
+        (WebCore::RenderRubyBase::~RenderRubyBase):
+        (WebCore::RenderRubyBase::isChildAllowed):
+        (WebCore::RenderRubyBase::splitToLeft):
+        (WebCore::RenderRubyBase::mergeWithRight):
+        * rendering/RenderRubyBase.h: Added.
+        (WebCore::RenderRubyBase::renderName):
+        (WebCore::RenderRubyBase::isRubyBase):
+        * rendering/RenderRubyRun.cpp: Added.
+        (WebCore::RenderRubyRun::RenderRubyRun):
+        (WebCore::RenderRubyRun::~RenderRubyRun):
+        (WebCore::RenderRubyRun::hasRubyText):
+        (WebCore::RenderRubyRun::hasRubyBase):
+        (WebCore::RenderRubyRun::isEmpty):
+        (WebCore::RenderRubyRun::rubyText):
+        (WebCore::RenderRubyRun::rubyBase):
+        (WebCore::RenderRubyRun::rubyBaseSafe):
+        (WebCore::RenderRubyRun::firstLineBlock):
+        (WebCore::RenderRubyRun::updateFirstLetter):
+        (WebCore::RenderRubyRun::isChildAllowed):
+        (WebCore::RenderRubyRun::addChild):
+        (WebCore::RenderRubyRun::removeChild):
+        (WebCore::RenderRubyRun::createRubyBase):
+        (WebCore::RenderRubyRun::staticCreateRubyRun):
+        * rendering/RenderRubyRun.h: Added.
+        (WebCore::RenderRubyRun::renderName):
+        (WebCore::RenderRubyRun::isRubyRun):
+        * rendering/RenderRubyText.cpp: Added.
+        (WebCore::RenderRubyText::RenderRubyText):
+        (WebCore::RenderRubyText::~RenderRubyText):
+        (WebCore::RenderRubyText::isChildAllowed):
+        * rendering/RenderRubyText.h: Added.
+        (WebCore::RenderRubyText::renderName):
+        (WebCore::RenderRubyText::isRubyText):
+
+2009-11-01  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by Dan Bernstein.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30992
+        Node.isDefaultNamespace doesn't convert empty strings to null
+
+        Test: fast/dom/Node/default-namespace-empty-argument.html
+
+        * dom/Node.cpp: (WebCore::Node::isDefaultNamespace): Per DOM 3 Core, treat empty input
+        as null.
+
+2009-11-01  Yael Aharon  <yael.aharon@nokia.com>
+
+        Reviewed by Darin Adler.
+
+        Don't add '/' to the URL path if the it does not include '/' after the protocol component
+        https://bugs.webkit.org/show_bug.cgi?id=30971
+
+        Match IE8 behaviour, that does not add '/' if there is none after the protocol component.
+
+        * platform/KURL.cpp:
+        (WebCore::KURL::parse):
+
+2009-10-31  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Fix layering violations in GraphicsContext3D
+        https://bugs.webkit.org/show_bug.cgi?id=30986
+
+        Remove uses of HTMLImageElement and HTMLCanvasElement
+
+        * html/canvas/CanvasRenderingContext3D.cpp:
+        (WebCore::CanvasRenderingContext3D::texImage2D):
+        (WebCore::CanvasRenderingContext3D::texSubImage2D):
+        * platform/graphics/GraphicsContext3D.h:
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::GraphicsContext3D::texImage2D):
+        (WebCore::GraphicsContext3D::texSubImage2D):
+
+2009-11-01  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30964
+        [Gtk] Implemment AtkDocument
+
+        Provides access to expected document attributes.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (documentAttributeValue):
+        (webkit_accessible_document_get_document_attribute_value):
+        (webkit_accessible_document_get_document_attributes):
+
+2009-11-03  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Jan Alonzo.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30964
+        [Gtk] Implemment AtkDocument
+
+        Implements what has been implemented in AT-SPI.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (GetAtkInterfaceTypeFromWAIType):
+        (getInterfaceMaskFromObject):
+        (atk_document_interface_init):
+        (webkit_accessible_document_get_document_attribute_value):
+        (webkit_accessible_document_get_document_attributes):
+        (webkit_accessible_document_get_locale):
+
+2009-11-01  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Eric Seidel.
+
+        Turn on warnings for QtWebKit for gcc
+        https://bugs.webkit.org/show_bug.cgi?id=30958
+
+        No new tests as there is no functional change.
+
+        * platform/image-decoders/qt/RGBA32BufferQt.cpp:
+        (WebCore::RGBA32Buffer::RGBA32Buffer): Reorder 
+        initialization list to fix compiler warnings.
+
+
+2009-11-01  Keishi Hattori  <casey.hattori@gmail.com>
+
+        Reviewed by Pavel Feldman.
+
+        [Regression] monitorEvent doesn't work
+
+        * inspector/front-end/InjectedScript.js:
+        (InjectedScript._ensureCommandLineAPIInstalled):
+
+2009-11-01  Keishi Hattori  <casey.hattori@gmail.com>
+
+        Reviewed by Pavel Feldman.
+
+        Fix Web Inspector: Bug with Message Bubble in Syntax Highlighter
+        https://bugs.webkit.org/show_bug.cgi?id=30990
+
+        * inspector/front-end/SourceFrame.js:
+
+2009-10-31  Alexey Proskuryakov  <ap@apple.com>
+
+        Reviewed by John Sullivan.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30982
+        createHTMLDocument doesn't escape ampersand and less-than in title
+
+        Test: fast/dom/DOMImplementation/createHTMLDocument-title.html
+
+        * dom/DOMImplementation.cpp: (WebCore::DOMImplementation::createHTMLDocument):
+        Set document title after creating the document, avoiding parser intricacies.
+
+2009-11-01  Keishi Hattori  <casey.hattori@gmail.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Double clicking on a breakpoints should not select text
+        https://bugs.webkit.org/show_bug.cgi?id=30950
+
+        * inspector/front-end/SourceFrame.js:
+        (WebInspector.SourceFrame.prototype._documentMouseDown):
+
+2009-11-01  Yuta Kitamura  <yutak@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Fix assertion falure in RenderObjectChildList::updateBeforeAfterContent().
+
+        [Crash (debug)] Combination of list-item and :after causes assertion failure
+        https://bugs.webkit.org/show_bug.cgi?id=30944
+
+        Test: fast/css/list-item-pseudo-nocrash.html
+
+        * rendering/RenderObjectChildList.cpp:
+        (WebCore::RenderObjectChildList::updateBeforeAfterContent):
+
+2009-11-01  Philippe Normand  <pnormand@igalia.com>
+
+        Reviewed by Eric Seidel.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30586
+        [GTK] Failing test media/video-src-empty.html
+
+        Correctly set network/ready state depending on GStreamer errors
+        received on the bus.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::mediaPlayerPrivateMessageCallback):
+
+2009-10-31  Oliver Hunt  <oliver@apple.com>
+
+        Build fix
+
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::GraphicsContext3D::attachShader):
+
+2009-10-31  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Remove obsolete null checks from CanvasRenderingContext3DMac
+        https://bugs.webkit.org/show_bug.cgi?id=30983
+
+        * platform/graphics/mac/GraphicsContext3DMac.cpp:
+        (WebCore::GraphicsContext3D::attachShader):
+        (WebCore::GraphicsContext3D::bindAttribLocation):
+        (WebCore::GraphicsContext3D::compileShader):
+        (WebCore::GraphicsContext3D::detachShader):
+        (WebCore::GraphicsContext3D::framebufferRenderbuffer):
+        (WebCore::GraphicsContext3D::framebufferTexture2D):
+        (WebCore::GraphicsContext3D::linkProgram):
+        (WebCore::GraphicsContext3D::shaderSource):
+        (WebCore::GraphicsContext3D::useProgram):
+        (WebCore::GraphicsContext3D::validateProgram):
+        (WebCore::GraphicsContext3D::getProgramInfoLog):
+        (WebCore::GraphicsContext3D::getShaderi):
+        (WebCore::GraphicsContext3D::getShaderiv):
+        (WebCore::GraphicsContext3D::getShaderInfoLog):
+        (WebCore::GraphicsContext3D::getShaderSource):
+        (WebCore::GraphicsContext3D::getUniformLocation):
+
+2009-10-31  Oliver Hunt  <oliver@apple.com>
+
+        Reviewed by Jon Honeycutt.
+
+        WebGL allows objects to be used with the wrong context
+        https://bugs.webkit.org/show_bug.cgi?id=30981
+
+        Simply add null checks and a few context guards to ensure we don't
+        deref null or attempt to use an object from a different context.
+
+        Tests: fast/canvas/webgl/incorrect-context-object-behaviour.html
+               fast/canvas/webgl/null-object-behaviour.html
+
+        * html/canvas/CanvasRenderingContext3D.cpp:
+        (WebCore::CanvasRenderingContext3D::attachShader):
+        (WebCore::CanvasRenderingContext3D::bindAttribLocation):
+        (WebCore::CanvasRenderingContext3D::bindBuffer):
+        (WebCore::CanvasRenderingContext3D::bindFramebuffer):
+        (WebCore::CanvasRenderingContext3D::bindRenderbuffer):
+        (WebCore::CanvasRenderingContext3D::bindTexture):
+        (WebCore::CanvasRenderingContext3D::compileShader):
+        (WebCore::CanvasRenderingContext3D::detachShader):
+        (WebCore::CanvasRenderingContext3D::framebufferRenderbuffer):
+        (WebCore::CanvasRenderingContext3D::framebufferTexture2D):
+        (WebCore::CanvasRenderingContext3D::getProgrami):
+        (WebCore::CanvasRenderingContext3D::getProgramiv):
+        (WebCore::CanvasRenderingContext3D::getProgramInfoLog):
+        (WebCore::CanvasRenderingContext3D::getShaderi):
+        (WebCore::CanvasRenderingContext3D::getShaderiv):
+        (WebCore::CanvasRenderingContext3D::getShaderInfoLog):
+        (WebCore::CanvasRenderingContext3D::getShaderSource):
+        (WebCore::CanvasRenderingContext3D::getUniformf):
+        (WebCore::CanvasRenderingContext3D::getUniformfv):
+        (WebCore::CanvasRenderingContext3D::getUniformi):
+        (WebCore::CanvasRenderingContext3D::getUniformiv):
+        (WebCore::CanvasRenderingContext3D::getUniformLocation):
+        (WebCore::CanvasRenderingContext3D::isBuffer):
+        (WebCore::CanvasRenderingContext3D::linkProgram):
+        (WebCore::CanvasRenderingContext3D::shaderSource):
+        * html/canvas/CanvasRenderingContext3D.h:
+        * html/canvas/CanvasRenderingContext3D.idl:
+
+2009-10-30  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's MediaQueryResult
+        https://bugs.webkit.org/show_bug.cgi?id=30857
+
+        Inherits MediaQueryResult class from Noncopyable because it is
+        instantiated by 'new' in WebCore/css/CSSStyleSelector.cpp:5984 and
+        it is no need to be copyable.
+
+        * css/CSSStyleSelector.h:
+
+2009-10-30  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's MediaQueryEvaluator
+        https://bugs.webkit.org/show_bug.cgi?id=30854
+
+        Inherits MediaQueryEvaluator class from Noncopyable because it is
+        instantiated by 'new' in WebCore/css/CSSStyleSelector.cpp:401 and   
+        it is no need to be copyable.
+
+        * css/MediaQueryEvaluator.h:
+
+2009-10-30  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's CSSRuleSet
+        https://bugs.webkit.org/show_bug.cgi?id=30852
+
+        Inherits CSSRuleSet class from Noncopyable because it is
+        instantiated by 'new' in WebCore/css/CSSStyleSelector.cpp:455 and
+        it is no need to be copyable.
+
+        * css/CSSStyleSelector.cpp:
+
+2009-10-30  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's CSSRuleData
+        https://bugs.webkit.org/show_bug.cgi?id=30851
+
+        Inherits CSSRuleData class from Noncopyable because it is
+        instantiated by 'new' in WebCore/css/CSSStyleSelector.h:320 and
+        it is no need to be copyable.
+
+        * css/CSSStyleSelector.h:
+
+2009-10-30  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's CSSRuleDataList
+        https://bugs.webkit.org/show_bug.cgi?id=30850
+
+        Inherits CSSRuleDataList class from Noncopyable because it has been
+        instantiated by 'new' in WebCore/css/CSSStyleSelector.cpp:2715 and
+        it is no need to be copyable.
+
+        * css/CSSStyleSelector.h:
+
+2009-10-30  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's CSSNamespace
+        https://bugs.webkit.org/show_bug.cgi?id=30849
+
+        Inherits CSSNamespace struct from Noncopyable because it is
+        instantiated by 'new' in WebCore/css/CSSStyleSheet.cpp:141 and
+        it is no need to be copyable.
+
+        * css/CSSNamespace.h:
+
+2009-10-30  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by David Levin.
+
+        Refactor DatabaseTask in preparation for removing threadsafe refcounting from it.
+        Move the synchronizer object out of the DatabaseTask so there is no need to keep
+        the pointer to Databasetask around after passing it to MessageQueue.
+        Also pass the references to return parameters to the task so it can update them.
+        https://bugs.webkit.org/show_bug.cgi?id=30941
+
+        No new tests, since this is just moving the code around, no change in functionality.
+
+        * storage/Database.cpp:
+        (WebCore::Database::Database):
+        (WebCore::Database::openAndVerifyVersion): Use new DatabaseTaskSynchronizer to wait for task completion.
+        (WebCore::Database::markAsDeletedAndClose): Ditto.
+        (WebCore::Database::tableNames): Ditto.
+        (WebCore::Database::stop): Use the boolean flag rather then 'killed' flag built into MessageQueue.
+        (WebCore::Database::scheduleTransaction): Transaction queue is a Deque now, change the way to fetch the transaction.
+        * storage/Database.h: Change the SQLTransaction queue to be a Deque rather then a MessageQueue.
+        * storage/DatabaseTask.cpp:
+        (WebCore::DatabaseTaskSynchronizer::DatabaseTaskSynchronizer):
+        (WebCore::DatabaseTaskSynchronizer::waitForTaskCompletion):
+        (WebCore::DatabaseTaskSynchronizer::taskCompleted):
+        (WebCore::DatabaseTask::DatabaseTask): Ctor takes DatabaseTaskSynchronizer which can be 0.
+        (WebCore::DatabaseTask::performTask): Signal completion. m_synchronizer should still be around since main thread is waiting on it.
+        (WebCore::DatabaseOpenTask::DatabaseOpenTask): Pass synchronizer and return parameters via constructor.
+        (WebCore::DatabaseCloseTask::DatabaseCloseTask): Ditto.
+        (WebCore::DatabaseTransactionTask::DatabaseTransactionTask): Ditto.
+        (WebCore::DatabaseTableNamesTask::DatabaseTableNamesTask): Ditto.
+        * storage/DatabaseTask.h:
+        (WebCore::DatabaseOpenTask::create):
+        (WebCore::DatabaseCloseTask::create):
+        (WebCore::DatabaseTransactionTask::create):
+        (WebCore::DatabaseTableNamesTask::create):
+
+2009-10-30  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by Darin Adler.
+
+        REGRESSION: In Mail, Undo does not restore some characters I have deleted at the end of a line
+        https://bugs.webkit.org/show_bug.cgi?id=30955
+        <rdar://problem/7067033>
+        
+        When the command is deleteWordBackward or deleteWordForward
+        we should not add to the open typing command, but
+        create a new one.
+        
+        Test: editing/undo/undo-deleteWord.html
+
+        * editing/TypingCommand.cpp:
+        (WebCore::TypingCommand::deleteKeyPressed): Always start a new command if the granularity is
+        not CharacterGranularity. 
+        (WebCore::TypingCommand::forwardDeleteKeyPressed): Always start a new command if the granularity is
+        not CharacterGranularity. 
+
+2009-10-30  Eric Carlson  <eric.carlson@apple.com>
+
+        Reviewed by Darin Adler.
+
+        Make MediaPlayer constructor private
+        https://bugs.webkit.org/show_bug.cgi?id=30965
+
+        * html/HTMLMediaElement.cpp:
+        (WebCore::HTMLMediaElement::loadResource): 
+        (WebCore::HTMLMediaElement::finishParsingChildren): Use MediaPlayer::create.
+
+        * platform/graphics/MediaPlayer.h:
+        (WebCore::MediaPlayer::create): New.
+
+2009-10-29  Jon Honeycutt  <jhoneycutt@apple.com>
+
+        MSAA: Accessibility of headings is not correct
+
+        https://bugs.webkit.org/show_bug.cgi?id=30937
+
+        Reviewed by Alice Liu.
+
+        * accessibility/AccessibilityObject.h:
+        (WebCore::AccessibilityObject::stringRoleForMSAA):
+        (WebCore::AccessibilityObject::descriptionForMSAA):
+
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::shouldReturnTagNameAsRoleForMSAA):
+        If the element's tag name is one of h1, h2, h3, h4, h5, h6, return
+        true.
+        (WebCore::AccessibilityRenderObject::stringRoleForMSAA):
+        If the element should return its tag name as the role, return the tag
+        name.
+        (WebCore::AccessibilityRenderObject::positionalDescriptionForMSAA):
+        If the object is a heading, return the string "L" followed by the
+        heading level.
+        (WebCore::AccessibilityRenderObject::descriptionForMSAA):
+        If the object has a positional description, return it. Otherwise, get
+        the accessibility description, and prefix it with "Description" so that
+        MSAA clients know that it's not a positional description.
+
+        * accessibility/AccessibilityRenderObject.h:
+
+2009-10-29  Jon Honeycutt  <jhoneycutt@apple.com>
+
+        MSAA: Accessibility of links is wrong
+
+        https://bugs.webkit.org/show_bug.cgi?id=30928
+
+        Reviewed by Darin Adler.
+
+        * accessibility/AccessibilityImageMapLink.cpp:
+        (WebCore::AccessibilityImageMapLink::stringValueForMSAA):
+        Return the URL.
+        (WebCore::AccessibilityImageMapLink::nameForMSAA):
+        Return the alt text.
+
+        * accessibility/AccessibilityImageMapLink.h:
+        (WebCore::AccessibilityImageMapLink::isLinked):
+        Return true.
+
+        * accessibility/AccessibilityObject.h:
+        (WebCore::AccessibilityObject::isLinked):
+        (WebCore::AccessibilityObject::stringValueForMSAA):
+        (WebCore::AccessibilityObject::nameForMSAA):
+
+        * accessibility/AccessibilityRenderObject.cpp:
+        (WebCore::isLinkable):
+        Return true if the element is considered "linkable" with respect to
+        accessibility.
+        (WebCore::AccessibilityRenderObject::stringValueForMSAA):
+        If the element is linkable, check whether it has a parent anchor
+        element. If so, return the anchor element's href.
+        (WebCore::AccessibilityRenderObject::isLinked):
+        Return true if the element is linkable and if it's parent anchor tag's
+        href is non-empty.
+        (WebCore::AccessibilityRenderObject::nameForMSAA):
+        For text nodes, return the text.
+
+        * accessibility/AccessibilityRenderObject.h:
+
+2009-10-30  Evan Stade  <estade@chromium.org>
+
+        Reviewed by David Levin.
+
+        Notify the chrome when the focused node has changed.
+        https://bugs.webkit.org/show_bug.cgi?id=30832
+
+        This is similar to AX code that is already in place, except that this also informs the
+        chrome when there stops being a focused node. This is needed for a browser to show the
+        anchor for links that have keyboard focus.
+
+        * dom/Document.cpp:
+        (WebCore::Document::setFocusedNode):
+        * loader/EmptyClients.h:
+        (WebCore::EmptyChromeClient::focusedNodeChanged):
+        * page/Chrome.cpp:
+        (WebCore::Chrome::focusedNodeChanged):
+        * page/Chrome.h:
+        * page/ChromeClient.h:
+
+2009-10-30  Ben Murdoch  <benm@google.com>
+
+        Reviewed by David Kilzer.
+
+        openDatabase() with empty version sets db version up incorrectly
+        https://bugs.webkit.org/show_bug.cgi?id=28417
+
+        Test: storage/open-database-set-empty-version.html
+
+        * storage/Database.cpp:
+        (WebCore::Database::performOpenAndVerify): Raise an exception if the current database version does not match the expected version when the current version is the empty string.
+
+2009-10-30  John Gregg  <johnnyg@google.com>
+
+        Reviewed by David Levin.
+
+        Need to turn off notifications properly at runtime
+        https://bugs.webkit.org/show_bug.cgi?id=30409
+
+        Moving the notificationsEnabled bit from NotificationCenter
+        to the new V8 RuntimeEnabledFeatures object.
+
+        Just moving a bit around, so no new tests.
+
+        * bindings/v8/RuntimeEnabledFeatures.cpp:
+        * bindings/v8/RuntimeEnabledFeatures.h:
+        (WebCore::RuntimeEnabledFeatures::setNotificationsEnabled):
+        (WebCore::RuntimeEnabledFeatures::notificationsEnabled):
+        * bindings/v8/custom/V8DOMWindowCustom.cpp:
+        (WebCore::ACCESSOR_RUNTIME_ENABLER):
+        * bindings/v8/custom/V8WorkerContextCustom.cpp:
+        (WebCore::ACCESSOR_RUNTIME_ENABLER):
+        * notifications/NotificationCenter.cpp:
+        * notifications/NotificationCenter.h:
+
+2009-10-30  Dmitry Titov  <dimich@chromium.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        [V8] More cleanup after r49949: remove ListenerGuard.
+        ListenerGuard is no longer needed since EventListeners do not depend on frame or v8 context.
+        https://bugs.webkit.org/show_bug.cgi?id=30943
+
+        Covered by fast/events/add-event-without-document.html which will now pass in Chromium.
+
+        * bindings/v8/V8AbstractEventListener.cpp:
+        (WebCore::V8AbstractEventListener::V8AbstractEventListener):
+        (WebCore::V8AbstractEventListener::handleEvent):
+        * bindings/v8/V8AbstractEventListener.h:
+        * bindings/v8/V8DOMWrapper.cpp:
+        (WebCore::V8DOMWrapper::getEventListener):
+        * bindings/v8/V8EventListenerList.h:
+        (WebCore::V8EventListenerList::findOrCreateWrapper):
+        * bindings/v8/V8LazyEventListener.cpp:
+        (WebCore::V8LazyEventListener::V8LazyEventListener):
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::V8Proxy):
+        (WebCore::V8Proxy::disconnectFrame):
+        (WebCore::V8Proxy::clearForNavigation):
+        * bindings/v8/V8Proxy.h:
+        * bindings/v8/V8WorkerContextEventListener.cpp:
+        (WebCore::V8WorkerContextEventListener::V8WorkerContextEventListener):
+        (WebCore::V8WorkerContextEventListener::handleEvent):
+        (WebCore::V8WorkerContextEventListener::reportError):
+        * bindings/v8/V8WorkerContextEventListener.h:
+        (WebCore::V8WorkerContextEventListener::create):
+        * bindings/v8/WorkerContextExecutionProxy.cpp:
+        (WebCore::WorkerContextExecutionProxy::WorkerContextExecutionProxy):
+        (WebCore::WorkerContextExecutionProxy::dispose):
+        (WebCore::WorkerContextExecutionProxy::findOrCreateEventListener):
+        * bindings/v8/WorkerContextExecutionProxy.h:
+        * bindings/v8/custom/V8CustomEventListener.cpp:
+        (WebCore::V8EventListener::V8EventListener):
+        * bindings/v8/custom/V8CustomEventListener.h:
+        (WebCore::V8EventListener::create):
+
+2009-10-30  Shinichiro Hamaji  <hamaji@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        counterValueForElementById should return space-separated string for multiple counters
+        https://bugs.webkit.org/show_bug.cgi?id=30939
+
+        Test: fast/css/counters/counterValueForElementById.html
+
+        * rendering/RenderTreeAsText.cpp:
+        (WebCore::writeCounterValuesFromChildren):
+        (WebCore::counterValueForElement):
+
+2009-10-30  Sebastian Dröge  <sebastian.droege@collabora.co.uk>
+
+        Reviewed by Gustavo Noronha.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::MediaPlayerPrivate::paint):
+        Add some comments to explain what is happening here.
+
+2009-10-30  Alexander Pavlov  <apavlov@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Fix Web Inspector crash on the errors/warnings counter click
+
+        RenderObject::createVisiblePosition(const Position& position)
+        understands "null Positions", so we can construct such a Position manually.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30499
+
+        * rendering/RenderBox.cpp:
+        (WebCore::RenderBox::positionForPoint):
+
+2009-10-30  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Xan Lopez.
+
+        https://bugs.webkit.org/show_bug.cgi?id=25534
+        [GTK] Objects of ROLE_TABLE should implement the accessible table interface
+
+        Third part of the implementation of AtkTable.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (nameFromChildren):
+        (webkit_accessible_get_name):
+        New convenience function to construct an object's name using the name(s) of
+        any children it has.
+
+        (atk_table_interface_init):
+        (webkit_accessible_table_get_column_description):
+        (webkit_accessible_table_get_row_description):
+        Implemented.
+
+        (webkit_accessible_table_get_column_header):
+        Stub function added so that webkit_accessible_table_get_column_description
+        could be implemented in the meantime.
+
+2009-10-30  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Xan Lopez.
+
+        https://bugs.webkit.org/show_bug.cgi?id=25534
+        [GTK] Objects of ROLE_TABLE should implement the accessible table interface
+
+        Second part of the implementation of AtkTable.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (cellAtIndex):
+        (webkit_accessible_table_get_column_at_index):
+        (webkit_accessible_table_get_row_at_index):
+        (webkit_accessible_table_get_caption):
+        (atk_table_interface_init):
+
+2009-10-30  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Add TimelinePanel into the panels enum.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30915
+
+        * inspector/InspectorFrontend.cpp:
+        (WebCore::InspectorFrontend::showPanel):
+        * inspector/front-end/inspector.js:
+        (WebInspector.showTimelinePanel):
+
+2009-10-30  Kenneth Rohde Christiansen  <kenneth@webkit.org>
+
+        Reviewed by Holger Hans Peter Freyther.
+
+        If the owner widget of the page has a palette set, we
+        should use that one. This was only working when the
+        owner was a QWebView. This patch fixes that.
+
+        * platform/qt/RenderThemeQt.cpp:
+        (WebCore::RenderThemeQt::applyTheme):
+
+2009-10-30  Pavel Feldman  <pfeldman@chromium.org>
+
+        Not reviewed: Wire CookieJarChromium to the cookies
+        backend. This is a final step of a 3-steps raw cookies
+        access implementation in Chromium.
+
+        * platform/network/chromium/CookieJarChromium.cpp:
+        (WebCore::getRawCookies):
+        (WebCore::deleteCookie):
+
+2009-10-30  Yury Semikhatsky  <yurys@chromium.org>
+
+        Reviewed by Pavel Feldman.
+
+        Fix Chromium crash in console.log in "deeply recursive" function 
+
+        Check that result of 'frameSourceName' is not null handle
+        before casting it to String. 
+      
+        Allow V8Proxy::sourceName/sourceLineNumber() to report
+        that they have failed due to JavaScript stack overflow.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30904
+
+        * bindings/scripts/CodeGeneratorV8.pm:
+        * bindings/v8/ScriptCallStack.cpp:
+        (WebCore::ScriptCallStack::create):
+        (WebCore::ScriptCallStack::ScriptCallStack):
+        * bindings/v8/ScriptCallStack.h:
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::sourceLineNumber):
+        (WebCore::V8Proxy::sourceName):
+        * bindings/v8/V8Proxy.h:
+        * bindings/v8/custom/V8WorkerContextCustom.cpp:
+        (WebCore::CALLBACK_FUNC_DECL):
+
+2009-10-30  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's MediaQuery
+        https://bugs.webkit.org/show_bug.cgi?id=30856
+
+        Inherits MediaQuery class from Noncopyable because it is
+        instantiated by 'new' in WebCore/css/CSSParser.cpp:4905 and
+        it is no need to be copyable.
+
+        * css/CSSStyleSelector.h:
+
+2009-10-30  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's MediaQueryExp
+        https://bugs.webkit.org/show_bug.cgi?id=30855
+
+        Inherits MediaQueryExp class from FastAllocBase because it is
+        instantiated by 'new' in WebCore/css/CSSParser.cpp:4874.
+
+        * css/MediaQueryExp.h:
+
+2009-10-30  Roland Steiner  <rolandsteiner@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Remove ENABLE_RUBY guards as discussed with Dave Hyatt and Maciej Stachowiak.
+
+        Bug 28420 -  Implement HTML5 <ruby> rendering
+        (https://bugs.webkit.org/show_bug.cgi?id=28420)
+
+        No new tests (no functional change).
+
+        * Configurations/FeatureDefines.xcconfig:
+        * DerivedSources.make:
+        * GNUmakefile.am:
+        * WebCore.pro:
+        * WebCore.vcproj/WebCoreCommon.vsprops:
+        * WebCore.vcproj/build-generated-files.sh:
+
+2009-10-30  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Adele Peterson.
+
+        Removed test for an impossible condition (a glyph in a right-to-left run not having
+        the RTL flag 0x800)
+
+        * platform/graphics/mac/ComplexTextControllerATSUI.cpp:
+        (WebCore::ComplexTextController::ComplexTextRun::overrideLayoutOperation):
+
+2009-10-29  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        [V8] Out-of-memory crash in isolated worlds
+        https://bugs.webkit.org/show_bug.cgi?id=30906
+
+        We need to handle the fact that creating a V8:Context might fail.  I
+        don't know how to test this change because creating a context usually
+        only fails when V8 decides it's using too much memory.
+
+        * bindings/v8/V8IsolatedWorld.cpp:
+        (WebCore::V8IsolatedWorld::V8IsolatedWorld):
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::evaluateInIsolatedWorld):
+        (WebCore::V8Proxy::evaluateInNewContext):
+
+2009-10-29  Erik Arvidsson  <arv@chromium.org>
+
+        Reviewed by Eric Seidel.
+
+        Make links mouse focusable only on GTK and QT.
+
+        Links are now always mouse focusable on GTK and QT. On other platforms
+        the link needs a tabIndex or it needs to be contentEditable.
+
+        https://bugs.webkit.org/show_bug.cgi?id=26856
+
+        * html/HTMLAnchorElement.cpp:
+        (WebCore::HTMLAnchorElement::isMouseFocusable):
+
+2009-10-29  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        Complete the fix for hit-testing and selection highlighting in ligatures for the ATSUI
+        code path.
+
+        * platform/graphics/mac/ComplexTextController.h: Added m_ltr member to ComplexTextRun.
+        * platform/graphics/mac/ComplexTextControllerATSUI.cpp:
+        (WebCore::ComplexTextController::ComplexTextRun::overrideLayoutOperation): Skip over deleted
+        glyphs, but update indexes and advances correctly.
+        (WebCore::ComplexTextController::ComplexTextRun::ComplexTextRun): Initialize m_ltr.
+
+2009-10-29  Enrica Casucci  <enrica@apple.com>
+
+        Reviewed by Darin Adler.
+
+        REGRESSION(3.2.3 - 4.0.2): Message composing: when I undo a color change to text in Mail, undo/redo behaves strangely
+        <rdar://problem/7115041>
+        https://bugs.webkit.org/show_bug.cgi?id=30892
+
+        This problem shows in any scenario where it is necessary to split a text
+        node to apply a style. SplitElementCommand and WrapContentsInDummySpanCommand both
+        have member variables initialized in the constructor to keep reference to elements
+        they need to operate upon. These reference are not updated when reapplying the command.
+        For this reason it is necessary to guarantee that unapply doesn not delete the references
+        and that these commands implement doReapply to correctly reuse the existing
+        elements.
+
+        Test: editing/undo/redo-style.html
+
+        * editing/SplitElementCommand.cpp:
+        (WebCore::SplitElementCommand::executeApply): Added.
+        (WebCore::SplitElementCommand::doApply): Modified to call executeApply. 
+        (WebCore::SplitElementCommand::doUnapply): Doesn't release m_element1.
+        (WebCore::SplitElementCommand::doReapply): Added.
+        * editing/SplitElementCommand.h: Added doReapply and executeApply.
+        * editing/WrapContentsInDummySpanCommand.cpp:
+        (WebCore::WrapContentsInDummySpanCommand::executeApply): Added.
+        (WebCore::WrapContentsInDummySpanCommand::doApply): Modified to call executeApply.
+        (WebCore::WrapContentsInDummySpanCommand::doUnapply): Doesn't release m_dummySpan.
+        (WebCore::WrapContentsInDummySpanCommand::doReapply): Added.
+        * editing/WrapContentsInDummySpanCommand.h: Added doReapply and executeApply.
+
+2009-10-29  Jeremy Orlow  <jorlow@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        DOM Storage's condition variable needs to handle spurious wakeups
+        https://bugs.webkit.org/show_bug.cgi?id=30920
+
+        Add a boolean to keep track of whether it's been terminated.  Clean
+        up the locking code a tiny bit to make it easier to read.  There's
+        no way to reproduce this reliably in a LayoutTest.
+
+        * storage/LocalStorageThread.cpp:
+        (WebCore::LocalStorageThread::LocalStorageThread):
+        (WebCore::LocalStorageThread::terminate):
+        (WebCore::LocalStorageThread::performTerminate):
+        * storage/LocalStorageThread.h:
+
+2009-10-29  Dimitri Glazkov  <dglazkov@chromium.org>
+
+        Unreviewed, build fix.
+
+        [Chromium] Include ComplextTextController into Chromium Mac project.
+
+        * WebCore.gyp/WebCore.gyp: Added include rule for ComplextText* files.
+
+2009-10-29  Timothy Hatcher  <timothy@apple.com>
+
+        Fix tabbing through element attributes in the Web Insector.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30429
+
+        Reviewed by Pavel Feldman.
+
+        * inspector/front-end/ElementsTreeOutline.js:
+        (WebInspector.ElementsTreeElement.prototype._attributeEditingCommitted): Don't call _updateTitle,
+        it is called for us when removeAttribute succeeds in the back-end.
+        (WebInspector.ElementsTreeElement.prototype._textNodeEditingCommitted): Ditto except for nodeValue.
+        (WebInspector.ElementsTreeElement.prototype._editingCancelled): Don't call _updateTitle, editing code reverts.
+        (WebInspector.ElementsTreeElement.prototype._updateTitle): Return early if we are editing.
+
+2009-10-29  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        Problem editing or selecting text containing ligatures
+        https://bugs.webkit.org/show_bug.cgi?id=30025
+
+        Test: platform/mac/fast/text/ligature-subdivision.html
+
+        * platform/graphics/mac/ComplexTextController.cpp:
+        (WebCore::ComplexTextController::ComplexTextController): Initialize
+        m_characterInCurrentGlyph.
+        (WebCore::ComplexTextController::offsetForPosition): If the hit glyph spans multiple
+        characters, compute the hit character based on dividing the glyph’s total advance into
+        a number of equal intervals equal to the number of characters and assigning the hit to the
+        character corresponding to the hit interval.
+        (WebCore::ComplexTextController::advance): If the final offset occurs mid-glyph, advance
+        by a fraction of the glyph’s total advance.
+        * platform/graphics/mac/ComplexTextController.h: Added m_characterInCurrentGlyph.
+
+2009-10-29  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Fixes <http://webkit.org/b/30918>.
+        Web Inspector: Datagrid Rows on Windows not properly aligned.
+        
+        Use line-height for the table rows to make sure the height
+        of our text and the height of the table rows are consistent.
+
+        * inspector/front-end/inspector.css:
+
+2009-10-29  Adam Barth  <abarth@webkit.org>
+
+        No review, rolling out r50296.
+        http://trac.webkit.org/changeset/50296
+
+        * bindings/v8/V8IsolatedWorld.cpp:
+        (WebCore::V8IsolatedWorld::V8IsolatedWorld):
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::evaluateInIsolatedWorld):
+        (WebCore::V8Proxy::evaluateInNewContext):
+
+2009-10-29  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Dimitri Glazkov.
+
+        [V8] Out-of-memory crash in isolated worlds
+        https://bugs.webkit.org/show_bug.cgi?id=30906
+
+        We need to handle the fact that creating a V8:Context might fail.  I
+        don't know how to test this change because creating a context usually
+        only fails when V8 decides it's using too much memory.
+
+        * bindings/v8/V8IsolatedWorld.cpp:
+        (WebCore::V8IsolatedWorld::V8IsolatedWorld):
+        * bindings/v8/V8Proxy.cpp:
+        (WebCore::V8Proxy::evaluateInIsolatedWorld):
+        (WebCore::V8Proxy::evaluateInNewContext):
+
+2009-10-29  Gustavo Noronha Silva  <gustavo.noronha@collabora.co.uk>
+
+        Reviewed by Xan Lopez.
+
+        Remove build warning introduced by r50284.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::MediaPlayerPrivate::duration):
+
+2009-10-29  Dimitri Glazkov  <dglazkov@chromium.org>
+
+        Reviewed by Adam Barth.
+
+        [V8] Remove random crashes by removing retrieval of V8 context during garbage collection.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30919
+
+        Unfortunately, I haven't been able to trigger this crash explicitly, so no test :(.
+
+        * bindings/v8/V8DOMWrapper.cpp:
+        (WebCore::V8DOMWrapper::jsWrapperForDOMObject): Added new "assume-it's-there" getter.
+        * bindings/v8/V8DOMWrapper.h: Added getter decl.
+        * bindings/v8/V8GCController.cpp:
+        (WebCore::GCPrologueVisitor::visitDOMWrapper): Changed to use explicit getter.
+
+2009-10-29  Dimitri Glazkov  <dglazkov@chromium.org>
+
+        Unreviewed, build fix.
+
+        [Chromium] Adjust the project files to sync up with
+        http://trac.webkit.org/changeset/50259
+
+        * WebCore.gypi: Renamed and added files.
+
+2009-10-29  Laszlo Gombos  <laszlo.1.gombos@nokia.com>
+
+        Reviewed by Tor Arne Vestbø.
+
+        [Qt] Implement DELETE HTTP method for XmlHttpRequest
+        https://bugs.webkit.org/show_bug.cgi?id=30894
+
+        No new tests as this functionality is already tested by the 
+        xmlhttprequest LayoutTests. As this patch depends on an unreleased
+        version of the dependent QtNetwork library and the tests will be
+        enabled later once the dependent library is released (and the
+        buildbot is updated).
+
+        * platform/network/qt/QNetworkReplyHandler.cpp:
+        (WebCore::QNetworkReplyHandler::QNetworkReplyHandler):
+        (WebCore::QNetworkReplyHandler::start):
+
+2009-10-29  Brian Weinstein  <bweinstein@apple.com>
+
+        Reviewed by Timothy Hatcher.
+
+        Part of <http://webkit.org/b/30483>.
+        Web Inspector: Always show the Local and Session Storage Views.
+        
+        Even if the length of the DOM Storage entry array is 0, still
+        generate the Datagrid because users can add things storage items
+        through the UI, so we should allow them to even if there isn't
+        anything there currently.
+
+        * English.lproj/localizedStrings.js: Removed "This Storage is Empty".
+        * inspector/front-end/DOMStorageItemsView.js:
+        (WebInspector.DOMStorageItemsView.prototype._showDOMStorageEntries):
+
+2009-10-29  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: Add TimelinePanel into the panels enum.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30915
+
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::specialPanelForJSName):
+        * inspector/InspectorController.h:
+        (WebCore::InspectorController::):
+
+2009-10-29  Xan Lopez  <xlopez@igalia.com>
+
+        Reviewed by Oliver Hunt.
+
+        [GTK] Threading problems with some of the tests
+        https://bugs.webkit.org/show_bug.cgi?id=30814
+
+        Create strings shared among threads with crossThreadString
+        constructor method.
+
+        * storage/Database.cpp:
+        (WebCore::Database::Database):
+
+2009-10-29  Sebastian Dröge  <sebastian.droege@collabora.co.uk>
+
+        Reviewed by Gustavo Noronha.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30308
+        
+        Add support for ARGB videos.
+
+        * platform/graphics/gtk/MediaPlayerPrivateGStreamer.cpp:
+        (WebCore::MediaPlayerPrivate::paint):
+        Create the Cairo image surface for ARGB32 or RGB24
+        depending on the buffer's caps.
+        
+        * platform/graphics/gtk/VideoSinkGStreamer.cpp:
+        (webkit_video_sink_timeout_func):
+        (webkit_video_sink_render):
+        Handle ARGB video and convert GStreamer's ARGB to
+        Cairo's for displaying.
+
+2009-10-29  Anton Muhin  <antonm@chromium.org>
+
+        Reviewed by David Levin.
+
+        [chromium] expose a method to access memory usage information in ChromiumBridge
+        Declare a static method to be implemented by http://codereview.chromium.org/332010/
+        https://bugs.webkit.org/show_bug.cgi?id=30829
+
+        * platform/chromium/ChromiumBridge.h:
+
+2009-10-29  Joanmarie Diggs  <joanmarie.diggs@gmail.com>
+
+        Reviewed by Xan Lopez.
+
+        https://bugs.webkit.org/show_bug.cgi?id=25679
+        [Gtk] Improve accessibility of focusable lists
+
+        Implements the AtkSelection interface and enables the corresponding
+        (and expected) object:selection-changed event.
+
+        * accessibility/gtk/AccessibilityObjectWrapperAtk.cpp:
+        (optionFromList):
+        (optionFromSelection):
+        (atk_selection_interface_init):
+        (webkit_accessible_selection_add_selection):
+        (webkit_accessible_selection_clear_selection):
+        (webkit_accessible_selection_ref_selection):
+        (webkit_accessible_selection_get_selection_count):
+        (webkit_accessible_selection_is_child_selected):
+        (webkit_accessible_selection_remove_selection):
+        (webkit_accessible_selection_select_all_selection):
+        (GetAtkInterfaceTypeFromWAIType):
+        * accessibility/gtk/AXObjectCacheAtk.cpp:
+        (AXObjectCache::postPlatformNotification):
+
+2009-10-29  Jian Li  <jianli@chromium.org>
+
+        Reviewed by Darin Adler.
+
+        Bug 30655 - Only plain text should be copied to clipboard for TextArea.
+        https://bugs.webkit.org/show_bug.cgi?id=30655
+
+        * editing/Editor.cpp:
+        (WebCore::nodeIsInTextFormControl):
+        (WebCore::Editor::cut):
+        (WebCore::Editor::copy):
+
+2009-10-29  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: hide timeline for now - not yet ready.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30912
+
+        * inspector/front-end/inspector.js:
+        (WebInspector._createPanels):
+
+2009-10-29  Pavel Feldman  <pfeldman@chromium.org>
+
+        Not reviewed: deploy Web Inspector's images in WebCore.gypi.
+
+        * WebCore.gypi:
+
+2009-10-29  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Timothy Hatcher.
+
+        Web Inspector: get rid of timelineProfilerEnabled method.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30911
+
+        * inspector/InspectorBackend.cpp:
+        * inspector/InspectorBackend.h:
+        * inspector/InspectorBackend.idl:
+        * inspector/InspectorController.cpp:
+        (WebCore::InspectorController::setWindowVisible):
+        * inspector/InspectorController.h:
+        * inspector/front-end/TimelinePanel.js:
+        (WebInspector.TimelinePanel.prototype._toggleTimelineButtonClicked):
+
+2009-10-29  Pavel Feldman  <pfeldman@chromium.org>
+
+        Reviewed by Darin Fisher.
+
+        Create stub methods for raw cookies access in ChromiumBridge.h
+
+        https://bugs.webkit.org/show_bug.cgi?id=30910
+
+        * platform/chromium/ChromiumBridge.h:
+
+2009-10-29  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's RareData
+        https://bugs.webkit.org/show_bug.cgi?id=30858
+
+        Inherits RareData struct from Noncopyable because it is
+        instantiated by 'new' in WebCore/css/CSSSelector.h:259 and 
+        it is no need to be copyable.
+
+        * css/CSSSelector.h:
+
+2009-10-29  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's ShorthandScope
+        https://bugs.webkit.org/show_bug.cgi?id=30859
+
+        Inherits ShorthandScope class from FastAllocBase because it is 
+        instantiated by 'new' in WebCore/css/CSSParser.cpp:902 and 
+        it is no need to be copyable.        
+
+        * css/CSSParser.h:
+
+2009-10-29  Zoltan Horvath  <zoltan@webkit.org>
+
+        Reviewed by Darin Adler.
+
+        Allow custom memory allocation control for WebCore's AXObjectCache
+        https://bugs.webkit.org/show_bug.cgi?id=30848
+
+        Inherits AXObjectCache class from FastAllocBase because it is
+        instantiated by 'new' in WebCore/dom/Document.cpp:1537 and                                
+        it is no need to be copyable.
+
+        * accessibility/AXObjectCache.h:
+
+2009-10-28  Adam Barth  <abarth@webkit.org>
+
+        Reviewed by Eric Seidel.
+
+        Don't run JavaScript URLs in view source mode
+        https://bugs.webkit.org/show_bug.cgi?id=30881
+
+        Just say no.
+
+        Test: http/tests/security/view-source-no-javascript-url.html
+
+        * bindings/ScriptControllerBase.cpp:
+        (WebCore::ScriptController::executeIfJavaScriptURL):
+
+2009-10-29  Gustavo Noronha Silva  <gustavo.noronha@collabora.co.uk>
+
+        Unreviewed. Fixes style problems pointed out by Evan Martin.
+
+        * platform/gtk/Language.cpp:
+        (WebCore::defaultLanguage):
+
+2009-10-29  Dan Bernstein  <mitz@apple.com>
+
+        Rubber-stamped by Mark Rowe.
+
+        64-bit Leopard build fix after r50259
+        
+        * platform/graphics/mac/ComplexTextControllerATSUI.cpp:
+        Declared ATSUTextInserted in 64-bit.
+        (WebCore::fontHasMirroringInfo): Use %d format and cast to int.
+        (WebCore::disableLigatures): Ditto.
+        (WebCore::initializeATSUStyle): Ditto.
+        (WebCore::ComplexTextController::collectComplexTextRunsForCharacters): Ditto.
+
+2009-10-29  Dan Bernstein  <mitz@apple.com>
+
+        Tiger build fix after r50259
+
+        * platform/graphics/mac/ComplexTextController.h:
+        * platform/graphics/mac/ComplexTextControllerATSUI.cpp:
+
+2009-10-29  Dan Bernstein  <mitz@apple.com>
+
+        Attempted Tiger build fix after r50259
+
+        * platform/graphics/mac/ComplexTextControllerATSUI.cpp:
+
+2009-10-28  Steve Falkenburg  <sfalken@apple.com>
+
+        Rubber stamped by Mark Rowe.
+
+        https://bugs.webkit.org/show_bug.cgi?id=30899
+        WebKit fails to build release on 32-bit Windows systems
+
+        * WebCore.vcproj/WebCore.vcproj: Excluded files from project.
+        * bindings/js/JSBindingsAllInOne.cpp: Added.
+
+2009-10-28  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Jon Honeycutt.
+
+        Fixed typos in color names.
+
+        * inspector/front-end/Color.js:
+
+2009-10-28  Dan Bernstein  <mitz@apple.com>
+
+        Reviewed by Sam Weinig.
+
+        Share code between the ATSUI- and Core Text-based Font implementations by doing the
+        following:
+        - Generalize CoreTextController as ComplexTextController, keeping the Core Text-specific
+          parts in ComplexTextControllerCoreText.cpp.
+        - Generalize FontMacCoreText as FontComplexTextMac using ComplexTextController
+        - Implement ATSUI-specific parts of ComplexTextController in ComplexTextControllerATSUI.
+        - Remove FontMacATSUI.
+
+        * WebCore.xcodeproj/project.pbxproj: Removed CoreTextController.{cpp,h}, FontMacATSUI.mm,
+        and FontMacCoreText.cpp, and added ComplexTextController.{cpp,h},
+        ComplexTextControllerATSUI.cpp, ComplexTextControllerCoreText.cpp, and
+        FontComplexTextMac.cpp.
+
+        * platform/graphics/mac/ComplexTextController.cpp: Copied from CoreTextController.cpp and
+        kept the non-Core Text-specific bits.
+        (WebCore::ComplexTextController::ComplexTextController): Updated for renames, including
+        its own.
+        (WebCore::ComplexTextController::offsetForPosition): Updated for renames and for
+        m_complexTextRuns holding references instead of objects.
+        (WebCore::ComplexTextController::collectComplexTextRuns): Updated for renames, including
+        its own.
+        (WebCore::ComplexTextController::advance): Updated for renames.
+        (WebCore::ComplexTextController::adjustGlyphsAndAdvances): Updated for renames and for
+        m_complexTextRuns holding references instead of objects, and changed to use the glyphs()
+        and advances() accessors.
+
+        * platform/graphics/mac/ComplexTextController.h: Copied from CoreTextController.h and
+        renamed CoreTextController to ComplexTextController and CoreTextRun to ComplexTextRun. Made
+        the latter RefCounted, added ATSUI-specific members to it, and made some other members
+        Core Text-specific. Renamed m_coreTextRuns to m_complexTextRuns and made it hold references
+        rather than objects.
+        (WebCore::ComplexTextController::ComplexTextRun::create):
+        (WebCore::ComplexTextController::ComplexTextRun::glyphs):
+        (WebCore::ComplexTextController::ComplexTextRun::advances):
+
+        * platform/graphics/mac/ComplexTextControllerATSUI.cpp: Added. Includes ATSUI-specific
+        parts of the ComplexTextController implementation. 
+        (WebCore::ComplexTextController::ComplexTextRun::overrideLayoutOperation): This ATSUI
+        callback populates the ComplexTextRun’s glyphs, advances and indices vectors. It is invoked
+        when the ComplexTextRun constructor calls ATSUGetGlyphBounds().
+        (WebCore::isArabicLamWithAlefLigature): Helper function, copied from FontMacATSUI.mm.
+        (WebCore::shapeArabic): Helper function, adapted from FontMacATSUI.mm.
+        (WebCore::ComplexTextController::ComplexTextRun::ComplexTextRun): Sets up the
+        ATSUTextLayout, substituting the text buffer if necessary for things like shaping Arabic,
+        mirroring glyphs or directionality overrides, then calls ATSUGetGlyphBounds() in order to
+        get the glyphs, advances and indices vectors populated.
+        (WebCore::fontHasMirroringInfo): Helper function, copied from FontMacATSUI.mm.
+        (WebCore::disableLigatures): Ditto.
+        (WebCore::initializeATSUStyle): Ditto, somewhat cleaned up and simplified.
+        (WebCore::ComplexTextController::collectComplexTextRunsForCharacters): Constructs
+        ComplexTextRuns, either missing-glyphs ones or ATSUTextLayout-based ones.
+
+        * platform/graphics/mac/ComplexTextControllerCoreText.cpp: Copied from
+        CoreTextController.cpp and kept the Core Text-specific bits.
+        (WebCore::ComplexTextController::ComplexTextRun::ComplexTextRun): Updated for renames,
+        including its own, and moved the code to initialize m_glyphs and m_advances here. Previously
+        this was done in adjustGlyphsAndAdvances().
+        (WebCore::ComplexTextController::collectComplexTextRunsForCharacters): Updated for renames,
+        including its own.
+        * platform/graphics/mac/CoreTextController.cpp: Removed.
+        * platform/graphics/mac/CoreTextController.h: Removed.
+        * platform/graphics/mac/FontComplexTextMac.cpp: Renamed FontMacCoreText.cpp to this.
+        (WebCore::Font::selectionRectForComplexText): Changed to use ComplexTextController instead
+        of CoreTextController.
+        (WebCore::Font::drawComplexText): Ditto.
+        (WebCore::Font::floatWidthForComplexText): Ditto.
+        (WebCore::Font::offsetForPositionForComplexText): Ditto.
+        * platform/graphics/mac/FontMacATSUI.mm: Removed.
+        * platform/graphics/mac/FontMacCoreText.cpp: Removed.
+
 2009-10-27  Chris Fleizach  <cfleizach@apple.com>
 
         Reviewed by Darin Adler.
@@ -44,7 +16715,7 @@
         * xml/XPathFunctions.cpp:
         (WebCore::XPath::createFunctionMap):  Fix struct visibiity warning.
 
-2009-10-28  Adam Barth  <abarth@webkit.org>
+2009-10-29  Adam Barth  <abarth@webkit.org>
 
         Reviewed by Darin Adler.