Linux-2.6.12-rc2

Initial git repository build. I'm not bothering with the full history,
even though we have it. We can create a separate "historical" git
archive of that later if we want to, and in the meantime it's about
3.2GB when imported into git - space that would just make the early
git days unnecessarily complicated, when we don't have a lot of good
infrastructure for it.

Let it rip!

20 files changed, 10160 insertions, 0 deletions

diff --git a/drivers/video/matrox/Makefile b/drivers/video/matrox/Makefile
new file mode 100644
index 0000000..f9c00eb
--- /dev/null
+++ b/drivers/video/matrox/Makefile
@@ -0,0 +1,11 @@
+# Makefile for the Linux video drivers.
+# 5 Aug 1999, James Simmons, <mailto:jsimmons@edgeglobal.com>
+# Rewritten to use lists instead of if-statements.
+
+# Each configuration option enables a list of files.
+
+my-obj-$(CONFIG_FB_MATROX_G)      += g450_pll.o matroxfb_g450.o matroxfb_crtc2.o
+
+obj-$(CONFIG_FB_MATROX)           += matroxfb_base.o matroxfb_accel.o matroxfb_DAC1064.o matroxfb_Ti3026.o matroxfb_misc.o $(my-obj-y)
+obj-$(CONFIG_FB_MATROX_I2C)       += i2c-matroxfb.o
+obj-$(CONFIG_FB_MATROX_MAVEN)     += matroxfb_maven.o matroxfb_crtc2.o
diff --git a/drivers/video/matrox/g450_pll.c b/drivers/video/matrox/g450_pll.c
new file mode 100644
index 0000000..8073a73
--- /dev/null
+++ b/drivers/video/matrox/g450_pll.c
@@ -0,0 +1,479 @@
+/*
+ *
+ * Hardware accelerated Matrox PCI cards - G450/G550 PLL control.
+ *
+ * (c) 2001-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.64 2002/06/10
+ *
+ * This file is subject to the terms and conditions of the GNU General Public
+ * License. See the file COPYING in the main directory of this archive for
+ * more details.
+ *
+ */
+
+#include "g450_pll.h"
+#include "matroxfb_DAC1064.h"
+
+static inline unsigned int g450_vco2f(unsigned char p, unsigned int fvco) {
+	return (p & 0x40) ? fvco : fvco >> ((p & 3) + 1);
+}
+
+static inline unsigned int g450_f2vco(unsigned char p, unsigned int fin) {
+	return (p & 0x40) ? fin : fin << ((p & 3) + 1);
+}
+
+static unsigned int g450_mnp2vco(CPMINFO unsigned int mnp) {
+	unsigned int m, n;
+
+	m = ((mnp >> 16) & 0x0FF) + 1;
+	n = ((mnp >>  7) & 0x1FE) + 4;
+	return (ACCESS_FBINFO(features).pll.ref_freq * n + (m >> 1)) / m;
+}
+
+unsigned int g450_mnp2f(CPMINFO unsigned int mnp) {
+	return g450_vco2f(mnp, g450_mnp2vco(PMINFO mnp));
+}
+
+static inline unsigned int pll_freq_delta(unsigned int f1, unsigned int f2) {
+	if (f2 < f1) {
+    		f2 = f1 - f2;
+	} else {
+		f2 = f2 - f1;
+	}
+	return f2;
+}
+
+#define NO_MORE_MNP	0x01FFFFFF
+#define G450_MNP_FREQBITS	(0xFFFFFF43)	/* do not mask high byte so we'll catch NO_MORE_MNP */
+
+static unsigned int g450_nextpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* fvco, unsigned int mnp) {
+	unsigned int m, n, p;
+	unsigned int tvco = *fvco;
+
+	m = (mnp >> 16) & 0xFF;
+	p = mnp & 0xFF;
+
+	do {
+		if (m == 0 || m == 0xFF) {
+			if (m == 0) {
+				if (p & 0x40) {
+					return NO_MORE_MNP;
+				}
+			        if (p & 3) {
+					p--;
+				} else {
+					p = 0x40;
+				}
+				tvco >>= 1;
+				if (tvco < pi->vcomin) {
+					return NO_MORE_MNP;
+				}
+				*fvco = tvco;
+			}
+
+			p &= 0x43;
+			if (tvco < 550000) {
+/*				p |= 0x00; */
+			} else if (tvco < 700000) {
+				p |= 0x08;
+			} else if (tvco < 1000000) {
+				p |= 0x10;
+			} else if (tvco < 1150000) {
+				p |= 0x18;
+			} else {
+				p |= 0x20;
+			}
+			m = 9;
+		} else {
+			m--;
+		}
+        	n = ((tvco * (m+1) + ACCESS_FBINFO(features).pll.ref_freq) / (ACCESS_FBINFO(features).pll.ref_freq * 2)) - 2;
+	} while (n < 0x03 || n > 0x7A);
+	return (m << 16) | (n << 8) | p;
+}
+
+static unsigned int g450_firstpll(CPMINFO const struct matrox_pll_limits* pi, unsigned int* vco, unsigned int fout) {
+	unsigned int p;
+	unsigned int vcomax;
+
+	vcomax = pi->vcomax;
+	if (fout > (vcomax / 2)) {
+		if (fout > vcomax) {
+			*vco = vcomax;
+		} else {
+			*vco = fout;
+		}
+		p = 0x40;
+	} else {
+		unsigned int tvco;
+
+		p = 3;
+		tvco = g450_f2vco(p, fout);
+		while (p && (tvco > vcomax)) {
+			p--;
+			tvco >>= 1;
+		}
+		if (tvco < pi->vcomin) {
+			tvco = pi->vcomin;
+		}
+		*vco = tvco;
+	}
+	return g450_nextpll(PMINFO pi, vco, 0xFF0000 | p);
+}
+
+static inline unsigned int g450_setpll(CPMINFO unsigned int mnp, unsigned int pll) {
+	switch (pll) {
+		case M_PIXEL_PLL_A:
+			matroxfb_DAC_out(PMINFO M1064_XPIXPLLAM, mnp >> 16);
+			matroxfb_DAC_out(PMINFO M1064_XPIXPLLAN, mnp >> 8);
+			matroxfb_DAC_out(PMINFO M1064_XPIXPLLAP, mnp);
+			return M1064_XPIXPLLSTAT;
+
+		case M_PIXEL_PLL_B:
+			matroxfb_DAC_out(PMINFO M1064_XPIXPLLBM, mnp >> 16);
+			matroxfb_DAC_out(PMINFO M1064_XPIXPLLBN, mnp >> 8);
+			matroxfb_DAC_out(PMINFO M1064_XPIXPLLBP, mnp);
+			return M1064_XPIXPLLSTAT;
+
+		case M_PIXEL_PLL_C:
+			matroxfb_DAC_out(PMINFO M1064_XPIXPLLCM, mnp >> 16);
+			matroxfb_DAC_out(PMINFO M1064_XPIXPLLCN, mnp >> 8);
+			matroxfb_DAC_out(PMINFO M1064_XPIXPLLCP, mnp);
+			return M1064_XPIXPLLSTAT;
+
+		case M_SYSTEM_PLL:
+			matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLM, mnp >> 16);
+			matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLN, mnp >> 8);
+			matroxfb_DAC_out(PMINFO DAC1064_XSYSPLLP, mnp);
+			return DAC1064_XSYSPLLSTAT;
+
+		case M_VIDEO_PLL:
+			matroxfb_DAC_out(PMINFO M1064_XVIDPLLM, mnp >> 16);
+			matroxfb_DAC_out(PMINFO M1064_XVIDPLLN, mnp >> 8);
+			matroxfb_DAC_out(PMINFO M1064_XVIDPLLP, mnp);
+			return M1064_XVIDPLLSTAT;
+	}
+	return 0;
+}
+
+static inline unsigned int g450_cmppll(CPMINFO unsigned int mnp, unsigned int pll) {
+	unsigned char m = mnp >> 16;
+	unsigned char n = mnp >> 8;
+	unsigned char p = mnp;
+
+	switch (pll) {
+		case M_PIXEL_PLL_A:
+			return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLAM) != m ||
+				matroxfb_DAC_in(PMINFO M1064_XPIXPLLAN) != n ||
+				matroxfb_DAC_in(PMINFO M1064_XPIXPLLAP) != p);
+
+		case M_PIXEL_PLL_B:
+			return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLBM) != m ||
+				matroxfb_DAC_in(PMINFO M1064_XPIXPLLBN) != n ||
+				matroxfb_DAC_in(PMINFO M1064_XPIXPLLBP) != p);
+
+		case M_PIXEL_PLL_C:
+			return (matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) != m ||
+				matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) != n ||
+				matroxfb_DAC_in(PMINFO M1064_XPIXPLLCP) != p);
+
+		case M_SYSTEM_PLL:
+			return (matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLM) != m ||
+				matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLN) != n ||
+				matroxfb_DAC_in(PMINFO DAC1064_XSYSPLLP) != p);
+
+		case M_VIDEO_PLL:
+			return (matroxfb_DAC_in(PMINFO M1064_XVIDPLLM) != m ||
+				matroxfb_DAC_in(PMINFO M1064_XVIDPLLN) != n ||
+				matroxfb_DAC_in(PMINFO M1064_XVIDPLLP) != p);
+	}
+	return 1;
+}
+
+static inline int g450_isplllocked(CPMINFO unsigned int regidx) {
+	unsigned int j;
+
+	for (j = 0; j < 1000; j++) {
+		if (matroxfb_DAC_in(PMINFO regidx) & 0x40) {
+			unsigned int r = 0;
+			int i;
+
+			for (i = 0; i < 100; i++) {
+				r += matroxfb_DAC_in(PMINFO regidx) & 0x40;
+			}
+			return r >= (90 * 0x40);
+		}
+		/* udelay(1)... but DAC_in is much slower... */
+	}
+	return 0;
+}
+
+static int g450_testpll(CPMINFO unsigned int mnp, unsigned int pll) {
+	return g450_isplllocked(PMINFO g450_setpll(PMINFO mnp, pll));
+}
+
+static void updatehwstate_clk(struct matrox_hw_state* hw, unsigned int mnp, unsigned int pll) {
+	switch (pll) {
+		case M_SYSTEM_PLL:
+			hw->DACclk[3] = mnp >> 16;
+			hw->DACclk[4] = mnp >> 8;
+			hw->DACclk[5] = mnp;
+			break;
+	}
+}
+
+void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll) {
+	if (g450_cmppll(PMINFO mnp, pll)) {
+		g450_setpll(PMINFO mnp, pll);
+	}
+}
+
+static inline unsigned int g450_findworkingpll(WPMINFO unsigned int pll, unsigned int* mnparray, unsigned int mnpcount) {
+	unsigned int found = 0;
+	unsigned int idx;
+	unsigned int mnpfound = mnparray[0];
+		
+	for (idx = 0; idx < mnpcount; idx++) {
+		unsigned int sarray[3];
+		unsigned int *sptr;
+		{
+			unsigned int mnp;
+		
+			sptr = sarray;
+			mnp = mnparray[idx];
+			if (mnp & 0x38) {
+				*sptr++ = mnp - 8;
+			}
+			if ((mnp & 0x38) != 0x38) {
+				*sptr++ = mnp + 8;
+			}
+			*sptr = mnp;
+		}
+		while (sptr >= sarray) {
+			unsigned int mnp = *sptr--;
+		
+			if (g450_testpll(PMINFO mnp - 0x0300, pll) &&
+			    g450_testpll(PMINFO mnp + 0x0300, pll) &&
+			    g450_testpll(PMINFO mnp - 0x0200, pll) &&
+			    g450_testpll(PMINFO mnp + 0x0200, pll) &&
+			    g450_testpll(PMINFO mnp - 0x0100, pll) &&
+			    g450_testpll(PMINFO mnp + 0x0100, pll)) {
+				if (g450_testpll(PMINFO mnp, pll)) {
+					return mnp;
+				}
+			} else if (!found && g450_testpll(PMINFO mnp, pll)) {
+				mnpfound = mnp;
+				found = 1;
+			}
+		}
+	}
+	g450_setpll(PMINFO mnpfound, pll);
+	return mnpfound;
+}
+
+static void g450_addcache(struct matrox_pll_cache* ci, unsigned int mnp_key, unsigned int mnp_value) {
+	if (++ci->valid > ARRAY_SIZE(ci->data)) {
+		ci->valid = ARRAY_SIZE(ci->data);
+	}
+	memmove(ci->data + 1, ci->data, (ci->valid - 1) * sizeof(*ci->data));
+	ci->data[0].mnp_key = mnp_key & G450_MNP_FREQBITS;
+	ci->data[0].mnp_value = mnp_value;
+}
+
+static int g450_checkcache(WPMINFO struct matrox_pll_cache* ci, unsigned int mnp_key) {
+	unsigned int i;
+	
+	mnp_key &= G450_MNP_FREQBITS;
+	for (i = 0; i < ci->valid; i++) {
+		if (ci->data[i].mnp_key == mnp_key) {
+			unsigned int mnp;
+			
+			mnp = ci->data[i].mnp_value;
+			if (i) {
+				memmove(ci->data + 1, ci->data, i * sizeof(*ci->data));
+				ci->data[0].mnp_key = mnp_key;
+				ci->data[0].mnp_value = mnp;
+			}
+			return mnp;
+		}
+	}
+	return NO_MORE_MNP;
+}
+
+static int __g450_setclk(WPMINFO unsigned int fout, unsigned int pll, 
+		unsigned int* mnparray, unsigned int* deltaarray) {
+	unsigned int mnpcount;
+	unsigned int pixel_vco;
+	const struct matrox_pll_limits* pi;
+	struct matrox_pll_cache* ci;
+
+	pixel_vco = 0;
+	switch (pll) {
+		case M_PIXEL_PLL_A:
+		case M_PIXEL_PLL_B:
+		case M_PIXEL_PLL_C:
+			{
+				u_int8_t tmp;
+				unsigned long flags;
+				
+				matroxfb_DAC_lock_irqsave(flags);
+				tmp = matroxfb_DAC_in(PMINFO M1064_XPIXCLKCTRL);
+				if (!(tmp & M1064_XPIXCLKCTRL_PLL_UP)) {
+					matroxfb_DAC_out(PMINFO M1064_XPIXCLKCTRL, tmp | M1064_XPIXCLKCTRL_PLL_UP);
+				}
+				matroxfb_DAC_unlock_irqrestore(flags);
+			}
+			{
+				u_int8_t misc;
+		
+				misc = mga_inb(M_MISC_REG_READ) & ~0x0C;
+				switch (pll) {
+					case M_PIXEL_PLL_A:
+						break;
+					case M_PIXEL_PLL_B:
+						misc |=  0x04;
+						break;
+					default:
+						misc |=  0x0C;
+						break;
+				}
+				mga_outb(M_MISC_REG, misc);
+			}
+			pi = &ACCESS_FBINFO(limits.pixel);
+			ci = &ACCESS_FBINFO(cache.pixel);
+			break;
+		case M_SYSTEM_PLL:
+			{
+				u_int32_t opt;
+
+				pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &opt);
+				if (!(opt & 0x20)) {
+					pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, opt | 0x20);
+				}
+			}
+			pi = &ACCESS_FBINFO(limits.system);
+			ci = &ACCESS_FBINFO(cache.system);
+			break;
+		case M_VIDEO_PLL:
+			{
+				u_int8_t tmp;
+				unsigned int mnp;
+				unsigned long flags;
+				
+				matroxfb_DAC_lock_irqsave(flags);
+				tmp = matroxfb_DAC_in(PMINFO M1064_XPWRCTRL);
+				if (!(tmp & 2)) {
+					matroxfb_DAC_out(PMINFO M1064_XPWRCTRL, tmp | 2);
+				}
+				
+				mnp = matroxfb_DAC_in(PMINFO M1064_XPIXPLLCM) << 16;
+				mnp |= matroxfb_DAC_in(PMINFO M1064_XPIXPLLCN) << 8;
+				pixel_vco = g450_mnp2vco(PMINFO mnp);
+				matroxfb_DAC_unlock_irqrestore(flags);
+			}
+			pi = &ACCESS_FBINFO(limits.video);
+			ci = &ACCESS_FBINFO(cache.video);
+			break;
+		default:
+			return -EINVAL;
+	}
+
+	mnpcount = 0;
+	{
+		unsigned int mnp;
+		unsigned int xvco;
+
+		for(mnp = g450_firstpll(PMINFO pi, &xvco, fout); mnp != NO_MORE_MNP; mnp = g450_nextpll(PMINFO pi, &xvco, mnp)) {
+			unsigned int idx;
+			unsigned int vco;
+			unsigned int delta;
+
+			vco = g450_mnp2vco(PMINFO mnp);
+#if 0			
+			if (pll == M_VIDEO_PLL) {
+				unsigned int big, small;
+
+				if (vco < pixel_vco) {
+					small = vco;
+					big = pixel_vco;
+				} else {
+					small = pixel_vco;
+					big = vco;
+				}
+				while (big > small) {
+					big >>= 1;
+				}
+				if (big == small) {
+					continue;
+				}
+			}
+#endif			
+			delta = pll_freq_delta(fout, g450_vco2f(mnp, vco));
+			for (idx = mnpcount; idx > 0; idx--) {
+				/* == is important; due to nextpll algorithm we get
+				   sorted equally good frequencies from lower VCO 
+				   frequency to higher - with <= lowest wins, while
+				   with < highest one wins */
+				if (delta <= deltaarray[idx-1]) {
+					mnparray[idx] = mnparray[idx-1];
+					deltaarray[idx] = deltaarray[idx-1];
+				} else {
+					break;
+				}
+			}
+			mnparray[idx] = mnp;
+			deltaarray[idx] = delta;
+			mnpcount++;
+		}
+	}
+	/* VideoPLL and PixelPLL matched: do nothing... In all other cases we should get at least one frequency */
+	if (!mnpcount) {
+		return -EBUSY;
+	}
+	{
+		unsigned long flags;
+		unsigned int mnp;
+		
+		matroxfb_DAC_lock_irqsave(flags);
+		mnp = g450_checkcache(PMINFO ci, mnparray[0]);
+		if (mnp != NO_MORE_MNP) {
+			matroxfb_g450_setpll_cond(PMINFO mnp, pll);
+		} else {
+			mnp = g450_findworkingpll(PMINFO pll, mnparray, mnpcount);
+			g450_addcache(ci, mnparray[0], mnp);
+		}
+		updatehwstate_clk(&ACCESS_FBINFO(hw), mnp, pll);
+		matroxfb_DAC_unlock_irqrestore(flags);
+		return mnp;
+	}
+}
+
+/* It must be greater than number of possible PLL values.
+ * Currently there is 5(p) * 10(m) = 50 possible values. */
+#define MNP_TABLE_SIZE  64
+
+int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll) {
+	unsigned int* arr;
+	
+	arr = kmalloc(sizeof(*arr) * MNP_TABLE_SIZE * 2, GFP_KERNEL);
+	if (arr) {
+		int r;
+
+		r = __g450_setclk(PMINFO fout, pll, arr, arr + MNP_TABLE_SIZE);
+		kfree(arr);
+		return r;
+	}
+	return -ENOMEM;
+}
+
+EXPORT_SYMBOL(matroxfb_g450_setclk);
+EXPORT_SYMBOL(g450_mnp2f);
+EXPORT_SYMBOL(matroxfb_g450_setpll_cond);
+
+MODULE_AUTHOR("(c) 2001-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Matrox G450/G550 PLL driver");
+
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/g450_pll.h b/drivers/video/matrox/g450_pll.h
new file mode 100644
index 0000000..c17ed74
--- /dev/null
+++ b/drivers/video/matrox/g450_pll.h
@@ -0,0 +1,10 @@
+#ifndef __G450_PLL_H__
+#define __G450_PLL_H__
+
+#include "matroxfb_base.h"
+
+int matroxfb_g450_setclk(WPMINFO unsigned int fout, unsigned int pll);
+unsigned int g450_mnp2f(CPMINFO unsigned int mnp);
+void matroxfb_g450_setpll_cond(WPMINFO unsigned int mnp, unsigned int pll);
+
+#endif	/* __G450_PLL_H__ */
diff --git a/drivers/video/matrox/i2c-matroxfb.c b/drivers/video/matrox/i2c-matroxfb.c
new file mode 100644
index 0000000..57abbae
--- /dev/null
+++ b/drivers/video/matrox/i2c-matroxfb.c
@@ -0,0 +1,223 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Version: 1.64 2002/06/10
+ *
+ * See matroxfb_base.c for contributors.
+ *
+ */
+
+#include "matroxfb_base.h"
+#include "matroxfb_maven.h"
+#include <linux/i2c.h>
+#include <linux/i2c-algo-bit.h>
+
+/* MGA-TVO I2C for G200, G400 */
+#define MAT_CLK		0x20
+#define MAT_DATA	0x10
+/* primary head DDC for Mystique(?), G100, G200, G400 */
+#define DDC1_CLK	0x08
+#define DDC1_DATA	0x02
+/* primary head DDC for Millennium, Millennium II */
+#define DDC1B_CLK	0x10
+#define DDC1B_DATA	0x04
+/* secondary head DDC for G400 */
+#define DDC2_CLK	0x04
+#define DDC2_DATA	0x01
+
+/******************************************************/
+
+struct matroxfb_dh_maven_info {
+	struct i2c_bit_adapter	maven;
+	struct i2c_bit_adapter	ddc1;
+	struct i2c_bit_adapter	ddc2;
+};
+
+static int matroxfb_read_gpio(struct matrox_fb_info* minfo) {
+	unsigned long flags;
+	int v;
+
+	matroxfb_DAC_lock_irqsave(flags);
+	v = matroxfb_DAC_in(PMINFO DAC_XGENIODATA);
+	matroxfb_DAC_unlock_irqrestore(flags);
+	return v;
+}
+
+static void matroxfb_set_gpio(struct matrox_fb_info* minfo, int mask, int val) {
+	unsigned long flags;
+	int v;
+
+	matroxfb_DAC_lock_irqsave(flags);
+	v = (matroxfb_DAC_in(PMINFO DAC_XGENIOCTRL) & mask) | val;
+	matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, v);
+	/* We must reset GENIODATA very often... XFree plays with this register */
+	matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0x00);
+	matroxfb_DAC_unlock_irqrestore(flags);
+}
+
+/* software I2C functions */
+static inline void matroxfb_i2c_set(struct matrox_fb_info* minfo, int mask, int state) {
+	if (state)
+		state = 0;
+	else
+		state = mask;
+	matroxfb_set_gpio(minfo, ~mask, state);
+}
+
+static void matroxfb_gpio_setsda(void* data, int state) {
+	struct i2c_bit_adapter* b = data;
+	matroxfb_i2c_set(b->minfo, b->mask.data, state);
+}
+
+static void matroxfb_gpio_setscl(void* data, int state) {
+	struct i2c_bit_adapter* b = data;
+	matroxfb_i2c_set(b->minfo, b->mask.clock, state);
+}
+
+static int matroxfb_gpio_getsda(void* data) {
+	struct i2c_bit_adapter* b = data;
+	return (matroxfb_read_gpio(b->minfo) & b->mask.data) ? 1 : 0;
+}
+
+static int matroxfb_gpio_getscl(void* data) {
+	struct i2c_bit_adapter* b = data;
+	return (matroxfb_read_gpio(b->minfo) & b->mask.clock) ? 1 : 0;
+}
+
+static struct i2c_adapter matrox_i2c_adapter_template =
+{
+	.owner =	THIS_MODULE,
+	.id =		I2C_HW_B_G400,
+};
+
+static struct i2c_algo_bit_data matrox_i2c_algo_template =
+{
+	NULL,
+	matroxfb_gpio_setsda,
+	matroxfb_gpio_setscl,
+	matroxfb_gpio_getsda,
+	matroxfb_gpio_getscl,
+	10, 10, 100,
+};
+
+static int i2c_bus_reg(struct i2c_bit_adapter* b, struct matrox_fb_info* minfo, 
+		unsigned int data, unsigned int clock, const char* name) {
+	int err;
+
+	b->minfo = minfo;
+	b->mask.data = data;
+	b->mask.clock = clock;
+	b->adapter = matrox_i2c_adapter_template;
+	snprintf(b->adapter.name, I2C_NAME_SIZE, name,
+		minfo->fbcon.node);
+	i2c_set_adapdata(&b->adapter, b);
+	b->adapter.algo_data = &b->bac;
+	b->bac = matrox_i2c_algo_template;
+	b->bac.data = b;
+	err = i2c_bit_add_bus(&b->adapter);
+	b->initialized = !err;
+	return err;
+}
+
+static void i2c_bit_bus_del(struct i2c_bit_adapter* b) {
+	if (b->initialized) {
+		i2c_bit_del_bus(&b->adapter);
+		b->initialized = 0;
+	}
+}
+
+static inline void i2c_maven_done(struct matroxfb_dh_maven_info* minfo2) {
+	i2c_bit_bus_del(&minfo2->maven);
+}
+
+static inline void i2c_ddc1_done(struct matroxfb_dh_maven_info* minfo2) {
+	i2c_bit_bus_del(&minfo2->ddc1);
+}
+
+static inline void i2c_ddc2_done(struct matroxfb_dh_maven_info* minfo2) {
+	i2c_bit_bus_del(&minfo2->ddc2);
+}
+
+static void* i2c_matroxfb_probe(struct matrox_fb_info* minfo) {
+	int err;
+	unsigned long flags;
+	struct matroxfb_dh_maven_info* m2info;
+
+	m2info = (struct matroxfb_dh_maven_info*)kmalloc(sizeof(*m2info), GFP_KERNEL);
+	if (!m2info)
+		return NULL;
+
+	matroxfb_DAC_lock_irqsave(flags);
+	matroxfb_DAC_out(PMINFO DAC_XGENIODATA, 0xFF);
+	matroxfb_DAC_out(PMINFO DAC_XGENIOCTRL, 0x00);
+	matroxfb_DAC_unlock_irqrestore(flags);
+
+	memset(m2info, 0, sizeof(*m2info));
+
+	switch (ACCESS_FBINFO(chip)) {
+		case MGA_2064:
+		case MGA_2164:
+			err = i2c_bus_reg(&m2info->ddc1, minfo, DDC1B_DATA, DDC1B_CLK, "DDC:fb%u #0");
+			break;
+		default:
+			err = i2c_bus_reg(&m2info->ddc1, minfo, DDC1_DATA, DDC1_CLK, "DDC:fb%u #0");
+			break;
+	}
+	if (err)
+		goto fail_ddc1;
+	if (ACCESS_FBINFO(devflags.dualhead)) {
+		err = i2c_bus_reg(&m2info->ddc2, minfo, DDC2_DATA, DDC2_CLK, "DDC:fb%u #1");
+		if (err == -ENODEV) {
+			printk(KERN_INFO "i2c-matroxfb: VGA->TV plug detected, DDC unavailable.\n");
+		} else if (err)
+			printk(KERN_INFO "i2c-matroxfb: Could not register secondary output i2c bus. Continuing anyway.\n");
+		/* Register maven bus even on G450/G550 */
+		err = i2c_bus_reg(&m2info->maven, minfo, MAT_DATA, MAT_CLK, "MAVEN:fb%u");
+		if (err)
+			printk(KERN_INFO "i2c-matroxfb: Could not register Maven i2c bus. Continuing anyway.\n");
+	}
+	return m2info;
+fail_ddc1:;
+	kfree(m2info);
+	printk(KERN_ERR "i2c-matroxfb: Could not register primary adapter DDC bus.\n");
+	return NULL;
+}
+
+static void i2c_matroxfb_remove(struct matrox_fb_info* minfo, void* data) {
+	struct matroxfb_dh_maven_info* m2info = data;
+
+	i2c_maven_done(m2info);
+	i2c_ddc2_done(m2info);
+	i2c_ddc1_done(m2info);
+	kfree(m2info);
+}
+
+static struct matroxfb_driver i2c_matroxfb = {
+	.node =		LIST_HEAD_INIT(i2c_matroxfb.node),
+	.name =		"i2c-matroxfb",
+	.probe = 	i2c_matroxfb_probe,
+	.remove =	i2c_matroxfb_remove,
+};
+
+static int __init i2c_matroxfb_init(void) {
+	if (matroxfb_register_driver(&i2c_matroxfb)) {
+		printk(KERN_ERR "i2c-matroxfb: failed to register driver\n");
+		return -ENXIO;
+	}
+	return 0;
+}
+
+static void __exit i2c_matroxfb_exit(void) {
+	matroxfb_unregister_driver(&i2c_matroxfb);
+}
+
+MODULE_AUTHOR("(c) 1999-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Support module providing I2C buses present on Matrox videocards");
+
+module_init(i2c_matroxfb_init);
+module_exit(i2c_matroxfb_exit);
+/* no __setup required */
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_DAC1064.c b/drivers/video/matrox/matroxfb_DAC1064.c
new file mode 100644
index 0000000..149680f
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_DAC1064.c
@@ -0,0 +1,1086 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * See matroxfb_base.c for contributors.
+ *
+ */
+
+/* make checkconfig does not walk through include tree :-( */
+#include <linux/config.h>
+
+#include "matroxfb_DAC1064.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_accel.h"
+#include "g450_pll.h"
+#include <linux/matroxfb.h>
+
+#ifdef NEED_DAC1064
+#define outDAC1064 matroxfb_DAC_out
+#define inDAC1064 matroxfb_DAC_in
+
+#define DAC1064_OPT_SCLK_PCI	0x00
+#define DAC1064_OPT_SCLK_PLL	0x01
+#define DAC1064_OPT_SCLK_EXT	0x02
+#define DAC1064_OPT_SCLK_MASK	0x03
+#define DAC1064_OPT_GDIV1	0x04	/* maybe it is GDIV2 on G100 ?! */
+#define DAC1064_OPT_GDIV3	0x00
+#define DAC1064_OPT_MDIV1	0x08
+#define DAC1064_OPT_MDIV2	0x00
+#define DAC1064_OPT_RESERVED	0x10
+
+static void DAC1064_calcclock(CPMINFO unsigned int freq, unsigned int fmax, unsigned int* in, unsigned int* feed, unsigned int* post) {
+	unsigned int fvco;
+	unsigned int p;
+
+	DBG(__FUNCTION__)
+	
+	/* only for devices older than G450 */
+
+	fvco = PLL_calcclock(PMINFO freq, fmax, in, feed, &p);
+	
+	p = (1 << p) - 1;
+	if (fvco <= 100000)
+		;
+	else if (fvco <= 140000)
+		p |= 0x08;
+	else if (fvco <= 180000)
+		p |= 0x10;
+	else
+		p |= 0x18;
+	*post = p;
+}
+
+/* they must be in POS order */
+static const unsigned char MGA1064_DAC_regs[] = {
+		M1064_XCURADDL, M1064_XCURADDH, M1064_XCURCTRL,
+		M1064_XCURCOL0RED, M1064_XCURCOL0GREEN, M1064_XCURCOL0BLUE,
+		M1064_XCURCOL1RED, M1064_XCURCOL1GREEN, M1064_XCURCOL1BLUE,
+		M1064_XCURCOL2RED, M1064_XCURCOL2GREEN, M1064_XCURCOL2BLUE,
+		DAC1064_XVREFCTRL, M1064_XMULCTRL, M1064_XPIXCLKCTRL, M1064_XGENCTRL,
+		M1064_XMISCCTRL,
+		M1064_XGENIOCTRL, M1064_XGENIODATA, M1064_XZOOMCTRL, M1064_XSENSETEST,
+		M1064_XCRCBITSEL,
+		M1064_XCOLKEYMASKL, M1064_XCOLKEYMASKH, M1064_XCOLKEYL, M1064_XCOLKEYH };
+
+static const unsigned char MGA1064_DAC[] = {
+		0x00, 0x00, M1064_XCURCTRL_DIS,
+		0x00, 0x00, 0x00, 	/* black */
+		0xFF, 0xFF, 0xFF,	/* white */
+		0xFF, 0x00, 0x00,	/* red */
+		0x00, 0,
+		M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_PLL,
+		M1064_XGENCTRL_VS_0 | M1064_XGENCTRL_ALPHA_DIS | M1064_XGENCTRL_BLACK_0IRE | M1064_XGENCTRL_NO_SYNC_ON_GREEN,
+		M1064_XMISCCTRL_DAC_8BIT,
+		0x00, 0x00, M1064_XZOOMCTRL_1, M1064_XSENSETEST_BCOMP | M1064_XSENSETEST_GCOMP | M1064_XSENSETEST_RCOMP | M1064_XSENSETEST_PDOWN,
+		0x00,
+		0x00, 0x00, 0xFF, 0xFF};
+
+static void DAC1064_setpclk(WPMINFO unsigned long fout) {
+	unsigned int m, n, p;
+
+	DBG(__FUNCTION__)
+
+	DAC1064_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
+	ACCESS_FBINFO(hw).DACclk[0] = m;
+	ACCESS_FBINFO(hw).DACclk[1] = n;
+	ACCESS_FBINFO(hw).DACclk[2] = p;
+}
+
+static void DAC1064_setmclk(WPMINFO int oscinfo, unsigned long fmem) {
+	u_int32_t mx;
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	if (ACCESS_FBINFO(devflags.noinit)) {
+		/* read MCLK and give up... */
+		hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
+		hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
+		hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+		return;
+	}
+	mx = hw->MXoptionReg | 0x00000004;
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+	mx &= ~0x000000BB;
+	if (oscinfo & DAC1064_OPT_GDIV1)
+		mx |= 0x00000008;
+	if (oscinfo & DAC1064_OPT_MDIV1)
+		mx |= 0x00000010;
+	if (oscinfo & DAC1064_OPT_RESERVED)
+		mx |= 0x00000080;
+	if ((oscinfo & DAC1064_OPT_SCLK_MASK) == DAC1064_OPT_SCLK_PLL) {
+		/* select PCI clock until we have setup oscilator... */
+		int clk;
+		unsigned int m, n, p;
+
+		/* powerup system PLL, select PCI clock */
+		mx |= 0x00000020;
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+		mx &= ~0x00000004;
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+
+		/* !!! you must not access device if MCLK is not running !!!
+		   Doing so cause immediate PCI lockup :-( Maybe they should
+		   generate ABORT or I/O (parity...) error and Linux should
+		   recover from this... (kill driver/process). But world is not
+		   perfect... */
+		/* (bit 2 of PCI_OPTION_REG must be 0... and bits 0,1 must not
+		   select PLL... because of PLL can be stopped at this time) */
+		DAC1064_calcclock(PMINFO fmem, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
+		outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3] = m);
+		outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4] = n);
+		outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5] = p);
+		for (clk = 65536; clk; --clk) {
+			if (inDAC1064(PMINFO DAC1064_XSYSPLLSTAT) & 0x40)
+				break;
+		}
+		if (!clk)
+			printk(KERN_ERR "matroxfb: aiee, SYSPLL not locked\n");
+		/* select PLL */
+		mx |= 0x00000005;
+	} else {
+		/* select specified system clock source */
+		mx |= oscinfo & DAC1064_OPT_SCLK_MASK;
+	}
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+	mx &= ~0x00000004;
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mx);
+	hw->MXoptionReg = mx;
+}
+
+#ifdef CONFIG_FB_MATROX_G
+static void g450_set_plls(WPMINFO2) {
+	u_int32_t c2_ctl;
+	unsigned int pxc;
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	int pixelmnp;
+	int videomnp;
+	
+	c2_ctl = hw->crtc2.ctl & ~0x4007;	/* Clear PLL + enable for CRTC2 */
+	c2_ctl |= 0x0001;			/* Enable CRTC2 */
+	hw->DACreg[POS1064_XPWRCTRL] &= ~0x02;	/* Stop VIDEO PLL */
+	pixelmnp = ACCESS_FBINFO(crtc1).mnp;
+	videomnp = ACCESS_FBINFO(crtc2).mnp;
+	if (videomnp < 0) {
+		c2_ctl &= ~0x0001;			/* Disable CRTC2 */
+		hw->DACreg[POS1064_XPWRCTRL] &= ~0x10;	/* Powerdown CRTC2 */
+	} else if (ACCESS_FBINFO(crtc2).pixclock == ACCESS_FBINFO(features).pll.ref_freq) {
+		c2_ctl |=  0x4002;	/* Use reference directly */
+	} else if (videomnp == pixelmnp) {
+		c2_ctl |=  0x0004;	/* Use pixel PLL */
+	} else {
+		if (0 == ((videomnp ^ pixelmnp) & 0xFFFFFF00)) {
+			/* PIXEL and VIDEO PLL must not use same frequency. We modify N
+			   of PIXEL PLL in such case because of VIDEO PLL may be source
+			   of TVO clocks, and chroma subcarrier is derived from its
+			   pixel clocks */
+			pixelmnp += 0x000100;
+		}
+		c2_ctl |=  0x0006;	/* Use video PLL */
+		hw->DACreg[POS1064_XPWRCTRL] |= 0x02;
+		
+		outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+		matroxfb_g450_setpll_cond(PMINFO videomnp, M_VIDEO_PLL);
+	}
+
+	hw->DACreg[POS1064_XPIXCLKCTRL] &= ~M1064_XPIXCLKCTRL_PLL_UP;
+	if (pixelmnp >= 0) {
+		hw->DACreg[POS1064_XPIXCLKCTRL] |= M1064_XPIXCLKCTRL_PLL_UP;
+		
+		outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+		matroxfb_g450_setpll_cond(PMINFO pixelmnp, M_PIXEL_PLL_C);
+	}
+	if (c2_ctl != hw->crtc2.ctl) {
+		hw->crtc2.ctl = c2_ctl;
+		mga_outl(0x3C10, c2_ctl);
+	}
+
+	pxc = ACCESS_FBINFO(crtc1).pixclock;
+	if (pxc == 0 || ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC2) {
+		pxc = ACCESS_FBINFO(crtc2).pixclock;
+	}
+	if (ACCESS_FBINFO(chip) == MGA_G550) {
+		if (pxc < 45000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x00;	/* 0-50 */
+		} else if (pxc < 55000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x08;	/* 34-62 */
+		} else if (pxc < 70000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x10;	/* 42-78 */
+		} else if (pxc < 85000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x18;	/* 62-92 */
+		} else if (pxc < 100000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x20;	/* 74-108 */
+		} else if (pxc < 115000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x28;	/* 94-122 */
+		} else if (pxc < 125000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x30;	/* 108-132 */
+		} else {
+			hw->DACreg[POS1064_XPANMODE] = 0x38;	/* 120-168 */
+		}
+	} else {
+		/* G450 */
+		if (pxc < 45000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x00;	/* 0-54 */
+		} else if (pxc < 65000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x08;	/* 38-70 */
+		} else if (pxc < 85000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x10;	/* 56-96 */
+		} else if (pxc < 105000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x18;	/* 80-114 */
+		} else if (pxc < 135000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x20;	/* 102-144 */
+		} else if (pxc < 160000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x28;	/* 132-166 */
+		} else if (pxc < 175000) {
+			hw->DACreg[POS1064_XPANMODE] = 0x30;	/* 154-182 */
+		} else {
+			hw->DACreg[POS1064_XPANMODE] = 0x38;	/* 170-204 */
+		}
+	}
+}
+#endif
+
+void DAC1064_global_init(WPMINFO2) {
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	hw->DACreg[POS1064_XMISCCTRL] &= M1064_XMISCCTRL_DAC_WIDTHMASK;
+	hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_LUT_EN;
+	hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_PLL;
+#ifdef CONFIG_FB_MATROX_G
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+		hw->DACreg[POS1064_XPWRCTRL] = 0x1F;	/* powerup everything */
+		hw->DACreg[POS1064_XOUTPUTCONN] = 0x00;	/* disable outputs */
+		hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
+		switch (ACCESS_FBINFO(outputs[0]).src) {
+			case MATROXFB_SRC_CRTC1:
+			case MATROXFB_SRC_CRTC2:
+				hw->DACreg[POS1064_XOUTPUTCONN] |= 0x01;	/* enable output; CRTC1/2 selection is in CRTC2 ctl */
+				break;
+			case MATROXFB_SRC_NONE:
+				hw->DACreg[POS1064_XMISCCTRL] &= ~M1064_XMISCCTRL_DAC_EN;
+				break;
+		}
+		switch (ACCESS_FBINFO(outputs[1]).src) {
+			case MATROXFB_SRC_CRTC1:
+				hw->DACreg[POS1064_XOUTPUTCONN] |= 0x04;
+				break;
+			case MATROXFB_SRC_CRTC2:
+				if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_MONITOR) {
+					hw->DACreg[POS1064_XOUTPUTCONN] |= 0x08;
+				} else {
+					hw->DACreg[POS1064_XOUTPUTCONN] |= 0x0C;
+				}
+				break;
+			case MATROXFB_SRC_NONE:
+				hw->DACreg[POS1064_XPWRCTRL] &= ~0x01;		/* Poweroff DAC2 */
+				break;
+		}
+		switch (ACCESS_FBINFO(outputs[2]).src) {
+			case MATROXFB_SRC_CRTC1:
+				hw->DACreg[POS1064_XOUTPUTCONN] |= 0x20;
+				break;
+			case MATROXFB_SRC_CRTC2:
+				hw->DACreg[POS1064_XOUTPUTCONN] |= 0x40;
+				break;
+			case MATROXFB_SRC_NONE:
+#if 0
+				/* HELP! If we boot without DFP connected to DVI, we can
+				   poweroff TMDS. But if we boot with DFP connected,
+				   TMDS generated clocks are used instead of ALL pixclocks
+				   available... If someone knows which register
+				   handles it, please reveal this secret to me... */			
+				hw->DACreg[POS1064_XPWRCTRL] &= ~0x04;		/* Poweroff TMDS */
+#endif				
+				break;
+		}
+		/* Now set timming related variables... */
+		g450_set_plls(PMINFO2);
+	} else
+#endif
+	{
+		if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1) {
+			hw->DACreg[POS1064_XPIXCLKCTRL] = M1064_XPIXCLKCTRL_PLL_UP | M1064_XPIXCLKCTRL_EN | M1064_XPIXCLKCTRL_SRC_EXT;
+			hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_MAFC12;
+		} else if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
+			hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_MAFC | G400_XMISCCTRL_VDO_C2_MAFC12;
+		} else if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1)
+			hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_PANELLINK | G400_XMISCCTRL_VDO_MAFC12;
+		else
+			hw->DACreg[POS1064_XMISCCTRL] |= GX00_XMISCCTRL_MFC_DIS;
+
+		if (ACCESS_FBINFO(outputs[0]).src != MATROXFB_SRC_NONE)
+			hw->DACreg[POS1064_XMISCCTRL] |= M1064_XMISCCTRL_DAC_EN;
+	}
+}
+
+void DAC1064_global_restore(WPMINFO2) {
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	outDAC1064(PMINFO M1064_XPIXCLKCTRL, hw->DACreg[POS1064_XPIXCLKCTRL]);
+	outDAC1064(PMINFO M1064_XMISCCTRL, hw->DACreg[POS1064_XMISCCTRL]);
+	if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
+		outDAC1064(PMINFO 0x20, 0x04);
+		outDAC1064(PMINFO 0x1F, ACCESS_FBINFO(devflags.dfp_type));
+		if (ACCESS_FBINFO(devflags.g450dac)) {
+			outDAC1064(PMINFO M1064_XSYNCCTRL, 0xCC);
+			outDAC1064(PMINFO M1064_XPWRCTRL, hw->DACreg[POS1064_XPWRCTRL]);
+			outDAC1064(PMINFO M1064_XPANMODE, hw->DACreg[POS1064_XPANMODE]);
+			outDAC1064(PMINFO M1064_XOUTPUTCONN, hw->DACreg[POS1064_XOUTPUTCONN]);
+		}
+	}
+}
+
+static int DAC1064_init_1(WPMINFO struct my_timming* m) {
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	memcpy(hw->DACreg, MGA1064_DAC, sizeof(MGA1064_DAC_regs));
+	switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+		/* case 4: not supported by MGA1064 DAC */
+		case 8:
+			hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_8BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+			break;
+		case 16:
+			if (ACCESS_FBINFO(fbcon).var.green.length == 5)
+				hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_15BPP_1BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+			else
+				hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_16BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+			break;
+		case 24:
+			hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_24BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+			break;
+		case 32:
+			hw->DACreg[POS1064_XMULCTRL] = M1064_XMULCTRL_DEPTH_32BPP | M1064_XMULCTRL_GRAPHICS_PALETIZED;
+			break;
+		default:
+			return 1;	/* unsupported depth */
+	}
+	hw->DACreg[POS1064_XVREFCTRL] = ACCESS_FBINFO(features.DAC1064.xvrefctrl);
+	hw->DACreg[POS1064_XGENCTRL] &= ~M1064_XGENCTRL_SYNC_ON_GREEN_MASK;
+	hw->DACreg[POS1064_XGENCTRL] |= (m->sync & FB_SYNC_ON_GREEN)?M1064_XGENCTRL_SYNC_ON_GREEN:M1064_XGENCTRL_NO_SYNC_ON_GREEN;
+	hw->DACreg[POS1064_XCURADDL] = 0;
+	hw->DACreg[POS1064_XCURADDH] = 0;
+
+	DAC1064_global_init(PMINFO2);
+	return 0;
+}
+
+static int DAC1064_init_2(WPMINFO struct my_timming* m) {
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 16) {	/* 256 entries */
+		int i;
+
+		for (i = 0; i < 256; i++) {
+			hw->DACpal[i * 3 + 0] = i;
+			hw->DACpal[i * 3 + 1] = i;
+			hw->DACpal[i * 3 + 2] = i;
+		}
+	} else if (ACCESS_FBINFO(fbcon).var.bits_per_pixel > 8) {
+		if (ACCESS_FBINFO(fbcon).var.green.length == 5) {	/* 0..31, 128..159 */
+			int i;
+
+			for (i = 0; i < 32; i++) {
+				/* with p15 == 0 */
+				hw->DACpal[i * 3 + 0] = i << 3;
+				hw->DACpal[i * 3 + 1] = i << 3;
+				hw->DACpal[i * 3 + 2] = i << 3;
+				/* with p15 == 1 */
+				hw->DACpal[(i + 128) * 3 + 0] = i << 3;
+				hw->DACpal[(i + 128) * 3 + 1] = i << 3;
+				hw->DACpal[(i + 128) * 3 + 2] = i << 3;
+			}
+		} else {
+			int i;
+
+			for (i = 0; i < 64; i++) {		/* 0..63 */
+				hw->DACpal[i * 3 + 0] = i << 3;
+				hw->DACpal[i * 3 + 1] = i << 2;
+				hw->DACpal[i * 3 + 2] = i << 3;
+			}
+		}
+	} else {
+		memset(hw->DACpal, 0, 768);
+	}
+	return 0;
+}
+
+static void DAC1064_restore_1(WPMINFO2) {
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+	CRITBEGIN
+
+	if ((inDAC1064(PMINFO DAC1064_XSYSPLLM) != hw->DACclk[3]) ||
+	    (inDAC1064(PMINFO DAC1064_XSYSPLLN) != hw->DACclk[4]) ||
+	    (inDAC1064(PMINFO DAC1064_XSYSPLLP) != hw->DACclk[5])) {
+		outDAC1064(PMINFO DAC1064_XSYSPLLM, hw->DACclk[3]);
+		outDAC1064(PMINFO DAC1064_XSYSPLLN, hw->DACclk[4]);
+		outDAC1064(PMINFO DAC1064_XSYSPLLP, hw->DACclk[5]);
+	}
+	{
+		unsigned int i;
+
+		for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
+			if ((i != POS1064_XPIXCLKCTRL) && (i != POS1064_XMISCCTRL))
+				outDAC1064(PMINFO MGA1064_DAC_regs[i], hw->DACreg[i]);
+		}
+	}
+
+	DAC1064_global_restore(PMINFO2);
+
+	CRITEND
+};
+
+static void DAC1064_restore_2(WPMINFO2) {
+#ifdef DEBUG
+	unsigned int i;
+#endif
+
+	DBG(__FUNCTION__)
+
+#ifdef DEBUG
+	dprintk(KERN_DEBUG "DAC1064regs ");
+	for (i = 0; i < sizeof(MGA1064_DAC_regs); i++) {
+		dprintk("R%02X=%02X ", MGA1064_DAC_regs[i], ACCESS_FBINFO(hw).DACreg[i]);
+		if ((i & 0x7) == 0x7) dprintk("\n" KERN_DEBUG "continuing... ");
+	}
+	dprintk("\n" KERN_DEBUG "DAC1064clk ");
+	for (i = 0; i < 6; i++)
+		dprintk("C%02X=%02X ", i, ACCESS_FBINFO(hw).DACclk[i]);
+	dprintk("\n");
+#endif
+}
+
+static int m1064_compute(void* out, struct my_timming* m) {
+#define minfo ((struct matrox_fb_info*)out)
+	{
+		int i;
+		int tmout;
+		CRITFLAGS
+
+		DAC1064_setpclk(PMINFO m->pixclock);
+
+		CRITBEGIN
+
+		for (i = 0; i < 3; i++)
+			outDAC1064(PMINFO M1064_XPIXPLLCM + i, ACCESS_FBINFO(hw).DACclk[i]);
+		for (tmout = 500000; tmout; tmout--) {
+			if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+				break;
+			udelay(10);
+		};
+
+		CRITEND
+
+		if (!tmout)
+			printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n");
+	}
+#undef minfo
+	return 0;
+}
+
+static struct matrox_altout m1064 = {
+	.name	 = "Primary output",
+	.compute = m1064_compute,
+};
+
+#ifdef CONFIG_FB_MATROX_G
+static int g450_compute(void* out, struct my_timming* m) {
+#define minfo ((struct matrox_fb_info*)out)
+	if (m->mnp < 0) {
+		m->mnp = matroxfb_g450_setclk(PMINFO m->pixclock, (m->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+		if (m->mnp >= 0) {
+			m->pixclock = g450_mnp2f(PMINFO m->mnp);
+		}
+	}
+#undef minfo
+	return 0;
+}
+
+static struct matrox_altout g450out = {
+	.name	 = "Primary output",
+	.compute = g450_compute,
+};
+#endif
+
+#endif /* NEED_DAC1064 */
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static int MGA1064_init(WPMINFO struct my_timming* m) {
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	if (DAC1064_init_1(PMINFO m)) return 1;
+	if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+
+	hw->MiscOutReg = 0xCB;
+	if (m->sync & FB_SYNC_HOR_HIGH_ACT)
+		hw->MiscOutReg &= ~0x40;
+	if (m->sync & FB_SYNC_VERT_HIGH_ACT)
+		hw->MiscOutReg &= ~0x80;
+	if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
+		hw->CRTCEXT[3] |= 0x40;
+
+	if (DAC1064_init_2(PMINFO m)) return 1;
+	return 0;
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+static int MGAG100_init(WPMINFO struct my_timming* m) {
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	if (DAC1064_init_1(PMINFO m)) return 1;
+	hw->MXoptionReg &= ~0x2000;
+	if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+
+	hw->MiscOutReg = 0xEF;
+	if (m->sync & FB_SYNC_HOR_HIGH_ACT)
+		hw->MiscOutReg &= ~0x40;
+	if (m->sync & FB_SYNC_VERT_HIGH_ACT)
+		hw->MiscOutReg &= ~0x80;
+	if (m->sync & FB_SYNC_COMP_HIGH_ACT) /* should be only FB_SYNC_COMP */
+		hw->CRTCEXT[3] |= 0x40;
+
+	if (DAC1064_init_2(PMINFO m)) return 1;
+	return 0;
+}
+#endif	/* G */
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static void MGA1064_ramdac_init(WPMINFO2) {
+
+	DBG(__FUNCTION__)
+
+	/* ACCESS_FBINFO(features.DAC1064.vco_freq_min) = 120000; */
+	ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
+	ACCESS_FBINFO(features.pll.ref_freq)	 = 14318;
+	ACCESS_FBINFO(features.pll.feed_div_min) = 100;
+	ACCESS_FBINFO(features.pll.feed_div_max) = 127;
+	ACCESS_FBINFO(features.pll.in_div_min)	 = 1;
+	ACCESS_FBINFO(features.pll.in_div_max)	 = 31;
+	ACCESS_FBINFO(features.pll.post_shift_max) = 3;
+	ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_EXTERNAL;
+	/* maybe cmdline MCLK= ?, doc says gclk=44MHz, mclk=66MHz... it was 55/83 with old values */
+	DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PLL, 133333);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+/* BIOS environ */
+static int x7AF4 = 0x10;	/* flags, maybe 0x10 = SDRAM, 0x00 = SGRAM??? */
+				/* G100 wants 0x10, G200 SGRAM does not care... */
+#if 0
+static int def50 = 0;	/* reg50, & 0x0F, & 0x3000 (only 0x0000, 0x1000, 0x2000 (0x3000 disallowed and treated as 0) */
+#endif
+
+static void MGAG100_progPixClock(CPMINFO int flags, int m, int n, int p) {
+	int reg;
+	int selClk;
+	int clk;
+
+	DBG(__FUNCTION__)
+
+	outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) | M1064_XPIXCLKCTRL_DIS |
+		   M1064_XPIXCLKCTRL_PLL_UP);
+	switch (flags & 3) {
+		case 0:		reg = M1064_XPIXPLLAM; break;
+		case 1:		reg = M1064_XPIXPLLBM; break;
+		default:	reg = M1064_XPIXPLLCM; break;
+	}
+	outDAC1064(PMINFO reg++, m);
+	outDAC1064(PMINFO reg++, n);
+	outDAC1064(PMINFO reg, p);
+	selClk = mga_inb(M_MISC_REG_READ) & ~0xC;
+	/* there should be flags & 0x03 & case 0/1/else */
+	/* and we should first select source and after that we should wait for PLL */
+	/* and we are waiting for PLL with oscilator disabled... Is it right? */
+	switch (flags & 0x03) {
+		case 0x00:	break;
+		case 0x01:	selClk |= 4; break;
+		default:	selClk |= 0x0C; break;
+	}
+	mga_outb(M_MISC_REG, selClk);
+	for (clk = 500000; clk; clk--) {
+		if (inDAC1064(PMINFO M1064_XPIXPLLSTAT) & 0x40)
+			break;
+		udelay(10);
+	};
+	if (!clk)
+		printk(KERN_ERR "matroxfb: Pixel PLL%c not locked after usual time\n", (reg-M1064_XPIXPLLAM-2)/4 + 'A');
+	selClk = inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_SRC_MASK;
+	switch (flags & 0x0C) {
+		case 0x00:	selClk |= M1064_XPIXCLKCTRL_SRC_PCI; break;
+		case 0x04:	selClk |= M1064_XPIXCLKCTRL_SRC_PLL; break;
+		default:	selClk |= M1064_XPIXCLKCTRL_SRC_EXT; break;
+	}
+	outDAC1064(PMINFO M1064_XPIXCLKCTRL, selClk);
+	outDAC1064(PMINFO M1064_XPIXCLKCTRL, inDAC1064(PMINFO M1064_XPIXCLKCTRL) & ~M1064_XPIXCLKCTRL_DIS);
+}
+
+static void MGAG100_setPixClock(CPMINFO int flags, int freq) {
+	unsigned int m, n, p;
+
+	DBG(__FUNCTION__)
+
+	DAC1064_calcclock(PMINFO freq, ACCESS_FBINFO(max_pixel_clock), &m, &n, &p);
+	MGAG100_progPixClock(PMINFO flags, m, n, p);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static int MGA1064_preinit(WPMINFO2) {
+	static const int vxres_mystique[] = { 512,        640, 768,  800,  832,  960,
+					     1024, 1152, 1280,      1600, 1664, 1920,
+					     2048,    0};
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	/* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
+	ACCESS_FBINFO(capable.text) = 1;
+	ACCESS_FBINFO(capable.vxres) = vxres_mystique;
+	ACCESS_FBINFO(features.accel.has_cacheflush) = 1;
+
+	ACCESS_FBINFO(outputs[0]).output = &m1064;
+	ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
+	ACCESS_FBINFO(outputs[0]).data = MINFO;
+	ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+
+	if (ACCESS_FBINFO(devflags.noinit))
+		return 0;	/* do not modify settings */
+	hw->MXoptionReg &= 0xC0000100;
+	hw->MXoptionReg |= 0x00094E20;
+	if (ACCESS_FBINFO(devflags.novga))
+		hw->MXoptionReg &= ~0x00000100;
+	if (ACCESS_FBINFO(devflags.nobios))
+		hw->MXoptionReg &= ~0x40000000;
+	if (ACCESS_FBINFO(devflags.nopciretry))
+		hw->MXoptionReg |=  0x20000000;
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	mga_setr(M_SEQ_INDEX, 0x01, 0x20);
+	mga_outl(M_CTLWTST, 0x00000000);
+	udelay(200);
+	mga_outl(M_MACCESS, 0x00008000);
+	udelay(100);
+	mga_outl(M_MACCESS, 0x0000C000);
+	return 0;
+}
+
+static void MGA1064_reset(WPMINFO2) {
+
+	DBG(__FUNCTION__);
+
+	MGA1064_ramdac_init(PMINFO2);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+static void g450_mclk_init(WPMINFO2) {
+	/* switch all clocks to PCI source */
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3 & ~0x00300C03);
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+	
+	if (((ACCESS_FBINFO(values).reg.opt3 & 0x000003) == 0x000003) ||
+	    ((ACCESS_FBINFO(values).reg.opt3 & 0x000C00) == 0x000C00) ||
+	    ((ACCESS_FBINFO(values).reg.opt3 & 0x300000) == 0x300000)) {
+		matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.video), M_VIDEO_PLL);
+	} else {
+		unsigned long flags;
+		unsigned int pwr;
+		
+		matroxfb_DAC_lock_irqsave(flags);
+		pwr = inDAC1064(PMINFO M1064_XPWRCTRL) & ~0x02;
+		outDAC1064(PMINFO M1064_XPWRCTRL, pwr);
+		matroxfb_DAC_unlock_irqrestore(flags);
+	}
+	matroxfb_g450_setclk(PMINFO ACCESS_FBINFO(values.pll.system), M_SYSTEM_PLL);
+	
+	/* switch clocks to their real PLL source(s) */
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg | 4);
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION3_REG, ACCESS_FBINFO(values).reg.opt3);
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+
+}
+
+static void g450_memory_init(WPMINFO2) {
+	/* disable memory refresh */
+	ACCESS_FBINFO(hw).MXoptionReg &= ~0x001F8000;
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+	
+	/* set memory interface parameters */
+	ACCESS_FBINFO(hw).MXoptionReg &= ~0x00207E00;
+	ACCESS_FBINFO(hw).MXoptionReg |= 0x00207E00 & ACCESS_FBINFO(values).reg.opt;
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, ACCESS_FBINFO(values).reg.opt2);
+	
+	mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+	
+	/* first set up memory interface with disabled memory interface clocks */
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc & ~0x80000000U);
+	mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+	mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess);
+	/* start memory clocks */
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MEMMISC_REG, ACCESS_FBINFO(values).reg.memmisc | 0x80000000U);
+
+	udelay(200);
+	
+	if (ACCESS_FBINFO(values).memory.ddr && (!ACCESS_FBINFO(values).memory.emrswen || !ACCESS_FBINFO(values).memory.dll)) {
+		mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk & ~0x1000);
+	}
+	mga_outl(M_MACCESS, ACCESS_FBINFO(values).reg.maccess | 0x8000);
+	
+	udelay(200);
+	
+	ACCESS_FBINFO(hw).MXoptionReg |= 0x001F8000 & ACCESS_FBINFO(values).reg.opt;
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+	
+	/* value is written to memory chips only if old != new */
+	mga_outl(M_PLNWT, 0);
+	mga_outl(M_PLNWT, ~0);
+	
+	if (ACCESS_FBINFO(values).reg.mctlwtst != ACCESS_FBINFO(values).reg.mctlwtst_core) {
+		mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst_core);
+	}
+	
+}
+
+static void g450_preinit(WPMINFO2) {
+	u_int32_t c2ctl;
+	u_int8_t curctl;
+	u_int8_t c1ctl;
+	
+	/* ACCESS_FBINFO(hw).MXoptionReg = minfo->values.reg.opt; */
+	ACCESS_FBINFO(hw).MXoptionReg &= 0xC0000100;
+	ACCESS_FBINFO(hw).MXoptionReg |= 0x00000020;
+	if (ACCESS_FBINFO(devflags.novga))
+		ACCESS_FBINFO(hw).MXoptionReg &= ~0x00000100;
+	if (ACCESS_FBINFO(devflags.nobios))
+		ACCESS_FBINFO(hw).MXoptionReg &= ~0x40000000;
+	if (ACCESS_FBINFO(devflags.nopciretry))
+		ACCESS_FBINFO(hw).MXoptionReg |=  0x20000000;
+	ACCESS_FBINFO(hw).MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x03400040;
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+
+	/* Init system clocks */
+		
+	/* stop crtc2 */
+	c2ctl = mga_inl(M_C2CTL);
+	mga_outl(M_C2CTL, c2ctl & ~1);
+	/* stop cursor */
+	curctl = inDAC1064(PMINFO M1064_XCURCTRL);
+	outDAC1064(PMINFO M1064_XCURCTRL, 0);
+	/* stop crtc1 */
+	c1ctl = mga_readr(M_SEQ_INDEX, 1);
+	mga_setr(M_SEQ_INDEX, 1, c1ctl | 0x20);
+
+	g450_mclk_init(PMINFO2);
+	g450_memory_init(PMINFO2);
+	
+	/* set legacy VGA clock sources for DOSEmu or VMware... */
+	matroxfb_g450_setclk(PMINFO 25175, M_PIXEL_PLL_A);
+	matroxfb_g450_setclk(PMINFO 28322, M_PIXEL_PLL_B);
+
+	/* restore crtc1 */
+	mga_setr(M_SEQ_INDEX, 1, c1ctl);
+	
+	/* restore cursor */
+	outDAC1064(PMINFO M1064_XCURCTRL, curctl);
+
+	/* restore crtc2 */
+	mga_outl(M_C2CTL, c2ctl);
+	
+	return;
+}
+
+static int MGAG100_preinit(WPMINFO2) {
+	static const int vxres_g100[] = {  512,        640, 768,  800,  832,  960,
+                                          1024, 1152, 1280,      1600, 1664, 1920,
+                                          2048, 0};
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+        u_int32_t reg50;
+#if 0
+	u_int32_t q;
+#endif
+
+	DBG(__FUNCTION__)
+
+	/* there are some instabilities if in_div > 19 && vco < 61000 */
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+		ACCESS_FBINFO(features.pll.vco_freq_min) = 130000;	/* my sample: >118 */
+	} else {
+		ACCESS_FBINFO(features.pll.vco_freq_min) = 62000;
+	}
+	if (!ACCESS_FBINFO(features.pll.ref_freq)) {
+		ACCESS_FBINFO(features.pll.ref_freq)	 = 27000;
+	}
+	ACCESS_FBINFO(features.pll.feed_div_min) = 7;
+	ACCESS_FBINFO(features.pll.feed_div_max) = 127;
+	ACCESS_FBINFO(features.pll.in_div_min)	 = 1;
+	ACCESS_FBINFO(features.pll.in_div_max)	 = 31;
+	ACCESS_FBINFO(features.pll.post_shift_max) = 3;
+	ACCESS_FBINFO(features.DAC1064.xvrefctrl) = DAC1064_XVREFCTRL_G100_DEFAULT;
+	/* ACCESS_FBINFO(capable.cfb4) = 0; ... preinitialized by 0 */
+	ACCESS_FBINFO(capable.text) = 1;
+	ACCESS_FBINFO(capable.vxres) = vxres_g100;
+	ACCESS_FBINFO(features.accel.has_cacheflush) = 1;
+	ACCESS_FBINFO(capable.plnwt) = ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100
+			? ACCESS_FBINFO(devflags.sgram) : 1;
+
+#ifdef CONFIG_FB_MATROX_G
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+		ACCESS_FBINFO(outputs[0]).output = &g450out;
+	} else
+#endif
+	{
+		ACCESS_FBINFO(outputs[0]).output = &m1064;
+	}
+	ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
+	ACCESS_FBINFO(outputs[0]).data = MINFO;
+	ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+		/* we must do this always, BIOS does not do it for us
+		   and accelerator dies without it */
+		mga_outl(0x1C0C, 0);
+	}
+	if (ACCESS_FBINFO(devflags.noinit))
+		return 0;
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+		g450_preinit(PMINFO2);
+		return 0;
+	}
+	hw->MXoptionReg &= 0xC0000100;
+	hw->MXoptionReg |= 0x00000020;
+	if (ACCESS_FBINFO(devflags.novga))
+		hw->MXoptionReg &= ~0x00000100;
+	if (ACCESS_FBINFO(devflags.nobios))
+		hw->MXoptionReg &= ~0x40000000;
+	if (ACCESS_FBINFO(devflags.nopciretry))
+		hw->MXoptionReg |=  0x20000000;
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	DAC1064_setmclk(PMINFO DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV3 | DAC1064_OPT_SCLK_PCI, 133333);
+
+	if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG100) {
+		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, &reg50);
+		reg50 &= ~0x3000;
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+
+		hw->MXoptionReg |= 0x1080;
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+		mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+		udelay(100);
+		mga_outb(0x1C05, 0x00);
+		mga_outb(0x1C05, 0x80);
+		udelay(100);
+		mga_outb(0x1C05, 0x40);
+		mga_outb(0x1C05, 0xC0);
+		udelay(100);
+		reg50 &= ~0xFF;
+		reg50 |=  0x07;
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+		/* it should help with G100 */
+		mga_outb(M_GRAPHICS_INDEX, 6);
+		mga_outb(M_GRAPHICS_DATA, (mga_inb(M_GRAPHICS_DATA) & 3) | 4);
+		mga_setr(M_EXTVGA_INDEX, 0x03, 0x81);
+		mga_setr(M_EXTVGA_INDEX, 0x04, 0x00);
+		mga_writeb(ACCESS_FBINFO(video.vbase), 0x0000, 0xAA);
+		mga_writeb(ACCESS_FBINFO(video.vbase), 0x0800, 0x55);
+		mga_writeb(ACCESS_FBINFO(video.vbase), 0x4000, 0x55);
+#if 0
+		if (mga_readb(ACCESS_FBINFO(video.vbase), 0x0000) != 0xAA) {
+			hw->MXoptionReg &= ~0x1000;
+		}
+#endif
+		hw->MXoptionReg |= 0x00078020;
+	} else if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG200) {
+		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, &reg50);
+		reg50 &= ~0x3000;
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+
+		if (ACCESS_FBINFO(devflags.memtype) == -1)
+			hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+		else
+			hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
+		if (ACCESS_FBINFO(devflags.sgram))
+			hw->MXoptionReg |= 0x4000;
+		mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+		mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+		udelay(200);
+		mga_outl(M_MACCESS, 0x00000000);
+		mga_outl(M_MACCESS, 0x00008000);
+		udelay(100);
+		mga_outw(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+		hw->MXoptionReg |= 0x00078020;
+	} else {
+		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, &reg50);
+		reg50 &= ~0x00000100;
+		reg50 |=  0x00000000;
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION2_REG, reg50);
+
+		if (ACCESS_FBINFO(devflags.memtype) == -1)
+			hw->MXoptionReg |= ACCESS_FBINFO(values).reg.opt & 0x1C00;
+		else
+			hw->MXoptionReg |= (ACCESS_FBINFO(devflags.memtype) & 7) << 10;
+		if (ACCESS_FBINFO(devflags.sgram))
+			hw->MXoptionReg |= 0x4000;
+		mga_outl(M_CTLWTST, ACCESS_FBINFO(values).reg.mctlwtst);
+		mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+		udelay(200);
+		mga_outl(M_MACCESS, 0x00000000);
+		mga_outl(M_MACCESS, 0x00008000);
+		udelay(100);
+		mga_outl(M_MEMRDBK, ACCESS_FBINFO(values).reg.memrdbk);
+		hw->MXoptionReg |= 0x00040020;
+	}
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	return 0;
+}
+
+static void MGAG100_reset(WPMINFO2) {
+	u_int8_t b;
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	{
+#ifdef G100_BROKEN_IBM_82351
+		u_int32_t d;
+
+		find 1014/22 (IBM/82351); /* if found and bridging Matrox, do some strange stuff */
+		pci_read_config_byte(ibm, PCI_SECONDARY_BUS, &b);
+		if (b == ACCESS_FBINFO(pcidev)->bus->number) {
+			pci_write_config_byte(ibm, PCI_COMMAND+1, 0);	/* disable back-to-back & SERR */
+			pci_write_config_byte(ibm, 0x41, 0xF4);		/* ??? */
+			pci_write_config_byte(ibm, PCI_IO_BASE, 0xF0);	/* ??? */
+			pci_write_config_byte(ibm, PCI_IO_LIMIT, 0x00);	/* ??? */
+		}
+#endif
+		if (!ACCESS_FBINFO(devflags.noinit)) {
+			if (x7AF4 & 8) {
+				hw->MXoptionReg |= 0x40;	/* FIXME... */
+				pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+			}
+			mga_setr(M_EXTVGA_INDEX, 0x06, 0x50);
+		}
+	}
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+		/* either leave MCLK as is... or they were set in preinit */
+		hw->DACclk[3] = inDAC1064(PMINFO DAC1064_XSYSPLLM);
+		hw->DACclk[4] = inDAC1064(PMINFO DAC1064_XSYSPLLN);
+		hw->DACclk[5] = inDAC1064(PMINFO DAC1064_XSYSPLLP);
+	} else {
+		DAC1064_setmclk(PMINFO DAC1064_OPT_RESERVED | DAC1064_OPT_MDIV2 | DAC1064_OPT_GDIV1 | DAC1064_OPT_SCLK_PLL, 133333);
+	}
+	if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400) {
+		if (ACCESS_FBINFO(devflags.dfp_type) == -1) {
+			ACCESS_FBINFO(devflags.dfp_type) = inDAC1064(PMINFO 0x1F);
+		}
+	}
+	if (ACCESS_FBINFO(devflags.noinit))
+		return;
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+	} else {
+		MGAG100_setPixClock(PMINFO 4, 25175);
+		MGAG100_setPixClock(PMINFO 5, 28322);
+		if (x7AF4 & 0x10) {
+			b = inDAC1064(PMINFO M1064_XGENIODATA) & ~1;
+			outDAC1064(PMINFO M1064_XGENIODATA, b);
+			b = inDAC1064(PMINFO M1064_XGENIOCTRL) | 1;
+			outDAC1064(PMINFO M1064_XGENIOCTRL, b);
+		}
+	}
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static void MGA1064_restore(WPMINFO2) {
+	int i;
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+	CRITBEGIN
+
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	mga_outb(M_IEN, 0x00);
+	mga_outb(M_CACHEFLUSH, 0x00);
+
+	CRITEND
+
+	DAC1064_restore_1(PMINFO2);
+	matroxfb_vgaHWrestore(PMINFO2);
+	ACCESS_FBINFO(crtc1.panpos) = -1;
+	for (i = 0; i < 6; i++)
+		mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
+	DAC1064_restore_2(PMINFO2);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+static void MGAG100_restore(WPMINFO2) {
+	int i;
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+	CRITBEGIN
+
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+	CRITEND
+
+	DAC1064_restore_1(PMINFO2);
+	matroxfb_vgaHWrestore(PMINFO2);
+#ifdef CONFIG_FB_MATROX_32MB
+	if (ACCESS_FBINFO(devflags.support32MB))
+		mga_setr(M_EXTVGA_INDEX, 8, hw->CRTCEXT[8]);
+#endif
+	ACCESS_FBINFO(crtc1.panpos) = -1;
+	for (i = 0; i < 6; i++)
+		mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
+	DAC1064_restore_2(PMINFO2);
+}
+#endif
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+struct matrox_switch matrox_mystique = {
+	MGA1064_preinit, MGA1064_reset, MGA1064_init, MGA1064_restore,
+};
+EXPORT_SYMBOL(matrox_mystique);
+#endif
+
+#ifdef CONFIG_FB_MATROX_G
+struct matrox_switch matrox_G100 = {
+	MGAG100_preinit, MGAG100_reset, MGAG100_init, MGAG100_restore,
+};
+EXPORT_SYMBOL(matrox_G100);
+#endif
+
+#ifdef NEED_DAC1064
+EXPORT_SYMBOL(DAC1064_global_init);
+EXPORT_SYMBOL(DAC1064_global_restore);
+#endif
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_DAC1064.h b/drivers/video/matrox/matroxfb_DAC1064.h
new file mode 100644
index 0000000..a6a4701
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_DAC1064.h
@@ -0,0 +1,164 @@
+#ifndef __MATROXFB_DAC1064_H__
+#define __MATROXFB_DAC1064_H__
+
+/* make checkconfig does not walk through include tree */
+#include <linux/config.h>
+
+#include "matroxfb_base.h"
+
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+extern struct matrox_switch matrox_mystique;
+#endif
+#ifdef CONFIG_FB_MATROX_G
+extern struct matrox_switch matrox_G100;
+#endif
+#ifdef NEED_DAC1064
+void DAC1064_global_init(WPMINFO2);
+void DAC1064_global_restore(WPMINFO2);
+#endif
+
+#define M1064_INDEX	0x00
+#define M1064_PALWRADD	0x00
+#define M1064_PALDATA	0x01
+#define M1064_PIXRDMSK	0x02
+#define M1064_PALRDADD	0x03
+#define M1064_X_DATAREG	0x0A
+#define M1064_CURPOSXL	0x0C	/* can be accessed as DWORD */
+#define M1064_CURPOSXH	0x0D
+#define M1064_CURPOSYL	0x0E
+#define M1064_CURPOSYH	0x0F
+
+#define M1064_XCURADDL		0x04
+#define M1064_XCURADDH		0x05
+#define M1064_XCURCTRL		0x06
+#define     M1064_XCURCTRL_DIS		0x00	/* transparent, transparent, transparent, transparent */
+#define     M1064_XCURCTRL_3COLOR	0x01	/* transparent, 0, 1, 2 */
+#define     M1064_XCURCTRL_XGA		0x02	/* 0, 1, transparent, complement */
+#define     M1064_XCURCTRL_XWIN		0x03	/* transparent, transparent, 0, 1 */
+#define M1064_XCURCOL0RED	0x08
+#define M1064_XCURCOL0GREEN	0x09
+#define M1064_XCURCOL0BLUE	0x0A
+#define M1064_XCURCOL1RED	0x0C
+#define M1064_XCURCOL1GREEN	0x0D
+#define M1064_XCURCOL1BLUE	0x0E
+#define M1064_XCURCOL2RED	0x10
+#define M1064_XCURCOL2GREEN	0x11
+#define M1064_XCURCOL2BLUE	0x12
+#define DAC1064_XVREFCTRL	0x18
+#define      DAC1064_XVREFCTRL_INTERNAL		0x3F
+#define      DAC1064_XVREFCTRL_EXTERNAL		0x00
+#define      DAC1064_XVREFCTRL_G100_DEFAULT	0x03
+#define M1064_XMULCTRL		0x19
+#define      M1064_XMULCTRL_DEPTH_8BPP		0x00	/* 8 bpp paletized */
+#define      M1064_XMULCTRL_DEPTH_15BPP_1BPP	0x01	/* 15 bpp paletized + 1 bpp overlay */
+#define      M1064_XMULCTRL_DEPTH_16BPP		0x02	/* 16 bpp paletized */
+#define      M1064_XMULCTRL_DEPTH_24BPP		0x03	/* 24 bpp paletized */
+#define      M1064_XMULCTRL_DEPTH_24BPP_8BPP	0x04	/* 24 bpp direct + 8 bpp overlay paletized */
+#define      M1064_XMULCTRL_2G8V16		0x05	/* 15 bpp video direct, half xres, 8bpp paletized */
+#define      M1064_XMULCTRL_G16V16		0x06	/* 15 bpp video, 15bpp graphics, one of them paletized */
+#define      M1064_XMULCTRL_DEPTH_32BPP		0x07	/* 24 bpp paletized + 8 bpp unused */
+#define      M1064_XMULCTRL_GRAPHICS_PALETIZED	0x00
+#define      M1064_XMULCTRL_VIDEO_PALETIZED	0x08
+#define M1064_XPIXCLKCTRL	0x1A
+#define      M1064_XPIXCLKCTRL_SRC_PCI		0x00
+#define      M1064_XPIXCLKCTRL_SRC_PLL		0x01
+#define      M1064_XPIXCLKCTRL_SRC_EXT		0x02
+#define	     M1064_XPIXCLKCTRL_SRC_SYS		0x03	/* G200/G400 */
+#define      M1064_XPIXCLKCTRL_SRC_PLL2		0x03	/* G450 */
+#define      M1064_XPIXCLKCTRL_SRC_MASK		0x03
+#define      M1064_XPIXCLKCTRL_EN		0x00
+#define      M1064_XPIXCLKCTRL_DIS		0x04
+#define      M1064_XPIXCLKCTRL_PLL_DOWN		0x00
+#define      M1064_XPIXCLKCTRL_PLL_UP		0x08
+#define M1064_XGENCTRL		0x1D
+#define      M1064_XGENCTRL_VS_0		0x00
+#define      M1064_XGENCTRL_VS_1		0x01
+#define      M1064_XGENCTRL_ALPHA_DIS		0x00
+#define      M1064_XGENCTRL_ALPHA_EN		0x02
+#define      M1064_XGENCTRL_BLACK_0IRE		0x00
+#define      M1064_XGENCTRL_BLACK_75IRE		0x10
+#define      M1064_XGENCTRL_SYNC_ON_GREEN	0x00
+#define      M1064_XGENCTRL_NO_SYNC_ON_GREEN	0x20
+#define      M1064_XGENCTRL_SYNC_ON_GREEN_MASK	0x20
+#define M1064_XMISCCTRL		0x1E
+#define      M1064_XMISCCTRL_DAC_DIS		0x00
+#define      M1064_XMISCCTRL_DAC_EN		0x01
+#define      M1064_XMISCCTRL_MFC_VGA		0x00
+#define      M1064_XMISCCTRL_MFC_MAFC		0x02
+#define      M1064_XMISCCTRL_MFC_DIS		0x06
+#define      GX00_XMISCCTRL_MFC_MAFC		0x02
+#define      GX00_XMISCCTRL_MFC_PANELLINK	0x04
+#define      GX00_XMISCCTRL_MFC_DIS		0x06
+#define      GX00_XMISCCTRL_MFC_MASK		0x06
+#define      M1064_XMISCCTRL_DAC_6BIT		0x00
+#define      M1064_XMISCCTRL_DAC_8BIT		0x08
+#define      M1064_XMISCCTRL_DAC_WIDTHMASK	0x08
+#define      M1064_XMISCCTRL_LUT_DIS		0x00
+#define      M1064_XMISCCTRL_LUT_EN		0x10
+#define      G400_XMISCCTRL_VDO_MAFC12		0x00
+#define      G400_XMISCCTRL_VDO_BYPASS656	0x40
+#define      G400_XMISCCTRL_VDO_C2_MAFC12	0x80
+#define      G400_XMISCCTRL_VDO_C2_BYPASS656	0xC0
+#define      G400_XMISCCTRL_VDO_MASK		0xE0
+#define M1064_XGENIOCTRL	0x2A
+#define M1064_XGENIODATA	0x2B
+#define DAC1064_XSYSPLLM	0x2C
+#define DAC1064_XSYSPLLN	0x2D
+#define DAC1064_XSYSPLLP	0x2E
+#define DAC1064_XSYSPLLSTAT	0x2F
+#define M1064_XZOOMCTRL		0x38
+#define      M1064_XZOOMCTRL_1			0x00
+#define      M1064_XZOOMCTRL_2			0x01
+#define      M1064_XZOOMCTRL_4			0x03
+#define M1064_XSENSETEST	0x3A
+#define      M1064_XSENSETEST_BCOMP		0x01
+#define      M1064_XSENSETEST_GCOMP		0x02
+#define      M1064_XSENSETEST_RCOMP		0x04
+#define      M1064_XSENSETEST_PDOWN		0x00
+#define      M1064_XSENSETEST_PUP		0x80
+#define M1064_XCRCREML		0x3C
+#define M1064_XCRCREMH		0x3D
+#define M1064_XCRCBITSEL	0x3E
+#define M1064_XCOLKEYMASKL	0x40
+#define M1064_XCOLKEYMASKH	0x41
+#define M1064_XCOLKEYL		0x42
+#define M1064_XCOLKEYH		0x43
+#define M1064_XPIXPLLAM		0x44
+#define M1064_XPIXPLLAN		0x45
+#define M1064_XPIXPLLAP		0x46
+#define M1064_XPIXPLLBM		0x48
+#define M1064_XPIXPLLBN		0x49
+#define M1064_XPIXPLLBP		0x4A
+#define M1064_XPIXPLLCM		0x4C
+#define M1064_XPIXPLLCN		0x4D
+#define M1064_XPIXPLLCP		0x4E
+#define M1064_XPIXPLLSTAT	0x4F
+
+#define M1064_XTVO_IDX		0x87
+#define M1064_XTVO_DATA		0x88
+
+#define M1064_XOUTPUTCONN	0x8A
+#define M1064_XSYNCCTRL		0x8B
+#define M1064_XVIDPLLSTAT	0x8C
+#define M1064_XVIDPLLP		0x8D
+#define M1064_XVIDPLLM		0x8E
+#define M1064_XVIDPLLN		0x8F
+
+#define M1064_XPWRCTRL		0xA0
+
+#define M1064_XPANMODE		0xA2
+
+enum POS1064 {
+	POS1064_XCURADDL=0, POS1064_XCURADDH, POS1064_XCURCTRL,
+	POS1064_XCURCOL0RED, POS1064_XCURCOL0GREEN, POS1064_XCURCOL0BLUE,
+	POS1064_XCURCOL1RED, POS1064_XCURCOL1GREEN, POS1064_XCURCOL1BLUE,
+	POS1064_XCURCOL2RED, POS1064_XCURCOL2GREEN, POS1064_XCURCOL2BLUE,
+	POS1064_XVREFCTRL, POS1064_XMULCTRL, POS1064_XPIXCLKCTRL, POS1064_XGENCTRL,
+	POS1064_XMISCCTRL,
+	POS1064_XGENIOCTRL, POS1064_XGENIODATA, POS1064_XZOOMCTRL, POS1064_XSENSETEST,
+	POS1064_XCRCBITSEL,
+	POS1064_XCOLKEYMASKL, POS1064_XCOLKEYMASKH, POS1064_XCOLKEYL, POS1064_XCOLKEYH,
+	POS1064_XOUTPUTCONN, POS1064_XPANMODE, POS1064_XPWRCTRL };
+
+
+#endif	/* __MATROXFB_DAC1064_H__ */
diff --git a/drivers/video/matrox/matroxfb_Ti3026.c b/drivers/video/matrox/matroxfb_Ti3026.c
new file mode 100644
index 0000000..537ade5
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_Ti3026.c
@@ -0,0 +1,739 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * MTRR stuff: 1998 Tom Rini <trini@kernel.crashing.org>
+ *
+ * Contributors: "menion?" <menion@mindless.com>
+ *                     Betatesting, fixes, ideas
+ *
+ *               "Kurt Garloff" <garloff@suse.de>
+ *                     Betatesting, fixes, ideas, videomodes, videomodes timmings
+ *
+ *               "Tom Rini" <trini@kernel.crashing.org>
+ *                     MTRR stuff, PPC cleanups, betatesting, fixes, ideas
+ *
+ *               "Bibek Sahu" <scorpio@dodds.net>
+ *                     Access device through readb|w|l and write b|w|l
+ *                     Extensive debugging stuff
+ *
+ *               "Daniel Haun" <haund@usa.net>
+ *                     Testing, hardware cursor fixes
+ *
+ *               "Scott Wood" <sawst46+@pitt.edu>
+ *                     Fixes
+ *
+ *               "Gerd Knorr" <kraxel@goldbach.isdn.cs.tu-berlin.de>
+ *                     Betatesting
+ *
+ *               "Kelly French" <targon@hazmat.com>
+ *               "Fernando Herrera" <fherrera@eurielec.etsit.upm.es>
+ *                     Betatesting, bug reporting
+ *
+ *               "Pablo Bianucci" <pbian@pccp.com.ar>
+ *                     Fixes, ideas, betatesting
+ *
+ *               "Inaky Perez Gonzalez" <inaky@peloncho.fis.ucm.es>
+ *                     Fixes, enhandcements, ideas, betatesting
+ *
+ *               "Ryuichi Oikawa" <roikawa@rr.iiij4u.or.jp>
+ *                     PPC betatesting, PPC support, backward compatibility
+ *
+ *               "Paul Womar" <Paul@pwomar.demon.co.uk>
+ *               "Owen Waller" <O.Waller@ee.qub.ac.uk>
+ *                     PPC betatesting
+ *
+ *               "Thomas Pornin" <pornin@bolet.ens.fr>
+ *                     Alpha betatesting
+ *
+ *               "Pieter van Leuven" <pvl@iae.nl>
+ *               "Ulf Jaenicke-Roessler" <ujr@physik.phy.tu-dresden.de>
+ *                     G100 testing
+ *
+ *               "H. Peter Arvin" <hpa@transmeta.com>
+ *                     Ideas
+ *
+ *               "Cort Dougan" <cort@cs.nmt.edu>
+ *                     CHRP fixes and PReP cleanup
+ *
+ *               "Mark Vojkovich" <mvojkovi@ucsd.edu>
+ *                     G400 support
+ *
+ * (following author is not in any relation with this code, but his code
+ *  is included in this driver)
+ *
+ * Based on framebuffer driver for VBE 2.0 compliant graphic boards
+ *     (c) 1998 Gerd Knorr <kraxel@cs.tu-berlin.de>
+ *
+ * (following author is not in any relation with this code, but his ideas
+ *  were used when writting this driver)
+ *
+ *		 FreeVBE/AF (Matrox), "Shawn Hargreaves" <shawn@talula.demon.co.uk>
+ *
+ */
+
+/* make checkconfig does not verify included files... */
+#include <linux/config.h>
+
+#include "matroxfb_Ti3026.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_accel.h"
+#include <linux/matroxfb.h>
+
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+#define outTi3026 matroxfb_DAC_out
+#define inTi3026 matroxfb_DAC_in
+
+#define TVP3026_INDEX		0x00
+#define TVP3026_PALWRADD	0x00
+#define TVP3026_PALDATA		0x01
+#define TVP3026_PIXRDMSK	0x02
+#define TVP3026_PALRDADD	0x03
+#define TVP3026_CURCOLWRADD	0x04
+#define     TVP3026_CLOVERSCAN		0x00
+#define     TVP3026_CLCOLOR0		0x01
+#define     TVP3026_CLCOLOR1		0x02
+#define     TVP3026_CLCOLOR2		0x03
+#define TVP3026_CURCOLDATA	0x05
+#define TVP3026_CURCOLRDADD	0x07
+#define TVP3026_CURCTRL		0x09
+#define TVP3026_X_DATAREG	0x0A
+#define TVP3026_CURRAMDATA	0x0B
+#define TVP3026_CURPOSXL	0x0C
+#define TVP3026_CURPOSXH	0x0D
+#define TVP3026_CURPOSYL	0x0E
+#define TVP3026_CURPOSYH	0x0F
+
+#define TVP3026_XSILICONREV	0x01
+#define TVP3026_XCURCTRL	0x06
+#define     TVP3026_XCURCTRL_DIS	0x00	/* transparent, transparent, transparent, transparent */
+#define     TVP3026_XCURCTRL_3COLOR	0x01	/* transparent, 0, 1, 2 */
+#define     TVP3026_XCURCTRL_XGA	0x02	/* 0, 1, transparent, complement */
+#define     TVP3026_XCURCTRL_XWIN	0x03	/* transparent, transparent, 0, 1 */
+#define     TVP3026_XCURCTRL_BLANK2048	0x00
+#define     TVP3026_XCURCTRL_BLANK4096	0x10
+#define     TVP3026_XCURCTRL_INTERLACED	0x20
+#define     TVP3026_XCURCTRL_ODD	0x00 /* ext.signal ODD/\EVEN */
+#define     TVP3026_XCURCTRL_EVEN	0x40 /* ext.signal EVEN/\ODD */
+#define     TVP3026_XCURCTRL_INDIRECT	0x00
+#define     TVP3026_XCURCTRL_DIRECT	0x80
+#define TVP3026_XLATCHCTRL	0x0F
+#define     TVP3026_XLATCHCTRL_1_1	0x06
+#define     TVP3026_XLATCHCTRL_2_1	0x07
+#define     TVP3026_XLATCHCTRL_4_1	0x06
+#define     TVP3026_XLATCHCTRL_8_1	0x06
+#define     TVP3026_XLATCHCTRL_16_1	0x06
+#define     TVP3026A_XLATCHCTRL_4_3	0x06	/* ??? do not understand... but it works... !!! */
+#define     TVP3026A_XLATCHCTRL_8_3	0x07
+#define     TVP3026B_XLATCHCTRL_4_3	0x08
+#define     TVP3026B_XLATCHCTRL_8_3	0x06	/* ??? do not understand... but it works... !!! */
+#define TVP3026_XTRUECOLORCTRL	0x18
+#define     TVP3026_XTRUECOLORCTRL_VRAM_SHIFT_ACCEL	0x00
+#define     TVP3026_XTRUECOLORCTRL_VRAM_SHIFT_TVP	0x20
+#define     TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR		0x80
+#define     TVP3026_XTRUECOLORCTRL_TRUECOLOR		0x40 /* paletized */
+#define     TVP3026_XTRUECOLORCTRL_DIRECTCOLOR		0x00
+#define     TVP3026_XTRUECOLORCTRL_24_ALTERNATE		0x08 /* 5:4/5:2 instead of 4:3/8:3 */
+#define     TVP3026_XTRUECOLORCTRL_RGB_888		0x16 /* 4:3/8:3 (or 5:4/5:2) */
+#define	    TVP3026_XTRUECOLORCTRL_BGR_888		0x17
+#define     TVP3026_XTRUECOLORCTRL_ORGB_8888		0x06
+#define     TVP3026_XTRUECOLORCTRL_BGRO_8888		0x07
+#define     TVP3026_XTRUECOLORCTRL_RGB_565		0x05
+#define     TVP3026_XTRUECOLORCTRL_ORGB_1555		0x04
+#define     TVP3026_XTRUECOLORCTRL_RGB_664		0x03
+#define     TVP3026_XTRUECOLORCTRL_RGBO_4444		0x01
+#define TVP3026_XMUXCTRL	0x19
+#define     TVP3026_XMUXCTRL_MEMORY_8BIT			0x01 /* - */
+#define     TVP3026_XMUXCTRL_MEMORY_16BIT			0x02 /* - */
+#define     TVP3026_XMUXCTRL_MEMORY_32BIT			0x03 /* 2MB RAM, 512K * 4 */
+#define     TVP3026_XMUXCTRL_MEMORY_64BIT			0x04 /* >2MB RAM, 512K * 8 & more */
+#define     TVP3026_XMUXCTRL_PIXEL_4BIT				0x40 /* L0,H0,L1,H1... */
+#define     TVP3026_XMUXCTRL_PIXEL_4BIT_SWAPPED			0x60 /* H0,L0,H1,L1... */
+#define     TVP3026_XMUXCTRL_PIXEL_8BIT				0x48
+#define     TVP3026_XMUXCTRL_PIXEL_16BIT			0x50
+#define     TVP3026_XMUXCTRL_PIXEL_32BIT			0x58
+#define     TVP3026_XMUXCTRL_VGA				0x98 /* VGA MEMORY, 8BIT PIXEL */
+#define TVP3026_XCLKCTRL	0x1A
+#define     TVP3026_XCLKCTRL_DIV1	0x00
+#define     TVP3026_XCLKCTRL_DIV2	0x10
+#define     TVP3026_XCLKCTRL_DIV4	0x20
+#define     TVP3026_XCLKCTRL_DIV8	0x30
+#define     TVP3026_XCLKCTRL_DIV16	0x40
+#define     TVP3026_XCLKCTRL_DIV32	0x50
+#define     TVP3026_XCLKCTRL_DIV64	0x60
+#define     TVP3026_XCLKCTRL_CLKSTOPPED	0x70
+#define     TVP3026_XCLKCTRL_SRC_CLK0	0x00
+#define     TVP3026_XCLKCTRL_SRC_CLK1   0x01
+#define     TVP3026_XCLKCTRL_SRC_CLK2	0x02	/* CLK2 is TTL source*/
+#define     TVP3026_XCLKCTRL_SRC_NCLK2	0x03	/* not CLK2 is TTL source */
+#define     TVP3026_XCLKCTRL_SRC_ECLK2	0x04	/* CLK2 and not CLK2 is ECL source */
+#define     TVP3026_XCLKCTRL_SRC_PLL	0x05
+#define     TVP3026_XCLKCTRL_SRC_DIS	0x06	/* disable & poweroff internal clock */
+#define     TVP3026_XCLKCTRL_SRC_CLK0VGA 0x07
+#define TVP3026_XPALETTEPAGE	0x1C
+#define TVP3026_XGENCTRL	0x1D
+#define     TVP3026_XGENCTRL_HSYNC_POS	0x00
+#define     TVP3026_XGENCTRL_HSYNC_NEG	0x01
+#define     TVP3026_XGENCTRL_VSYNC_POS	0x00
+#define     TVP3026_XGENCTRL_VSYNC_NEG	0x02
+#define     TVP3026_XGENCTRL_LITTLE_ENDIAN 0x00
+#define     TVP3026_XGENCTRL_BIG_ENDIAN    0x08
+#define     TVP3026_XGENCTRL_BLACK_0IRE		0x00
+#define     TVP3026_XGENCTRL_BLACK_75IRE	0x10
+#define     TVP3026_XGENCTRL_NO_SYNC_ON_GREEN	0x00
+#define     TVP3026_XGENCTRL_SYNC_ON_GREEN	0x20
+#define     TVP3026_XGENCTRL_OVERSCAN_DIS	0x00
+#define     TVP3026_XGENCTRL_OVERSCAN_EN	0x40
+#define TVP3026_XMISCCTRL	0x1E
+#define     TVP3026_XMISCCTRL_DAC_PUP	0x00
+#define     TVP3026_XMISCCTRL_DAC_PDOWN	0x01
+#define     TVP3026_XMISCCTRL_DAC_EXT	0x00 /* or 8, bit 3 is ignored */
+#define     TVP3026_XMISCCTRL_DAC_6BIT	0x04
+#define     TVP3026_XMISCCTRL_DAC_8BIT	0x0C
+#define     TVP3026_XMISCCTRL_PSEL_DIS	0x00
+#define     TVP3026_XMISCCTRL_PSEL_EN	0x10
+#define     TVP3026_XMISCCTRL_PSEL_LOW	0x00 /* PSEL high selects directcolor */
+#define     TVP3026_XMISCCTRL_PSEL_HIGH 0x20 /* PSEL high selects truecolor or pseudocolor */
+#define TVP3026_XGENIOCTRL	0x2A
+#define TVP3026_XGENIODATA	0x2B
+#define TVP3026_XPLLADDR	0x2C
+#define     TVP3026_XPLLADDR_X(LOOP,MCLK,PIX) (((LOOP)<<4) | ((MCLK)<<2) | (PIX))
+#define     TVP3026_XPLLDATA_N		0x00
+#define     TVP3026_XPLLDATA_M		0x01
+#define     TVP3026_XPLLDATA_P		0x02
+#define     TVP3026_XPLLDATA_STAT	0x03
+#define TVP3026_XPIXPLLDATA	0x2D
+#define TVP3026_XMEMPLLDATA	0x2E
+#define TVP3026_XLOOPPLLDATA	0x2F
+#define TVP3026_XCOLKEYOVRMIN	0x30
+#define TVP3026_XCOLKEYOVRMAX	0x31
+#define TVP3026_XCOLKEYREDMIN	0x32
+#define TVP3026_XCOLKEYREDMAX	0x33
+#define TVP3026_XCOLKEYGREENMIN	0x34
+#define TVP3026_XCOLKEYGREENMAX	0x35
+#define TVP3026_XCOLKEYBLUEMIN	0x36
+#define TVP3026_XCOLKEYBLUEMAX	0x37
+#define TVP3026_XCOLKEYCTRL	0x38
+#define     TVP3026_XCOLKEYCTRL_OVR_EN	0x01
+#define     TVP3026_XCOLKEYCTRL_RED_EN	0x02
+#define     TVP3026_XCOLKEYCTRL_GREEN_EN 0x04
+#define     TVP3026_XCOLKEYCTRL_BLUE_EN	0x08
+#define     TVP3026_XCOLKEYCTRL_NEGATE	0x10
+#define     TVP3026_XCOLKEYCTRL_ZOOM1	0x00
+#define     TVP3026_XCOLKEYCTRL_ZOOM2	0x20
+#define     TVP3026_XCOLKEYCTRL_ZOOM4	0x40
+#define     TVP3026_XCOLKEYCTRL_ZOOM8	0x60
+#define     TVP3026_XCOLKEYCTRL_ZOOM16	0x80
+#define     TVP3026_XCOLKEYCTRL_ZOOM32	0xA0
+#define TVP3026_XMEMPLLCTRL	0x39
+#define     TVP3026_XMEMPLLCTRL_DIV(X)	(((X)-1)>>1)	/* 2,4,6,8,10,12,14,16, division applied to LOOP PLL after divide by 2^P */
+#define     TVP3026_XMEMPLLCTRL_STROBEMKC4	0x08
+#define     TVP3026_XMEMPLLCTRL_MCLK_DOTCLOCK	0x00	/* MKC4 */
+#define     TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL	0x10	/* MKC4 */
+#define     TVP3026_XMEMPLLCTRL_RCLK_PIXPLL	0x00
+#define     TVP3026_XMEMPLLCTRL_RCLK_LOOPPLL	0x20
+#define     TVP3026_XMEMPLLCTRL_RCLK_DOTDIVN	0x40	/* dot clock divided by loop pclk N prescaler */
+#define TVP3026_XSENSETEST	0x3A
+#define TVP3026_XTESTMODEDATA	0x3B
+#define TVP3026_XCRCREML	0x3C
+#define TVP3026_XCRCREMH	0x3D
+#define TVP3026_XCRCBITSEL	0x3E
+#define TVP3026_XID		0x3F
+
+static const unsigned char DACseq[] =
+{ TVP3026_XLATCHCTRL, TVP3026_XTRUECOLORCTRL,
+  TVP3026_XMUXCTRL, TVP3026_XCLKCTRL,
+  TVP3026_XPALETTEPAGE,
+  TVP3026_XGENCTRL,
+  TVP3026_XMISCCTRL,
+  TVP3026_XGENIOCTRL,
+  TVP3026_XGENIODATA,
+  TVP3026_XCOLKEYOVRMIN, TVP3026_XCOLKEYOVRMAX, TVP3026_XCOLKEYREDMIN, TVP3026_XCOLKEYREDMAX,
+  TVP3026_XCOLKEYGREENMIN, TVP3026_XCOLKEYGREENMAX, TVP3026_XCOLKEYBLUEMIN, TVP3026_XCOLKEYBLUEMAX,
+  TVP3026_XCOLKEYCTRL,
+  TVP3026_XMEMPLLCTRL, TVP3026_XSENSETEST, TVP3026_XCURCTRL };
+
+#define POS3026_XLATCHCTRL	0
+#define POS3026_XTRUECOLORCTRL	1
+#define POS3026_XMUXCTRL	2
+#define POS3026_XCLKCTRL	3
+#define POS3026_XGENCTRL	5
+#define POS3026_XMISCCTRL	6
+#define POS3026_XMEMPLLCTRL	18
+#define POS3026_XCURCTRL	20
+
+static const unsigned char MGADACbpp32[] =
+{ TVP3026_XLATCHCTRL_2_1, TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_8888,
+  0x00, TVP3026_XCLKCTRL_DIV1 | TVP3026_XCLKCTRL_SRC_PLL,
+  0x00,
+  TVP3026_XGENCTRL_HSYNC_POS | TVP3026_XGENCTRL_VSYNC_POS | TVP3026_XGENCTRL_LITTLE_ENDIAN | TVP3026_XGENCTRL_BLACK_0IRE | TVP3026_XGENCTRL_NO_SYNC_ON_GREEN | TVP3026_XGENCTRL_OVERSCAN_DIS,
+  TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_8BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_HIGH,
+  0x00,
+  0x1E,
+  0xFF, 0xFF, 0xFF, 0xFF,
+  0xFF, 0xFF, 0xFF, 0xFF,
+  TVP3026_XCOLKEYCTRL_ZOOM1,
+  0x00, 0x00, TVP3026_XCURCTRL_DIS };
+
+static int Ti3026_calcclock(CPMINFO unsigned int freq, unsigned int fmax, int* in, int* feed, int* post) {
+	unsigned int fvco;
+	unsigned int lin, lfeed, lpost;
+
+	DBG(__FUNCTION__)
+
+	fvco = PLL_calcclock(PMINFO freq, fmax, &lin, &lfeed, &lpost);
+	fvco >>= (*post = lpost);
+	*in = 64 - lin;
+	*feed = 64 - lfeed;
+	return fvco;
+}
+
+static int Ti3026_setpclk(WPMINFO int clk) {
+	unsigned int f_pll;
+	unsigned int pixfeed, pixin, pixpost;
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	f_pll = Ti3026_calcclock(PMINFO clk, ACCESS_FBINFO(max_pixel_clock), &pixin, &pixfeed, &pixpost);
+
+	hw->DACclk[0] = pixin | 0xC0;
+	hw->DACclk[1] = pixfeed;
+	hw->DACclk[2] = pixpost | 0xB0;
+
+	{
+		unsigned int loopfeed, loopin, looppost, loopdiv, z;
+		unsigned int Bpp;
+
+		Bpp = ACCESS_FBINFO(curr.final_bppShift);
+
+		if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+			loopfeed = 3;		/* set lm to any possible value */
+			loopin = 3 * 32 / Bpp;
+		} else {
+			loopfeed = 4;
+			loopin = 4 * 32 / Bpp;
+		}
+		z = (110000 * loopin) / (f_pll * loopfeed);
+		loopdiv = 0; /* div 2 */
+		if (z < 2)
+			looppost = 0;
+		else if (z < 4)
+			looppost = 1;
+		else if (z < 8)
+			looppost = 2;
+		else {
+			looppost = 3;
+			loopdiv = z/16;
+		}
+		if (ACCESS_FBINFO(fbcon).var.bits_per_pixel == 24) {
+			hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
+			hw->DACclk[4] = (65 - loopfeed) | 0x80;
+			if (ACCESS_FBINFO(accel.ramdac_rev) > 0x20) {
+				if (isInterleave(MINFO))
+					hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_8_3;
+				else {
+					hw->DACclk[4] &= ~0xC0;
+					hw->DACreg[POS3026_XLATCHCTRL] = TVP3026B_XLATCHCTRL_4_3;
+				}
+			} else {
+				if (isInterleave(MINFO))
+					;	/* default... */
+				else {
+					hw->DACclk[4] ^= 0xC0;	/* change from 0x80 to 0x40 */
+					hw->DACreg[POS3026_XLATCHCTRL] = TVP3026A_XLATCHCTRL_4_3;
+				}
+			}
+			hw->DACclk[5] = looppost | 0xF8;
+			if (ACCESS_FBINFO(devflags.mga_24bpp_fix))
+				hw->DACclk[5] ^= 0x40;
+		} else {
+			hw->DACclk[3] = ((65 - loopin) & 0x3F) | 0xC0;
+			hw->DACclk[4] = 65 - loopfeed;
+			hw->DACclk[5] = looppost | 0xF0;
+		}
+		hw->DACreg[POS3026_XMEMPLLCTRL] = loopdiv | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_RCLK_LOOPPLL;
+	}
+	return 0;
+}
+
+static int Ti3026_init(WPMINFO struct my_timming* m) {
+	u_int8_t muxctrl = isInterleave(MINFO) ? TVP3026_XMUXCTRL_MEMORY_64BIT : TVP3026_XMUXCTRL_MEMORY_32BIT;
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	memcpy(hw->DACreg, MGADACbpp32, sizeof(hw->DACreg));
+	switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+		case 4:	hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_16_1;	/* or _8_1, they are same */
+			hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR;
+			hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_4BIT;
+			hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV8;
+			hw->DACreg[POS3026_XMISCCTRL] = TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_8BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_LOW;
+			break;
+		case 8: hw->DACreg[POS3026_XLATCHCTRL] = TVP3026_XLATCHCTRL_8_1;	/* or _4_1, they are same */
+			hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR;
+			hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_8BIT;
+			hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV4;
+			hw->DACreg[POS3026_XMISCCTRL] = TVP3026_XMISCCTRL_DAC_PUP | TVP3026_XMISCCTRL_DAC_8BIT | TVP3026_XMISCCTRL_PSEL_DIS | TVP3026_XMISCCTRL_PSEL_LOW;
+			break;
+		case 16:
+			/* XLATCHCTRL should be _4_1 / _2_1... Why is not? (_2_1 is used everytime) */
+			hw->DACreg[POS3026_XTRUECOLORCTRL] = (ACCESS_FBINFO(fbcon).var.green.length == 5)? (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_ORGB_1555 ) : (TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_565);
+			hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_16BIT;
+			hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV2;
+			break;
+		case 24:
+			/* XLATCHCTRL is: for (A) use _4_3 (?_8_3 is same? TBD), for (B) it is set in setpclk */
+			hw->DACreg[POS3026_XTRUECOLORCTRL] = TVP3026_XTRUECOLORCTRL_DIRECTCOLOR | TVP3026_XTRUECOLORCTRL_RGB_888;
+			hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_32BIT;
+			hw->DACreg[POS3026_XCLKCTRL] = TVP3026_XCLKCTRL_SRC_PLL | TVP3026_XCLKCTRL_DIV4;
+			break;
+		case 32:
+			/* XLATCHCTRL should be _2_1 / _1_1... Why is not? (_2_1 is used everytime) */
+			hw->DACreg[POS3026_XMUXCTRL] = muxctrl | TVP3026_XMUXCTRL_PIXEL_32BIT;
+			break;
+		default:
+			return 1;	/* TODO: failed */
+	}
+	if (matroxfb_vgaHWinit(PMINFO m)) return 1;
+
+	/* set SYNC */
+	hw->MiscOutReg = 0xCB;
+	if (m->sync & FB_SYNC_HOR_HIGH_ACT)
+		hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_HSYNC_NEG;
+	if (m->sync & FB_SYNC_VERT_HIGH_ACT)
+		hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_VSYNC_NEG;
+	if (m->sync & FB_SYNC_ON_GREEN)
+		hw->DACreg[POS3026_XGENCTRL] |= TVP3026_XGENCTRL_SYNC_ON_GREEN;
+
+	/* set DELAY */
+	if (ACCESS_FBINFO(video.len) < 0x400000)
+		hw->CRTCEXT[3] |= 0x08;
+	else if (ACCESS_FBINFO(video.len) > 0x400000)
+		hw->CRTCEXT[3] |= 0x10;
+
+	/* set HWCURSOR */
+	if (m->interlaced) {
+		hw->DACreg[POS3026_XCURCTRL] |= TVP3026_XCURCTRL_INTERLACED;
+	}
+	if (m->HTotal >= 1536)
+		hw->DACreg[POS3026_XCURCTRL] |= TVP3026_XCURCTRL_BLANK4096;
+
+	/* set interleaving */
+	hw->MXoptionReg &= ~0x00001000;
+	if (isInterleave(MINFO)) hw->MXoptionReg |= 0x00001000;
+
+	/* set DAC */
+	Ti3026_setpclk(PMINFO m->pixclock);
+	return 0;
+}
+
+static void ti3026_setMCLK(WPMINFO int fout){
+	unsigned int f_pll;
+	unsigned int pclk_m, pclk_n, pclk_p;
+	unsigned int mclk_m, mclk_n, mclk_p;
+	unsigned int rfhcnt, mclk_ctl;
+	int tmout;
+
+	DBG(__FUNCTION__)
+
+	f_pll = Ti3026_calcclock(PMINFO fout, ACCESS_FBINFO(max_pixel_clock), &mclk_n, &mclk_m, &mclk_p);
+
+	/* save pclk */
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
+	pclk_n = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFD);
+	pclk_m = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
+	pclk_p = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+
+	/* stop pclk */
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
+	outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+
+	/* set pclk to new mclk */
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
+	outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_n | 0xC0);
+	outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_m);
+	outTi3026(PMINFO TVP3026_XPIXPLLDATA, mclk_p | 0xB0);
+
+	/* wait for PLL to lock */
+	for (tmout = 500000; tmout; tmout--) {
+		if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+			break;
+		udelay(10);
+	};
+	if (!tmout)
+		printk(KERN_ERR "matroxfb: Temporary pixel PLL not locked after 5 secs\n");
+
+	/* output pclk on mclk pin */
+	mclk_ctl = inTi3026(PMINFO TVP3026_XMEMPLLCTRL);
+	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, mclk_ctl & 0xE7);
+	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+
+	/* stop MCLK */
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFB);
+	outTi3026(PMINFO TVP3026_XMEMPLLDATA, 0x00);
+
+	/* set mclk to new freq */
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0xF3);
+	outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_n | 0xC0);
+	outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_m);
+	outTi3026(PMINFO TVP3026_XMEMPLLDATA, mclk_p | 0xB0);
+
+	/* wait for PLL to lock */
+	for (tmout = 500000; tmout; tmout--) {
+		if (inTi3026(PMINFO TVP3026_XMEMPLLDATA) & 0x40)
+			break;
+		udelay(10);
+	}
+	if (!tmout)
+		printk(KERN_ERR "matroxfb: Memory PLL not locked after 5 secs\n");
+
+	f_pll = f_pll * 333 / (10000 << mclk_p);
+	if (isMilleniumII(MINFO)) {
+		rfhcnt = (f_pll - 128) / 256;
+		if (rfhcnt > 15)
+			rfhcnt = 15;
+	} else {
+		rfhcnt = (f_pll - 64) / 128;
+		if (rfhcnt > 15)
+			rfhcnt = 0;
+	}
+	ACCESS_FBINFO(hw).MXoptionReg = (ACCESS_FBINFO(hw).MXoptionReg & ~0x000F0000) | (rfhcnt << 16);
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, ACCESS_FBINFO(hw).MXoptionReg);
+
+	/* output MCLK to MCLK pin */
+	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl & 0xE7) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, (mclk_ctl       ) | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL | TVP3026_XMEMPLLCTRL_STROBEMKC4);
+
+	/* stop PCLK */
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFE);
+	outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+
+	/* restore pclk */
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0xFC);
+	outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_n);
+	outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_m);
+	outTi3026(PMINFO TVP3026_XPIXPLLDATA, pclk_p);
+
+	/* wait for PLL to lock */
+	for (tmout = 500000; tmout; tmout--) {
+		if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+			break;
+		udelay(10);
+	}
+	if (!tmout)
+		printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n");
+}
+
+static void ti3026_ramdac_init(WPMINFO2) {
+
+	DBG(__FUNCTION__)
+
+	ACCESS_FBINFO(features.pll.vco_freq_min) = 110000;
+	ACCESS_FBINFO(features.pll.ref_freq)	 = 114545;
+	ACCESS_FBINFO(features.pll.feed_div_min) = 2;
+	ACCESS_FBINFO(features.pll.feed_div_max) = 24;
+	ACCESS_FBINFO(features.pll.in_div_min)	 = 2;
+	ACCESS_FBINFO(features.pll.in_div_max)	 = 63;
+	ACCESS_FBINFO(features.pll.post_shift_max) = 3;
+	if (ACCESS_FBINFO(devflags.noinit))
+		return;
+	ti3026_setMCLK(PMINFO 60000);
+}
+
+static void Ti3026_restore(WPMINFO2) {
+	int i;
+	unsigned char progdac[6];
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+#ifdef DEBUG
+	dprintk(KERN_INFO "EXTVGA regs: ");
+	for (i = 0; i < 6; i++)
+		dprintk("%02X:", hw->CRTCEXT[i]);
+	dprintk("\n");
+#endif
+
+	CRITBEGIN
+
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+
+	CRITEND
+
+	matroxfb_vgaHWrestore(PMINFO2);
+
+	CRITBEGIN
+
+	ACCESS_FBINFO(crtc1.panpos) = -1;
+	for (i = 0; i < 6; i++)
+		mga_setr(M_EXTVGA_INDEX, i, hw->CRTCEXT[i]);
+
+	for (i = 0; i < 21; i++) {
+		outTi3026(PMINFO DACseq[i], hw->DACreg[i]);
+	}
+
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+	progdac[0] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+	progdac[3] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0x15);
+	progdac[1] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+	progdac[4] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
+	progdac[2] = inTi3026(PMINFO TVP3026_XPIXPLLDATA);
+	progdac[5] = inTi3026(PMINFO TVP3026_XLOOPPLLDATA);
+
+	CRITEND
+	if (memcmp(hw->DACclk, progdac, 6)) {
+		/* agrhh... setting up PLL is very slow on Millennium... */
+		/* Mystique PLL is locked in few ms, but Millennium PLL lock takes about 0.15 s... */
+		/* Maybe even we should call schedule() ? */
+
+		CRITBEGIN
+		outTi3026(PMINFO TVP3026_XCLKCTRL, hw->DACreg[POS3026_XCLKCTRL]);
+		outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
+		outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0);
+		outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0);
+
+		outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+		for (i = 0; i < 3; i++)
+			outTi3026(PMINFO TVP3026_XPIXPLLDATA, hw->DACclk[i]);
+		/* wait for PLL only if PLL clock requested (always for PowerMode, never for VGA) */
+		if (hw->MiscOutReg & 0x08) {
+			int tmout;
+			outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+			for (tmout = 500000; tmout; --tmout) {
+				if (inTi3026(PMINFO TVP3026_XPIXPLLDATA) & 0x40)
+					break;
+				udelay(10);
+			}
+
+			CRITEND
+
+			if (!tmout)
+				printk(KERN_ERR "matroxfb: Pixel PLL not locked after 5 secs\n");
+			else
+				dprintk(KERN_INFO "PixelPLL: %d\n", 500000-tmout);
+			CRITBEGIN
+		}
+		outTi3026(PMINFO TVP3026_XMEMPLLCTRL, hw->DACreg[POS3026_XMEMPLLCTRL]);
+		outTi3026(PMINFO TVP3026_XPLLADDR, 0x00);
+		for (i = 3; i < 6; i++)
+			outTi3026(PMINFO TVP3026_XLOOPPLLDATA, hw->DACclk[i]);
+		CRITEND
+		if ((hw->MiscOutReg & 0x08) && ((hw->DACclk[5] & 0x80) == 0x80)) {
+			int tmout;
+
+			CRITBEGIN
+			outTi3026(PMINFO TVP3026_XPLLADDR, 0x3F);
+			for (tmout = 500000; tmout; --tmout) {
+				if (inTi3026(PMINFO TVP3026_XLOOPPLLDATA) & 0x40)
+					break;
+				udelay(10);
+			}
+			CRITEND
+			if (!tmout)
+				printk(KERN_ERR "matroxfb: Loop PLL not locked after 5 secs\n");
+			else
+				dprintk(KERN_INFO "LoopPLL: %d\n", 500000-tmout);
+		}
+	}
+
+#ifdef DEBUG
+	dprintk(KERN_DEBUG "3026DACregs ");
+	for (i = 0; i < 21; i++) {
+		dprintk("R%02X=%02X ", DACseq[i], hw->DACreg[i]);
+		if ((i & 0x7) == 0x7) dprintk("\n" KERN_DEBUG "continuing... ");
+	}
+	dprintk("\n" KERN_DEBUG "DACclk ");
+	for (i = 0; i < 6; i++)
+		dprintk("C%02X=%02X ", i, hw->DACclk[i]);
+	dprintk("\n");
+#endif
+}
+
+static void Ti3026_reset(WPMINFO2) {
+
+	DBG(__FUNCTION__)
+
+	ti3026_ramdac_init(PMINFO2);
+}
+
+static struct matrox_altout ti3026_output = {
+	.name	 = "Primary output",
+};
+
+static int Ti3026_preinit(WPMINFO2) {
+	static const int vxres_mill2[] = { 512,        640, 768,  800,  832,  960,
+					  1024, 1152, 1280,      1600, 1664, 1920,
+					  2048, 0};
+	static const int vxres_mill1[] = {             640, 768,  800,        960,
+					  1024, 1152, 1280,      1600,       1920,
+					  2048, 0};
+	struct matrox_hw_state* hw = &ACCESS_FBINFO(hw);
+
+	DBG(__FUNCTION__)
+
+	ACCESS_FBINFO(millenium) = 1;
+	ACCESS_FBINFO(milleniumII) = (ACCESS_FBINFO(pcidev)->device != PCI_DEVICE_ID_MATROX_MIL);
+	ACCESS_FBINFO(capable.cfb4) = 1;
+	ACCESS_FBINFO(capable.text) = 1; /* isMilleniumII(MINFO); */
+	ACCESS_FBINFO(capable.vxres) = isMilleniumII(MINFO)?vxres_mill2:vxres_mill1;
+
+	ACCESS_FBINFO(outputs[0]).data = MINFO;
+	ACCESS_FBINFO(outputs[0]).output = &ti3026_output;
+	ACCESS_FBINFO(outputs[0]).src = ACCESS_FBINFO(outputs[0]).default_src;
+	ACCESS_FBINFO(outputs[0]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+
+	if (ACCESS_FBINFO(devflags.noinit))
+		return 0;
+	/* preserve VGA I/O, BIOS and PPC */
+	hw->MXoptionReg &= 0xC0000100;
+	hw->MXoptionReg |= 0x002C0000;
+	if (ACCESS_FBINFO(devflags.novga))
+		hw->MXoptionReg &= ~0x00000100;
+	if (ACCESS_FBINFO(devflags.nobios))
+		hw->MXoptionReg &= ~0x40000000;
+	if (ACCESS_FBINFO(devflags.nopciretry))
+		hw->MXoptionReg |=  0x20000000;
+	pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, hw->MXoptionReg);
+
+	ACCESS_FBINFO(accel.ramdac_rev) = inTi3026(PMINFO TVP3026_XSILICONREV);
+
+	outTi3026(PMINFO TVP3026_XCLKCTRL, TVP3026_XCLKCTRL_SRC_CLK0VGA | TVP3026_XCLKCTRL_CLKSTOPPED);
+	outTi3026(PMINFO TVP3026_XTRUECOLORCTRL, TVP3026_XTRUECOLORCTRL_PSEUDOCOLOR);
+	outTi3026(PMINFO TVP3026_XMUXCTRL, TVP3026_XMUXCTRL_VGA);
+
+	outTi3026(PMINFO TVP3026_XPLLADDR, 0x2A);
+	outTi3026(PMINFO TVP3026_XLOOPPLLDATA, 0x00);
+	outTi3026(PMINFO TVP3026_XPIXPLLDATA, 0x00);
+
+	mga_outb(M_MISC_REG, 0x67);
+
+	outTi3026(PMINFO TVP3026_XMEMPLLCTRL, TVP3026_XMEMPLLCTRL_STROBEMKC4 | TVP3026_XMEMPLLCTRL_MCLK_MCLKPLL);
+
+	mga_outl(M_RESET, 1);
+	udelay(250);
+	mga_outl(M_RESET, 0);
+	udelay(250);
+	mga_outl(M_MACCESS, 0x00008000);
+	udelay(10);
+	return 0;
+}
+
+struct matrox_switch matrox_millennium = {
+	Ti3026_preinit, Ti3026_reset, Ti3026_init, Ti3026_restore
+};
+EXPORT_SYMBOL(matrox_millennium);
+#endif
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_Ti3026.h b/drivers/video/matrox/matroxfb_Ti3026.h
new file mode 100644
index 0000000..541933d
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_Ti3026.h
@@ -0,0 +1,13 @@
+#ifndef __MATROXFB_TI3026_H__
+#define __MATROXFB_TI3026_H__
+
+/* make checkconfig does not walk through whole include tree */
+#include <linux/config.h>
+
+#include "matroxfb_base.h"
+
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+extern struct matrox_switch matrox_millennium;
+#endif
+
+#endif	/* __MATROXFB_TI3026_H__ */
diff --git a/drivers/video/matrox/matroxfb_accel.c b/drivers/video/matrox/matroxfb_accel.c
new file mode 100644
index 0000000..c7f3e13
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_accel.c
@@ -0,0 +1,497 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * MTRR stuff: 1998 Tom Rini <trini@kernel.crashing.org>
+ *
+ * Contributors: "menion?" <menion@mindless.com>
+ *                     Betatesting, fixes, ideas
+ *
+ *               "Kurt Garloff" <garloff@suse.de>
+ *                     Betatesting, fixes, ideas, videomodes, videomodes timmings
+ *
+ *               "Tom Rini" <trini@kernel.crashing.org>
+ *                     MTRR stuff, PPC cleanups, betatesting, fixes, ideas
+ *
+ *               "Bibek Sahu" <scorpio@dodds.net>
+ *                     Access device through readb|w|l and write b|w|l
+ *                     Extensive debugging stuff
+ *
+ *               "Daniel Haun" <haund@usa.net>
+ *                     Testing, hardware cursor fixes
+ *
+ *               "Scott Wood" <sawst46+@pitt.edu>
+ *                     Fixes
+ *
+ *               "Gerd Knorr" <kraxel@goldbach.isdn.cs.tu-berlin.de>
+ *                     Betatesting
+ *
+ *               "Kelly French" <targon@hazmat.com>
+ *               "Fernando Herrera" <fherrera@eurielec.etsit.upm.es>
+ *                     Betatesting, bug reporting
+ *
+ *               "Pablo Bianucci" <pbian@pccp.com.ar>
+ *                     Fixes, ideas, betatesting
+ *
+ *               "Inaky Perez Gonzalez" <inaky@peloncho.fis.ucm.es>
+ *                     Fixes, enhandcements, ideas, betatesting
+ *
+ *               "Ryuichi Oikawa" <roikawa@rr.iiij4u.or.jp>
+ *                     PPC betatesting, PPC support, backward compatibility
+ *
+ *               "Paul Womar" <Paul@pwomar.demon.co.uk>
+ *               "Owen Waller" <O.Waller@ee.qub.ac.uk>
+ *                     PPC betatesting
+ *
+ *               "Thomas Pornin" <pornin@bolet.ens.fr>
+ *                     Alpha betatesting
+ *
+ *               "Pieter van Leuven" <pvl@iae.nl>
+ *               "Ulf Jaenicke-Roessler" <ujr@physik.phy.tu-dresden.de>
+ *                     G100 testing
+ *
+ *               "H. Peter Arvin" <hpa@transmeta.com>
+ *                     Ideas
+ *
+ *               "Cort Dougan" <cort@cs.nmt.edu>
+ *                     CHRP fixes and PReP cleanup
+ *
+ *               "Mark Vojkovich" <mvojkovi@ucsd.edu>
+ *                     G400 support
+ *
+ * (following author is not in any relation with this code, but his code
+ *  is included in this driver)
+ *
+ * Based on framebuffer driver for VBE 2.0 compliant graphic boards
+ *     (c) 1998 Gerd Knorr <kraxel@cs.tu-berlin.de>
+ *
+ * (following author is not in any relation with this code, but his ideas
+ *  were used when writting this driver)
+ *
+ *		 FreeVBE/AF (Matrox), "Shawn Hargreaves" <shawn@talula.demon.co.uk>
+ *
+ */
+
+#include "matroxfb_accel.h"
+#include "matroxfb_DAC1064.h"
+#include "matroxfb_Ti3026.h"
+#include "matroxfb_misc.h"
+
+#define curr_ydstorg(x)	ACCESS_FBINFO2(x, curr.ydstorg.pixels)
+
+#define mga_ydstlen(y,l) mga_outl(M_YDSTLEN | M_EXEC, ((y) << 16) | (l))
+
+static inline void matrox_cfb4_pal(u_int32_t* pal) {
+	unsigned int i;
+	
+	for (i = 0; i < 16; i++) {
+		pal[i] = i * 0x11111111U;
+	}
+	pal[i] = 0xFFFFFFFF;
+}
+
+static inline void matrox_cfb8_pal(u_int32_t* pal) {
+	unsigned int i;
+	
+	for (i = 0; i < 16; i++) {
+		pal[i] = i * 0x01010101U;
+	}
+	pal[i] = 0x0F0F0F0F;
+}
+
+static void matroxfb_copyarea(struct fb_info* info, const struct fb_copyarea* area);
+static void matroxfb_fillrect(struct fb_info* info, const struct fb_fillrect* rect);
+static void matroxfb_imageblit(struct fb_info* info, const struct fb_image* image);
+static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect);
+static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area);
+
+void matrox_cfbX_init(WPMINFO2) {
+	u_int32_t maccess;
+	u_int32_t mpitch;
+	u_int32_t mopmode;
+	int accel;
+
+	DBG(__FUNCTION__)
+
+	mpitch = ACCESS_FBINFO(fbcon).var.xres_virtual;
+
+	ACCESS_FBINFO(fbops).fb_copyarea = cfb_copyarea;
+	ACCESS_FBINFO(fbops).fb_fillrect = cfb_fillrect;
+	ACCESS_FBINFO(fbops).fb_imageblit = cfb_imageblit;
+	ACCESS_FBINFO(fbops).fb_cursor = soft_cursor;
+
+	accel = (ACCESS_FBINFO(fbcon).var.accel_flags & FB_ACCELF_TEXT) == FB_ACCELF_TEXT;
+
+	switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+		case 4:		maccess = 0x00000000;	/* accelerate as 8bpp video */
+				mpitch = (mpitch >> 1) | 0x8000; /* disable linearization */
+				mopmode = M_OPMODE_4BPP;
+				matrox_cfb4_pal(ACCESS_FBINFO(cmap));
+				if (accel && !(mpitch & 1)) {
+					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_cfb4_copyarea;
+					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_cfb4_fillrect;
+				}
+				break;
+		case 8:		maccess = 0x00000000;
+				mopmode = M_OPMODE_8BPP;
+				matrox_cfb8_pal(ACCESS_FBINFO(cmap));
+				if (accel) {
+					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
+					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
+					ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+				}
+				break;
+		case 16:	if (ACCESS_FBINFO(fbcon).var.green.length == 5) {
+					maccess = 0xC0000001;
+					ACCESS_FBINFO(cmap[16]) = 0x7FFF7FFF;
+				} else {
+					maccess = 0x40000001;
+					ACCESS_FBINFO(cmap[16]) = 0xFFFFFFFF;
+				}
+				mopmode = M_OPMODE_16BPP;
+				if (accel) {
+					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
+					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
+					ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+				}
+				break;
+		case 24:	maccess = 0x00000003;
+				mopmode = M_OPMODE_24BPP;
+				ACCESS_FBINFO(cmap[16]) = 0xFFFFFFFF;
+				if (accel) {
+					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
+					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
+					ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+				}
+				break;
+		case 32:	maccess = 0x00000002;
+				mopmode = M_OPMODE_32BPP;
+				ACCESS_FBINFO(cmap[16]) = 0xFFFFFFFF;
+				if (accel) {
+					ACCESS_FBINFO(fbops).fb_copyarea = matroxfb_copyarea;
+					ACCESS_FBINFO(fbops).fb_fillrect = matroxfb_fillrect;
+					ACCESS_FBINFO(fbops).fb_imageblit = matroxfb_imageblit;
+				}
+				break;
+		default:	maccess = 0x00000000;
+				mopmode = 0x00000000;
+				break;	/* turn off acceleration!!! */
+	}
+	mga_fifo(8);
+	mga_outl(M_PITCH, mpitch);
+	mga_outl(M_YDSTORG, curr_ydstorg(MINFO));
+	if (ACCESS_FBINFO(capable.plnwt))
+		mga_outl(M_PLNWT, -1);
+	if (ACCESS_FBINFO(capable.srcorg)) {
+		mga_outl(M_SRCORG, 0);
+		mga_outl(M_DSTORG, 0);
+	}
+	mga_outl(M_OPMODE, mopmode);
+	mga_outl(M_CXBNDRY, 0xFFFF0000);
+	mga_outl(M_YTOP, 0);
+	mga_outl(M_YBOT, 0x01FFFFFF);
+	mga_outl(M_MACCESS, maccess);
+	ACCESS_FBINFO(accel.m_dwg_rect) = M_DWG_TRAP | M_DWG_SOLID | M_DWG_ARZERO | M_DWG_SGNZERO | M_DWG_SHIFTZERO;
+	if (isMilleniumII(MINFO)) ACCESS_FBINFO(accel.m_dwg_rect) |= M_DWG_TRANSC;
+	ACCESS_FBINFO(accel.m_opmode) = mopmode;
+}
+
+EXPORT_SYMBOL(matrox_cfbX_init);
+
+static void matrox_accel_bmove(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+	int start, end;
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+	CRITBEGIN
+
+	if ((dy < sy) || ((dy == sy) && (dx <= sx))) {
+		mga_fifo(2);
+		mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_SGNZERO |
+			 M_DWG_BFCOL | M_DWG_REPLACE);
+		mga_outl(M_AR5, vxres);
+		width--;
+		start = sy*vxres+sx+curr_ydstorg(MINFO);
+		end = start+width;
+	} else {
+		mga_fifo(3);
+		mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_BFCOL | M_DWG_REPLACE);
+		mga_outl(M_SGN, 5);
+		mga_outl(M_AR5, -vxres);
+		width--;
+		end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+		start = end+width;
+		dy += height-1;
+	}
+	mga_fifo(4);
+	mga_outl(M_AR0, end);
+	mga_outl(M_AR3, start);
+	mga_outl(M_FXBNDRY, ((dx+width)<<16) | dx);
+	mga_ydstlen(dy, height);
+	WaitTillIdle();
+
+	CRITEND
+}
+
+static void matrox_accel_bmove_lin(WPMINFO int vxres, int sy, int sx, int dy, int dx, int height, int width) {
+	int start, end;
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+	CRITBEGIN
+
+	if ((dy < sy) || ((dy == sy) && (dx <= sx))) {
+		mga_fifo(2);
+		mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_SGNZERO |
+			M_DWG_BFCOL | M_DWG_REPLACE);
+		mga_outl(M_AR5, vxres);
+		width--;
+		start = sy*vxres+sx+curr_ydstorg(MINFO);
+		end = start+width;
+	} else {
+		mga_fifo(3);
+		mga_outl(M_DWGCTL, M_DWG_BITBLT | M_DWG_SHIFTZERO | M_DWG_BFCOL | M_DWG_REPLACE);
+		mga_outl(M_SGN, 5);
+		mga_outl(M_AR5, -vxres);
+		width--;
+		end = (sy+height-1)*vxres+sx+curr_ydstorg(MINFO);
+		start = end+width;
+		dy += height-1;
+	}
+	mga_fifo(5);
+	mga_outl(M_AR0, end);
+	mga_outl(M_AR3, start);
+	mga_outl(M_FXBNDRY, ((dx+width)<<16) | dx);
+	mga_outl(M_YDST, dy*vxres >> 5);
+	mga_outl(M_LEN | M_EXEC, height);
+	WaitTillIdle();
+
+	CRITEND
+}
+
+static void matroxfb_cfb4_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
+	MINFO_FROM_INFO(info);
+
+	if ((area->sx | area->dx | area->width) & 1)
+		cfb_copyarea(info, area);
+	else
+		matrox_accel_bmove_lin(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual) >> 1, area->sy, area->sx >> 1, area->dy, area->dx >> 1, area->height, area->width >> 1);
+}
+
+static void matroxfb_copyarea(struct fb_info* info, const struct fb_copyarea* area) {
+	MINFO_FROM_INFO(info);
+
+	matrox_accel_bmove(PMINFO ACCESS_FBINFO(fbcon.var.xres_virtual), area->sy, area->sx, area->dy, area->dx, area->height, area->width);
+}
+
+static void matroxfb_accel_clear(WPMINFO u_int32_t color, int sy, int sx, int height,
+		int width) {
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+	CRITBEGIN
+
+	mga_fifo(5);
+	mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE);
+	mga_outl(M_FCOL, color);
+	mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
+	mga_ydstlen(sy, height);
+	WaitTillIdle();
+
+	CRITEND
+}
+
+static void matroxfb_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
+	MINFO_FROM_INFO(info);
+
+	switch (rect->rop) {
+		case ROP_COPY:
+			matroxfb_accel_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+			break;
+	}
+}
+
+static void matroxfb_cfb4_clear(WPMINFO u_int32_t bgx, int sy, int sx, int height, int width) {
+	int whattodo;
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+	CRITBEGIN
+
+	whattodo = 0;
+	if (sx & 1) {
+		sx ++;
+		if (!width) return;
+		width --;
+		whattodo = 1;
+	}
+	if (width & 1) {
+		whattodo |= 2;
+	}
+	width >>= 1;
+	sx >>= 1;
+	if (width) {
+		mga_fifo(5);
+		mga_outl(M_DWGCTL, ACCESS_FBINFO(accel.m_dwg_rect) | M_DWG_REPLACE2);
+		mga_outl(M_FCOL, bgx);
+		mga_outl(M_FXBNDRY, ((sx + width) << 16) | sx);
+		mga_outl(M_YDST, sy * ACCESS_FBINFO(fbcon).var.xres_virtual >> 6);
+		mga_outl(M_LEN | M_EXEC, height);
+		WaitTillIdle();
+	}
+	if (whattodo) {
+		u_int32_t step = ACCESS_FBINFO(fbcon).var.xres_virtual >> 1;
+		vaddr_t vbase = ACCESS_FBINFO(video.vbase);
+		if (whattodo & 1) {
+			unsigned int uaddr = sy * step + sx - 1;
+			u_int32_t loop;
+			u_int8_t bgx2 = bgx & 0xF0;
+			for (loop = height; loop > 0; loop --) {
+				mga_writeb(vbase, uaddr, (mga_readb(vbase, uaddr) & 0x0F) | bgx2);
+				uaddr += step;
+			}
+		}
+		if (whattodo & 2) {
+			unsigned int uaddr = sy * step + sx + width;
+			u_int32_t loop;
+			u_int8_t bgx2 = bgx & 0x0F;
+			for (loop = height; loop > 0; loop --) {
+				mga_writeb(vbase, uaddr, (mga_readb(vbase, uaddr) & 0xF0) | bgx2);
+				uaddr += step;
+			}
+		}
+	}
+
+	CRITEND
+}
+
+static void matroxfb_cfb4_fillrect(struct fb_info* info, const struct fb_fillrect* rect) {
+	MINFO_FROM_INFO(info);
+
+	switch (rect->rop) {
+		case ROP_COPY:
+			matroxfb_cfb4_clear(PMINFO ((u_int32_t*)info->pseudo_palette)[rect->color], rect->dy, rect->dx, rect->height, rect->width);
+			break;
+	}
+}
+
+static void matroxfb_1bpp_imageblit(WPMINFO u_int32_t fgx, u_int32_t bgx,
+		const u_int8_t* chardata, int width, int height, int yy, int xx) {
+	u_int32_t step;
+	u_int32_t ydstlen;
+	u_int32_t xlen;
+	u_int32_t ar0;
+	u_int32_t charcell;
+	u_int32_t fxbndry;
+	vaddr_t mmio;
+	int easy;
+	CRITFLAGS
+
+	DBG_HEAVY(__FUNCTION__);
+
+	step = (width + 7) >> 3;
+	charcell = height * step;
+	xlen = (charcell + 3) & ~3;
+	ydstlen = (yy << 16) | height;
+	if (width == step << 3) {
+		ar0 = height * width - 1;
+		easy = 1;
+	} else {
+		ar0 = width - 1;
+		easy = 0;
+	}
+
+	CRITBEGIN
+
+	mga_fifo(3);
+	if (easy)
+		mga_outl(M_DWGCTL, M_DWG_ILOAD | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_LINEAR | M_DWG_REPLACE);
+	else
+		mga_outl(M_DWGCTL, M_DWG_ILOAD | M_DWG_SGNZERO | M_DWG_SHIFTZERO | M_DWG_BMONOWF | M_DWG_REPLACE);
+	mga_outl(M_FCOL, fgx);
+	mga_outl(M_BCOL, bgx);
+	fxbndry = ((xx + width - 1) << 16) | xx;
+	mmio = ACCESS_FBINFO(mmio.vbase);
+
+	mga_fifo(6);
+	mga_writel(mmio, M_FXBNDRY, fxbndry);
+	mga_writel(mmio, M_AR0, ar0);
+	mga_writel(mmio, M_AR3, 0);
+	if (easy) {
+		mga_writel(mmio, M_YDSTLEN | M_EXEC, ydstlen);
+		mga_memcpy_toio(mmio, chardata, xlen);
+	} else {
+		mga_writel(mmio, M_AR5, 0);
+		mga_writel(mmio, M_YDSTLEN | M_EXEC, ydstlen);
+		if ((step & 3) == 0) {
+			/* Great. Source has 32bit aligned lines, so we can feed them
+			   directly to the accelerator. */
+			mga_memcpy_toio(mmio, chardata, charcell);
+		} else if (step == 1) {
+			/* Special case for 1..8bit widths */
+			while (height--) {
+#if defined(__BIG_ENDIAN)
+				fb_writel((*chardata) << 24, mmio.vaddr);
+#else
+				fb_writel(*chardata, mmio.vaddr);
+#endif
+				chardata++;
+			}
+		} else if (step == 2) {
+			/* Special case for 9..15bit widths */
+			while (height--) {
+#if defined(__BIG_ENDIAN)
+				fb_writel((*(u_int16_t*)chardata) << 16, mmio.vaddr);
+#else
+				fb_writel(*(u_int16_t*)chardata, mmio.vaddr);
+#endif
+				chardata += 2;
+			}
+		} else {
+			/* Tell... well, why bother... */
+			while (height--) {
+				size_t i;
+				
+				for (i = 0; i < step; i += 4) {
+					/* Hope that there are at least three readable bytes beyond the end of bitmap */
+					fb_writel(get_unaligned((u_int32_t*)(chardata + i)),mmio.vaddr);
+				}
+				chardata += step;
+			}
+		}
+	}
+	WaitTillIdle();
+	CRITEND
+}
+
+
+static void matroxfb_imageblit(struct fb_info* info, const struct fb_image* image) {
+	MINFO_FROM_INFO(info);
+
+	DBG_HEAVY(__FUNCTION__);
+
+	if (image->depth == 1) {
+		u_int32_t fgx, bgx;
+
+		fgx = ((u_int32_t*)info->pseudo_palette)[image->fg_color];
+		bgx = ((u_int32_t*)info->pseudo_palette)[image->bg_color];
+		matroxfb_1bpp_imageblit(PMINFO fgx, bgx, image->data, image->width, image->height, image->dy, image->dx);
+	} else {
+		/* Danger! image->depth is useless: logo painting code always
+		   passes framebuffer color depth here, although logo data are
+		   always 8bpp and info->pseudo_palette is changed to contain
+		   logo palette to be used (but only for true/direct-color... sic...).
+		   So do it completely in software... */
+		cfb_imageblit(info, image);
+	}
+}
+
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_accel.h b/drivers/video/matrox/matroxfb_accel.h
new file mode 100644
index 0000000..f40c314
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_accel.h
@@ -0,0 +1,8 @@
+#ifndef __MATROXFB_ACCEL_H__
+#define __MATROXFB_ACCEL_H__
+
+#include "matroxfb_base.h"
+
+void matrox_cfbX_init(WPMINFO2);
+
+#endif
diff --git a/drivers/video/matrox/matroxfb_base.c b/drivers/video/matrox/matroxfb_base.c
new file mode 100644
index 0000000..98e00d8
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_base.c
@@ -0,0 +1,2589 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * MTRR stuff: 1998 Tom Rini <trini@kernel.crashing.org>
+ *
+ * Contributors: "menion?" <menion@mindless.com>
+ *                     Betatesting, fixes, ideas
+ *
+ *               "Kurt Garloff" <garloff@suse.de>
+ *                     Betatesting, fixes, ideas, videomodes, videomodes timmings
+ *
+ *               "Tom Rini" <trini@kernel.crashing.org>
+ *                     MTRR stuff, PPC cleanups, betatesting, fixes, ideas
+ *
+ *               "Bibek Sahu" <scorpio@dodds.net>
+ *                     Access device through readb|w|l and write b|w|l
+ *                     Extensive debugging stuff
+ *
+ *               "Daniel Haun" <haund@usa.net>
+ *                     Testing, hardware cursor fixes
+ *
+ *               "Scott Wood" <sawst46+@pitt.edu>
+ *                     Fixes
+ *
+ *               "Gerd Knorr" <kraxel@goldbach.isdn.cs.tu-berlin.de>
+ *                     Betatesting
+ *
+ *               "Kelly French" <targon@hazmat.com>
+ *               "Fernando Herrera" <fherrera@eurielec.etsit.upm.es>
+ *                     Betatesting, bug reporting
+ *
+ *               "Pablo Bianucci" <pbian@pccp.com.ar>
+ *                     Fixes, ideas, betatesting
+ *
+ *               "Inaky Perez Gonzalez" <inaky@peloncho.fis.ucm.es>
+ *                     Fixes, enhandcements, ideas, betatesting
+ *
+ *               "Ryuichi Oikawa" <roikawa@rr.iiij4u.or.jp>
+ *                     PPC betatesting, PPC support, backward compatibility
+ *
+ *               "Paul Womar" <Paul@pwomar.demon.co.uk>
+ *               "Owen Waller" <O.Waller@ee.qub.ac.uk>
+ *                     PPC betatesting
+ *
+ *               "Thomas Pornin" <pornin@bolet.ens.fr>
+ *                     Alpha betatesting
+ *
+ *               "Pieter van Leuven" <pvl@iae.nl>
+ *               "Ulf Jaenicke-Roessler" <ujr@physik.phy.tu-dresden.de>
+ *                     G100 testing
+ *
+ *               "H. Peter Arvin" <hpa@transmeta.com>
+ *                     Ideas
+ *
+ *               "Cort Dougan" <cort@cs.nmt.edu>
+ *                     CHRP fixes and PReP cleanup
+ *
+ *               "Mark Vojkovich" <mvojkovi@ucsd.edu>
+ *                     G400 support
+ *
+ *               "Samuel Hocevar" <sam@via.ecp.fr>
+ *                     Fixes
+ *
+ *               "Anton Altaparmakov" <AntonA@bigfoot.com>
+ *                     G400 MAX/non-MAX distinction
+ *
+ *               "Ken Aaker" <kdaaker@rchland.vnet.ibm.com>
+ *                     memtype extension (needed for GXT130P RS/6000 adapter)
+ *
+ *               "Uns Lider" <unslider@miranda.org>
+ *                     G100 PLNWT fixes
+ *
+ *               "Denis Zaitsev" <zzz@cd-club.ru>
+ *                     Fixes
+ *
+ *               "Mike Pieper" <mike@pieper-family.de>
+ *                     TVOut enhandcements, V4L2 control interface.
+ *
+ *               "Diego Biurrun" <diego@biurrun.de>
+ *                     DFP testing
+ *
+ * (following author is not in any relation with this code, but his code
+ *  is included in this driver)
+ *
+ * Based on framebuffer driver for VBE 2.0 compliant graphic boards
+ *     (c) 1998 Gerd Knorr <kraxel@cs.tu-berlin.de>
+ *
+ * (following author is not in any relation with this code, but his ideas
+ *  were used when writting this driver)
+ *
+ *		 FreeVBE/AF (Matrox), "Shawn Hargreaves" <shawn@talula.demon.co.uk>
+ *
+ */
+
+/* make checkconfig does not check included files... */
+#include <linux/config.h>
+#include <linux/version.h>
+
+#include "matroxfb_base.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_accel.h"
+#include "matroxfb_DAC1064.h"
+#include "matroxfb_Ti3026.h"
+#include "matroxfb_maven.h"
+#include "matroxfb_crtc2.h"
+#include "matroxfb_g450.h"
+#include <linux/matroxfb.h>
+#include <linux/interrupt.h>
+#include <asm/uaccess.h>
+
+#ifdef CONFIG_PPC_PMAC
+unsigned char nvram_read_byte(int);
+static int default_vmode = VMODE_NVRAM;
+static int default_cmode = CMODE_NVRAM;
+#endif
+
+static void matroxfb_unregister_device(struct matrox_fb_info* minfo);
+
+/* --------------------------------------------------------------------- */
+
+/*
+ * card parameters
+ */
+
+/* --------------------------------------------------------------------- */
+
+static struct fb_var_screeninfo vesafb_defined = {
+	640,480,640,480,/* W,H, W, H (virtual) load xres,xres_virtual*/
+	0,0,		/* virtual -> visible no offset */
+	8,		/* depth -> load bits_per_pixel */
+	0,		/* greyscale ? */
+	{0,0,0},	/* R */
+	{0,0,0},	/* G */
+	{0,0,0},	/* B */
+	{0,0,0},	/* transparency */
+	0,		/* standard pixel format */
+	FB_ACTIVATE_NOW,
+	-1,-1,
+	FB_ACCELF_TEXT,	/* accel flags */
+	39721L,48L,16L,33L,10L,
+	96L,2L,~0,	/* No sync info */
+	FB_VMODE_NONINTERLACED,
+	0, {0,0,0,0,0}
+};
+
+
+
+/* --------------------------------------------------------------------- */
+static void update_crtc2(WPMINFO unsigned int pos) {
+	struct matroxfb_dh_fb_info* info = ACCESS_FBINFO(crtc2.info);
+
+	/* Make sure that displays are compatible */
+	if (info && (info->fbcon.var.bits_per_pixel == ACCESS_FBINFO(fbcon).var.bits_per_pixel)
+	         && (info->fbcon.var.xres_virtual == ACCESS_FBINFO(fbcon).var.xres_virtual)
+	         && (info->fbcon.var.green.length == ACCESS_FBINFO(fbcon).var.green.length)
+	         ) {
+		switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+			case 16:
+			case 32:
+				pos = pos * 8;
+				if (info->interlaced) {
+					mga_outl(0x3C2C, pos);
+					mga_outl(0x3C28, pos + ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(fbcon).var.bits_per_pixel / 8);
+				} else {
+					mga_outl(0x3C28, pos);
+				}
+				break;
+		}
+	}
+}
+
+static void matroxfb_crtc1_panpos(WPMINFO2) {
+	if (ACCESS_FBINFO(crtc1.panpos) >= 0) {
+		unsigned long flags;
+		int panpos;
+
+		matroxfb_DAC_lock_irqsave(flags);
+		panpos = ACCESS_FBINFO(crtc1.panpos);
+		if (panpos >= 0) {
+			unsigned int extvga_reg;
+
+			ACCESS_FBINFO(crtc1.panpos) = -1; /* No update pending anymore */
+			extvga_reg = mga_inb(M_EXTVGA_INDEX);
+			mga_setr(M_EXTVGA_INDEX, 0x00, panpos);
+			if (extvga_reg != 0x00) {
+				mga_outb(M_EXTVGA_INDEX, extvga_reg);
+			}
+		}
+		matroxfb_DAC_unlock_irqrestore(flags);
+	}
+}
+
+static irqreturn_t matrox_irq(int irq, void *dev_id, struct pt_regs *fp)
+{
+	u_int32_t status;
+	int handled = 0;
+
+	MINFO_FROM(dev_id);
+
+	status = mga_inl(M_STATUS);
+
+	if (status & 0x20) {
+		mga_outl(M_ICLEAR, 0x20);
+		ACCESS_FBINFO(crtc1.vsync.cnt)++;
+		matroxfb_crtc1_panpos(PMINFO2);
+		wake_up_interruptible(&ACCESS_FBINFO(crtc1.vsync.wait));
+		handled = 1;
+	}
+	if (status & 0x200) {
+		mga_outl(M_ICLEAR, 0x200);
+		ACCESS_FBINFO(crtc2.vsync.cnt)++;
+		wake_up_interruptible(&ACCESS_FBINFO(crtc2.vsync.wait));
+		handled = 1;
+	}
+	return IRQ_RETVAL(handled);
+}
+
+int matroxfb_enable_irq(WPMINFO int reenable) {
+	u_int32_t bm;
+	
+	if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+		bm = 0x220;
+	else
+		bm = 0x020;
+
+	if (!test_and_set_bit(0, &ACCESS_FBINFO(irq_flags))) {
+		if (request_irq(ACCESS_FBINFO(pcidev)->irq, matrox_irq,
+				SA_SHIRQ, "matroxfb", MINFO)) {
+			clear_bit(0, &ACCESS_FBINFO(irq_flags));
+			return -EINVAL;
+		}
+		/* Clear any pending field interrupts */
+		mga_outl(M_ICLEAR, bm);
+		mga_outl(M_IEN, mga_inl(M_IEN) | bm);
+	} else if (reenable) {
+		u_int32_t ien;
+		
+		ien = mga_inl(M_IEN);
+		if ((ien & bm) != bm) {
+			printk(KERN_DEBUG "matroxfb: someone disabled IRQ [%08X]\n", ien);
+			mga_outl(M_IEN, ien | bm);
+		}
+	}
+	return 0;
+}
+
+static void matroxfb_disable_irq(WPMINFO2) {
+	if (test_and_clear_bit(0, &ACCESS_FBINFO(irq_flags))) {
+		/* Flush pending pan-at-vbl request... */
+		matroxfb_crtc1_panpos(PMINFO2);
+		if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+			mga_outl(M_IEN, mga_inl(M_IEN) & ~0x220);
+		else
+			mga_outl(M_IEN, mga_inl(M_IEN) & ~0x20);
+		free_irq(ACCESS_FBINFO(pcidev)->irq, MINFO);
+	}
+}
+
+int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc) {
+	wait_queue_t __wait;
+	struct matrox_vsync *vs;
+	unsigned int cnt;
+	int ret;
+
+	switch (crtc) {
+		case 0:
+			vs = &ACCESS_FBINFO(crtc1.vsync);
+			break;
+		case 1:
+			if (ACCESS_FBINFO(devflags.accelerator) != FB_ACCEL_MATROX_MGAG400) {
+				return -ENODEV;
+			}
+			vs = &ACCESS_FBINFO(crtc2.vsync);
+			break;
+		default:
+			return -ENODEV;
+	}
+	ret = matroxfb_enable_irq(PMINFO 0);
+	if (ret) {
+		return ret;
+	}
+        init_waitqueue_entry(&__wait, current);
+
+	cnt = vs->cnt;
+	ret = wait_event_interruptible_timeout(vs->wait, cnt != vs->cnt, HZ/10);
+	if (ret < 0) {
+		return ret;
+	}
+	if (ret == 0) {
+		matroxfb_enable_irq(PMINFO 1);
+		return -ETIMEDOUT;
+	}
+	return 0;
+}
+
+/* --------------------------------------------------------------------- */
+
+static void matrox_pan_var(WPMINFO struct fb_var_screeninfo *var) {
+	unsigned int pos;
+	unsigned short p0, p1, p2;
+#ifdef CONFIG_FB_MATROX_32MB
+	unsigned int p3;
+#endif
+	int vbl;
+	unsigned long flags;
+
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+	if (ACCESS_FBINFO(dead))
+		return;
+
+	ACCESS_FBINFO(fbcon).var.xoffset = var->xoffset;
+	ACCESS_FBINFO(fbcon).var.yoffset = var->yoffset;
+	pos = (ACCESS_FBINFO(fbcon).var.yoffset * ACCESS_FBINFO(fbcon).var.xres_virtual + ACCESS_FBINFO(fbcon).var.xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
+	pos += ACCESS_FBINFO(curr.ydstorg.chunks);
+	p0 = ACCESS_FBINFO(hw).CRTC[0x0D] = pos & 0xFF;
+	p1 = ACCESS_FBINFO(hw).CRTC[0x0C] = (pos & 0xFF00) >> 8;
+	p2 = ACCESS_FBINFO(hw).CRTCEXT[0] = (ACCESS_FBINFO(hw).CRTCEXT[0] & 0xB0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
+#ifdef CONFIG_FB_MATROX_32MB
+	p3 = ACCESS_FBINFO(hw).CRTCEXT[8] = pos >> 21;
+#endif
+
+	/* FB_ACTIVATE_VBL and we can acquire interrupts? Honor FB_ACTIVATE_VBL then... */
+	vbl = (var->activate & FB_ACTIVATE_VBL) && (matroxfb_enable_irq(PMINFO 0) == 0);
+
+	CRITBEGIN
+
+	matroxfb_DAC_lock_irqsave(flags);
+	mga_setr(M_CRTC_INDEX, 0x0D, p0);
+	mga_setr(M_CRTC_INDEX, 0x0C, p1);
+#ifdef CONFIG_FB_MATROX_32MB
+	if (ACCESS_FBINFO(devflags.support32MB))
+		mga_setr(M_EXTVGA_INDEX, 0x08, p3);
+#endif
+	if (vbl) {
+		ACCESS_FBINFO(crtc1.panpos) = p2;
+	} else {
+		/* Abort any pending change */
+		ACCESS_FBINFO(crtc1.panpos) = -1;
+		mga_setr(M_EXTVGA_INDEX, 0x00, p2);
+	}
+	matroxfb_DAC_unlock_irqrestore(flags);
+	
+	update_crtc2(PMINFO pos);
+
+	CRITEND
+}
+
+static void matroxfb_remove(WPMINFO int dummy) {
+	/* Currently we are holding big kernel lock on all dead & usecount updates.
+	 * Destroy everything after all users release it. Especially do not unregister
+	 * framebuffer and iounmap memory, neither fbmem nor fbcon-cfb* does not check
+	 * for device unplugged when in use.
+	 * In future we should point mmio.vbase & video.vbase somewhere where we can
+	 * write data without causing too much damage...
+	 */
+
+	ACCESS_FBINFO(dead) = 1;
+	if (ACCESS_FBINFO(usecount)) {
+		/* destroy it later */
+		return;
+	}
+	matroxfb_unregister_device(MINFO);
+	unregister_framebuffer(&ACCESS_FBINFO(fbcon));
+	matroxfb_g450_shutdown(PMINFO2);
+#ifdef CONFIG_MTRR
+	if (ACCESS_FBINFO(mtrr.vram_valid))
+		mtrr_del(ACCESS_FBINFO(mtrr.vram), ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len));
+#endif
+	mga_iounmap(ACCESS_FBINFO(mmio.vbase));
+	mga_iounmap(ACCESS_FBINFO(video.vbase));
+	release_mem_region(ACCESS_FBINFO(video.base), ACCESS_FBINFO(video.len_maximum));
+	release_mem_region(ACCESS_FBINFO(mmio.base), 16384);
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+	kfree(minfo);
+#endif
+}
+
+	/*
+	 * Open/Release the frame buffer device
+	 */
+
+static int matroxfb_open(struct fb_info *info, int user)
+{
+	MINFO_FROM_INFO(info);
+	
+	DBG_LOOP(__FUNCTION__)
+
+	if (ACCESS_FBINFO(dead)) {
+		return -ENXIO;
+	}
+	ACCESS_FBINFO(usecount)++;
+	if (user) {
+		ACCESS_FBINFO(userusecount)++;
+	}
+	return(0);
+}
+
+static int matroxfb_release(struct fb_info *info, int user)
+{
+	MINFO_FROM_INFO(info);
+	
+	DBG_LOOP(__FUNCTION__)
+
+	if (user) {
+		if (0 == --ACCESS_FBINFO(userusecount)) {
+			matroxfb_disable_irq(PMINFO2);
+		}
+	}
+	if (!(--ACCESS_FBINFO(usecount)) && ACCESS_FBINFO(dead)) {
+		matroxfb_remove(PMINFO 0);
+	}
+	return(0);
+}
+
+static int matroxfb_pan_display(struct fb_var_screeninfo *var,
+		struct fb_info* info) {
+	MINFO_FROM_INFO(info);
+
+	DBG(__FUNCTION__)
+
+	matrox_pan_var(PMINFO var);
+	return 0;
+}
+
+static int matroxfb_get_final_bppShift(CPMINFO int bpp) {
+	int bppshft2;
+
+	DBG(__FUNCTION__)
+
+	bppshft2 = bpp;
+	if (!bppshft2) {
+		return 8;
+	}
+	if (isInterleave(MINFO))
+		bppshft2 >>= 1;
+	if (ACCESS_FBINFO(devflags.video64bits))
+		bppshft2 >>= 1;
+	return bppshft2;
+}
+
+static int matroxfb_test_and_set_rounding(CPMINFO int xres, int bpp) {
+	int over;
+	int rounding;
+
+	DBG(__FUNCTION__)
+
+	switch (bpp) {
+		case 0:		return xres;
+		case 4:		rounding = 128;
+				break;
+		case 8:		rounding = 64;	/* doc says 64; 32 is OK for G400 */
+				break;
+		case 16:	rounding = 32;
+				break;
+		case 24:	rounding = 64;	/* doc says 64; 32 is OK for G400 */
+				break;
+		default:	rounding = 16;
+				/* on G400, 16 really does not work */
+				if (ACCESS_FBINFO(devflags.accelerator) == FB_ACCEL_MATROX_MGAG400)
+					rounding = 32;
+				break;
+	}
+	if (isInterleave(MINFO)) {
+		rounding *= 2;
+	}
+	over = xres % rounding;
+	if (over)
+		xres += rounding-over;
+	return xres;
+}
+
+static int matroxfb_pitch_adjust(CPMINFO int xres, int bpp) {
+	const int* width;
+	int xres_new;
+
+	DBG(__FUNCTION__)
+
+	if (!bpp) return xres;
+
+	width = ACCESS_FBINFO(capable.vxres);
+
+	if (ACCESS_FBINFO(devflags.precise_width)) {
+		while (*width) {
+			if ((*width >= xres) && (matroxfb_test_and_set_rounding(PMINFO *width, bpp) == *width)) {
+				break;
+			}
+			width++;
+		}
+		xres_new = *width;
+	} else {
+		xres_new = matroxfb_test_and_set_rounding(PMINFO xres, bpp);
+	}
+	if (!xres_new) return 0;
+	if (xres != xres_new) {
+		printk(KERN_INFO "matroxfb: cannot set xres to %d, rounded up to %d\n", xres, xres_new);
+	}
+	return xres_new;
+}
+
+static int matroxfb_get_cmap_len(struct fb_var_screeninfo *var) {
+
+	DBG(__FUNCTION__)
+
+	switch (var->bits_per_pixel) {
+		case 4:
+			return 16;	/* pseudocolor... 16 entries HW palette */
+		case 8:
+			return 256;	/* pseudocolor... 256 entries HW palette */
+		case 16:
+			return 16;	/* directcolor... 16 entries SW palette */
+					/* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */
+		case 24:
+			return 16;	/* directcolor... 16 entries SW palette */
+					/* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */
+		case 32:
+			return 16;	/* directcolor... 16 entries SW palette */
+					/* Mystique: truecolor, 16 entries SW palette, HW palette hardwired into 1:1 mapping */
+	}
+	return 16;	/* return something reasonable... or panic()? */
+}
+
+static int matroxfb_decode_var(CPMINFO struct fb_var_screeninfo *var, int *visual, int *video_cmap_len, unsigned int* ydstorg) {
+	struct RGBT {
+		unsigned char bpp;
+		struct {
+			unsigned char offset,
+				      length;
+		} red,
+		  green,
+		  blue,
+		  transp;
+		signed char visual;
+	};
+	static const struct RGBT table[]= {
+		{ 8,{ 0,8},{0,8},{0,8},{ 0,0},MX_VISUAL_PSEUDOCOLOR},
+		{15,{10,5},{5,5},{0,5},{15,1},MX_VISUAL_DIRECTCOLOR},
+		{16,{11,5},{5,6},{0,5},{ 0,0},MX_VISUAL_DIRECTCOLOR},
+		{24,{16,8},{8,8},{0,8},{ 0,0},MX_VISUAL_DIRECTCOLOR},
+		{32,{16,8},{8,8},{0,8},{24,8},MX_VISUAL_DIRECTCOLOR}
+	};
+	struct RGBT const *rgbt;
+	unsigned int bpp = var->bits_per_pixel;
+	unsigned int vramlen;
+	unsigned int memlen;
+
+	DBG(__FUNCTION__)
+
+	switch (bpp) {
+		case 4:	 if (!ACCESS_FBINFO(capable.cfb4)) return -EINVAL;
+			 break;
+		case 8:	 break;
+		case 16: break;
+		case 24: break;
+		case 32: break;
+		default: return -EINVAL;
+	}
+	*ydstorg = 0;
+	vramlen = ACCESS_FBINFO(video.len_usable);
+	if (var->yres_virtual < var->yres)
+		var->yres_virtual = var->yres;
+	if (var->xres_virtual < var->xres)
+		var->xres_virtual = var->xres;
+
+	var->xres_virtual = matroxfb_pitch_adjust(PMINFO var->xres_virtual, bpp);
+	memlen = var->xres_virtual * bpp * var->yres_virtual / 8;
+	if (memlen > vramlen) {
+		var->yres_virtual = vramlen * 8 / (var->xres_virtual * bpp);
+		memlen = var->xres_virtual * bpp * var->yres_virtual / 8;
+	}
+	/* There is hardware bug that no line can cross 4MB boundary */
+	/* give up for CFB24, it is impossible to easy workaround it */
+	/* for other try to do something */
+	if (!ACCESS_FBINFO(capable.cross4MB) && (memlen > 0x400000)) {
+		if (bpp == 24) {
+			/* sorry */
+		} else {
+			unsigned int linelen;
+			unsigned int m1 = linelen = var->xres_virtual * bpp / 8;
+			unsigned int m2 = PAGE_SIZE;	/* or 128 if you do not need PAGE ALIGNED address */
+			unsigned int max_yres;
+
+			while (m1) {
+				int t;
+
+				while (m2 >= m1) m2 -= m1;
+				t = m1;
+				m1 = m2;
+				m2 = t;
+			}
+			m2 = linelen * PAGE_SIZE / m2;
+			*ydstorg = m2 = 0x400000 % m2;
+			max_yres = (vramlen - m2) / linelen;
+			if (var->yres_virtual > max_yres)
+				var->yres_virtual = max_yres;
+		}
+	}
+	/* YDSTLEN contains only signed 16bit value */
+	if (var->yres_virtual > 32767)
+		var->yres_virtual = 32767;
+	/* we must round yres/xres down, we already rounded y/xres_virtual up
+	   if it was possible. We should return -EINVAL, but I disagree */
+	if (var->yres_virtual < var->yres)
+		var->yres = var->yres_virtual;
+	if (var->xres_virtual < var->xres)
+		var->xres = var->xres_virtual;
+	if (var->xoffset + var->xres > var->xres_virtual)
+		var->xoffset = var->xres_virtual - var->xres;
+	if (var->yoffset + var->yres > var->yres_virtual)
+		var->yoffset = var->yres_virtual - var->yres;
+
+	if (bpp == 16 && var->green.length == 5) {
+		bpp--; /* an artifical value - 15 */
+	}
+
+	for (rgbt = table; rgbt->bpp < bpp; rgbt++);
+#define	SETCLR(clr)\
+	var->clr.offset = rgbt->clr.offset;\
+	var->clr.length = rgbt->clr.length
+	SETCLR(red);
+	SETCLR(green);
+	SETCLR(blue);
+	SETCLR(transp);
+#undef	SETCLR
+	*visual = rgbt->visual;
+
+	if (bpp > 8)
+		dprintk("matroxfb: truecolor: "
+			"size=%d:%d:%d:%d, shift=%d:%d:%d:%d\n",
+			var->transp.length, var->red.length, var->green.length, var->blue.length,
+			var->transp.offset, var->red.offset, var->green.offset, var->blue.offset);
+
+	*video_cmap_len = matroxfb_get_cmap_len(var);
+	dprintk(KERN_INFO "requested %d*%d/%dbpp (%d*%d)\n", var->xres, var->yres, var->bits_per_pixel,
+				var->xres_virtual, var->yres_virtual);
+	return 0;
+}
+
+static int matroxfb_setcolreg(unsigned regno, unsigned red, unsigned green,
+			      unsigned blue, unsigned transp,
+			      struct fb_info *fb_info)
+{
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+	struct matrox_fb_info* minfo = container_of(fb_info, struct matrox_fb_info, fbcon);
+#endif
+
+	DBG(__FUNCTION__)
+
+	/*
+	 *  Set a single color register. The values supplied are
+	 *  already rounded down to the hardware's capabilities
+	 *  (according to the entries in the `var' structure). Return
+	 *  != 0 for invalid regno.
+	 */
+
+	if (regno >= ACCESS_FBINFO(curr.cmap_len))
+		return 1;
+
+	if (ACCESS_FBINFO(fbcon).var.grayscale) {
+		/* gray = 0.30*R + 0.59*G + 0.11*B */
+		red = green = blue = (red * 77 + green * 151 + blue * 28) >> 8;
+	}
+
+	red = CNVT_TOHW(red, ACCESS_FBINFO(fbcon).var.red.length);
+	green = CNVT_TOHW(green, ACCESS_FBINFO(fbcon).var.green.length);
+	blue = CNVT_TOHW(blue, ACCESS_FBINFO(fbcon).var.blue.length);
+	transp = CNVT_TOHW(transp, ACCESS_FBINFO(fbcon).var.transp.length);
+
+	switch (ACCESS_FBINFO(fbcon).var.bits_per_pixel) {
+	case 4:
+	case 8:
+		mga_outb(M_DAC_REG, regno);
+		mga_outb(M_DAC_VAL, red);
+		mga_outb(M_DAC_VAL, green);
+		mga_outb(M_DAC_VAL, blue);
+		break;
+	case 16:
+		{
+			u_int16_t col =
+				(red << ACCESS_FBINFO(fbcon).var.red.offset)     |
+				(green << ACCESS_FBINFO(fbcon).var.green.offset) |
+				(blue << ACCESS_FBINFO(fbcon).var.blue.offset)   |
+				(transp << ACCESS_FBINFO(fbcon).var.transp.offset); /* for 1:5:5:5 */
+			ACCESS_FBINFO(cmap[regno]) = col | (col << 16);
+		}
+		break;
+	case 24:
+	case 32:
+		ACCESS_FBINFO(cmap[regno]) =
+			(red   << ACCESS_FBINFO(fbcon).var.red.offset)   |
+			(green << ACCESS_FBINFO(fbcon).var.green.offset) |
+			(blue  << ACCESS_FBINFO(fbcon).var.blue.offset)  |
+			(transp << ACCESS_FBINFO(fbcon).var.transp.offset);	/* 8:8:8:8 */
+		break;
+	}
+	return 0;
+}
+
+static void matroxfb_init_fix(WPMINFO2)
+{
+	struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+	DBG(__FUNCTION__)
+
+	strcpy(fix->id,"MATROX");
+
+	fix->xpanstep = 8;	/* 8 for 8bpp, 4 for 16bpp, 2 for 32bpp */
+	fix->ypanstep = 1;
+	fix->ywrapstep = 0;
+	fix->mmio_start = ACCESS_FBINFO(mmio.base);
+	fix->mmio_len = ACCESS_FBINFO(mmio.len);
+	fix->accel = ACCESS_FBINFO(devflags.accelerator);
+}
+
+static void matroxfb_update_fix(WPMINFO2)
+{
+	struct fb_fix_screeninfo *fix = &ACCESS_FBINFO(fbcon).fix;
+	DBG(__FUNCTION__)
+
+	fix->smem_start = ACCESS_FBINFO(video.base) + ACCESS_FBINFO(curr.ydstorg.bytes);
+	fix->smem_len = ACCESS_FBINFO(video.len_usable) - ACCESS_FBINFO(curr.ydstorg.bytes);
+}
+
+static int matroxfb_check_var(struct fb_var_screeninfo *var, struct fb_info *info)
+{
+	int err;
+	int visual;
+	int cmap_len;
+	unsigned int ydstorg;
+	MINFO_FROM_INFO(info);
+
+	if (ACCESS_FBINFO(dead)) {
+		return -ENXIO;
+	}
+	if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+		return err;
+	return 0;
+}
+
+static int matroxfb_set_par(struct fb_info *info)
+{
+	int err;
+	int visual;
+	int cmap_len;
+	unsigned int ydstorg;
+	struct fb_var_screeninfo *var;
+	MINFO_FROM_INFO(info);
+
+	DBG(__FUNCTION__)
+
+	if (ACCESS_FBINFO(dead)) {
+		return -ENXIO;
+	}
+
+	var = &info->var;
+	if ((err = matroxfb_decode_var(PMINFO var, &visual, &cmap_len, &ydstorg)) != 0)
+		return err;
+	ACCESS_FBINFO(fbcon.screen_base) = vaddr_va(ACCESS_FBINFO(video.vbase)) + ydstorg;
+	matroxfb_update_fix(PMINFO2);
+	ACCESS_FBINFO(fbcon).fix.visual = visual;
+	ACCESS_FBINFO(fbcon).fix.type = FB_TYPE_PACKED_PIXELS;
+	ACCESS_FBINFO(fbcon).fix.type_aux = 0;
+	ACCESS_FBINFO(fbcon).fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
+	{
+		unsigned int pos;
+
+		ACCESS_FBINFO(curr.cmap_len) = cmap_len;
+		ydstorg += ACCESS_FBINFO(devflags.ydstorg);
+		ACCESS_FBINFO(curr.ydstorg.bytes) = ydstorg;
+		ACCESS_FBINFO(curr.ydstorg.chunks) = ydstorg >> (isInterleave(MINFO)?3:2);
+		if (var->bits_per_pixel == 4)
+			ACCESS_FBINFO(curr.ydstorg.pixels) = ydstorg;
+		else
+			ACCESS_FBINFO(curr.ydstorg.pixels) = (ydstorg * 8) / var->bits_per_pixel;
+		ACCESS_FBINFO(curr.final_bppShift) = matroxfb_get_final_bppShift(PMINFO var->bits_per_pixel);
+		{	struct my_timming mt;
+			struct matrox_hw_state* hw;
+			int out;
+
+			matroxfb_var2my(var, &mt);
+			mt.crtc = MATROXFB_SRC_CRTC1;
+			/* CRTC1 delays */
+			switch (var->bits_per_pixel) {
+				case  0:	mt.delay = 31 + 0; break;
+				case 16:	mt.delay = 21 + 8; break;
+				case 24:	mt.delay = 17 + 8; break;
+				case 32:	mt.delay = 16 + 8; break;
+				default:	mt.delay = 31 + 8; break;
+			}
+
+			hw = &ACCESS_FBINFO(hw);
+
+			down_read(&ACCESS_FBINFO(altout).lock);
+			for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+				if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
+				    ACCESS_FBINFO(outputs[out]).output->compute) {
+					ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+				}
+			}
+			up_read(&ACCESS_FBINFO(altout).lock);
+			ACCESS_FBINFO(crtc1).pixclock = mt.pixclock;
+			ACCESS_FBINFO(crtc1).mnp = mt.mnp;
+			ACCESS_FBINFO(hw_switch->init(PMINFO &mt));
+			pos = (var->yoffset * var->xres_virtual + var->xoffset) * ACCESS_FBINFO(curr.final_bppShift) / 32;
+			pos += ACCESS_FBINFO(curr.ydstorg.chunks);
+
+			hw->CRTC[0x0D] = pos & 0xFF;
+			hw->CRTC[0x0C] = (pos & 0xFF00) >> 8;
+			hw->CRTCEXT[0] = (hw->CRTCEXT[0] & 0xF0) | ((pos >> 16) & 0x0F) | ((pos >> 14) & 0x40);
+			hw->CRTCEXT[8] = pos >> 21;
+			ACCESS_FBINFO(hw_switch->restore(PMINFO2));
+			update_crtc2(PMINFO pos);
+			down_read(&ACCESS_FBINFO(altout).lock);
+			for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+				if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
+				    ACCESS_FBINFO(outputs[out]).output->program) {
+					ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+				}
+			}
+			for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+				if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC1 &&
+				    ACCESS_FBINFO(outputs[out]).output->start) {
+					ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+				}
+			}
+			up_read(&ACCESS_FBINFO(altout).lock);
+			matrox_cfbX_init(PMINFO2);
+		}
+	}
+	ACCESS_FBINFO(initialized) = 1;
+	return 0;
+}
+
+static int matroxfb_get_vblank(WPMINFO struct fb_vblank *vblank)
+{
+	unsigned int sts1;
+
+	matroxfb_enable_irq(PMINFO 0);
+	memset(vblank, 0, sizeof(*vblank));
+	vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VSYNC |
+			FB_VBLANK_HAVE_VBLANK | FB_VBLANK_HAVE_HBLANK;
+	sts1 = mga_inb(M_INSTS1);
+	vblank->vcount = mga_inl(M_VCOUNT);
+	/* BTW, on my PIII/450 with G400, reading M_INSTS1
+	   byte makes this call about 12% slower (1.70 vs. 2.05 us
+	   per ioctl()) */
+	if (sts1 & 1)
+		vblank->flags |= FB_VBLANK_HBLANKING;
+	if (sts1 & 8)
+		vblank->flags |= FB_VBLANK_VSYNCING;
+	if (vblank->vcount >= ACCESS_FBINFO(fbcon).var.yres)
+		vblank->flags |= FB_VBLANK_VBLANKING;
+	if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+		vblank->flags |= FB_VBLANK_HAVE_COUNT;
+		/* Only one writer, aligned int value... 
+		   it should work without lock and without atomic_t */
+		vblank->count = ACCESS_FBINFO(crtc1).vsync.cnt;
+	}
+	return 0;
+}
+
+static struct matrox_altout panellink_output = {
+	.name	 = "Panellink output",
+};
+
+static int matroxfb_ioctl(struct inode *inode, struct file *file,
+			  unsigned int cmd, unsigned long arg,
+			  struct fb_info *info)
+{
+	void __user *argp = (void __user *)arg;
+	MINFO_FROM_INFO(info);
+	
+	DBG(__FUNCTION__)
+
+	if (ACCESS_FBINFO(dead)) {
+		return -ENXIO;
+	}
+
+	switch (cmd) {
+		case FBIOGET_VBLANK:
+			{
+				struct fb_vblank vblank;
+				int err;
+
+				err = matroxfb_get_vblank(PMINFO &vblank);
+				if (err)
+					return err;
+				if (copy_to_user(argp, &vblank, sizeof(vblank)))
+					return -EFAULT;
+				return 0;
+			}
+		case FBIO_WAITFORVSYNC:
+			{
+				u_int32_t crt;
+
+				if (get_user(crt, (u_int32_t __user *)arg))
+					return -EFAULT;
+
+				return matroxfb_wait_for_sync(PMINFO crt);
+			}
+		case MATROXFB_SET_OUTPUT_MODE:
+			{
+				struct matroxioc_output_mode mom;
+				struct matrox_altout *oproc;
+				int val;
+
+				if (copy_from_user(&mom, argp, sizeof(mom)))
+					return -EFAULT;
+				if (mom.output >= MATROXFB_MAX_OUTPUTS)
+					return -ENXIO;
+				down_read(&ACCESS_FBINFO(altout.lock));
+				oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+				if (!oproc) {
+					val = -ENXIO;
+				} else if (!oproc->verifymode) {
+					if (mom.mode == MATROXFB_OUTPUT_MODE_MONITOR) {
+						val = 0;
+					} else {
+						val = -EINVAL;
+					}
+				} else {
+					val = oproc->verifymode(ACCESS_FBINFO(outputs[mom.output]).data, mom.mode);
+				}
+				if (!val) {
+					if (ACCESS_FBINFO(outputs[mom.output]).mode != mom.mode) {
+						ACCESS_FBINFO(outputs[mom.output]).mode = mom.mode;
+						val = 1;
+					}
+				}
+				up_read(&ACCESS_FBINFO(altout.lock));
+				if (val != 1)
+					return val;
+				switch (ACCESS_FBINFO(outputs[mom.output]).src) {
+					case MATROXFB_SRC_CRTC1:
+						matroxfb_set_par(info);
+						break;
+					case MATROXFB_SRC_CRTC2:
+						{
+							struct matroxfb_dh_fb_info* crtc2;
+
+							down_read(&ACCESS_FBINFO(crtc2.lock));
+							crtc2 = ACCESS_FBINFO(crtc2.info);
+							if (crtc2)
+								crtc2->fbcon.fbops->fb_set_par(&crtc2->fbcon);
+							up_read(&ACCESS_FBINFO(crtc2.lock));
+						}
+						break;
+				}
+				return 0;
+			}
+		case MATROXFB_GET_OUTPUT_MODE:
+			{
+				struct matroxioc_output_mode mom;
+				struct matrox_altout *oproc;
+				int val;
+
+				if (copy_from_user(&mom, argp, sizeof(mom)))
+					return -EFAULT;
+				if (mom.output >= MATROXFB_MAX_OUTPUTS)
+					return -ENXIO;
+				down_read(&ACCESS_FBINFO(altout.lock));
+				oproc = ACCESS_FBINFO(outputs[mom.output]).output;
+				if (!oproc) {
+					val = -ENXIO;
+				} else {
+					mom.mode = ACCESS_FBINFO(outputs[mom.output]).mode;
+					val = 0;
+				}
+				up_read(&ACCESS_FBINFO(altout.lock));
+				if (val)
+					return val;
+				if (copy_to_user(argp, &mom, sizeof(mom)))
+					return -EFAULT;
+				return 0;
+			}
+		case MATROXFB_SET_OUTPUT_CONNECTION:
+			{
+				u_int32_t tmp;
+				int i;
+				int changes;
+
+				if (copy_from_user(&tmp, argp, sizeof(tmp)))
+					return -EFAULT;
+				for (i = 0; i < 32; i++) {
+					if (tmp & (1 << i)) {
+						if (i >= MATROXFB_MAX_OUTPUTS)
+							return -ENXIO;
+						if (!ACCESS_FBINFO(outputs[i]).output)
+							return -ENXIO;
+						switch (ACCESS_FBINFO(outputs[i]).src) {
+							case MATROXFB_SRC_NONE:
+							case MATROXFB_SRC_CRTC1:
+								break;
+							default:
+								return -EBUSY;
+						}
+					}
+				}
+				if (ACCESS_FBINFO(devflags.panellink)) {
+					if (tmp & MATROXFB_OUTPUT_CONN_DFP) {
+						if (tmp & MATROXFB_OUTPUT_CONN_SECONDARY)
+							return -EINVAL;
+						for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+							if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC2) {
+								return -EBUSY;
+							}
+						}
+					}
+				}
+				changes = 0;
+				for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+					if (tmp & (1 << i)) {
+						if (ACCESS_FBINFO(outputs[i]).src != MATROXFB_SRC_CRTC1) {
+							changes = 1;
+							ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_CRTC1;
+						}
+					} else if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+						changes = 1;
+						ACCESS_FBINFO(outputs[i]).src = MATROXFB_SRC_NONE;
+					}
+				}
+				if (!changes)
+					return 0;
+				matroxfb_set_par(info);
+				return 0;
+			}
+		case MATROXFB_GET_OUTPUT_CONNECTION:
+			{
+				u_int32_t conn = 0;
+				int i;
+
+				for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+					if (ACCESS_FBINFO(outputs[i]).src == MATROXFB_SRC_CRTC1) {
+						conn |= 1 << i;
+					}
+				}
+				if (put_user(conn, (u_int32_t __user *)arg))
+					return -EFAULT;
+				return 0;
+			}
+		case MATROXFB_GET_AVAILABLE_OUTPUTS:
+			{
+				u_int32_t conn = 0;
+				int i;
+
+				for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+					if (ACCESS_FBINFO(outputs[i]).output) {
+						switch (ACCESS_FBINFO(outputs[i]).src) {
+							case MATROXFB_SRC_NONE:
+							case MATROXFB_SRC_CRTC1:
+								conn |= 1 << i;
+								break;
+						}
+					}
+				}
+				if (ACCESS_FBINFO(devflags.panellink)) {
+					if (conn & MATROXFB_OUTPUT_CONN_DFP)
+						conn &= ~MATROXFB_OUTPUT_CONN_SECONDARY;
+					if (conn & MATROXFB_OUTPUT_CONN_SECONDARY)
+						conn &= ~MATROXFB_OUTPUT_CONN_DFP;
+				}
+				if (put_user(conn, (u_int32_t __user *)arg))
+					return -EFAULT;
+				return 0;
+			}
+		case MATROXFB_GET_ALL_OUTPUTS:
+			{
+				u_int32_t conn = 0;
+				int i;
+
+				for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+					if (ACCESS_FBINFO(outputs[i]).output) {
+						conn |= 1 << i;
+					}
+				}
+				if (put_user(conn, (u_int32_t __user *)arg))
+					return -EFAULT;
+				return 0;
+			}
+		case VIDIOC_QUERYCAP:
+			{
+				struct v4l2_capability r;
+				
+				memset(&r, 0, sizeof(r));
+				strcpy(r.driver, "matroxfb");
+				strcpy(r.card, "Matrox");
+				sprintf(r.bus_info, "PCI:%s", pci_name(ACCESS_FBINFO(pcidev)));
+				r.version = KERNEL_VERSION(1,0,0);
+				r.capabilities = V4L2_CAP_VIDEO_OUTPUT;
+				if (copy_to_user(argp, &r, sizeof(r)))
+					return -EFAULT;
+				return 0;
+				
+			}
+		case VIDIOC_QUERYCTRL:
+			{
+				struct v4l2_queryctrl qctrl;
+				int err;
+
+				if (copy_from_user(&qctrl, argp, sizeof(qctrl)))
+					return -EFAULT;
+
+				down_read(&ACCESS_FBINFO(altout).lock);
+				if (!ACCESS_FBINFO(outputs[1]).output) {
+					err = -ENXIO;
+				} else if (ACCESS_FBINFO(outputs[1]).output->getqueryctrl) {
+					err = ACCESS_FBINFO(outputs[1]).output->getqueryctrl(ACCESS_FBINFO(outputs[1]).data, &qctrl);
+				} else {
+					err = -EINVAL;
+				}
+				up_read(&ACCESS_FBINFO(altout).lock);
+				if (err >= 0 &&
+				    copy_to_user(argp, &qctrl, sizeof(qctrl)))
+					return -EFAULT;
+				return err;
+			}
+		case VIDIOC_G_CTRL:
+			{
+				struct v4l2_control ctrl;
+				int err;
+
+				if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
+					return -EFAULT;
+
+				down_read(&ACCESS_FBINFO(altout).lock);
+				if (!ACCESS_FBINFO(outputs[1]).output) {
+					err = -ENXIO;
+				} else if (ACCESS_FBINFO(outputs[1]).output->getctrl) {
+					err = ACCESS_FBINFO(outputs[1]).output->getctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+				} else {
+					err = -EINVAL;
+				}
+				up_read(&ACCESS_FBINFO(altout).lock);
+				if (err >= 0 &&
+				    copy_to_user(argp, &ctrl, sizeof(ctrl)))
+					return -EFAULT;
+				return err;
+			}
+		case VIDIOC_S_CTRL_OLD:
+		case VIDIOC_S_CTRL:
+			{
+				struct v4l2_control ctrl;
+				int err;
+
+				if (copy_from_user(&ctrl, argp, sizeof(ctrl)))
+					return -EFAULT;
+
+				down_read(&ACCESS_FBINFO(altout).lock);
+				if (!ACCESS_FBINFO(outputs[1]).output) {
+					err = -ENXIO;
+				} else if (ACCESS_FBINFO(outputs[1]).output->setctrl) {
+					err = ACCESS_FBINFO(outputs[1]).output->setctrl(ACCESS_FBINFO(outputs[1]).data, &ctrl);
+				} else {
+					err = -EINVAL;
+				}
+				up_read(&ACCESS_FBINFO(altout).lock);
+				return err;
+			}
+	}
+	return -ENOTTY;
+}
+
+/* 0 unblank, 1 blank, 2 no vsync, 3 no hsync, 4 off */
+
+static int matroxfb_blank(int blank, struct fb_info *info)
+{
+	int seq;
+	int crtc;
+	CRITFLAGS
+	MINFO_FROM_INFO(info);
+
+	DBG(__FUNCTION__)
+
+	if (ACCESS_FBINFO(dead))
+		return 1;
+
+	switch (blank) {
+	case FB_BLANK_NORMAL:  seq = 0x20; crtc = 0x00; break; /* works ??? */
+	case FB_BLANK_VSYNC_SUSPEND:  seq = 0x20; crtc = 0x10; break;
+	case FB_BLANK_HSYNC_SUSPEND:  seq = 0x20; crtc = 0x20; break;
+	case FB_BLANK_POWERDOWN:  seq = 0x20; crtc = 0x30; break;
+	default: seq = 0x00; crtc = 0x00; break;
+	}
+
+	CRITBEGIN
+
+	mga_outb(M_SEQ_INDEX, 1);
+	mga_outb(M_SEQ_DATA, (mga_inb(M_SEQ_DATA) & ~0x20) | seq);
+	mga_outb(M_EXTVGA_INDEX, 1);
+	mga_outb(M_EXTVGA_DATA, (mga_inb(M_EXTVGA_DATA) & ~0x30) | crtc);
+
+	CRITEND
+	return 0;
+}
+
+static struct fb_ops matroxfb_ops = {
+	.owner =	THIS_MODULE,
+	.fb_open =	matroxfb_open,
+	.fb_release =	matroxfb_release,
+	.fb_check_var =	matroxfb_check_var,
+	.fb_set_par =	matroxfb_set_par,
+	.fb_setcolreg =	matroxfb_setcolreg,
+	.fb_pan_display =matroxfb_pan_display,
+	.fb_blank =	matroxfb_blank,
+	.fb_ioctl =	matroxfb_ioctl,
+/*	.fb_fillrect =	<set by matrox_cfbX_init>, */
+/*	.fb_copyarea =	<set by matrox_cfbX_init>, */
+/*	.fb_imageblit =	<set by matrox_cfbX_init>, */
+/*	.fb_cursor =	<set by matrox_cfbX_init>, */
+};
+
+#define RSDepth(X)	(((X) >> 8) & 0x0F)
+#define RS8bpp		0x1
+#define RS15bpp		0x2
+#define RS16bpp		0x3
+#define RS32bpp		0x4
+#define RS4bpp		0x5
+#define RS24bpp		0x6
+#define RSText		0x7
+#define RSText8		0x8
+/* 9-F */
+static struct { struct fb_bitfield red, green, blue, transp; int bits_per_pixel; } colors[] = {
+	{ {  0, 8, 0}, { 0, 8, 0}, { 0, 8, 0}, {  0, 0, 0},  8 },
+	{ { 10, 5, 0}, { 5, 5, 0}, { 0, 5, 0}, { 15, 1, 0}, 16 },
+	{ { 11, 5, 0}, { 5, 6, 0}, { 0, 5, 0}, {  0, 0, 0}, 16 },
+	{ { 16, 8, 0}, { 8, 8, 0}, { 0, 8, 0}, { 24, 8, 0}, 32 },
+	{ {  0, 8, 0}, { 0, 8, 0}, { 0, 8, 0}, {  0, 0, 0},  4 },
+	{ { 16, 8, 0}, { 8, 8, 0}, { 0, 8, 0}, {  0, 0, 0}, 24 },
+	{ {  0, 6, 0}, { 0, 6, 0}, { 0, 6, 0}, {  0, 0, 0},  0 },	/* textmode with (default) VGA8x16 */
+	{ {  0, 6, 0}, { 0, 6, 0}, { 0, 6, 0}, {  0, 0, 0},  0 },	/* textmode hardwired to VGA8x8 */
+};
+
+/* initialized by setup, see explanation at end of file (search for MODULE_PARM_DESC) */
+static unsigned int mem;		/* "matrox:mem:xxxxxM" */
+static int option_precise_width = 1;	/* cannot be changed, option_precise_width==0 must imply noaccel */
+static int inv24;			/* "matrox:inv24" */
+static int cross4MB = -1;		/* "matrox:cross4MB" */
+static int disabled;			/* "matrox:disabled" */
+static int noaccel;			/* "matrox:noaccel" */
+static int nopan;			/* "matrox:nopan" */
+static int no_pci_retry;		/* "matrox:nopciretry" */
+static int novga;			/* "matrox:novga" */
+static int nobios;			/* "matrox:nobios" */
+static int noinit = 1;			/* "matrox:init" */
+static int inverse;			/* "matrox:inverse" */
+static int sgram;			/* "matrox:sgram" */
+#ifdef CONFIG_MTRR
+static int mtrr = 1;			/* "matrox:nomtrr" */
+#endif
+static int grayscale;			/* "matrox:grayscale" */
+static int dev = -1;			/* "matrox:dev:xxxxx" */
+static unsigned int vesa = ~0;		/* "matrox:vesa:xxxxx" */
+static int depth = -1;			/* "matrox:depth:xxxxx" */
+static unsigned int xres;		/* "matrox:xres:xxxxx" */
+static unsigned int yres;		/* "matrox:yres:xxxxx" */
+static unsigned int upper = ~0;		/* "matrox:upper:xxxxx" */
+static unsigned int lower = ~0;		/* "matrox:lower:xxxxx" */
+static unsigned int vslen;		/* "matrox:vslen:xxxxx" */
+static unsigned int left = ~0;		/* "matrox:left:xxxxx" */
+static unsigned int right = ~0;		/* "matrox:right:xxxxx" */
+static unsigned int hslen;		/* "matrox:hslen:xxxxx" */
+static unsigned int pixclock;		/* "matrox:pixclock:xxxxx" */
+static int sync = -1;			/* "matrox:sync:xxxxx" */
+static unsigned int fv;			/* "matrox:fv:xxxxx" */
+static unsigned int fh;			/* "matrox:fh:xxxxxk" */
+static unsigned int maxclk;		/* "matrox:maxclk:xxxxM" */
+static int dfp;				/* "matrox:dfp */
+static int dfp_type = -1;		/* "matrox:dfp:xxx */
+static int memtype = -1;		/* "matrox:memtype:xxx" */
+static char outputs[8];			/* "matrox:outputs:xxx" */
+
+#ifndef MODULE
+static char videomode[64];		/* "matrox:mode:xxxxx" or "matrox:xxxxx" */
+#endif
+
+static int matroxfb_getmemory(WPMINFO unsigned int maxSize, unsigned int *realSize){
+	vaddr_t vm;
+	unsigned int offs;
+	unsigned int offs2;
+	unsigned char store;
+	unsigned char bytes[32];
+	unsigned char* tmp;
+
+	DBG(__FUNCTION__)
+
+	vm = ACCESS_FBINFO(video.vbase);
+	maxSize &= ~0x1FFFFF;	/* must be X*2MB (really it must be 2 or X*4MB) */
+	/* at least 2MB */
+	if (maxSize < 0x0200000) return 0;
+	if (maxSize > 0x2000000) maxSize = 0x2000000;
+
+	mga_outb(M_EXTVGA_INDEX, 0x03);
+	mga_outb(M_EXTVGA_DATA, mga_inb(M_EXTVGA_DATA) | 0x80);
+
+	store = mga_readb(vm, 0x1234);
+	tmp = bytes;
+	for (offs = 0x100000; offs < maxSize; offs += 0x200000)
+		*tmp++ = mga_readb(vm, offs);
+	for (offs = 0x100000; offs < maxSize; offs += 0x200000)
+		mga_writeb(vm, offs, 0x02);
+	if (ACCESS_FBINFO(features.accel.has_cacheflush))
+		mga_outb(M_CACHEFLUSH, 0x00);
+	else
+		mga_writeb(vm, 0x1234, 0x99);
+	for (offs = 0x100000; offs < maxSize; offs += 0x200000) {
+		if (mga_readb(vm, offs) != 0x02)
+			break;
+		mga_writeb(vm, offs, mga_readb(vm, offs) - 0x02);
+		if (mga_readb(vm, offs))
+			break;
+	}
+	tmp = bytes;
+	for (offs2 = 0x100000; offs2 < maxSize; offs2 += 0x200000)
+		mga_writeb(vm, offs2, *tmp++);
+	mga_writeb(vm, 0x1234, store);
+
+	mga_outb(M_EXTVGA_INDEX, 0x03);
+	mga_outb(M_EXTVGA_DATA, mga_inb(M_EXTVGA_DATA) & ~0x80);
+
+	*realSize = offs - 0x100000;
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+	ACCESS_FBINFO(interleave) = !(!isMillenium(MINFO) || ((offs - 0x100000) & 0x3FFFFF));
+#endif
+	return 1;
+}
+
+struct video_board {
+	int maxvram;
+	int maxdisplayable;
+	int accelID;
+	struct matrox_switch* lowlevel;
+		 };
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+static struct video_board vbMillennium		= {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGA2064W,	&matrox_millennium};
+static struct video_board vbMillennium2		= {0x1000000, 0x0800000, FB_ACCEL_MATROX_MGA2164W,	&matrox_millennium};
+static struct video_board vbMillennium2A	= {0x1000000, 0x0800000, FB_ACCEL_MATROX_MGA2164W_AGP,	&matrox_millennium};
+#endif	/* CONFIG_FB_MATROX_MILLENIUM */
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+static struct video_board vbMystique		= {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGA1064SG,	&matrox_mystique};
+#endif	/* CONFIG_FB_MATROX_MYSTIQUE */
+#ifdef CONFIG_FB_MATROX_G
+static struct video_board vbG100		= {0x0800000, 0x0800000, FB_ACCEL_MATROX_MGAG100,	&matrox_G100};
+static struct video_board vbG200		= {0x1000000, 0x1000000, FB_ACCEL_MATROX_MGAG200,	&matrox_G100};
+#ifdef CONFIG_FB_MATROX_32MB
+/* from doc it looks like that accelerator can draw only to low 16MB :-( Direct accesses & displaying are OK for
+   whole 32MB */
+static struct video_board vbG400		= {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400,	&matrox_G100};
+#else
+static struct video_board vbG400		= {0x2000000, 0x1000000, FB_ACCEL_MATROX_MGAG400,	&matrox_G100};
+#endif
+#endif
+
+#define DEVF_VIDEO64BIT		0x0001
+#define	DEVF_SWAPS		0x0002
+#define DEVF_SRCORG		0x0004
+#define DEVF_DUALHEAD		0x0008
+#define DEVF_CROSS4MB		0x0010
+#define DEVF_TEXT4B		0x0020
+/* #define DEVF_recycled	0x0040	*/
+/* #define DEVF_recycled	0x0080	*/
+#define DEVF_SUPPORT32MB	0x0100
+#define DEVF_ANY_VXRES		0x0200
+#define DEVF_TEXT16B		0x0400
+#define DEVF_CRTC2		0x0800
+#define DEVF_MAVEN_CAPABLE	0x1000
+#define DEVF_PANELLINK_CAPABLE	0x2000
+#define DEVF_G450DAC		0x4000
+
+#define DEVF_GCORE	(DEVF_VIDEO64BIT | DEVF_SWAPS | DEVF_CROSS4MB)
+#define DEVF_G2CORE	(DEVF_GCORE | DEVF_ANY_VXRES | DEVF_MAVEN_CAPABLE | DEVF_PANELLINK_CAPABLE | DEVF_SRCORG | DEVF_DUALHEAD)
+#define DEVF_G100	(DEVF_GCORE) /* no doc, no vxres... */
+#define DEVF_G200	(DEVF_G2CORE)
+#define DEVF_G400	(DEVF_G2CORE | DEVF_SUPPORT32MB | DEVF_TEXT16B | DEVF_CRTC2)
+/* if you'll find how to drive DFP... */
+#define DEVF_G450	(DEVF_GCORE | DEVF_ANY_VXRES | DEVF_SUPPORT32MB | DEVF_TEXT16B | DEVF_CRTC2 | DEVF_G450DAC | DEVF_SRCORG | DEVF_DUALHEAD)
+#define DEVF_G550	(DEVF_G450)
+
+static struct board {
+	unsigned short vendor, device, rev, svid, sid;
+	unsigned int flags;
+	unsigned int maxclk;
+	enum mga_chip chip;
+	struct video_board* base;
+	const char* name;
+		} dev_list[] = {
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_MIL,	0xFF,
+		0,			0,
+		DEVF_TEXT4B,
+		230000,
+		MGA_2064,
+		&vbMillennium,
+		"Millennium (PCI)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_MIL_2,	0xFF,
+		0,			0,
+		DEVF_SWAPS,
+		220000,
+		MGA_2164,
+		&vbMillennium2,
+		"Millennium II (PCI)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_MIL_2_AGP,	0xFF,
+		0,			0,
+		DEVF_SWAPS,
+		250000,
+		MGA_2164,
+		&vbMillennium2A,
+		"Millennium II (AGP)"},
+#endif
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_MYS,	0x02,
+		0,			0,
+		DEVF_VIDEO64BIT | DEVF_CROSS4MB,
+		180000,
+		MGA_1064,
+		&vbMystique,
+		"Mystique (PCI)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_MYS,	0xFF,
+		0,			0,
+		DEVF_VIDEO64BIT | DEVF_SWAPS | DEVF_CROSS4MB,
+		220000,
+		MGA_1164,
+		&vbMystique,
+		"Mystique 220 (PCI)"},
+#endif
+#ifdef CONFIG_FB_MATROX_G
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G100_MM,	0xFF,
+		0,			0,
+		DEVF_G100,
+		230000,
+		MGA_G100,
+		&vbG100,
+		"MGA-G100 (PCI)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G100_AGP,	0xFF,
+		0,			0,
+		DEVF_G100,
+		230000,
+		MGA_G100,
+		&vbG100,
+		"MGA-G100 (AGP)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G200_PCI,	0xFF,
+		0,			0,
+		DEVF_G200,
+		250000,
+		MGA_G200,
+		&vbG200,
+		"MGA-G200 (PCI)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G200_AGP,	0xFF,
+		PCI_SS_VENDOR_ID_MATROX,	PCI_SS_ID_MATROX_GENERIC,
+		DEVF_G200,
+		220000,
+		MGA_G200,
+		&vbG200,
+		"MGA-G200 (AGP)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G200_AGP,	0xFF,
+		PCI_SS_VENDOR_ID_MATROX,	PCI_SS_ID_MATROX_MYSTIQUE_G200_AGP,
+		DEVF_G200,
+		230000,
+		MGA_G200,
+		&vbG200,
+		"Mystique G200 (AGP)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G200_AGP,	0xFF,
+		PCI_SS_VENDOR_ID_MATROX,	PCI_SS_ID_MATROX_MILLENIUM_G200_AGP,
+		DEVF_G200,
+		250000,
+		MGA_G200,
+		&vbG200,
+		"Millennium G200 (AGP)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G200_AGP,	0xFF,
+		PCI_SS_VENDOR_ID_MATROX,	PCI_SS_ID_MATROX_MARVEL_G200_AGP,
+		DEVF_G200,
+		230000,
+		MGA_G200,
+		&vbG200,
+		"Marvel G200 (AGP)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G200_AGP,	0xFF,
+		PCI_SS_VENDOR_ID_SIEMENS_NIXDORF,	PCI_SS_ID_SIEMENS_MGA_G200_AGP,
+		DEVF_G200,
+		230000,
+		MGA_G200,
+		&vbG200,
+		"MGA-G200 (AGP)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G200_AGP,	0xFF,
+		0,			0,
+		DEVF_G200,
+		230000,
+		MGA_G200,
+		&vbG200,
+		"G200 (AGP)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G400,	0x80,
+		PCI_SS_VENDOR_ID_MATROX,	PCI_SS_ID_MATROX_MILLENNIUM_G400_MAX_AGP,
+		DEVF_G400,
+		360000,
+		MGA_G400,
+		&vbG400,
+		"Millennium G400 MAX (AGP)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G400,	0x80,
+		0,			0,
+		DEVF_G400,
+		300000,
+		MGA_G400,
+		&vbG400,
+		"G400 (AGP)"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G400,	0xFF,
+		0,			0,
+		DEVF_G450,
+		360000,
+		MGA_G450,
+		&vbG400,
+		"G450"},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G550,	0xFF,
+		0,			0,
+		DEVF_G550,
+		360000,
+		MGA_G550,
+		&vbG400,
+		"G550"},
+#endif
+	{0,			0,				0xFF,
+		0,			0,
+		0,
+		0,
+		0,
+		NULL,
+		NULL}};
+
+#ifndef MODULE
+static struct fb_videomode defaultmode = {
+	/* 640x480 @ 60Hz, 31.5 kHz */
+	NULL, 60, 640, 480, 39721, 40, 24, 32, 11, 96, 2,
+	0, FB_VMODE_NONINTERLACED
+};
+#endif /* !MODULE */
+
+static int hotplug = 0;
+
+static void setDefaultOutputs(WPMINFO2) {
+	unsigned int i;
+	const char* ptr;
+
+	ACCESS_FBINFO(outputs[0]).default_src = MATROXFB_SRC_CRTC1;
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+		ACCESS_FBINFO(outputs[1]).default_src = MATROXFB_SRC_CRTC1;
+		ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+	} else if (dfp) {
+		ACCESS_FBINFO(outputs[2]).default_src = MATROXFB_SRC_CRTC1;
+	}
+	ptr = outputs;
+	for (i = 0; i < MATROXFB_MAX_OUTPUTS; i++) {
+		char c = *ptr++;
+
+		if (c == 0) {
+			break;
+		}
+		if (c == '0') {
+			ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_NONE;
+		} else if (c == '1') {
+			ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC1;
+		} else if (c == '2' && ACCESS_FBINFO(devflags.crtc2)) {
+			ACCESS_FBINFO(outputs[i]).default_src = MATROXFB_SRC_CRTC2;
+		} else {
+			printk(KERN_ERR "matroxfb: Unknown outputs setting\n");
+			break;
+		}
+	}
+	/* Nullify this option for subsequent adapters */
+	outputs[0] = 0;
+}
+
+static int initMatrox2(WPMINFO struct board* b){
+	unsigned long ctrlptr_phys = 0;
+	unsigned long video_base_phys = 0;
+	unsigned int memsize;
+	int err;
+
+	static struct pci_device_id intel_82437[] = {
+		{ PCI_DEVICE(PCI_VENDOR_ID_INTEL, PCI_DEVICE_ID_INTEL_82437) },
+		{ },
+	};
+
+	DBG(__FUNCTION__)
+
+	/* set default values... */
+	vesafb_defined.accel_flags = FB_ACCELF_TEXT;
+
+	ACCESS_FBINFO(hw_switch) = b->base->lowlevel;
+	ACCESS_FBINFO(devflags.accelerator) = b->base->accelID;
+	ACCESS_FBINFO(max_pixel_clock) = b->maxclk;
+
+	printk(KERN_INFO "matroxfb: Matrox %s detected\n", b->name);
+	ACCESS_FBINFO(capable.plnwt) = 1;
+	ACCESS_FBINFO(chip) = b->chip;
+	ACCESS_FBINFO(capable.srcorg) = b->flags & DEVF_SRCORG;
+	ACCESS_FBINFO(devflags.video64bits) = b->flags & DEVF_VIDEO64BIT;
+	if (b->flags & DEVF_TEXT4B) {
+		ACCESS_FBINFO(devflags.vgastep) = 4;
+		ACCESS_FBINFO(devflags.textmode) = 4;
+		ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+	} else if (b->flags & DEVF_TEXT16B) {
+		ACCESS_FBINFO(devflags.vgastep) = 16;
+		ACCESS_FBINFO(devflags.textmode) = 1;
+		ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP16;
+	} else {
+		ACCESS_FBINFO(devflags.vgastep) = 8;
+		ACCESS_FBINFO(devflags.textmode) = 1;
+		ACCESS_FBINFO(devflags.text_type_aux) = FB_AUX_TEXT_MGA_STEP8;
+	}
+#ifdef CONFIG_FB_MATROX_32MB
+	ACCESS_FBINFO(devflags.support32MB) = (b->flags & DEVF_SUPPORT32MB) != 0;
+#endif
+	ACCESS_FBINFO(devflags.precise_width) = !(b->flags & DEVF_ANY_VXRES);
+	ACCESS_FBINFO(devflags.crtc2) = (b->flags & DEVF_CRTC2) != 0;
+	ACCESS_FBINFO(devflags.maven_capable) = (b->flags & DEVF_MAVEN_CAPABLE) != 0;
+	ACCESS_FBINFO(devflags.dualhead) = (b->flags & DEVF_DUALHEAD) != 0;
+	ACCESS_FBINFO(devflags.dfp_type) = dfp_type;
+	ACCESS_FBINFO(devflags.g450dac) = (b->flags & DEVF_G450DAC) != 0;
+	ACCESS_FBINFO(devflags.textstep) = ACCESS_FBINFO(devflags.vgastep) * ACCESS_FBINFO(devflags.textmode);
+	ACCESS_FBINFO(devflags.textvram) = 65536 / ACCESS_FBINFO(devflags.textmode);
+	setDefaultOutputs(PMINFO2);
+	if (b->flags & DEVF_PANELLINK_CAPABLE) {
+		ACCESS_FBINFO(outputs[2]).data = MINFO;
+		ACCESS_FBINFO(outputs[2]).output = &panellink_output;
+		ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
+		ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		ACCESS_FBINFO(devflags.panellink) = 1;
+	}
+
+	if (ACCESS_FBINFO(capable.cross4MB) < 0)
+		ACCESS_FBINFO(capable.cross4MB) = b->flags & DEVF_CROSS4MB;
+	if (b->flags & DEVF_SWAPS) {
+		ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
+		video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
+		ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_0;
+	} else {
+		ctrlptr_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 0);
+		video_base_phys = pci_resource_start(ACCESS_FBINFO(pcidev), 1);
+		ACCESS_FBINFO(devflags.fbResource) = PCI_BASE_ADDRESS_1;
+	}
+	err = -EINVAL;
+	if (!ctrlptr_phys) {
+		printk(KERN_ERR "matroxfb: control registers are not available, matroxfb disabled\n");
+		goto fail;
+	}
+	if (!video_base_phys) {
+		printk(KERN_ERR "matroxfb: video RAM is not available in PCI address space, matroxfb disabled\n");
+		goto fail;
+	}
+	memsize = b->base->maxvram;
+	if (!request_mem_region(ctrlptr_phys, 16384, "matroxfb MMIO")) {
+		goto fail;
+	}
+	if (!request_mem_region(video_base_phys, memsize, "matroxfb FB")) {
+		goto failCtrlMR;
+	}
+	ACCESS_FBINFO(video.len_maximum) = memsize;
+	/* convert mem (autodetect k, M) */
+	if (mem < 1024) mem *= 1024;
+	if (mem < 0x00100000) mem *= 1024;
+
+	if (mem && (mem < memsize))
+		memsize = mem;
+	err = -ENOMEM;
+	if (mga_ioremap(ctrlptr_phys, 16384, MGA_IOREMAP_MMIO, &ACCESS_FBINFO(mmio.vbase))) {
+		printk(KERN_ERR "matroxfb: cannot ioremap(%lX, 16384), matroxfb disabled\n", ctrlptr_phys);
+		goto failVideoMR;
+	}
+	ACCESS_FBINFO(mmio.base) = ctrlptr_phys;
+	ACCESS_FBINFO(mmio.len) = 16384;
+	ACCESS_FBINFO(video.base) = video_base_phys;
+	if (mga_ioremap(video_base_phys, memsize, MGA_IOREMAP_FB, &ACCESS_FBINFO(video.vbase))) {
+		printk(KERN_ERR "matroxfb: cannot ioremap(%lX, %d), matroxfb disabled\n",
+			video_base_phys, memsize);
+		goto failCtrlIO;
+	}
+	{
+		u_int32_t cmd;
+		u_int32_t mga_option;
+
+		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, &mga_option);
+		pci_read_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, &cmd);
+		mga_option &= 0x7FFFFFFF; /* clear BIG_ENDIAN */
+		mga_option |= MX_OPTION_BSWAP;
+                /* disable palette snooping */
+                cmd &= ~PCI_COMMAND_VGA_PALETTE;
+		if (pci_dev_present(intel_82437)) {
+			if (!(mga_option & 0x20000000) && !ACCESS_FBINFO(devflags.nopciretry)) {
+				printk(KERN_WARNING "matroxfb: Disabling PCI retries due to i82437 present\n");
+			}
+			mga_option |= 0x20000000;
+			ACCESS_FBINFO(devflags.nopciretry) = 1;
+		}
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_COMMAND, cmd);
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_OPTION_REG, mga_option);
+		ACCESS_FBINFO(hw).MXoptionReg = mga_option;
+
+		/* select non-DMA memory for PCI_MGA_DATA, otherwise dump of PCI cfg space can lock PCI bus */
+		/* maybe preinit() candidate, but it is same... for all devices... at this time... */
+		pci_write_config_dword(ACCESS_FBINFO(pcidev), PCI_MGA_INDEX, 0x00003C00);
+	}
+
+	err = -ENXIO;
+	matroxfb_read_pins(PMINFO2);
+	if (ACCESS_FBINFO(hw_switch)->preinit(PMINFO2)) {
+		goto failVideoIO;
+	}
+
+	err = -ENOMEM;
+	if (!matroxfb_getmemory(PMINFO memsize, &ACCESS_FBINFO(video.len)) || !ACCESS_FBINFO(video.len)) {
+		printk(KERN_ERR "matroxfb: cannot determine memory size\n");
+		goto failVideoIO;
+	}
+	ACCESS_FBINFO(devflags.ydstorg) = 0;
+
+	ACCESS_FBINFO(video.base) = video_base_phys;
+	ACCESS_FBINFO(video.len_usable) = ACCESS_FBINFO(video.len);
+	if (ACCESS_FBINFO(video.len_usable) > b->base->maxdisplayable)
+		ACCESS_FBINFO(video.len_usable) = b->base->maxdisplayable;
+#ifdef CONFIG_MTRR
+	if (mtrr) {
+		ACCESS_FBINFO(mtrr.vram) = mtrr_add(video_base_phys, ACCESS_FBINFO(video.len), MTRR_TYPE_WRCOMB, 1);
+		ACCESS_FBINFO(mtrr.vram_valid) = 1;
+		printk(KERN_INFO "matroxfb: MTRR's turned on\n");
+	}
+#endif	/* CONFIG_MTRR */
+
+	if (!ACCESS_FBINFO(devflags.novga))
+		request_region(0x3C0, 32, "matrox");
+	matroxfb_g450_connect(PMINFO2);
+	ACCESS_FBINFO(hw_switch->reset(PMINFO2));
+
+	ACCESS_FBINFO(fbcon.monspecs.hfmin) = 0;
+	ACCESS_FBINFO(fbcon.monspecs.hfmax) = fh;
+	ACCESS_FBINFO(fbcon.monspecs.vfmin) = 0;
+	ACCESS_FBINFO(fbcon.monspecs.vfmax) = fv;
+	ACCESS_FBINFO(fbcon.monspecs.dpms) = 0;	/* TBD */
+
+	/* static settings */
+	vesafb_defined.red = colors[depth-1].red;
+	vesafb_defined.green = colors[depth-1].green;
+	vesafb_defined.blue = colors[depth-1].blue;
+	vesafb_defined.bits_per_pixel = colors[depth-1].bits_per_pixel;
+	vesafb_defined.grayscale = grayscale;
+	vesafb_defined.vmode = 0;
+	if (noaccel)
+		vesafb_defined.accel_flags &= ~FB_ACCELF_TEXT;
+
+	ACCESS_FBINFO(fbops) = matroxfb_ops;
+	ACCESS_FBINFO(fbcon.fbops) = &ACCESS_FBINFO(fbops);
+	ACCESS_FBINFO(fbcon.pseudo_palette) = ACCESS_FBINFO(cmap);
+	/* after __init time we are like module... no logo */
+	ACCESS_FBINFO(fbcon.flags) = hotplug ? FBINFO_FLAG_MODULE : FBINFO_FLAG_DEFAULT;
+	ACCESS_FBINFO(fbcon.flags) |= FBINFO_PARTIAL_PAN_OK | 	 /* Prefer panning for scroll under MC viewer/edit */
+				      FBINFO_HWACCEL_COPYAREA |  /* We have hw-assisted bmove */
+				      FBINFO_HWACCEL_FILLRECT |  /* And fillrect */
+				      FBINFO_HWACCEL_IMAGEBLIT | /* And imageblit */
+				      FBINFO_HWACCEL_XPAN |      /* And we support both horizontal */
+				      FBINFO_HWACCEL_YPAN;       /* And vertical panning */
+	ACCESS_FBINFO(video.len_usable) &= PAGE_MASK;
+	fb_alloc_cmap(&ACCESS_FBINFO(fbcon.cmap), 256, 1);
+
+#ifndef MODULE
+	/* mode database is marked __init!!! */
+	if (!hotplug) {
+		fb_find_mode(&vesafb_defined, &ACCESS_FBINFO(fbcon), videomode[0]?videomode:NULL,
+			NULL, 0, &defaultmode, vesafb_defined.bits_per_pixel);
+	}
+#endif /* !MODULE */
+
+	/* mode modifiers */
+	if (hslen)
+		vesafb_defined.hsync_len = hslen;
+	if (vslen)
+		vesafb_defined.vsync_len = vslen;
+	if (left != ~0)
+		vesafb_defined.left_margin = left;
+	if (right != ~0)
+		vesafb_defined.right_margin = right;
+	if (upper != ~0)
+		vesafb_defined.upper_margin = upper;
+	if (lower != ~0)
+		vesafb_defined.lower_margin = lower;
+	if (xres)
+		vesafb_defined.xres = xres;
+	if (yres)
+		vesafb_defined.yres = yres;
+	if (sync != -1)
+		vesafb_defined.sync = sync;
+	else if (vesafb_defined.sync == ~0) {
+		vesafb_defined.sync = 0;
+		if (yres < 400)
+			vesafb_defined.sync |= FB_SYNC_HOR_HIGH_ACT;
+		else if (yres < 480)
+			vesafb_defined.sync |= FB_SYNC_VERT_HIGH_ACT;
+	}
+
+	/* fv, fh, maxclk limits was specified */
+	{
+		unsigned int tmp;
+
+		if (fv) {
+			tmp = fv * (vesafb_defined.upper_margin + vesafb_defined.yres
+			          + vesafb_defined.lower_margin + vesafb_defined.vsync_len);
+			if ((tmp < fh) || (fh == 0)) fh = tmp;
+		}
+		if (fh) {
+			tmp = fh * (vesafb_defined.left_margin + vesafb_defined.xres
+			          + vesafb_defined.right_margin + vesafb_defined.hsync_len);
+			if ((tmp < maxclk) || (maxclk == 0)) maxclk = tmp;
+		}
+		tmp = (maxclk + 499) / 500;
+		if (tmp) {
+			tmp = (2000000000 + tmp) / tmp;
+			if (tmp > pixclock) pixclock = tmp;
+		}
+	}
+	if (pixclock) {
+		if (pixclock < 2000)		/* > 500MHz */
+			pixclock = 4000;	/* 250MHz */
+		if (pixclock > 1000000)
+			pixclock = 1000000;	/* 1MHz */
+		vesafb_defined.pixclock = pixclock;
+	}
+
+	/* FIXME: Where to move this?! */
+#if defined(CONFIG_PPC_PMAC)
+#ifndef MODULE
+	if (_machine == _MACH_Pmac) {
+		struct fb_var_screeninfo var;
+		if (default_vmode <= 0 || default_vmode > VMODE_MAX)
+			default_vmode = VMODE_640_480_60;
+#ifdef CONFIG_NVRAM
+		if (default_cmode == CMODE_NVRAM)
+			default_cmode = nvram_read_byte(NV_CMODE);
+#endif
+		if (default_cmode < CMODE_8 || default_cmode > CMODE_32)
+			default_cmode = CMODE_8;
+		if (!mac_vmode_to_var(default_vmode, default_cmode, &var)) {
+			var.accel_flags = vesafb_defined.accel_flags;
+			var.xoffset = var.yoffset = 0;
+			/* Note: mac_vmode_to_var() does not set all parameters */
+			vesafb_defined = var;
+		}
+	}
+#endif /* !MODULE */
+#endif /* CONFIG_PPC_PMAC */
+	vesafb_defined.xres_virtual = vesafb_defined.xres;
+	if (nopan) {
+		vesafb_defined.yres_virtual = vesafb_defined.yres;
+	} else {
+		vesafb_defined.yres_virtual = 65536; /* large enough to be INF, but small enough
+							to yres_virtual * xres_virtual < 2^32 */
+	}
+	matroxfb_init_fix(PMINFO2);
+	/* Normalize values (namely yres_virtual) */
+	matroxfb_check_var(&vesafb_defined, &ACCESS_FBINFO(fbcon));
+	/* And put it into "current" var. Do NOT program hardware yet, or we'll not take over
+	 * vgacon correctly. fbcon_startup will call fb_set_par for us, WITHOUT check_var,
+	 * and unfortunately it will do it BEFORE vgacon contents is saved, so it won't work
+	 * anyway. But we at least tried... */
+	ACCESS_FBINFO(fbcon.var) = vesafb_defined;
+	err = -EINVAL;
+
+	printk(KERN_INFO "matroxfb: %dx%dx%dbpp (virtual: %dx%d)\n",
+		vesafb_defined.xres, vesafb_defined.yres, vesafb_defined.bits_per_pixel,
+		vesafb_defined.xres_virtual, vesafb_defined.yres_virtual);
+	printk(KERN_INFO "matroxfb: framebuffer at 0x%lX, mapped to 0x%p, size %d\n",
+		ACCESS_FBINFO(video.base), vaddr_va(ACCESS_FBINFO(video.vbase)), ACCESS_FBINFO(video.len));
+
+/* We do not have to set currcon to 0... register_framebuffer do it for us on first console
+ * and we do not want currcon == 0 for subsequent framebuffers */
+
+	ACCESS_FBINFO(fbcon).device = &ACCESS_FBINFO(pcidev)->dev;
+	if (register_framebuffer(&ACCESS_FBINFO(fbcon)) < 0) {
+		goto failVideoIO;
+	}
+	printk("fb%d: %s frame buffer device\n",
+	       ACCESS_FBINFO(fbcon.node), ACCESS_FBINFO(fbcon.fix.id));
+
+	/* there is no console on this fb... but we have to initialize hardware
+	 * until someone tells me what is proper thing to do */
+ 	if (!ACCESS_FBINFO(initialized)) {
+ 		printk(KERN_INFO "fb%d: initializing hardware\n",
+ 		       ACCESS_FBINFO(fbcon.node));
+ 		/* We have to use FB_ACTIVATE_FORCE, as we had to put vesafb_defined to the fbcon.var
+ 		 * already before, so register_framebuffer works correctly. */
+ 		vesafb_defined.activate |= FB_ACTIVATE_FORCE;
+ 		fb_set_var(&ACCESS_FBINFO(fbcon), &vesafb_defined);
+ 	}
+
+	return 0;
+failVideoIO:;
+	matroxfb_g450_shutdown(PMINFO2);
+	mga_iounmap(ACCESS_FBINFO(video.vbase));
+failCtrlIO:;
+	mga_iounmap(ACCESS_FBINFO(mmio.vbase));
+failVideoMR:;
+	release_mem_region(video_base_phys, ACCESS_FBINFO(video.len_maximum));
+failCtrlMR:;
+	release_mem_region(ctrlptr_phys, 16384);
+fail:;
+	return err;
+}
+
+static LIST_HEAD(matroxfb_list);
+static LIST_HEAD(matroxfb_driver_list);
+
+#define matroxfb_l(x) list_entry(x, struct matrox_fb_info, next_fb)
+#define matroxfb_driver_l(x) list_entry(x, struct matroxfb_driver, node)
+int matroxfb_register_driver(struct matroxfb_driver* drv) {
+	struct matrox_fb_info* minfo;
+
+	list_add(&drv->node, &matroxfb_driver_list);
+	for (minfo = matroxfb_l(matroxfb_list.next);
+	     minfo != matroxfb_l(&matroxfb_list);
+	     minfo = matroxfb_l(minfo->next_fb.next)) {
+		void* p;
+
+		if (minfo->drivers_count == MATROXFB_MAX_FB_DRIVERS)
+			continue;
+		p = drv->probe(minfo);
+		if (p) {
+			minfo->drivers_data[minfo->drivers_count] = p;
+			minfo->drivers[minfo->drivers_count++] = drv;
+		}
+	}
+	return 0;
+}
+
+void matroxfb_unregister_driver(struct matroxfb_driver* drv) {
+	struct matrox_fb_info* minfo;
+
+	list_del(&drv->node);
+	for (minfo = matroxfb_l(matroxfb_list.next);
+	     minfo != matroxfb_l(&matroxfb_list);
+	     minfo = matroxfb_l(minfo->next_fb.next)) {
+		int i;
+
+		for (i = 0; i < minfo->drivers_count; ) {
+			if (minfo->drivers[i] == drv) {
+				if (drv && drv->remove)
+					drv->remove(minfo, minfo->drivers_data[i]);
+				minfo->drivers[i] = minfo->drivers[--minfo->drivers_count];
+				minfo->drivers_data[i] = minfo->drivers_data[minfo->drivers_count];
+			} else
+				i++;
+		}
+	}
+}
+
+static void matroxfb_register_device(struct matrox_fb_info* minfo) {
+	struct matroxfb_driver* drv;
+	int i = 0;
+	list_add(&ACCESS_FBINFO(next_fb), &matroxfb_list);
+	for (drv = matroxfb_driver_l(matroxfb_driver_list.next);
+	     drv != matroxfb_driver_l(&matroxfb_driver_list);
+	     drv = matroxfb_driver_l(drv->node.next)) {
+		if (drv && drv->probe) {
+			void *p = drv->probe(minfo);
+			if (p) {
+				minfo->drivers_data[i] = p;
+				minfo->drivers[i++] = drv;
+				if (i == MATROXFB_MAX_FB_DRIVERS)
+					break;
+			}
+		}
+	}
+	minfo->drivers_count = i;
+}
+
+static void matroxfb_unregister_device(struct matrox_fb_info* minfo) {
+	int i;
+
+	list_del(&ACCESS_FBINFO(next_fb));
+	for (i = 0; i < minfo->drivers_count; i++) {
+		struct matroxfb_driver* drv = minfo->drivers[i];
+
+		if (drv && drv->remove)
+			drv->remove(minfo, minfo->drivers_data[i]);
+	}
+}
+
+static int matroxfb_probe(struct pci_dev* pdev, const struct pci_device_id* dummy) {
+	struct board* b;
+	u_int8_t rev;
+	u_int16_t svid;
+	u_int16_t sid;
+	struct matrox_fb_info* minfo;
+	int err;
+	u_int32_t cmd;
+#ifndef CONFIG_FB_MATROX_MULTIHEAD
+	static int registered = 0;
+#endif
+	DBG(__FUNCTION__)
+
+	pci_read_config_byte(pdev, PCI_REVISION_ID, &rev);
+	svid = pdev->subsystem_vendor;
+	sid = pdev->subsystem_device;
+	for (b = dev_list; b->vendor; b++) {
+		if ((b->vendor != pdev->vendor) || (b->device != pdev->device) || (b->rev < rev)) continue;
+		if (b->svid)
+			if ((b->svid != svid) || (b->sid != sid)) continue;
+		break;
+	}
+	/* not match... */
+	if (!b->vendor)
+		return -1;
+	if (dev > 0) {
+		/* not requested one... */
+		dev--;
+		return -1;
+	}
+	pci_read_config_dword(pdev, PCI_COMMAND, &cmd);
+	if (pci_enable_device(pdev)) {
+		return -1;
+	}
+
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+	minfo = (struct matrox_fb_info*)kmalloc(sizeof(*minfo), GFP_KERNEL);
+	if (!minfo)
+		return -1;
+#else
+	if (registered)	/* singlehead driver... */
+		return -1;
+	minfo = &matroxfb_global_mxinfo;
+#endif
+	memset(MINFO, 0, sizeof(*MINFO));
+
+	ACCESS_FBINFO(pcidev) = pdev;
+	ACCESS_FBINFO(dead) = 0;
+	ACCESS_FBINFO(usecount) = 0;
+	ACCESS_FBINFO(userusecount) = 0;
+
+	pci_set_drvdata(pdev, MINFO);
+	/* DEVFLAGS */
+	ACCESS_FBINFO(devflags.memtype) = memtype;
+	if (memtype != -1)
+		noinit = 0;
+	if (cmd & PCI_COMMAND_MEMORY) {
+		ACCESS_FBINFO(devflags.novga) = novga;
+		ACCESS_FBINFO(devflags.nobios) = nobios;
+		ACCESS_FBINFO(devflags.noinit) = noinit;
+		/* subsequent heads always needs initialization and must not enable BIOS */
+		novga = 1;
+		nobios = 1;
+		noinit = 0;
+	} else {
+		ACCESS_FBINFO(devflags.novga) = 1;
+		ACCESS_FBINFO(devflags.nobios) = 1;
+		ACCESS_FBINFO(devflags.noinit) = 0;
+	}
+
+	ACCESS_FBINFO(devflags.nopciretry) = no_pci_retry;
+	ACCESS_FBINFO(devflags.mga_24bpp_fix) = inv24;
+	ACCESS_FBINFO(devflags.precise_width) = option_precise_width;
+	ACCESS_FBINFO(devflags.sgram) = sgram;
+	ACCESS_FBINFO(capable.cross4MB) = cross4MB;
+
+	spin_lock_init(&ACCESS_FBINFO(lock.DAC));
+	spin_lock_init(&ACCESS_FBINFO(lock.accel));
+	init_rwsem(&ACCESS_FBINFO(crtc2.lock));
+	init_rwsem(&ACCESS_FBINFO(altout.lock));
+	ACCESS_FBINFO(irq_flags) = 0;
+	init_waitqueue_head(&ACCESS_FBINFO(crtc1.vsync.wait));
+	init_waitqueue_head(&ACCESS_FBINFO(crtc2.vsync.wait));
+	ACCESS_FBINFO(crtc1.panpos) = -1;
+
+	err = initMatrox2(PMINFO b);
+	if (!err) {
+#ifndef CONFIG_FB_MATROX_MULTIHEAD
+		registered = 1;
+#endif
+		matroxfb_register_device(MINFO);
+		return 0;
+	}
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+	kfree(minfo);
+#endif
+	return -1;
+}
+
+static void pci_remove_matrox(struct pci_dev* pdev) {
+	struct matrox_fb_info* minfo;
+
+	minfo = pci_get_drvdata(pdev);
+	matroxfb_remove(PMINFO 1);
+}
+
+static struct pci_device_id matroxfb_devices[] = {
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_MIL,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_MIL_2,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_MIL_2_AGP,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+#endif
+#ifdef CONFIG_FB_MATROX_MYSTIQUE
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_MYS,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+#endif
+#ifdef CONFIG_FB_MATROX_G
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G100_MM,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G100_AGP,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G200_PCI,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G200_AGP,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G400,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+	{PCI_VENDOR_ID_MATROX,	PCI_DEVICE_ID_MATROX_G550,
+		PCI_ANY_ID,	PCI_ANY_ID,	0, 0, 0},
+#endif
+	{0,			0,
+		0,		0,		0, 0, 0}
+};
+
+MODULE_DEVICE_TABLE(pci, matroxfb_devices);
+
+
+static struct pci_driver matroxfb_driver = {
+	.name =		"matroxfb",
+	.id_table =	matroxfb_devices,
+	.probe =	matroxfb_probe,
+	.remove =	pci_remove_matrox,
+};
+
+/* **************************** init-time only **************************** */
+
+#define RSResolution(X)	((X) & 0x0F)
+#define RS640x400	1
+#define RS640x480	2
+#define RS800x600	3
+#define RS1024x768	4
+#define RS1280x1024	5
+#define RS1600x1200	6
+#define RS768x576	7
+#define RS960x720	8
+#define RS1152x864	9
+#define RS1408x1056	10
+#define RS640x350	11
+#define RS1056x344	12	/* 132 x 43 text */
+#define RS1056x400	13	/* 132 x 50 text */
+#define RS1056x480	14	/* 132 x 60 text */
+#define RSNoxNo		15
+/* 10-FF */
+static struct { int xres, yres, left, right, upper, lower, hslen, vslen, vfreq; } timmings[] __initdata = {
+	{  640,  400,  48, 16, 39,  8,  96, 2, 70 },
+	{  640,  480,  48, 16, 33, 10,  96, 2, 60 },
+	{  800,  600, 144, 24, 28,  8, 112, 6, 60 },
+	{ 1024,  768, 160, 32, 30,  4, 128, 4, 60 },
+	{ 1280, 1024, 224, 32, 32,  4, 136, 4, 60 },
+	{ 1600, 1200, 272, 48, 32,  5, 152, 5, 60 },
+	{  768,  576, 144, 16, 28,  6, 112, 4, 60 },
+	{  960,  720, 144, 24, 28,  8, 112, 4, 60 },
+	{ 1152,  864, 192, 32, 30,  4, 128, 4, 60 },
+	{ 1408, 1056, 256, 40, 32,  5, 144, 5, 60 },
+	{  640,  350,  48, 16, 39,  8,  96, 2, 70 },
+	{ 1056,  344,  96, 24, 59, 44, 160, 2, 70 },
+	{ 1056,  400,  96, 24, 39,  8, 160, 2, 70 },
+	{ 1056,  480,  96, 24, 36, 12, 160, 3, 60 },
+	{    0,    0,  ~0, ~0, ~0, ~0,   0, 0,  0 }
+};
+
+#define RSCreate(X,Y)	((X) | ((Y) << 8))
+static struct { unsigned int vesa; unsigned int info; } *RSptr, vesamap[] __initdata = {
+/* default must be first */
+	{    ~0, RSCreate(RSNoxNo,     RS8bpp ) },
+	{ 0x101, RSCreate(RS640x480,   RS8bpp ) },
+	{ 0x100, RSCreate(RS640x400,   RS8bpp ) },
+	{ 0x180, RSCreate(RS768x576,   RS8bpp ) },
+	{ 0x103, RSCreate(RS800x600,   RS8bpp ) },
+	{ 0x188, RSCreate(RS960x720,   RS8bpp ) },
+	{ 0x105, RSCreate(RS1024x768,  RS8bpp ) },
+	{ 0x190, RSCreate(RS1152x864,  RS8bpp ) },
+	{ 0x107, RSCreate(RS1280x1024, RS8bpp ) },
+	{ 0x198, RSCreate(RS1408x1056, RS8bpp ) },
+	{ 0x11C, RSCreate(RS1600x1200, RS8bpp ) },
+	{ 0x110, RSCreate(RS640x480,   RS15bpp) },
+	{ 0x181, RSCreate(RS768x576,   RS15bpp) },
+	{ 0x113, RSCreate(RS800x600,   RS15bpp) },
+	{ 0x189, RSCreate(RS960x720,   RS15bpp) },
+	{ 0x116, RSCreate(RS1024x768,  RS15bpp) },
+	{ 0x191, RSCreate(RS1152x864,  RS15bpp) },
+	{ 0x119, RSCreate(RS1280x1024, RS15bpp) },
+	{ 0x199, RSCreate(RS1408x1056, RS15bpp) },
+	{ 0x11D, RSCreate(RS1600x1200, RS15bpp) },
+	{ 0x111, RSCreate(RS640x480,   RS16bpp) },
+	{ 0x182, RSCreate(RS768x576,   RS16bpp) },
+	{ 0x114, RSCreate(RS800x600,   RS16bpp) },
+	{ 0x18A, RSCreate(RS960x720,   RS16bpp) },
+	{ 0x117, RSCreate(RS1024x768,  RS16bpp) },
+	{ 0x192, RSCreate(RS1152x864,  RS16bpp) },
+	{ 0x11A, RSCreate(RS1280x1024, RS16bpp) },
+	{ 0x19A, RSCreate(RS1408x1056, RS16bpp) },
+	{ 0x11E, RSCreate(RS1600x1200, RS16bpp) },
+	{ 0x1B2, RSCreate(RS640x480,   RS24bpp) },
+	{ 0x184, RSCreate(RS768x576,   RS24bpp) },
+	{ 0x1B5, RSCreate(RS800x600,   RS24bpp) },
+	{ 0x18C, RSCreate(RS960x720,   RS24bpp) },
+	{ 0x1B8, RSCreate(RS1024x768,  RS24bpp) },
+	{ 0x194, RSCreate(RS1152x864,  RS24bpp) },
+	{ 0x1BB, RSCreate(RS1280x1024, RS24bpp) },
+	{ 0x19C, RSCreate(RS1408x1056, RS24bpp) },
+	{ 0x1BF, RSCreate(RS1600x1200, RS24bpp) },
+	{ 0x112, RSCreate(RS640x480,   RS32bpp) },
+	{ 0x183, RSCreate(RS768x576,   RS32bpp) },
+	{ 0x115, RSCreate(RS800x600,   RS32bpp) },
+	{ 0x18B, RSCreate(RS960x720,   RS32bpp) },
+	{ 0x118, RSCreate(RS1024x768,  RS32bpp) },
+	{ 0x193, RSCreate(RS1152x864,  RS32bpp) },
+	{ 0x11B, RSCreate(RS1280x1024, RS32bpp) },
+	{ 0x19B, RSCreate(RS1408x1056, RS32bpp) },
+	{ 0x11F, RSCreate(RS1600x1200, RS32bpp) },
+	{ 0x010, RSCreate(RS640x350,   RS4bpp ) },
+	{ 0x012, RSCreate(RS640x480,   RS4bpp ) },
+	{ 0x102, RSCreate(RS800x600,   RS4bpp ) },
+	{ 0x104, RSCreate(RS1024x768,  RS4bpp ) },
+	{ 0x106, RSCreate(RS1280x1024, RS4bpp ) },
+	{     0, 0				}};
+
+static void __init matroxfb_init_params(void) {
+	/* fh from kHz to Hz */
+	if (fh < 1000)
+		fh *= 1000;	/* 1kHz minimum */
+	/* maxclk */
+	if (maxclk < 1000) maxclk *= 1000;	/* kHz -> Hz, MHz -> kHz */
+	if (maxclk < 1000000) maxclk *= 1000;	/* kHz -> Hz, 1MHz minimum */
+	/* fix VESA number */
+	if (vesa != ~0)
+		vesa &= 0x1DFF;		/* mask out clearscreen, acceleration and so on */
+
+	/* static settings */
+	for (RSptr = vesamap; RSptr->vesa; RSptr++) {
+		if (RSptr->vesa == vesa) break;
+	}
+	if (!RSptr->vesa) {
+		printk(KERN_ERR "Invalid vesa mode 0x%04X\n", vesa);
+		RSptr = vesamap;
+	}
+	{
+		int res = RSResolution(RSptr->info)-1;
+		if (left == ~0)
+			left = timmings[res].left;
+		if (!xres)
+			xres = timmings[res].xres;
+		if (right == ~0)
+			right = timmings[res].right;
+		if (!hslen)
+			hslen = timmings[res].hslen;
+		if (upper == ~0)
+			upper = timmings[res].upper;
+		if (!yres)
+			yres = timmings[res].yres;
+		if (lower == ~0)
+			lower = timmings[res].lower;
+		if (!vslen)
+			vslen = timmings[res].vslen;
+		if (!(fv||fh||maxclk||pixclock))
+			fv = timmings[res].vfreq;
+		if (depth == -1)
+			depth = RSDepth(RSptr->info);
+	}
+}
+
+static void __init matrox_init(void) {
+	matroxfb_init_params();
+	pci_register_driver(&matroxfb_driver);
+	dev = -1;	/* accept all new devices... */
+}
+
+/* **************************** exit-time only **************************** */
+
+static void __exit matrox_done(void) {
+	pci_unregister_driver(&matroxfb_driver);
+}
+
+#ifndef MODULE
+
+/* ************************* init in-kernel code ************************** */
+
+static int __init matroxfb_setup(char *options) {
+	char *this_opt;
+
+	DBG(__FUNCTION__)
+
+	if (!options || !*options)
+		return 0;
+
+	while ((this_opt = strsep(&options, ",")) != NULL) {
+		if (!*this_opt) continue;
+
+		dprintk("matroxfb_setup: option %s\n", this_opt);
+
+		if (!strncmp(this_opt, "dev:", 4))
+			dev = simple_strtoul(this_opt+4, NULL, 0);
+		else if (!strncmp(this_opt, "depth:", 6)) {
+			switch (simple_strtoul(this_opt+6, NULL, 0)) {
+				case 0: depth = RSText; break;
+				case 4: depth = RS4bpp; break;
+				case 8: depth = RS8bpp; break;
+				case 15:depth = RS15bpp; break;
+				case 16:depth = RS16bpp; break;
+				case 24:depth = RS24bpp; break;
+				case 32:depth = RS32bpp; break;
+				default:
+					printk(KERN_ERR "matroxfb: unsupported color depth\n");
+			}
+		} else if (!strncmp(this_opt, "xres:", 5))
+			xres = simple_strtoul(this_opt+5, NULL, 0);
+		else if (!strncmp(this_opt, "yres:", 5))
+			yres = simple_strtoul(this_opt+5, NULL, 0);
+		else if (!strncmp(this_opt, "vslen:", 6))
+			vslen = simple_strtoul(this_opt+6, NULL, 0);
+		else if (!strncmp(this_opt, "hslen:", 6))
+			hslen = simple_strtoul(this_opt+6, NULL, 0);
+		else if (!strncmp(this_opt, "left:", 5))
+			left = simple_strtoul(this_opt+5, NULL, 0);
+		else if (!strncmp(this_opt, "right:", 6))
+			right = simple_strtoul(this_opt+6, NULL, 0);
+		else if (!strncmp(this_opt, "upper:", 6))
+			upper = simple_strtoul(this_opt+6, NULL, 0);
+		else if (!strncmp(this_opt, "lower:", 6))
+			lower = simple_strtoul(this_opt+6, NULL, 0);
+		else if (!strncmp(this_opt, "pixclock:", 9))
+			pixclock = simple_strtoul(this_opt+9, NULL, 0);
+		else if (!strncmp(this_opt, "sync:", 5))
+			sync = simple_strtoul(this_opt+5, NULL, 0);
+		else if (!strncmp(this_opt, "vesa:", 5))
+			vesa = simple_strtoul(this_opt+5, NULL, 0);
+		else if (!strncmp(this_opt, "maxclk:", 7))
+			maxclk = simple_strtoul(this_opt+7, NULL, 0);
+		else if (!strncmp(this_opt, "fh:", 3))
+			fh = simple_strtoul(this_opt+3, NULL, 0);
+		else if (!strncmp(this_opt, "fv:", 3))
+			fv = simple_strtoul(this_opt+3, NULL, 0);
+		else if (!strncmp(this_opt, "mem:", 4))
+			mem = simple_strtoul(this_opt+4, NULL, 0);
+		else if (!strncmp(this_opt, "mode:", 5))
+			strlcpy(videomode, this_opt+5, sizeof(videomode));
+		else if (!strncmp(this_opt, "outputs:", 8))
+			strlcpy(outputs, this_opt+8, sizeof(outputs));
+		else if (!strncmp(this_opt, "dfp:", 4)) {
+			dfp_type = simple_strtoul(this_opt+4, NULL, 0);
+			dfp = 1;
+		}	
+#ifdef CONFIG_PPC_PMAC
+		else if (!strncmp(this_opt, "vmode:", 6)) {
+			unsigned int vmode = simple_strtoul(this_opt+6, NULL, 0);
+			if (vmode > 0 && vmode <= VMODE_MAX)
+				default_vmode = vmode;
+		} else if (!strncmp(this_opt, "cmode:", 6)) {
+			unsigned int cmode = simple_strtoul(this_opt+6, NULL, 0);
+			switch (cmode) {
+				case 0:
+				case 8:
+					default_cmode = CMODE_8;
+					break;
+				case 15:
+				case 16:
+					default_cmode = CMODE_16;
+					break;
+				case 24:
+				case 32:
+					default_cmode = CMODE_32;
+					break;
+			}
+		}
+#endif
+		else if (!strcmp(this_opt, "disabled"))	/* nodisabled does not exist */
+			disabled = 1;
+		else if (!strcmp(this_opt, "enabled"))	/* noenabled does not exist */
+			disabled = 0;
+		else if (!strcmp(this_opt, "sgram"))	/* nosgram == sdram */
+			sgram = 1;
+		else if (!strcmp(this_opt, "sdram"))
+			sgram = 0;
+		else if (!strncmp(this_opt, "memtype:", 8))
+			memtype = simple_strtoul(this_opt+8, NULL, 0);
+		else {
+			int value = 1;
+
+			if (!strncmp(this_opt, "no", 2)) {
+				value = 0;
+				this_opt += 2;
+			}
+			if (! strcmp(this_opt, "inverse"))
+				inverse = value;
+			else if (!strcmp(this_opt, "accel"))
+				noaccel = !value;
+			else if (!strcmp(this_opt, "pan"))
+				nopan = !value;
+			else if (!strcmp(this_opt, "pciretry"))
+				no_pci_retry = !value;
+			else if (!strcmp(this_opt, "vga"))
+				novga = !value;
+			else if (!strcmp(this_opt, "bios"))
+				nobios = !value;
+			else if (!strcmp(this_opt, "init"))
+				noinit = !value;
+#ifdef CONFIG_MTRR
+			else if (!strcmp(this_opt, "mtrr"))
+				mtrr = value;
+#endif
+			else if (!strcmp(this_opt, "inv24"))
+				inv24 = value;
+			else if (!strcmp(this_opt, "cross4MB"))
+				cross4MB = value;
+			else if (!strcmp(this_opt, "grayscale"))
+				grayscale = value;
+			else if (!strcmp(this_opt, "dfp"))
+				dfp = value;
+			else {
+				strlcpy(videomode, this_opt, sizeof(videomode));
+			}
+		}
+	}
+	return 0;
+}
+
+static int __initdata initialized = 0;
+
+static int __init matroxfb_init(void)
+{
+	char *option = NULL;
+
+	DBG(__FUNCTION__)
+
+	if (fb_get_options("matroxfb", &option))
+		return -ENODEV;
+	matroxfb_setup(option);
+
+	if (disabled)
+		return -ENXIO;
+	if (!initialized) {
+		initialized = 1;
+		matrox_init();
+	}
+	hotplug = 1;
+	/* never return failure, user can hotplug matrox later... */
+	return 0;
+}
+
+module_init(matroxfb_init);
+
+#else
+
+/* *************************** init module code **************************** */
+
+MODULE_AUTHOR("(c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Accelerated FBDev driver for Matrox Millennium/Mystique/G100/G200/G400/G450/G550");
+MODULE_LICENSE("GPL");
+
+module_param(mem, int, 0);
+MODULE_PARM_DESC(mem, "Size of available memory in MB, KB or B (2,4,8,12,16MB, default=autodetect)");
+module_param(disabled, int, 0);
+MODULE_PARM_DESC(disabled, "Disabled (0 or 1=disabled) (default=0)");
+module_param(noaccel, int, 0);
+MODULE_PARM_DESC(noaccel, "Do not use accelerating engine (0 or 1=disabled) (default=0)");
+module_param(nopan, int, 0);
+MODULE_PARM_DESC(nopan, "Disable pan on startup (0 or 1=disabled) (default=0)");
+module_param(no_pci_retry, int, 0);
+MODULE_PARM_DESC(no_pci_retry, "PCI retries enabled (0 or 1=disabled) (default=0)");
+module_param(novga, int, 0);
+MODULE_PARM_DESC(novga, "VGA I/O (0x3C0-0x3DF) disabled (0 or 1=disabled) (default=0)");
+module_param(nobios, int, 0);
+MODULE_PARM_DESC(nobios, "Disables ROM BIOS (0 or 1=disabled) (default=do not change BIOS state)");
+module_param(noinit, int, 0);
+MODULE_PARM_DESC(noinit, "Disables W/SG/SD-RAM and bus interface initialization (0 or 1=do not initialize) (default=0)");
+module_param(memtype, int, 0);
+MODULE_PARM_DESC(memtype, "Memory type for G200/G400 (see Documentation/fb/matroxfb.txt for explanation) (default=3 for G200, 0 for G400)");
+#ifdef CONFIG_MTRR
+module_param(mtrr, int, 0);
+MODULE_PARM_DESC(mtrr, "This speeds up video memory accesses (0=disabled or 1) (default=1)");
+#endif
+module_param(sgram, int, 0);
+MODULE_PARM_DESC(sgram, "Indicates that G100/G200/G400 has SGRAM memory (0=SDRAM, 1=SGRAM) (default=0)");
+module_param(inv24, int, 0);
+MODULE_PARM_DESC(inv24, "Inverts clock polarity for 24bpp and loop frequency > 100MHz (default=do not invert polarity)");
+module_param(inverse, int, 0);
+MODULE_PARM_DESC(inverse, "Inverse (0 or 1) (default=0)");
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+module_param(dev, int, 0);
+MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=all working)");
+#else
+module_param(dev, int, 0);
+MODULE_PARM_DESC(dev, "Multihead support, attach to device ID (0..N) (default=first working)");
+#endif
+module_param(vesa, int, 0);
+MODULE_PARM_DESC(vesa, "Startup videomode (0x000-0x1FF) (default=0x101)");
+module_param(xres, int, 0);
+MODULE_PARM_DESC(xres, "Horizontal resolution (px), overrides xres from vesa (default=vesa)");
+module_param(yres, int, 0);
+MODULE_PARM_DESC(yres, "Vertical resolution (scans), overrides yres from vesa (default=vesa)");
+module_param(upper, int, 0);
+MODULE_PARM_DESC(upper, "Upper blank space (scans), overrides upper from vesa (default=vesa)");
+module_param(lower, int, 0);
+MODULE_PARM_DESC(lower, "Lower blank space (scans), overrides lower from vesa (default=vesa)");
+module_param(vslen, int, 0);
+MODULE_PARM_DESC(vslen, "Vertical sync length (scans), overrides lower from vesa (default=vesa)");
+module_param(left, int, 0);
+MODULE_PARM_DESC(left, "Left blank space (px), overrides left from vesa (default=vesa)");
+module_param(right, int, 0);
+MODULE_PARM_DESC(right, "Right blank space (px), overrides right from vesa (default=vesa)");
+module_param(hslen, int, 0);
+MODULE_PARM_DESC(hslen, "Horizontal sync length (px), overrides hslen from vesa (default=vesa)");
+module_param(pixclock, int, 0);
+MODULE_PARM_DESC(pixclock, "Pixelclock (ns), overrides pixclock from vesa (default=vesa)");
+module_param(sync, int, 0);
+MODULE_PARM_DESC(sync, "Sync polarity, overrides sync from vesa (default=vesa)");
+module_param(depth, int, 0);
+MODULE_PARM_DESC(depth, "Color depth (0=text,8,15,16,24,32) (default=vesa)");
+module_param(maxclk, int, 0);
+MODULE_PARM_DESC(maxclk, "Startup maximal clock, 0-999MHz, 1000-999999kHz, 1000000-INF Hz");
+module_param(fh, int, 0);
+MODULE_PARM_DESC(fh, "Startup horizontal frequency, 0-999kHz, 1000-INF Hz");
+module_param(fv, int, 0);
+MODULE_PARM_DESC(fv, "Startup vertical frequency, 0-INF Hz\n"
+"You should specify \"fv:max_monitor_vsync,fh:max_monitor_hsync,maxclk:max_monitor_dotclock\"\n");
+module_param(grayscale, int, 0);
+MODULE_PARM_DESC(grayscale, "Sets display into grayscale. Works perfectly with paletized videomode (4, 8bpp), some limitations apply to 16, 24 and 32bpp videomodes (default=nograyscale)");
+module_param(cross4MB, int, 0);
+MODULE_PARM_DESC(cross4MB, "Specifies that 4MB boundary can be in middle of line. (default=autodetected)");
+module_param(dfp, int, 0);
+MODULE_PARM_DESC(dfp, "Specifies whether to use digital flat panel interface of G200/G400 (0 or 1) (default=0)");
+module_param(dfp_type, int, 0);
+MODULE_PARM_DESC(dfp_type, "Specifies DFP interface type (0 to 255) (default=read from hardware)");
+module_param_string(outputs, outputs, sizeof(outputs), 0);
+MODULE_PARM_DESC(outputs, "Specifies which CRTC is mapped to which output (string of up to three letters, consisting of 0 (disabled), 1 (CRTC1), 2 (CRTC2)) (default=111 for Gx50, 101 for G200/G400 with DFP, and 100 for all other devices)");
+#ifdef CONFIG_PPC_PMAC
+module_param_named(vmode, default_vmode, int, 0);
+MODULE_PARM_DESC(vmode, "Specify the vmode mode number that should be used (640x480 default)");
+module_param_named(cmode, default_cmode, int, 0);
+MODULE_PARM_DESC(cmode, "Specify the video depth that should be used (8bit default)");
+#endif
+
+int __init init_module(void){
+
+	DBG(__FUNCTION__)
+
+	if (disabled)
+		return -ENXIO;
+
+	if (depth == 0)
+		depth = RSText;
+	else if (depth == 4)
+		depth = RS4bpp;
+	else if (depth == 8)
+		depth = RS8bpp;
+	else if (depth == 15)
+		depth = RS15bpp;
+	else if (depth == 16)
+		depth = RS16bpp;
+	else if (depth == 24)
+		depth = RS24bpp;
+	else if (depth == 32)
+		depth = RS32bpp;
+	else if (depth != -1) {
+		printk(KERN_ERR "matroxfb: depth %d is not supported, using default\n", depth);
+		depth = -1;
+	}
+	matrox_init();
+	/* never return failure; user can hotplug matrox later... */
+	return 0;
+}
+#endif	/* MODULE */
+
+module_exit(matrox_done);
+EXPORT_SYMBOL(matroxfb_register_driver);
+EXPORT_SYMBOL(matroxfb_unregister_driver);
+EXPORT_SYMBOL(matroxfb_wait_for_sync);
+EXPORT_SYMBOL(matroxfb_enable_irq);
+
+/*
+ * Overrides for Emacs so that we follow Linus's tabbing style.
+ * ---------------------------------------------------------------------------
+ * Local variables:
+ * c-basic-offset: 8
+ * End:
+ */
+
diff --git a/drivers/video/matrox/matroxfb_base.h b/drivers/video/matrox/matroxfb_base.h
new file mode 100644
index 0000000..85a0b25
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_base.h
@@ -0,0 +1,781 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ */
+#ifndef __MATROXFB_H__
+#define __MATROXFB_H__
+
+/* general, but fairly heavy, debugging */
+#undef MATROXFB_DEBUG
+
+/* heavy debugging: */
+/* -- logs putc[s], so everytime a char is displayed, it's logged */
+#undef MATROXFB_DEBUG_HEAVY
+
+/* This one _could_ cause infinite loops */
+/* It _does_ cause lots and lots of messages during idle loops */
+#undef MATROXFB_DEBUG_LOOP
+
+/* Debug register calls, too? */
+#undef MATROXFB_DEBUG_REG
+
+/* Guard accelerator accesses with spin_lock_irqsave... */
+#undef MATROXFB_USE_SPINLOCKS
+
+#include <linux/config.h>
+#include <linux/module.h>
+#include <linux/kernel.h>
+#include <linux/errno.h>
+#include <linux/string.h>
+#include <linux/mm.h>
+#include <linux/tty.h>
+#include <linux/slab.h>
+#include <linux/delay.h>
+#include <linux/fb.h>
+#include <linux/console.h>
+#include <linux/selection.h>
+#include <linux/ioport.h>
+#include <linux/init.h>
+#include <linux/timer.h>
+#include <linux/pci.h>
+#include <linux/spinlock.h>
+#include <linux/kd.h>
+
+#include <asm/io.h>
+#include <asm/unaligned.h>
+#ifdef CONFIG_MTRR
+#include <asm/mtrr.h>
+#endif
+
+#include "../console/fbcon.h"
+
+#if defined(CONFIG_PPC_PMAC)
+#include <asm/prom.h>
+#include <asm/pci-bridge.h>
+#include "../macmodes.h"
+#endif
+
+/* always compile support for 32MB... It cost almost nothing */
+#define CONFIG_FB_MATROX_32MB
+
+#ifdef MATROXFB_DEBUG
+
+#define DEBUG
+#define DBG(x)		printk(KERN_DEBUG "matroxfb: %s\n", (x));
+
+#ifdef MATROXFB_DEBUG_HEAVY
+#define DBG_HEAVY(x)	DBG(x)
+#else /* MATROXFB_DEBUG_HEAVY */
+#define DBG_HEAVY(x)	/* DBG_HEAVY */
+#endif /* MATROXFB_DEBUG_HEAVY */
+
+#ifdef MATROXFB_DEBUG_LOOP
+#define DBG_LOOP(x)	DBG(x)
+#else /* MATROXFB_DEBUG_LOOP */
+#define DBG_LOOP(x)	/* DBG_LOOP */
+#endif /* MATROXFB_DEBUG_LOOP */
+
+#ifdef MATROXFB_DEBUG_REG
+#define DBG_REG(x)	DBG(x)
+#else /* MATROXFB_DEBUG_REG */
+#define DBG_REG(x)	/* DBG_REG */
+#endif /* MATROXFB_DEBUG_REG */
+
+#else /* MATROXFB_DEBUG */
+
+#define DBG(x)		/* DBG */
+#define DBG_HEAVY(x)	/* DBG_HEAVY */
+#define DBG_REG(x)	/* DBG_REG */
+#define DBG_LOOP(x)	/* DBG_LOOP */
+
+#endif /* MATROXFB_DEBUG */
+
+#ifdef DEBUG
+#define dprintk(X...)	printk(X)
+#else
+#define dprintk(X...)
+#endif
+
+#ifndef PCI_SS_VENDOR_ID_SIEMENS_NIXDORF
+#define PCI_SS_VENDOR_ID_SIEMENS_NIXDORF	0x110A
+#endif
+#ifndef PCI_SS_VENDOR_ID_MATROX
+#define PCI_SS_VENDOR_ID_MATROX		PCI_VENDOR_ID_MATROX
+#endif
+
+#ifndef PCI_SS_ID_MATROX_PRODUCTIVA_G100_AGP
+#define PCI_SS_ID_MATROX_GENERIC		0xFF00
+#define PCI_SS_ID_MATROX_PRODUCTIVA_G100_AGP	0xFF01
+#define PCI_SS_ID_MATROX_MYSTIQUE_G200_AGP	0xFF02
+#define PCI_SS_ID_MATROX_MILLENIUM_G200_AGP	0xFF03
+#define PCI_SS_ID_MATROX_MARVEL_G200_AGP	0xFF04
+#define PCI_SS_ID_MATROX_MGA_G100_PCI		0xFF05
+#define PCI_SS_ID_MATROX_MGA_G100_AGP		0x1001
+#define PCI_SS_ID_MATROX_MILLENNIUM_G400_MAX_AGP	0x2179
+#define PCI_SS_ID_SIEMENS_MGA_G100_AGP		0x001E /* 30 */
+#define PCI_SS_ID_SIEMENS_MGA_G200_AGP		0x0032 /* 50 */
+#endif
+
+#define MX_VISUAL_TRUECOLOR	FB_VISUAL_DIRECTCOLOR
+#define MX_VISUAL_DIRECTCOLOR	FB_VISUAL_TRUECOLOR
+#define MX_VISUAL_PSEUDOCOLOR	FB_VISUAL_PSEUDOCOLOR
+
+#define CNVT_TOHW(val,width) ((((val)<<(width))+0x7FFF-(val))>>16)
+
+/* G-series and Mystique have (almost) same DAC */
+#undef NEED_DAC1064
+#if defined(CONFIG_FB_MATROX_MYSTIQUE) || defined(CONFIG_FB_MATROX_G)
+#define NEED_DAC1064 1
+#endif
+
+typedef struct {
+	void __iomem*	vaddr;
+} vaddr_t;
+
+static inline unsigned int mga_readb(vaddr_t va, unsigned int offs) {
+	return readb(va.vaddr + offs);
+}
+
+static inline void mga_writeb(vaddr_t va, unsigned int offs, u_int8_t value) {
+	writeb(value, va.vaddr + offs);
+}
+
+static inline void mga_writew(vaddr_t va, unsigned int offs, u_int16_t value) {
+	writew(value, va.vaddr + offs);
+}
+
+static inline u_int32_t mga_readl(vaddr_t va, unsigned int offs) {
+	return readl(va.vaddr + offs);
+}
+
+static inline void mga_writel(vaddr_t va, unsigned int offs, u_int32_t value) {
+	writel(value, va.vaddr + offs);
+}
+
+static inline void mga_memcpy_toio(vaddr_t va, const void* src, int len) {
+#if defined(__alpha__) || defined(__i386__) || defined(__x86_64__)
+	/*
+	 * memcpy_toio works for us if:
+	 *  (1) Copies data as 32bit quantities, not byte after byte,
+	 *  (2) Performs LE ordered stores, and
+	 *  (3) It copes with unaligned source (destination is guaranteed to be page
+	 *      aligned and length is guaranteed to be multiple of 4).
+	 */
+	memcpy_toio(va.vaddr, src, len);
+#else
+        u_int32_t __iomem* addr = va.vaddr;
+
+	if ((unsigned long)src & 3) {
+		while (len >= 4) {
+			fb_writel(get_unaligned((u32 *)src), addr);
+			addr++;
+			len -= 4;
+			src += 4;
+		}
+	} else {
+		while (len >= 4) {
+			fb_writel(*(u32 *)src, addr);
+			addr++;
+			len -= 4;
+			src += 4;
+		}
+	}
+#endif
+}
+
+static inline void vaddr_add(vaddr_t* va, unsigned long offs) {
+	va->vaddr += offs;
+}
+
+static inline void __iomem* vaddr_va(vaddr_t va) {
+	return va.vaddr;
+}
+
+#define MGA_IOREMAP_NORMAL	0
+#define MGA_IOREMAP_NOCACHE	1
+
+#define MGA_IOREMAP_FB		MGA_IOREMAP_NOCACHE
+#define MGA_IOREMAP_MMIO	MGA_IOREMAP_NOCACHE
+static inline int mga_ioremap(unsigned long phys, unsigned long size, int flags, vaddr_t* virt) {
+	if (flags & MGA_IOREMAP_NOCACHE)
+		virt->vaddr = ioremap_nocache(phys, size);
+	else
+		virt->vaddr = ioremap(phys, size);
+	return (virt->vaddr == 0); /* 0, !0... 0, error_code in future */
+}
+
+static inline void mga_iounmap(vaddr_t va) {
+	iounmap(va.vaddr);
+}
+
+struct my_timming {
+	unsigned int pixclock;
+	int mnp;
+	unsigned int crtc;
+	unsigned int HDisplay;
+	unsigned int HSyncStart;
+	unsigned int HSyncEnd;
+	unsigned int HTotal;
+	unsigned int VDisplay;
+	unsigned int VSyncStart;
+	unsigned int VSyncEnd;
+	unsigned int VTotal;
+	unsigned int sync;
+	int	     dblscan;
+	int	     interlaced;
+	unsigned int delay;	/* CRTC delay */
+};
+
+enum { M_SYSTEM_PLL, M_PIXEL_PLL_A, M_PIXEL_PLL_B, M_PIXEL_PLL_C, M_VIDEO_PLL };
+
+struct matrox_pll_cache {
+	unsigned int	valid;
+	struct {
+		unsigned int	mnp_key;
+		unsigned int	mnp_value;
+		      } data[4];
+};
+
+struct matrox_pll_limits {
+	unsigned int	vcomin;
+	unsigned int	vcomax;
+};
+
+struct matrox_pll_features {
+	unsigned int	vco_freq_min;
+	unsigned int	ref_freq;
+	unsigned int	feed_div_min;
+	unsigned int	feed_div_max;
+	unsigned int	in_div_min;
+	unsigned int	in_div_max;
+	unsigned int	post_shift_max;
+};
+
+struct matroxfb_par
+{
+	unsigned int	final_bppShift;
+	unsigned int	cmap_len;
+	struct {
+		unsigned int bytes;
+		unsigned int pixels;
+		unsigned int chunks;
+		      } ydstorg;
+};
+
+struct matrox_fb_info;
+
+struct matrox_DAC1064_features {
+	u_int8_t	xvrefctrl;
+	u_int8_t	xmiscctrl;
+};
+
+struct matrox_accel_features {
+	int		has_cacheflush;
+};
+
+/* current hardware status */
+struct mavenregs {
+	u_int8_t regs[256];
+	int	 mode;
+	int	 vlines;
+	int	 xtal;
+	int	 fv;
+
+	u_int16_t htotal;
+	u_int16_t hcorr;
+};
+
+struct matrox_crtc2 {
+	u_int32_t ctl;
+};
+
+struct matrox_hw_state {
+	u_int32_t	MXoptionReg;
+	unsigned char	DACclk[6];
+	unsigned char	DACreg[80];
+	unsigned char	MiscOutReg;
+	unsigned char	DACpal[768];
+	unsigned char	CRTC[25];
+	unsigned char	CRTCEXT[9];
+	unsigned char	SEQ[5];
+	/* unused for MGA mode, but who knows... */
+	unsigned char	GCTL[9];
+	/* unused for MGA mode, but who knows... */
+	unsigned char	ATTR[21];
+
+	/* TVOut only */
+	struct mavenregs	maven;
+
+	struct matrox_crtc2	crtc2;
+};
+
+struct matrox_accel_data {
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+	unsigned char	ramdac_rev;
+#endif
+	u_int32_t	m_dwg_rect;
+	u_int32_t	m_opmode;
+};
+
+struct v4l2_queryctrl;
+struct v4l2_control;
+
+struct matrox_altout {
+	const char	*name;
+	int		(*compute)(void* altout_dev, struct my_timming* input);
+	int		(*program)(void* altout_dev);
+	int		(*start)(void* altout_dev);
+	int		(*verifymode)(void* altout_dev, u_int32_t mode);
+	int		(*getqueryctrl)(void* altout_dev,
+					struct v4l2_queryctrl* ctrl);
+	int		(*getctrl)(void* altout_dev, 
+				   struct v4l2_control* ctrl);
+	int		(*setctrl)(void* altout_dev, 
+				   struct v4l2_control* ctrl);
+};
+
+#define MATROXFB_SRC_NONE	0
+#define MATROXFB_SRC_CRTC1	1
+#define MATROXFB_SRC_CRTC2	2
+
+enum mga_chip { MGA_2064, MGA_2164, MGA_1064, MGA_1164, MGA_G100, MGA_G200, MGA_G400, MGA_G450, MGA_G550 };
+
+struct matrox_bios {
+	unsigned int	bios_valid : 1;
+	unsigned int	pins_len;
+	unsigned char	pins[128];
+	struct {
+		unsigned char vMaj, vMin, vRev;
+		      } version;
+	struct {
+		unsigned char state, tvout;
+		      } output;
+};
+
+extern struct display fb_display[];
+
+struct matrox_switch;
+struct matroxfb_driver;
+struct matroxfb_dh_fb_info;
+
+struct matrox_vsync {
+	wait_queue_head_t	wait;
+	unsigned int		cnt;
+};
+
+struct matrox_fb_info {
+	struct fb_info		fbcon;
+
+	struct list_head	next_fb;
+
+	int			dead;
+	int                     initialized;
+	unsigned int		usecount;
+
+	unsigned int		userusecount;
+	unsigned long		irq_flags;
+
+	struct matroxfb_par	curr;
+	struct matrox_hw_state	hw;
+
+	struct matrox_accel_data accel;
+
+	struct pci_dev*		pcidev;
+
+	struct {
+		struct matrox_vsync	vsync;
+		unsigned int	pixclock;
+		int		mnp;
+		int		panpos;
+			      } crtc1;
+	struct {
+		struct matrox_vsync	vsync;
+		unsigned int 	pixclock;
+		int		mnp;
+	struct matroxfb_dh_fb_info*	info;
+	struct rw_semaphore	lock;
+			      } crtc2;
+	struct {
+	struct rw_semaphore	lock;
+	struct {
+		int brightness, contrast, saturation, hue, gamma;
+		int testout, deflicker;
+				} tvo_params;
+			      } altout;
+#define MATROXFB_MAX_OUTPUTS		3
+	struct {
+	unsigned int		src;
+	struct matrox_altout*	output;
+	void*			data;
+	unsigned int		mode;
+	unsigned int		default_src;
+			      } outputs[MATROXFB_MAX_OUTPUTS];
+
+#define MATROXFB_MAX_FB_DRIVERS		5
+	struct matroxfb_driver* (drivers[MATROXFB_MAX_FB_DRIVERS]);
+	void*			(drivers_data[MATROXFB_MAX_FB_DRIVERS]);
+	unsigned int		drivers_count;
+
+	struct {
+	unsigned long	base;	/* physical */
+	vaddr_t		vbase;	/* CPU view */
+	unsigned int	len;
+	unsigned int	len_usable;
+	unsigned int	len_maximum;
+		      } video;
+
+	struct {
+	unsigned long	base;	/* physical */
+	vaddr_t		vbase;	/* CPU view */
+	unsigned int	len;
+		      } mmio;
+
+	unsigned int	max_pixel_clock;
+
+	struct matrox_switch*	hw_switch;
+
+	struct {
+		struct matrox_pll_features pll;
+		struct matrox_DAC1064_features DAC1064;
+		struct matrox_accel_features accel;
+			      } features;
+	struct {
+		spinlock_t	DAC;
+		spinlock_t	accel;
+			      } lock;
+
+	enum mga_chip		chip;
+
+	int			interleave;
+	int			millenium;
+	int			milleniumII;
+	struct {
+		int		cfb4;
+		const int*	vxres;
+		int		cross4MB;
+		int		text;
+		int		plnwt;
+		int		srcorg;
+			      } capable;
+#ifdef CONFIG_MTRR
+	struct {
+		int		vram;
+		int		vram_valid;
+			      } mtrr;
+#endif
+	struct {
+		int		precise_width;
+		int		mga_24bpp_fix;
+		int		novga;
+		int		nobios;
+		int		nopciretry;
+		int		noinit;
+		int		sgram;
+#ifdef CONFIG_FB_MATROX_32MB
+		int		support32MB;
+#endif
+
+		int		accelerator;
+		int		text_type_aux;
+		int		video64bits;
+		int		crtc2;
+		int		maven_capable;
+		unsigned int	vgastep;
+		unsigned int	textmode;
+		unsigned int	textstep;
+		unsigned int	textvram;	/* character cells */
+		unsigned int	ydstorg;	/* offset in bytes from video start to usable memory */
+						/* 0 except for 6MB Millenium */
+		int		memtype;
+		int		g450dac;
+		int		dfp_type;
+		int		panellink;	/* G400 DFP possible (not G450/G550) */
+		int		dualhead;
+		unsigned int	fbResource;
+			      } devflags;
+	struct fb_ops		fbops;
+	struct matrox_bios	bios;
+	struct {
+		struct matrox_pll_limits	pixel;
+		struct matrox_pll_limits	system;
+		struct matrox_pll_limits	video;
+			      } limits;
+	struct {
+		struct matrox_pll_cache	pixel;
+		struct matrox_pll_cache	system;
+		struct matrox_pll_cache	video;
+				      } cache;
+	struct {
+		struct {
+			unsigned int	video;
+			unsigned int	system;
+				      } pll;
+		struct {
+			u_int32_t	opt;
+			u_int32_t	opt2;
+			u_int32_t	opt3;
+			u_int32_t	mctlwtst;
+			u_int32_t	mctlwtst_core;
+			u_int32_t	memmisc;
+			u_int32_t	memrdbk;
+			u_int32_t	maccess;
+				      } reg;
+		struct {
+			unsigned int	ddr:1,
+			                emrswen:1,
+					dll:1;
+				      } memory;
+			      } values;
+	u_int32_t cmap[17];
+};
+
+#define info2minfo(info) container_of(info, struct matrox_fb_info, fbcon)
+
+#ifdef CONFIG_FB_MATROX_MULTIHEAD
+#define ACCESS_FBINFO2(info, x) (info->x)
+#define ACCESS_FBINFO(x) ACCESS_FBINFO2(minfo,x)
+
+#define MINFO minfo
+
+#define WPMINFO2 struct matrox_fb_info* minfo
+#define WPMINFO  WPMINFO2 ,
+#define CPMINFO2 const struct matrox_fb_info* minfo
+#define CPMINFO	 CPMINFO2 ,
+#define PMINFO2  minfo
+#define PMINFO   PMINFO2 ,
+
+#define MINFO_FROM(x)	   struct matrox_fb_info* minfo = x
+#else
+
+extern struct matrox_fb_info matroxfb_global_mxinfo;
+
+#define ACCESS_FBINFO(x) (matroxfb_global_mxinfo.x)
+#define ACCESS_FBINFO2(info, x) (matroxfb_global_mxinfo.x)
+
+#define MINFO (&matroxfb_global_mxinfo)
+
+#define WPMINFO2 void
+#define WPMINFO
+#define CPMINFO2 void
+#define CPMINFO
+#define PMINFO2
+#define PMINFO
+
+#define MINFO_FROM(x)
+
+#endif
+
+#define MINFO_FROM_INFO(x) MINFO_FROM(info2minfo(x))
+
+struct matrox_switch {
+	int	(*preinit)(WPMINFO2);
+	void	(*reset)(WPMINFO2);
+	int	(*init)(WPMINFO struct my_timming*);
+	void	(*restore)(WPMINFO2);
+};
+
+struct matroxfb_driver {
+	struct list_head	node;
+	char*			name;
+	void*			(*probe)(struct matrox_fb_info* info);
+	void			(*remove)(struct matrox_fb_info* info, void* data);
+};
+
+int matroxfb_register_driver(struct matroxfb_driver* drv);
+void matroxfb_unregister_driver(struct matroxfb_driver* drv);
+
+#define PCI_OPTION_REG	0x40
+#define   PCI_OPTION_ENABLE_ROM		0x40000000
+
+#define PCI_MGA_INDEX	0x44
+#define PCI_MGA_DATA	0x48
+#define PCI_OPTION2_REG	0x50
+#define PCI_OPTION3_REG	0x54
+#define PCI_MEMMISC_REG	0x58
+
+#define M_DWGCTL	0x1C00
+#define M_MACCESS	0x1C04
+#define M_CTLWTST	0x1C08
+
+#define M_PLNWT		0x1C1C
+
+#define M_BCOL		0x1C20
+#define M_FCOL		0x1C24
+
+#define M_SGN		0x1C58
+#define M_LEN		0x1C5C
+#define M_AR0		0x1C60
+#define M_AR1		0x1C64
+#define M_AR2		0x1C68
+#define M_AR3		0x1C6C
+#define M_AR4		0x1C70
+#define M_AR5		0x1C74
+#define M_AR6		0x1C78
+
+#define M_CXBNDRY	0x1C80
+#define M_FXBNDRY	0x1C84
+#define M_YDSTLEN	0x1C88
+#define M_PITCH		0x1C8C
+#define M_YDST		0x1C90
+#define M_YDSTORG	0x1C94
+#define M_YTOP		0x1C98
+#define M_YBOT		0x1C9C
+
+/* mystique only */
+#define M_CACHEFLUSH	0x1FFF
+
+#define M_EXEC		0x0100
+
+#define M_DWG_TRAP	0x04
+#define M_DWG_BITBLT	0x08
+#define M_DWG_ILOAD	0x09
+
+#define M_DWG_LINEAR	0x0080
+#define M_DWG_SOLID	0x0800
+#define M_DWG_ARZERO	0x1000
+#define M_DWG_SGNZERO	0x2000
+#define M_DWG_SHIFTZERO	0x4000
+
+#define M_DWG_REPLACE	0x000C0000
+#define M_DWG_REPLACE2	(M_DWG_REPLACE | 0x40)
+#define M_DWG_XOR	0x00060010
+
+#define M_DWG_BFCOL	0x04000000
+#define M_DWG_BMONOWF	0x08000000
+
+#define M_DWG_TRANSC	0x40000000
+
+#define M_FIFOSTATUS	0x1E10
+#define M_STATUS	0x1E14
+#define M_ICLEAR	0x1E18
+#define M_IEN		0x1E1C
+
+#define M_VCOUNT	0x1E20
+
+#define M_RESET		0x1E40
+#define M_MEMRDBK	0x1E44
+
+#define M_AGP2PLL	0x1E4C
+
+#define M_OPMODE	0x1E54
+#define     M_OPMODE_DMA_GEN_WRITE	0x00
+#define     M_OPMODE_DMA_BLIT		0x04
+#define     M_OPMODE_DMA_VECTOR_WRITE	0x08
+#define     M_OPMODE_DMA_LE		0x0000		/* little endian - no transformation */
+#define     M_OPMODE_DMA_BE_8BPP	0x0000
+#define     M_OPMODE_DMA_BE_16BPP	0x0100
+#define     M_OPMODE_DMA_BE_32BPP	0x0200
+#define     M_OPMODE_DIR_LE		0x000000	/* little endian - no transformation */
+#define     M_OPMODE_DIR_BE_8BPP	0x000000
+#define     M_OPMODE_DIR_BE_16BPP	0x010000
+#define     M_OPMODE_DIR_BE_32BPP	0x020000
+
+#define M_ATTR_INDEX	0x1FC0
+#define M_ATTR_DATA	0x1FC1
+
+#define M_MISC_REG	0x1FC2
+#define M_3C2_RD	0x1FC2
+
+#define M_SEQ_INDEX	0x1FC4
+#define M_SEQ_DATA	0x1FC5
+
+#define M_MISC_REG_READ	0x1FCC
+
+#define M_GRAPHICS_INDEX 0x1FCE
+#define M_GRAPHICS_DATA	0x1FCF
+
+#define M_CRTC_INDEX	0x1FD4
+
+#define M_ATTR_RESET	0x1FDA
+#define M_3DA_WR	0x1FDA
+#define M_INSTS1	0x1FDA
+
+#define M_EXTVGA_INDEX	0x1FDE
+#define M_EXTVGA_DATA	0x1FDF
+
+/* G200 only */
+#define M_SRCORG	0x2CB4
+#define M_DSTORG	0x2CB8
+
+#define M_RAMDAC_BASE	0x3C00
+
+/* fortunately, same on TVP3026 and MGA1064 */
+#define M_DAC_REG	(M_RAMDAC_BASE+0)
+#define M_DAC_VAL	(M_RAMDAC_BASE+1)
+#define M_PALETTE_MASK	(M_RAMDAC_BASE+2)
+
+#define M_X_INDEX	0x00
+#define M_X_DATAREG	0x0A
+
+#define DAC_XGENIOCTRL		0x2A
+#define DAC_XGENIODATA		0x2B
+
+#define M_C2CTL		0x3C10
+
+#define MX_OPTION_BSWAP         0x00000000
+
+#ifdef __LITTLE_ENDIAN
+#define M_OPMODE_4BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_8BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_16BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_24BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_32BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_LE | M_OPMODE_DMA_BLIT)
+#else
+#ifdef __BIG_ENDIAN
+#define M_OPMODE_4BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_LE       | M_OPMODE_DMA_BLIT)	/* TODO */
+#define M_OPMODE_8BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_BE_8BPP  | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_16BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_BE_16BPP | M_OPMODE_DMA_BLIT)
+#define M_OPMODE_24BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_BE_8BPP  | M_OPMODE_DMA_BLIT)	/* TODO, ?32 */
+#define M_OPMODE_32BPP	(M_OPMODE_DMA_LE | M_OPMODE_DIR_BE_32BPP | M_OPMODE_DMA_BLIT)
+#else
+#error "Byte ordering have to be defined. Cannot continue."
+#endif
+#endif
+
+#define mga_inb(addr)		mga_readb(ACCESS_FBINFO(mmio.vbase), (addr))
+#define mga_inl(addr)		mga_readl(ACCESS_FBINFO(mmio.vbase), (addr))
+#define mga_outb(addr,val)	mga_writeb(ACCESS_FBINFO(mmio.vbase), (addr), (val))
+#define mga_outw(addr,val)	mga_writew(ACCESS_FBINFO(mmio.vbase), (addr), (val))
+#define mga_outl(addr,val)	mga_writel(ACCESS_FBINFO(mmio.vbase), (addr), (val))
+#define mga_readr(port,idx)	(mga_outb((port),(idx)), mga_inb((port)+1))
+#define mga_setr(addr,port,val)	mga_outw(addr, ((val)<<8) | (port))
+
+#define mga_fifo(n)	do {} while ((mga_inl(M_FIFOSTATUS) & 0xFF) < (n))
+
+#define WaitTillIdle()	do {} while (mga_inl(M_STATUS) & 0x10000)
+
+/* code speedup */
+#ifdef CONFIG_FB_MATROX_MILLENIUM
+#define isInterleave(x)	 (x->interleave)
+#define isMillenium(x)	 (x->millenium)
+#define isMilleniumII(x) (x->milleniumII)
+#else
+#define isInterleave(x)  (0)
+#define isMillenium(x)	 (0)
+#define isMilleniumII(x) (0)
+#endif
+
+#define matroxfb_DAC_lock()                   spin_lock(&ACCESS_FBINFO(lock.DAC))
+#define matroxfb_DAC_unlock()                 spin_unlock(&ACCESS_FBINFO(lock.DAC))
+#define matroxfb_DAC_lock_irqsave(flags)      spin_lock_irqsave(&ACCESS_FBINFO(lock.DAC),flags)
+#define matroxfb_DAC_unlock_irqrestore(flags) spin_unlock_irqrestore(&ACCESS_FBINFO(lock.DAC),flags)
+extern void matroxfb_DAC_out(CPMINFO int reg, int val);
+extern int matroxfb_DAC_in(CPMINFO int reg);
+extern void matroxfb_var2my(struct fb_var_screeninfo* fvsi, struct my_timming* mt);
+extern int matroxfb_wait_for_sync(WPMINFO u_int32_t crtc);
+extern int matroxfb_enable_irq(WPMINFO int reenable);
+
+#ifdef MATROXFB_USE_SPINLOCKS
+#define CRITBEGIN  spin_lock_irqsave(&ACCESS_FBINFO(lock.accel), critflags);
+#define CRITEND	   spin_unlock_irqrestore(&ACCESS_FBINFO(lock.accel), critflags);
+#define CRITFLAGS  unsigned long critflags;
+#else
+#define CRITBEGIN
+#define CRITEND
+#define CRITFLAGS
+#endif
+
+#endif	/* __MATROXFB_H__ */
diff --git a/drivers/video/matrox/matroxfb_crtc2.c b/drivers/video/matrox/matroxfb_crtc2.c
new file mode 100644
index 0000000..429047a
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_crtc2.c
@@ -0,0 +1,741 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ */
+
+#include "matroxfb_maven.h"
+#include "matroxfb_crtc2.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_DAC1064.h"
+#include <linux/matroxfb.h>
+#include <asm/uaccess.h>
+
+/* **************************************************** */
+
+static int mem = 8192;
+
+module_param(mem, int, 0);
+MODULE_PARM_DESC(mem, "Memory size reserved for dualhead (default=8MB)");
+
+/* **************************************************** */
+
+static int matroxfb_dh_setcolreg(unsigned regno, unsigned red, unsigned green,
+		unsigned blue, unsigned transp, struct fb_info* info) {
+	u_int32_t col;
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+
+	if (regno >= 16)
+		return 1;
+	if (m2info->fbcon.var.grayscale) {
+		/* gray = 0.30*R + 0.59*G + 0.11*B */
+		red = green = blue = (red * 77 + green * 151 + blue * 28) >> 8;
+	}
+	red = CNVT_TOHW(red, m2info->fbcon.var.red.length);
+	green = CNVT_TOHW(green, m2info->fbcon.var.green.length);
+	blue = CNVT_TOHW(blue, m2info->fbcon.var.blue.length);
+	transp = CNVT_TOHW(transp, m2info->fbcon.var.transp.length);
+
+	col = (red << m2info->fbcon.var.red.offset)     |
+	      (green << m2info->fbcon.var.green.offset) |
+	      (blue << m2info->fbcon.var.blue.offset)   |
+	      (transp << m2info->fbcon.var.transp.offset);
+
+	switch (m2info->fbcon.var.bits_per_pixel) {
+		case 16:
+			m2info->cmap[regno] = col | (col << 16);
+			break;
+		case 32:
+			m2info->cmap[regno] = col;
+			break;
+	}
+	return 0;
+#undef m2info
+}
+
+static void matroxfb_dh_restore(struct matroxfb_dh_fb_info* m2info,
+		struct my_timming* mt,
+		int mode,
+		unsigned int pos) {
+	u_int32_t tmp;
+	u_int32_t datactl;
+	MINFO_FROM(m2info->primary_dev);
+
+	switch (mode) {
+		case 15:
+			tmp = 0x00200000;
+			break;
+		case 16:
+			tmp = 0x00400000;
+			break;
+/*		case 32: */
+		default:
+			tmp = 0x00800000;
+			break;
+	}
+	tmp |= 0x00000001;	/* enable CRTC2 */
+	datactl = 0;
+	if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC2) {
+		if (ACCESS_FBINFO(devflags.g450dac)) {
+			tmp |= 0x00000006; /* source from secondary pixel PLL */
+			/* no vidrst when in monitor mode */
+			if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+				tmp |=  0xC0001000; /* Enable H/V vidrst */
+			}
+		} else {
+			tmp |= 0x00000002; /* source from VDOCLK */
+			tmp |= 0xC0000000; /* enable vvidrst & hvidrst */
+			/* MGA TVO is our clock source */
+		}
+	} else if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+		tmp |= 0x00000004; /* source from pixclock */
+		/* PIXPLL is our clock source */
+	}
+	if (ACCESS_FBINFO(outputs[0]).src == MATROXFB_SRC_CRTC2) {
+		tmp |= 0x00100000;	/* connect CRTC2 to DAC */
+	}
+	if (mt->interlaced) {
+		tmp |= 0x02000000;	/* interlaced, second field is bigger, as G450 apparently ignores it */
+		mt->VDisplay >>= 1;
+		mt->VSyncStart >>= 1;
+		mt->VSyncEnd >>= 1;
+		mt->VTotal >>= 1;
+	}
+	if ((mt->HTotal & 7) == 2) {
+		datactl |= 0x00000010;
+		mt->HTotal &= ~7;
+	}
+	tmp |= 0x10000000;	/* 0x10000000 is VIDRST polarity */
+	mga_outl(0x3C14, ((mt->HDisplay - 8) << 16) | (mt->HTotal - 8));
+	mga_outl(0x3C18, ((mt->HSyncEnd - 8) << 16) | (mt->HSyncStart - 8));
+	mga_outl(0x3C1C, ((mt->VDisplay - 1) << 16) | (mt->VTotal - 1));
+	mga_outl(0x3C20, ((mt->VSyncEnd - 1) << 16) | (mt->VSyncStart - 1));
+	mga_outl(0x3C24, ((mt->VSyncStart) << 16) | (mt->HSyncStart));	/* preload */
+	{
+		u_int32_t linelen = m2info->fbcon.var.xres_virtual * (m2info->fbcon.var.bits_per_pixel >> 3);
+		if (tmp & 0x02000000) {
+			/* field #0 is smaller, so... */
+			mga_outl(0x3C2C, pos);			/* field #1 vmemory start */
+			mga_outl(0x3C28, pos + linelen);	/* field #0 vmemory start */
+			linelen <<= 1;
+			m2info->interlaced = 1;
+		} else {
+			mga_outl(0x3C28, pos);		/* vmemory start */
+			m2info->interlaced = 0;
+		}
+		mga_outl(0x3C40, linelen);
+	}
+	mga_outl(0x3C4C, datactl);	/* data control */
+	if (tmp & 0x02000000) {
+		int i;
+
+		mga_outl(0x3C10, tmp & ~0x02000000);
+		for (i = 0; i < 2; i++) {
+			unsigned int nl;
+			unsigned int lastl = 0;
+
+			while ((nl = mga_inl(0x3C48) & 0xFFF) >= lastl) {
+				lastl = nl;
+			}
+		}
+	}
+	mga_outl(0x3C10, tmp);
+	ACCESS_FBINFO(hw).crtc2.ctl = tmp;
+
+	tmp = mt->VDisplay << 16;	/* line compare */
+	if (mt->sync & FB_SYNC_HOR_HIGH_ACT)
+		tmp |= 0x00000100;
+	if (mt->sync & FB_SYNC_VERT_HIGH_ACT)
+		tmp |= 0x00000200;
+	mga_outl(0x3C44, tmp);
+}
+
+static void matroxfb_dh_disable(struct matroxfb_dh_fb_info* m2info) {
+	MINFO_FROM(m2info->primary_dev);
+
+	mga_outl(0x3C10, 0x00000004);	/* disable CRTC2, CRTC1->DAC1, PLL as clock source */
+	ACCESS_FBINFO(hw).crtc2.ctl = 0x00000004;
+}
+
+static void matroxfb_dh_cfbX_init(struct matroxfb_dh_fb_info* m2info) {
+	/* no acceleration for secondary head... */
+	m2info->cmap[16] = 0xFFFFFFFF;
+}
+
+static void matroxfb_dh_pan_var(struct matroxfb_dh_fb_info* m2info,
+		struct fb_var_screeninfo* var) {
+	unsigned int pos;
+	unsigned int linelen;
+	unsigned int pixelsize;
+	MINFO_FROM(m2info->primary_dev);
+
+	m2info->fbcon.var.xoffset = var->xoffset;
+	m2info->fbcon.var.yoffset = var->yoffset;
+	pixelsize = m2info->fbcon.var.bits_per_pixel >> 3;
+	linelen = m2info->fbcon.var.xres_virtual * pixelsize;
+	pos = m2info->fbcon.var.yoffset * linelen + m2info->fbcon.var.xoffset * pixelsize;
+	pos += m2info->video.offbase;
+	if (m2info->interlaced) {
+		mga_outl(0x3C2C, pos);
+		mga_outl(0x3C28, pos + linelen);
+	} else {
+		mga_outl(0x3C28, pos);
+	}
+}
+
+static int matroxfb_dh_decode_var(struct matroxfb_dh_fb_info* m2info,
+		struct fb_var_screeninfo* var,
+		int *visual,
+		int *video_cmap_len,
+		int *mode) {
+	unsigned int mask;
+	unsigned int memlen;
+	unsigned int vramlen;
+
+	switch (var->bits_per_pixel) {
+		case 16:	mask = 0x1F;
+				break;
+		case 32:	mask = 0x0F;
+				break;
+		default:	return -EINVAL;
+	}
+	vramlen = m2info->video.len_usable;
+	if (var->yres_virtual < var->yres)
+		var->yres_virtual = var->yres;
+	if (var->xres_virtual < var->xres)
+		var->xres_virtual = var->xres;
+	var->xres_virtual = (var->xres_virtual + mask) & ~mask;
+	if (var->yres_virtual > 32767)
+		return -EINVAL;
+	memlen = var->xres_virtual * var->yres_virtual * (var->bits_per_pixel >> 3);
+	if (memlen > vramlen)
+		return -EINVAL;
+	if (var->xoffset + var->xres > var->xres_virtual)
+		var->xoffset = var->xres_virtual - var->xres;
+	if (var->yoffset + var->yres > var->yres_virtual)
+		var->yoffset = var->yres_virtual - var->yres;
+
+	var->xres &= ~7;
+	var->left_margin &= ~7;
+	var->right_margin &= ~7;
+	var->hsync_len &= ~7;
+
+	*mode = var->bits_per_pixel;
+	if (var->bits_per_pixel == 16) {
+		if (var->green.length == 5) {
+			var->red.offset = 10;
+			var->red.length = 5;
+			var->green.offset = 5;
+			var->green.length = 5;
+			var->blue.offset = 0;
+			var->blue.length = 5;
+			var->transp.offset = 15;
+			var->transp.length = 1;
+			*mode = 15;
+		} else {
+			var->red.offset = 11;
+			var->red.length = 5;
+			var->green.offset = 5;
+			var->green.length = 6;
+			var->blue.offset = 0;
+			var->blue.length = 5;
+			var->transp.offset = 0;
+			var->transp.length = 0;
+		}
+	} else {
+			var->red.offset = 16;
+			var->red.length = 8;
+			var->green.offset = 8;
+			var->green.length = 8;
+			var->blue.offset = 0;
+			var->blue.length = 8;
+			var->transp.offset = 24;
+			var->transp.length = 8;
+	}
+	*visual = FB_VISUAL_TRUECOLOR;
+	*video_cmap_len = 16;
+	return 0;
+}
+
+static int matroxfb_dh_open(struct fb_info* info, int user) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+	MINFO_FROM(m2info->primary_dev);
+
+	if (MINFO) {
+		int err;
+
+		if (ACCESS_FBINFO(dead)) {
+			return -ENXIO;
+		}
+		err = ACCESS_FBINFO(fbops).fb_open(&ACCESS_FBINFO(fbcon), user);
+		if (err) {
+			return err;
+		}
+	}
+	return 0;
+#undef m2info
+}
+
+static int matroxfb_dh_release(struct fb_info* info, int user) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+	int err = 0;
+	MINFO_FROM(m2info->primary_dev);
+
+	if (MINFO) {
+		err = ACCESS_FBINFO(fbops).fb_release(&ACCESS_FBINFO(fbcon), user);
+	}
+	return err;
+#undef m2info
+}
+
+static void matroxfb_dh_init_fix(struct matroxfb_dh_fb_info *m2info) {
+	struct fb_fix_screeninfo *fix = &m2info->fbcon.fix;
+
+	strcpy(fix->id, "MATROX DH");
+
+	fix->smem_start = m2info->video.base;
+	fix->smem_len = m2info->video.len_usable;
+	fix->ypanstep = 1;
+	fix->ywrapstep = 0;
+	fix->xpanstep = 8;	/* TBD */
+	fix->mmio_start = m2info->mmio.base;
+	fix->mmio_len = m2info->mmio.len;
+	fix->accel = 0;		/* no accel... */
+}
+
+static int matroxfb_dh_check_var(struct fb_var_screeninfo* var, struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+	int visual;
+	int cmap_len;
+	int mode;
+
+	return matroxfb_dh_decode_var(m2info, var, &visual, &cmap_len, &mode);
+#undef m2info
+}
+
+static int matroxfb_dh_set_par(struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+	int visual;
+	int cmap_len;
+	int mode;
+	int err;
+	struct fb_var_screeninfo* var = &info->var;
+	MINFO_FROM(m2info->primary_dev);
+
+	if ((err = matroxfb_dh_decode_var(m2info, var, &visual, &cmap_len, &mode)) != 0)
+		return err;
+	/* cmap */
+	{
+		m2info->fbcon.screen_base = vaddr_va(m2info->video.vbase);
+		m2info->fbcon.fix.visual = visual;
+		m2info->fbcon.fix.type = FB_TYPE_PACKED_PIXELS;
+		m2info->fbcon.fix.type_aux = 0;
+		m2info->fbcon.fix.line_length = (var->xres_virtual * var->bits_per_pixel) >> 3;
+	}
+	{
+		struct my_timming mt;
+		unsigned int pos;
+		int out;
+		int cnt;
+
+		matroxfb_var2my(&m2info->fbcon.var, &mt);
+		mt.crtc = MATROXFB_SRC_CRTC2;
+		/* CRTC2 delay */
+		mt.delay = 34;
+
+		pos = (m2info->fbcon.var.yoffset * m2info->fbcon.var.xres_virtual + m2info->fbcon.var.xoffset) * m2info->fbcon.var.bits_per_pixel >> 3;
+		pos += m2info->video.offbase;
+		cnt = 0;
+		down_read(&ACCESS_FBINFO(altout).lock);
+		for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+			if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+				cnt++;
+				if (ACCESS_FBINFO(outputs[out]).output->compute) {
+					ACCESS_FBINFO(outputs[out]).output->compute(ACCESS_FBINFO(outputs[out]).data, &mt);
+				}
+			}
+		}
+		ACCESS_FBINFO(crtc2).pixclock = mt.pixclock;
+		ACCESS_FBINFO(crtc2).mnp = mt.mnp;
+		up_read(&ACCESS_FBINFO(altout).lock);
+		if (cnt) {
+			matroxfb_dh_restore(m2info, &mt, mode, pos);
+		} else {
+			matroxfb_dh_disable(m2info);
+		}
+		DAC1064_global_init(PMINFO2);
+		DAC1064_global_restore(PMINFO2);
+		down_read(&ACCESS_FBINFO(altout).lock);
+		for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+			if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
+			    ACCESS_FBINFO(outputs[out]).output->program) {
+				ACCESS_FBINFO(outputs[out]).output->program(ACCESS_FBINFO(outputs[out]).data);
+			}
+		}
+		for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+			if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2 &&
+			    ACCESS_FBINFO(outputs[out]).output->start) {
+				ACCESS_FBINFO(outputs[out]).output->start(ACCESS_FBINFO(outputs[out]).data);
+			}
+		}
+		up_read(&ACCESS_FBINFO(altout).lock);
+		matroxfb_dh_cfbX_init(m2info);
+	}
+	m2info->initialized = 1;
+	return 0;
+#undef m2info
+}
+
+static int matroxfb_dh_pan_display(struct fb_var_screeninfo* var, struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+	matroxfb_dh_pan_var(m2info, var);
+	return 0;
+#undef m2info
+}
+
+static int matroxfb_dh_get_vblank(const struct matroxfb_dh_fb_info* m2info, struct fb_vblank* vblank) {
+	MINFO_FROM(m2info->primary_dev);
+
+	matroxfb_enable_irq(PMINFO 0);
+	memset(vblank, 0, sizeof(*vblank));
+	vblank->flags = FB_VBLANK_HAVE_VCOUNT | FB_VBLANK_HAVE_VBLANK;
+	/* mask out reserved bits + field number (odd/even) */
+	vblank->vcount = mga_inl(0x3C48) & 0x000007FF;
+	/* compatibility stuff */
+	if (vblank->vcount >= m2info->fbcon.var.yres)
+		vblank->flags |= FB_VBLANK_VBLANKING;
+        if (test_bit(0, &ACCESS_FBINFO(irq_flags))) {
+                vblank->flags |= FB_VBLANK_HAVE_COUNT;
+                /* Only one writer, aligned int value...
+                   it should work without lock and without atomic_t */
+                vblank->count = ACCESS_FBINFO(crtc2).vsync.cnt;
+        }
+	return 0;
+}
+
+static int matroxfb_dh_ioctl(struct inode* inode,
+		struct file* file,
+		unsigned int cmd,
+		unsigned long arg,
+		struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+	MINFO_FROM(m2info->primary_dev);
+
+	DBG(__FUNCTION__)
+
+	switch (cmd) {
+		case FBIOGET_VBLANK:
+			{
+				struct fb_vblank vblank;
+				int err;
+
+				err = matroxfb_dh_get_vblank(m2info, &vblank);
+				if (err)
+					return err;
+				if (copy_to_user((void __user *)arg, &vblank, sizeof(vblank)))
+					return -EFAULT;
+				return 0;
+			}
+		case FBIO_WAITFORVSYNC:
+			{
+				u_int32_t crt;
+
+				if (get_user(crt, (u_int32_t __user *)arg))
+					return -EFAULT;
+
+				if (crt != 0)
+					return -ENODEV;
+				return matroxfb_wait_for_sync(PMINFO 1);
+			}
+		case MATROXFB_SET_OUTPUT_MODE:
+		case MATROXFB_GET_OUTPUT_MODE:
+		case MATROXFB_GET_ALL_OUTPUTS:
+			{
+				return ACCESS_FBINFO(fbcon.fbops)->fb_ioctl(inode, file, cmd, arg, &ACCESS_FBINFO(fbcon));
+			}
+		case MATROXFB_SET_OUTPUT_CONNECTION:
+			{
+				u_int32_t tmp;
+				int out;
+				int changes;
+
+				if (get_user(tmp, (u_int32_t __user *)arg))
+					return -EFAULT;
+				for (out = 0; out < 32; out++) {
+					if (tmp & (1 << out)) {
+						if (out >= MATROXFB_MAX_OUTPUTS)
+							return -ENXIO;
+						if (!ACCESS_FBINFO(outputs[out]).output)
+							return -ENXIO;
+						switch (ACCESS_FBINFO(outputs[out]).src) {
+							case MATROXFB_SRC_NONE:
+							case MATROXFB_SRC_CRTC2:
+								break;
+							default:
+								return -EBUSY;
+						}
+					}
+				}
+				if (ACCESS_FBINFO(devflags.panellink)) {
+					if (tmp & MATROXFB_OUTPUT_CONN_DFP)
+						return -EINVAL;
+					if ((ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) && tmp)
+						return -EBUSY;
+				}
+				changes = 0;
+				for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+					if (tmp & (1 << out)) {
+						if (ACCESS_FBINFO(outputs[out]).src != MATROXFB_SRC_CRTC2) {
+							changes = 1;
+							ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_CRTC2;
+						}
+					} else if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+						changes = 1;
+						ACCESS_FBINFO(outputs[out]).src = MATROXFB_SRC_NONE;
+					}
+				}
+				if (!changes)
+					return 0;
+				matroxfb_dh_set_par(info);
+				return 0;
+			}
+		case MATROXFB_GET_OUTPUT_CONNECTION:
+			{
+				u_int32_t conn = 0;
+				int out;
+
+				for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+					if (ACCESS_FBINFO(outputs[out]).src == MATROXFB_SRC_CRTC2) {
+						conn |= 1 << out;
+					}
+				}
+				if (put_user(conn, (u_int32_t __user *)arg))
+					return -EFAULT;
+				return 0;
+			}
+		case MATROXFB_GET_AVAILABLE_OUTPUTS:
+			{
+				u_int32_t tmp = 0;
+				int out;
+
+				for (out = 0; out < MATROXFB_MAX_OUTPUTS; out++) {
+					if (ACCESS_FBINFO(outputs[out]).output) {
+						switch (ACCESS_FBINFO(outputs[out]).src) {
+							case MATROXFB_SRC_NONE:
+							case MATROXFB_SRC_CRTC2:
+								tmp |= 1 << out;
+								break;
+						}
+					}
+				}
+				if (ACCESS_FBINFO(devflags.panellink)) {
+					tmp &= ~MATROXFB_OUTPUT_CONN_DFP;
+					if (ACCESS_FBINFO(outputs[2]).src == MATROXFB_SRC_CRTC1) {
+						tmp = 0;
+					}
+				}
+				if (put_user(tmp, (u_int32_t __user *)arg))
+					return -EFAULT;
+				return 0;
+			}
+	}
+	return -ENOTTY;
+#undef m2info
+}
+
+static int matroxfb_dh_blank(int blank, struct fb_info* info) {
+#define m2info (container_of(info, struct matroxfb_dh_fb_info, fbcon))
+	switch (blank) {
+		case 1:
+		case 2:
+		case 3:
+		case 4:
+		default:;
+	}
+	/* do something... */
+	return 0;
+#undef m2info
+}
+
+static struct fb_ops matroxfb_dh_ops = {
+	.owner =	THIS_MODULE,
+	.fb_open =	matroxfb_dh_open,
+	.fb_release =	matroxfb_dh_release,
+	.fb_check_var =	matroxfb_dh_check_var,
+	.fb_set_par =	matroxfb_dh_set_par,
+	.fb_setcolreg =	matroxfb_dh_setcolreg,
+	.fb_pan_display =matroxfb_dh_pan_display,
+	.fb_blank =	matroxfb_dh_blank,
+	.fb_ioctl =	matroxfb_dh_ioctl,
+	.fb_fillrect =	cfb_fillrect,
+	.fb_copyarea =	cfb_copyarea,
+	.fb_imageblit =	cfb_imageblit,
+	.fb_cursor =	soft_cursor,
+};
+
+static struct fb_var_screeninfo matroxfb_dh_defined = {
+		640,480,640,480,/* W,H, virtual W,H */
+		0,0,		/* offset */
+		32,		/* depth */
+		0,		/* gray */
+		{0,0,0},	/* R */
+		{0,0,0},	/* G */
+		{0,0,0},	/* B */
+		{0,0,0},	/* alpha */
+		0,		/* nonstd */
+		FB_ACTIVATE_NOW,
+		-1,-1,		/* display size */
+		0,		/* accel flags */
+		39721L,48L,16L,33L,10L,
+		96L,2,0,	/* no sync info */
+		FB_VMODE_NONINTERLACED,
+		0, {0,0,0,0,0}
+};
+
+static int matroxfb_dh_regit(CPMINFO struct matroxfb_dh_fb_info* m2info) {
+#define minfo (m2info->primary_dev)
+	void* oldcrtc2;
+
+	m2info->fbcon.fbops = &matroxfb_dh_ops;
+	m2info->fbcon.flags = FBINFO_FLAG_DEFAULT;
+	m2info->fbcon.flags |= FBINFO_HWACCEL_XPAN |
+			       FBINFO_HWACCEL_YPAN;
+	m2info->fbcon.pseudo_palette = m2info->cmap;
+	fb_alloc_cmap(&m2info->fbcon.cmap, 256, 1);
+
+	if (mem < 64)
+		mem *= 1024;
+	if (mem < 64*1024)
+		mem *= 1024;
+	mem &= ~0x00000FFF;	/* PAGE_MASK? */
+	if (ACCESS_FBINFO(video.len_usable) + mem <= ACCESS_FBINFO(video.len))
+		m2info->video.offbase = ACCESS_FBINFO(video.len) - mem;
+	else if (ACCESS_FBINFO(video.len) < mem) {
+		return -ENOMEM;
+	} else { /* check yres on first head... */
+		m2info->video.borrowed = mem;
+		ACCESS_FBINFO(video.len_usable) -= mem;
+		m2info->video.offbase = ACCESS_FBINFO(video.len_usable);
+	}
+	m2info->video.base = ACCESS_FBINFO(video.base) + m2info->video.offbase;
+	m2info->video.len = m2info->video.len_usable = m2info->video.len_maximum = mem;
+	m2info->video.vbase.vaddr = vaddr_va(ACCESS_FBINFO(video.vbase)) + m2info->video.offbase;
+	m2info->mmio.base = ACCESS_FBINFO(mmio.base);
+	m2info->mmio.vbase = ACCESS_FBINFO(mmio.vbase);
+	m2info->mmio.len = ACCESS_FBINFO(mmio.len);
+
+	matroxfb_dh_init_fix(m2info);
+	if (register_framebuffer(&m2info->fbcon)) {
+		return -ENXIO;
+	}
+	if (!m2info->initialized)
+		fb_set_var(&m2info->fbcon, &matroxfb_dh_defined);
+	down_write(&ACCESS_FBINFO(crtc2.lock));
+	oldcrtc2 = ACCESS_FBINFO(crtc2.info);
+	ACCESS_FBINFO(crtc2.info) = m2info;
+	up_write(&ACCESS_FBINFO(crtc2.lock));
+	if (oldcrtc2) {
+		printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 already present: %p\n",
+			oldcrtc2);
+	}
+	return 0;
+#undef minfo
+}
+
+/* ************************** */
+
+static int matroxfb_dh_registerfb(struct matroxfb_dh_fb_info* m2info) {
+#define minfo (m2info->primary_dev)
+	if (matroxfb_dh_regit(PMINFO m2info)) {
+		printk(KERN_ERR "matroxfb_crtc2: secondary head failed to register\n");
+		return -1;
+	}
+	printk(KERN_INFO "matroxfb_crtc2: secondary head of fb%u was registered as fb%u\n",
+		ACCESS_FBINFO(fbcon.node), m2info->fbcon.node);
+	m2info->fbcon_registered = 1;
+	return 0;
+#undef minfo
+}
+
+static void matroxfb_dh_deregisterfb(struct matroxfb_dh_fb_info* m2info) {
+#define minfo (m2info->primary_dev)
+	if (m2info->fbcon_registered) {
+		int id;
+		struct matroxfb_dh_fb_info* crtc2;
+
+		down_write(&ACCESS_FBINFO(crtc2.lock));
+		crtc2 = ACCESS_FBINFO(crtc2.info);
+		if (crtc2 == m2info)
+			ACCESS_FBINFO(crtc2.info) = NULL;
+		up_write(&ACCESS_FBINFO(crtc2.lock));
+		if (crtc2 != m2info) {
+			printk(KERN_ERR "matroxfb_crtc2: Internal consistency check failed: crtc2 mismatch at unload: %p != %p\n",
+				crtc2, m2info);
+			printk(KERN_ERR "matroxfb_crtc2: Expect kernel crash after module unload.\n");
+			return;
+		}
+		id = m2info->fbcon.node;
+		unregister_framebuffer(&m2info->fbcon);
+		/* return memory back to primary head */
+		ACCESS_FBINFO(video.len_usable) += m2info->video.borrowed;
+		printk(KERN_INFO "matroxfb_crtc2: fb%u unregistered\n", id);
+		m2info->fbcon_registered = 0;
+	}
+#undef minfo
+}
+
+static void* matroxfb_crtc2_probe(struct matrox_fb_info* minfo) {
+	struct matroxfb_dh_fb_info* m2info;
+
+	/* hardware is CRTC2 incapable... */
+	if (!ACCESS_FBINFO(devflags.crtc2))
+		return NULL;
+	m2info = (struct matroxfb_dh_fb_info*)kmalloc(sizeof(*m2info), GFP_KERNEL);
+	if (!m2info) {
+		printk(KERN_ERR "matroxfb_crtc2: Not enough memory for CRTC2 control structs\n");
+		return NULL;
+	}
+	memset(m2info, 0, sizeof(*m2info));
+	m2info->primary_dev = MINFO;
+	if (matroxfb_dh_registerfb(m2info)) {
+		kfree(m2info);
+		printk(KERN_ERR "matroxfb_crtc2: CRTC2 framebuffer failed to register\n");
+		return NULL;
+	}
+	return m2info;
+}
+
+static void matroxfb_crtc2_remove(struct matrox_fb_info* minfo, void* crtc2) {
+	matroxfb_dh_deregisterfb(crtc2);
+	kfree(crtc2);
+}
+
+static struct matroxfb_driver crtc2 = {
+		.name =		"Matrox G400 CRTC2",
+		.probe =	matroxfb_crtc2_probe,
+		.remove =	matroxfb_crtc2_remove };
+
+static int matroxfb_crtc2_init(void) {
+	if (fb_get_options("matrox_crtc2fb", NULL))
+		return -ENODEV;
+
+	matroxfb_register_driver(&crtc2);
+	return 0;
+}
+
+static void matroxfb_crtc2_exit(void) {
+	matroxfb_unregister_driver(&crtc2);
+}
+
+MODULE_AUTHOR("(c) 1999-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Matrox G400 CRTC2 driver");
+MODULE_LICENSE("GPL");
+module_init(matroxfb_crtc2_init);
+module_exit(matroxfb_crtc2_exit);
+/* we do not have __setup() yet */
diff --git a/drivers/video/matrox/matroxfb_crtc2.h b/drivers/video/matrox/matroxfb_crtc2.h
new file mode 100644
index 0000000..608e40b
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_crtc2.h
@@ -0,0 +1,36 @@
+#ifndef __MATROXFB_CRTC2_H__
+#define __MATROXFB_CRTC2_H__
+
+#include <linux/ioctl.h>
+#include <linux/i2c.h>
+#include <linux/i2c-algo-bit.h>
+#include "matroxfb_base.h"
+
+struct matroxfb_dh_fb_info {
+	struct fb_info		fbcon;
+	int			fbcon_registered;
+	int                     initialized;
+
+	struct matrox_fb_info*	primary_dev;
+
+	struct {
+		unsigned long	base;	/* physical */
+		vaddr_t		vbase;	/* virtual */
+		unsigned int	len;
+		unsigned int	len_usable;
+		unsigned int	len_maximum;
+		unsigned int 	offbase;
+		unsigned int	borrowed;
+			      } video;
+	struct {
+		unsigned long	base;
+		vaddr_t		vbase;
+		unsigned int	len;
+			      } mmio;
+
+	unsigned int		interlaced:1;
+
+	u_int32_t cmap[17];
+};
+
+#endif /* __MATROXFB_CRTC2_H__ */
diff --git a/drivers/video/matrox/matroxfb_g450.c b/drivers/video/matrox/matroxfb_g450.c
new file mode 100644
index 0000000..35008af
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_g450.c
@@ -0,0 +1,626 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * See matroxfb_base.c for contributors.
+ *
+ */
+
+#include "matroxfb_base.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_DAC1064.h"
+#include "g450_pll.h"
+#include <linux/matroxfb.h>
+#include <asm/uaccess.h>
+#include <asm/div64.h>
+
+/* Definition of the various controls */
+struct mctl {
+	struct v4l2_queryctrl desc;
+	size_t control;
+};
+
+#define BLMIN	0xF3
+#define WLMAX	0x3FF
+
+static const struct mctl g450_controls[] =
+{	{ { V4L2_CID_BRIGHTNESS, V4L2_CTRL_TYPE_INTEGER, 
+	  "brightness",
+	  0, WLMAX-BLMIN, 1, 370-BLMIN, 
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.brightness) },
+	{ { V4L2_CID_CONTRAST, V4L2_CTRL_TYPE_INTEGER, 
+	  "contrast",
+	  0, 1023, 1, 127, 
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.contrast) },
+	{ { V4L2_CID_SATURATION, V4L2_CTRL_TYPE_INTEGER,
+	  "saturation",
+	  0, 255, 1, 165, 
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.saturation) },
+	{ { V4L2_CID_HUE, V4L2_CTRL_TYPE_INTEGER,
+	  "hue",
+	  0, 255, 1, 0, 
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.hue) },
+	{ { MATROXFB_CID_TESTOUT, V4L2_CTRL_TYPE_BOOLEAN,
+	  "test output",
+	  0, 1, 1, 0, 
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.testout) },
+};
+
+#define G450CTRLS (sizeof(g450_controls)/sizeof(g450_controls[0]))
+
+/* Return: positive number: id found
+           -EINVAL:         id not found, return failure
+	   -ENOENT:         id not found, create fake disabled control */
+static int get_ctrl_id(__u32 v4l2_id) {
+	int i;
+
+	for (i = 0; i < G450CTRLS; i++) {
+		if (v4l2_id < g450_controls[i].desc.id) {
+			if (g450_controls[i].desc.id == 0x08000000) {
+				return -EINVAL;
+			}
+			return -ENOENT;
+		}
+		if (v4l2_id == g450_controls[i].desc.id) {
+			return i;
+		}
+	}
+	return -EINVAL;
+}
+
+static inline int* get_ctrl_ptr(WPMINFO unsigned int idx) {
+	return (int*)((char*)MINFO + g450_controls[idx].control);
+}
+
+static void tvo_fill_defaults(WPMINFO2) {
+	unsigned int i;
+	
+	for (i = 0; i < G450CTRLS; i++) {
+		*get_ctrl_ptr(PMINFO i) = g450_controls[i].desc.default_value;
+	}
+}
+
+static int cve2_get_reg(WPMINFO int reg) {
+	unsigned long flags;
+	int val;
+	
+	matroxfb_DAC_lock_irqsave(flags);
+	matroxfb_DAC_out(PMINFO 0x87, reg);
+	val = matroxfb_DAC_in(PMINFO 0x88);
+	matroxfb_DAC_unlock_irqrestore(flags);
+	return val;
+}
+
+static void cve2_set_reg(WPMINFO int reg, int val) {
+	unsigned long flags;
+
+	matroxfb_DAC_lock_irqsave(flags);
+	matroxfb_DAC_out(PMINFO 0x87, reg);
+	matroxfb_DAC_out(PMINFO 0x88, val);
+	matroxfb_DAC_unlock_irqrestore(flags);
+}
+
+static void cve2_set_reg10(WPMINFO int reg, int val) {
+	unsigned long flags;
+
+	matroxfb_DAC_lock_irqsave(flags);
+	matroxfb_DAC_out(PMINFO 0x87, reg);
+	matroxfb_DAC_out(PMINFO 0x88, val >> 2);
+	matroxfb_DAC_out(PMINFO 0x87, reg + 1);
+	matroxfb_DAC_out(PMINFO 0x88, val & 3);
+	matroxfb_DAC_unlock_irqrestore(flags);
+}
+
+static void g450_compute_bwlevel(CPMINFO int *bl, int *wl) {
+	const int b = ACCESS_FBINFO(altout.tvo_params.brightness) + BLMIN;
+	const int c = ACCESS_FBINFO(altout.tvo_params.contrast);
+
+	*bl = max(b - c, BLMIN);
+	*wl = min(b + c, WLMAX);
+}
+
+static int g450_query_ctrl(void* md, struct v4l2_queryctrl *p) {
+	int i;
+	
+	i = get_ctrl_id(p->id);
+	if (i >= 0) {
+		*p = g450_controls[i].desc;
+		return 0;
+	}
+	if (i == -ENOENT) {
+		static const struct v4l2_queryctrl disctrl = 
+			{ .flags = V4L2_CTRL_FLAG_DISABLED };
+			
+		i = p->id;
+		*p = disctrl;
+		p->id = i;
+		sprintf(p->name, "Ctrl #%08X", i);
+		return 0;
+	}
+	return -EINVAL;
+}
+
+static int g450_set_ctrl(void* md, struct v4l2_control *p) {
+	int i;
+	MINFO_FROM(md);
+	
+	i = get_ctrl_id(p->id);
+	if (i < 0) return -EINVAL;
+
+	/*
+	 * Check if changed.
+	 */
+	if (p->value == *get_ctrl_ptr(PMINFO i)) return 0;
+
+	/*
+	 * Check limits.
+	 */
+	if (p->value > g450_controls[i].desc.maximum) return -EINVAL;
+	if (p->value < g450_controls[i].desc.minimum) return -EINVAL;
+
+	/*
+	 * Store new value.
+	 */
+	*get_ctrl_ptr(PMINFO i) = p->value;
+
+	switch (p->id) {
+		case V4L2_CID_BRIGHTNESS:
+		case V4L2_CID_CONTRAST:
+			{
+				int blacklevel, whitelevel;
+				g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
+				cve2_set_reg10(PMINFO 0x0e, blacklevel);
+				cve2_set_reg10(PMINFO 0x1e, whitelevel);
+			}
+			break;
+		case V4L2_CID_SATURATION:
+			cve2_set_reg(PMINFO 0x20, p->value);
+			cve2_set_reg(PMINFO 0x22, p->value);
+			break;
+		case V4L2_CID_HUE:
+			cve2_set_reg(PMINFO 0x25, p->value);
+			break;
+		case MATROXFB_CID_TESTOUT:
+			{
+				unsigned char val = cve2_get_reg (PMINFO 0x05);
+				if (p->value) val |=  0x02;
+				else          val &= ~0x02;
+				cve2_set_reg(PMINFO 0x05, val);
+			}
+			break;
+	}
+	
+
+	return 0;
+}
+
+static int g450_get_ctrl(void* md, struct v4l2_control *p) {
+	int i;
+	MINFO_FROM(md);
+	
+	i = get_ctrl_id(p->id);
+	if (i < 0) return -EINVAL;
+	p->value = *get_ctrl_ptr(PMINFO i);
+	return 0;
+}
+
+struct output_desc {
+	unsigned int	h_vis;
+	unsigned int	h_f_porch;
+	unsigned int	h_sync;
+	unsigned int	h_b_porch;
+	unsigned long long int	chromasc;
+	unsigned int	burst;
+	unsigned int	v_total;
+};
+
+static void computeRegs(WPMINFO struct mavenregs* r, struct my_timming* mt, const struct output_desc* outd) {
+	u_int32_t chromasc;
+	u_int32_t hlen;
+	u_int32_t hsl;
+	u_int32_t hbp;
+	u_int32_t hfp;
+	u_int32_t hvis;
+	unsigned int pixclock;
+	unsigned long long piic;
+	int mnp;
+	int over;
+	
+	r->regs[0x80] = 0x03;	/* | 0x40 for SCART */
+
+	hvis = ((mt->HDisplay << 1) + 3) & ~3;
+	
+	if (hvis >= 2048) {
+		hvis = 2044;
+	}
+	
+	piic = 1000000000ULL * hvis;
+	do_div(piic, outd->h_vis);
+
+	dprintk(KERN_DEBUG "Want %u kHz pixclock\n", (unsigned int)piic);
+	
+	mnp = matroxfb_g450_setclk(PMINFO piic, M_VIDEO_PLL);
+	
+	mt->mnp = mnp;
+	mt->pixclock = g450_mnp2f(PMINFO mnp);
+
+	dprintk(KERN_DEBUG "MNP=%08X\n", mnp);
+
+	pixclock = 1000000000U / mt->pixclock;
+
+	dprintk(KERN_DEBUG "Got %u ps pixclock\n", pixclock);
+
+	piic = outd->chromasc;
+	do_div(piic, mt->pixclock);
+	chromasc = piic;
+	
+	dprintk(KERN_DEBUG "Chroma is %08X\n", chromasc);
+
+	r->regs[0] = piic >> 24;
+	r->regs[1] = piic >> 16;
+	r->regs[2] = piic >>  8;
+	r->regs[3] = piic >>  0;
+	hbp = (((outd->h_b_porch + pixclock) / pixclock)) & ~1;
+	hfp = (((outd->h_f_porch + pixclock) / pixclock)) & ~1;
+	hsl = (((outd->h_sync + pixclock) / pixclock)) & ~1;
+	hlen = hvis + hfp + hsl + hbp;
+	over = hlen & 0x0F;
+	
+	dprintk(KERN_DEBUG "WL: vis=%u, hf=%u, hs=%u, hb=%u, total=%u\n", hvis, hfp, hsl, hbp, hlen);
+
+	if (over) {
+		hfp -= over;
+		hlen -= over;
+		if (over <= 2) {
+		} else if (over < 10) {
+			hfp += 4;
+			hlen += 4;
+		} else {
+			hfp += 16;
+			hlen += 16;
+		}
+	}
+
+	/* maybe cve2 has requirement 800 < hlen < 1184 */
+	r->regs[0x08] = hsl;
+	r->regs[0x09] = (outd->burst + pixclock - 1) / pixclock;	/* burst length */
+	r->regs[0x0A] = hbp;
+	r->regs[0x2C] = hfp;
+	r->regs[0x31] = hvis / 8;
+	r->regs[0x32] = hvis & 7;
+	
+	dprintk(KERN_DEBUG "PG: vis=%04X, hf=%02X, hs=%02X, hb=%02X, total=%04X\n", hvis, hfp, hsl, hbp, hlen);
+
+	r->regs[0x84] = 1;	/* x sync point */
+	r->regs[0x85] = 0;
+	hvis = hvis >> 1;
+	hlen = hlen >> 1;
+	
+	dprintk(KERN_DEBUG "hlen=%u hvis=%u\n", hlen, hvis);
+
+	mt->interlaced = 1;
+
+	mt->HDisplay = hvis & ~7;
+	mt->HSyncStart = mt->HDisplay + 8;
+	mt->HSyncEnd = (hlen & ~7) - 8;
+	mt->HTotal = hlen;
+
+	{
+		int upper;
+		unsigned int vtotal;
+		unsigned int vsyncend;
+		unsigned int vdisplay;
+		
+		vtotal = mt->VTotal;
+		vsyncend = mt->VSyncEnd;
+		vdisplay = mt->VDisplay;
+		if (vtotal < outd->v_total) {
+			unsigned int yovr = outd->v_total - vtotal;
+			
+			vsyncend += yovr >> 1;
+		} else if (vtotal > outd->v_total) {
+			vdisplay = outd->v_total - 4;
+			vsyncend = outd->v_total;
+		}
+		upper = (outd->v_total - vsyncend) >> 1;	/* in field lines */
+		r->regs[0x17] = outd->v_total / 4;
+		r->regs[0x18] = outd->v_total & 3;
+		r->regs[0x33] = upper - 1;	/* upper blanking */
+		r->regs[0x82] = upper;		/* y sync point */
+		r->regs[0x83] = upper >> 8;
+		
+		mt->VDisplay = vdisplay;
+		mt->VSyncStart = outd->v_total - 2;
+		mt->VSyncEnd = outd->v_total;
+		mt->VTotal = outd->v_total;
+	}
+}
+
+static void cve2_init_TVdata(int norm, struct mavenregs* data, const struct output_desc** outd) {
+	static const struct output_desc paloutd = {
+		.h_vis	   = 52148148,	// ps
+		.h_f_porch =  1407407,	// ps
+		.h_sync    =  4666667,	// ps
+		.h_b_porch =  5777778,	// ps
+		.chromasc  = 19042247534182ULL,	// 4433618.750 Hz
+		.burst     =  2518518,	// ps
+		.v_total   =      625,
+	};
+	static const struct output_desc ntscoutd = {
+		.h_vis     = 52888889,	// ps
+		.h_f_porch =  1333333,	// ps
+		.h_sync    =  4666667,	// ps
+		.h_b_porch =  4666667,	// ps
+		.chromasc  = 15374030659475ULL,	// 3579545.454 Hz
+		.burst     =  2418418,	// ps
+		.v_total   =      525,	// lines
+	};
+
+	static const struct mavenregs palregs = { {
+		0x2A, 0x09, 0x8A, 0xCB,	/* 00: chroma subcarrier */
+		0x00,
+		0x00,	/* test */
+		0xF9,	/* modified by code (F9 written...) */
+		0x00,	/* ? not written */
+		0x7E,	/* 08 */
+		0x44,	/* 09 */
+		0x9C,	/* 0A */
+		0x2E,	/* 0B */
+		0x21,	/* 0C */
+		0x00,	/* ? not written */
+//		0x3F, 0x03, /* 0E-0F */
+		0x3C, 0x03,
+		0x3C, 0x03, /* 10-11 */
+		0x1A,	/* 12 */
+		0x2A,	/* 13 */
+		0x1C, 0x3D, 0x14, /* 14-16 */
+		0x9C, 0x01, /* 17-18 */
+		0x00,	/* 19 */
+		0xFE,	/* 1A */
+		0x7E,	/* 1B */
+		0x60,	/* 1C */
+		0x05,	/* 1D */
+//		0x89, 0x03, /* 1E-1F */
+		0xAD, 0x03,
+//		0x72,	/* 20 */
+		0xA5,
+		0x07,	/* 21 */
+//		0x72,	/* 22 */
+		0xA5,
+		0x00,	/* 23 */
+		0x00,	/* 24 */
+		0x00,	/* 25 */
+		0x08,	/* 26 */
+		0x04,	/* 27 */
+		0x00,	/* 28 */
+		0x1A,	/* 29 */
+		0x55, 0x01, /* 2A-2B */
+		0x26,	/* 2C */
+		0x07, 0x7E, /* 2D-2E */
+		0x02, 0x54, /* 2F-30 */
+		0xB0, 0x00, /* 31-32 */
+		0x14,	/* 33 */
+		0x49,	/* 34 */
+		0x00,	/* 35 written multiple times */
+		0x00,	/* 36 not written */
+		0xA3,	/* 37 */
+		0xC8,	/* 38 */
+		0x22,	/* 39 */
+		0x02,	/* 3A */
+		0x22,	/* 3B */
+		0x3F, 0x03, /* 3C-3D */
+		0x00,	/* 3E written multiple times */
+		0x00,	/* 3F not written */
+	} };
+	static struct mavenregs ntscregs = { {
+		0x21, 0xF0, 0x7C, 0x1F,	/* 00: chroma subcarrier */
+		0x00,
+		0x00,	/* test */
+		0xF9,	/* modified by code (F9 written...) */
+		0x00,	/* ? not written */
+		0x7E,	/* 08 */
+		0x43,	/* 09 */
+		0x7E,	/* 0A */
+		0x3D,	/* 0B */
+		0x00,	/* 0C */
+		0x00,	/* ? not written */
+		0x41, 0x00, /* 0E-0F */
+		0x3C, 0x00, /* 10-11 */
+		0x17,	/* 12 */
+		0x21,	/* 13 */
+		0x1B, 0x1B, 0x24, /* 14-16 */
+		0x83, 0x01, /* 17-18 */
+		0x00,	/* 19 */
+		0x0F,	/* 1A */
+		0x0F,	/* 1B */
+		0x60,	/* 1C */
+		0x05,	/* 1D */
+		//0x89, 0x02, /* 1E-1F */
+		0xC0, 0x02, /* 1E-1F */
+		//0x5F,	/* 20 */
+		0x9C,	/* 20 */
+		0x04,	/* 21 */
+		//0x5F,	/* 22 */
+		0x9C,	/* 22 */
+		0x01,	/* 23 */
+		0x02,	/* 24 */
+		0x00,	/* 25 */
+		0x0A,	/* 26 */
+		0x05,	/* 27 */
+		0x00,	/* 28 */
+		0x10,	/* 29 */
+		0xFF, 0x03, /* 2A-2B */
+		0x24,	/* 2C */
+		0x0F, 0x78, /* 2D-2E */
+		0x00, 0x00, /* 2F-30 */
+		0xB2, 0x04, /* 31-32 */
+		0x14,	/* 33 */
+		0x02,	/* 34 */
+		0x00,	/* 35 written multiple times */
+		0x00,	/* 36 not written */
+		0xA3,	/* 37 */
+		0xC8,	/* 38 */
+		0x15,	/* 39 */
+		0x05,	/* 3A */
+		0x3B,	/* 3B */
+		0x3C, 0x00, /* 3C-3D */
+		0x00,	/* 3E written multiple times */
+		0x00,	/* never written */
+	} };
+
+	if (norm == MATROXFB_OUTPUT_MODE_PAL) {
+		*data = palregs;
+		*outd = &paloutd;
+	} else {
+  		*data = ntscregs;
+		*outd = &ntscoutd;
+	}
+ 	return;
+}
+
+#define LR(x) cve2_set_reg(PMINFO (x), m->regs[(x)])
+static void cve2_init_TV(WPMINFO const struct mavenregs* m) {
+	int i;
+
+	LR(0x80);
+	LR(0x82); LR(0x83);
+	LR(0x84); LR(0x85);
+	
+	cve2_set_reg(PMINFO 0x3E, 0x01);
+	
+	for (i = 0; i < 0x3E; i++) {
+		LR(i);
+	}
+	cve2_set_reg(PMINFO 0x3E, 0x00);
+}
+
+static int matroxfb_g450_compute(void* md, struct my_timming* mt) {
+	MINFO_FROM(md);
+
+	dprintk(KERN_DEBUG "Computing, mode=%u\n", ACCESS_FBINFO(outputs[1]).mode);
+
+	if (mt->crtc == MATROXFB_SRC_CRTC2 &&
+	    ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+		const struct output_desc* outd;
+
+		cve2_init_TVdata(ACCESS_FBINFO(outputs[1]).mode, &ACCESS_FBINFO(hw).maven, &outd);
+		{
+			int blacklevel, whitelevel;
+			g450_compute_bwlevel(PMINFO &blacklevel, &whitelevel);
+			ACCESS_FBINFO(hw).maven.regs[0x0E] = blacklevel >> 2;
+			ACCESS_FBINFO(hw).maven.regs[0x0F] = blacklevel & 3;
+			ACCESS_FBINFO(hw).maven.regs[0x1E] = whitelevel >> 2;
+			ACCESS_FBINFO(hw).maven.regs[0x1F] = whitelevel & 3;
+
+			ACCESS_FBINFO(hw).maven.regs[0x20] =
+			ACCESS_FBINFO(hw).maven.regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+
+			ACCESS_FBINFO(hw).maven.regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+
+			if (ACCESS_FBINFO(altout.tvo_params.testout)) {
+				ACCESS_FBINFO(hw).maven.regs[0x05] |= 0x02;
+			}
+		}
+		computeRegs(PMINFO &ACCESS_FBINFO(hw).maven, mt, outd);
+	} else if (mt->mnp < 0) {
+		/* We must program clocks before CRTC2, otherwise interlaced mode
+		   startup may fail */
+		mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+		mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+	}
+	dprintk(KERN_DEBUG "Pixclock = %u\n", mt->pixclock);
+	return 0;
+}
+
+static int matroxfb_g450_program(void* md) {
+	MINFO_FROM(md);
+	
+	if (ACCESS_FBINFO(outputs[1]).mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+		cve2_init_TV(PMINFO &ACCESS_FBINFO(hw).maven);
+	}
+	return 0;
+}
+
+static int matroxfb_g450_verify_mode(void* md, u_int32_t arg) {
+	switch (arg) {
+		case MATROXFB_OUTPUT_MODE_PAL:
+		case MATROXFB_OUTPUT_MODE_NTSC:
+		case MATROXFB_OUTPUT_MODE_MONITOR:
+			return 0;
+	}
+	return -EINVAL;
+}
+
+static int g450_dvi_compute(void* md, struct my_timming* mt) {
+	MINFO_FROM(md);
+
+	if (mt->mnp < 0) {
+		mt->mnp = matroxfb_g450_setclk(PMINFO mt->pixclock, (mt->crtc == MATROXFB_SRC_CRTC1) ? M_PIXEL_PLL_C : M_VIDEO_PLL);
+		mt->pixclock = g450_mnp2f(PMINFO mt->mnp);
+	}
+	return 0;
+}
+
+static struct matrox_altout matroxfb_g450_altout = {
+	.name		= "Secondary output",
+	.compute	= matroxfb_g450_compute,
+	.program	= matroxfb_g450_program,
+	.verifymode	= matroxfb_g450_verify_mode,
+	.getqueryctrl	= g450_query_ctrl,
+	.getctrl	= g450_get_ctrl,
+	.setctrl	= g450_set_ctrl,
+};
+
+static struct matrox_altout matroxfb_g450_dvi = {
+	.name		= "DVI output",
+	.compute	= g450_dvi_compute,
+};
+
+void matroxfb_g450_connect(WPMINFO2) {
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+		down_write(&ACCESS_FBINFO(altout.lock));
+		tvo_fill_defaults(PMINFO2);
+		ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
+		ACCESS_FBINFO(outputs[1]).data = MINFO;
+		ACCESS_FBINFO(outputs[1]).output = &matroxfb_g450_altout;
+		ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		ACCESS_FBINFO(outputs[2]).src = ACCESS_FBINFO(outputs[2]).default_src;
+		ACCESS_FBINFO(outputs[2]).data = MINFO;
+		ACCESS_FBINFO(outputs[2]).output = &matroxfb_g450_dvi;
+		ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		up_write(&ACCESS_FBINFO(altout.lock));
+	}
+}
+
+void matroxfb_g450_shutdown(WPMINFO2) {
+	if (ACCESS_FBINFO(devflags.g450dac)) {
+		down_write(&ACCESS_FBINFO(altout.lock));
+		ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
+		ACCESS_FBINFO(outputs[1]).output = NULL;
+		ACCESS_FBINFO(outputs[1]).data = NULL;
+		ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		ACCESS_FBINFO(outputs[2]).src = MATROXFB_SRC_NONE;
+		ACCESS_FBINFO(outputs[2]).output = NULL;
+		ACCESS_FBINFO(outputs[2]).data = NULL;
+		ACCESS_FBINFO(outputs[2]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		up_write(&ACCESS_FBINFO(altout.lock));
+	}
+}
+
+EXPORT_SYMBOL(matroxfb_g450_connect);
+EXPORT_SYMBOL(matroxfb_g450_shutdown);
+
+MODULE_AUTHOR("(c) 2000-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Matrox G450/G550 output driver");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_g450.h b/drivers/video/matrox/matroxfb_g450.h
new file mode 100644
index 0000000..a0822a6
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_g450.h
@@ -0,0 +1,14 @@
+#ifndef __MATROXFB_G450_H__
+#define __MATROXFB_G450_H__
+
+#include "matroxfb_base.h"
+
+#ifdef CONFIG_FB_MATROX_G
+void matroxfb_g450_connect(WPMINFO2);
+void matroxfb_g450_shutdown(WPMINFO2);
+#else
+static inline void matroxfb_g450_connect(WPMINFO2) { };
+static inline void matroxfb_g450_shutdown(WPMINFO2) { };
+#endif
+
+#endif /* __MATROXFB_G450_H__ */
diff --git a/drivers/video/matrox/matroxfb_maven.c b/drivers/video/matrox/matroxfb_maven.c
new file mode 100644
index 0000000..e529841
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_maven.c
@@ -0,0 +1,1328 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200, G400 and G450.
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * See matroxfb_base.c for contributors.
+ *
+ */
+
+#include "matroxfb_maven.h"
+#include "matroxfb_misc.h"
+#include "matroxfb_DAC1064.h"
+#include <linux/i2c.h>
+#include <linux/matroxfb.h>
+#include <asm/div64.h>
+#include <asm/uaccess.h>
+
+#define MAVEN_I2CID	(0x1B)
+
+#define MGATVO_B	1
+#define MGATVO_C	2
+
+static const struct maven_gamma {
+  unsigned char reg83;
+  unsigned char reg84;
+  unsigned char reg85;
+  unsigned char reg86;
+  unsigned char reg87;
+  unsigned char reg88;
+  unsigned char reg89;
+  unsigned char reg8a;
+  unsigned char reg8b;
+} maven_gamma[] = {
+  { 131, 57, 223, 15, 117, 212, 251, 91, 156},
+  { 133, 61, 128, 63, 180, 147, 195, 100, 180},
+  { 131, 19, 63, 31, 50, 66, 171, 64, 176},
+  { 0, 0, 0, 31, 16, 16, 16, 100, 200},
+  { 8, 23, 47, 73, 147, 244, 220, 80, 195},
+  { 22, 43, 64, 80, 147, 115, 58, 85, 168},
+  { 34, 60, 80, 214, 147, 212, 188, 85, 167},
+  { 45, 77, 96, 216, 147, 99, 91, 85, 159},
+  { 56, 76, 112, 107, 147, 212, 148, 64, 144},
+  { 65, 91, 128, 137, 147, 196, 17, 69, 148},
+  { 72, 104, 136, 138, 147, 180, 245, 73, 147},
+  { 87, 116, 143, 126, 16, 83, 229, 77, 144},
+  { 95, 119, 152, 254, 244, 83, 221, 77, 151},
+  { 100, 129, 159, 156, 244, 148, 197, 77, 160},
+  { 105, 141, 167, 247, 244, 132, 181, 84, 166},
+  { 105, 147, 168, 247, 244, 245, 181, 90, 170},
+  { 120, 153, 175, 248, 212, 229, 165, 90, 180},
+  { 119, 156, 176, 248, 244, 229, 84, 74, 160},
+  { 119, 158, 183, 248, 244, 229, 149, 78, 165}
+};
+
+/* Definition of the various controls */
+struct mctl {
+	struct v4l2_queryctrl desc;
+	size_t control;
+};
+
+#define BLMIN	0x0FF
+#define WLMAX	0x3FF
+
+static const struct mctl maven_controls[] =
+{	{ { V4L2_CID_BRIGHTNESS, V4L2_CTRL_TYPE_INTEGER,
+	  "brightness",
+	  0, WLMAX - BLMIN, 1, 379 - BLMIN, 
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.brightness) },
+	{ { V4L2_CID_CONTRAST, V4L2_CTRL_TYPE_INTEGER,
+	  "contrast",
+	  0, 1023, 1, 127,
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.contrast) },
+	{ { V4L2_CID_SATURATION, V4L2_CTRL_TYPE_INTEGER,
+	  "saturation",
+	  0, 255, 1, 155,
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.saturation) },
+	{ { V4L2_CID_HUE, V4L2_CTRL_TYPE_INTEGER,
+	  "hue",
+	  0, 255, 1, 0,
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.hue) },
+	{ { V4L2_CID_GAMMA, V4L2_CTRL_TYPE_INTEGER,
+	  "gamma",
+	  0, sizeof(maven_gamma)/sizeof(maven_gamma[0])-1, 1, 3,
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.gamma) },
+	{ { MATROXFB_CID_TESTOUT, V4L2_CTRL_TYPE_BOOLEAN,
+	  "test output",
+	  0, 1, 1, 0, 
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.testout) },
+	{ { MATROXFB_CID_DEFLICKER, V4L2_CTRL_TYPE_INTEGER,
+	  "deflicker mode",
+	  0, 2, 1, 0,
+	  0,
+	}, offsetof(struct matrox_fb_info, altout.tvo_params.deflicker) },
+
+};
+
+#define MAVCTRLS (sizeof(maven_controls)/sizeof(maven_controls[0]))
+
+/* Return: positive number: id found
+           -EINVAL:         id not found, return failure
+	   -ENOENT:         id not found, create fake disabled control */
+static int get_ctrl_id(__u32 v4l2_id) {
+	int i;
+
+	for (i = 0; i < MAVCTRLS; i++) {
+		if (v4l2_id < maven_controls[i].desc.id) {
+			if (maven_controls[i].desc.id == 0x08000000) {
+				return -EINVAL;
+			}
+			return -ENOENT;
+		}
+		if (v4l2_id == maven_controls[i].desc.id) {
+			return i;
+		}
+	}
+	return -EINVAL;
+}
+
+struct maven_data {
+	struct matrox_fb_info*		primary_head;
+	struct i2c_client*		client;
+	int				version;
+};
+
+static int* get_ctrl_ptr(struct maven_data* md, int idx) {
+	return (int*)((char*)(md->primary_head) + maven_controls[idx].control);
+}
+
+static int maven_get_reg(struct i2c_client* c, char reg) {
+	char dst;
+	struct i2c_msg msgs[] = {{ c->addr, I2C_M_REV_DIR_ADDR, sizeof(reg), &reg },
+				 { c->addr, I2C_M_RD | I2C_M_NOSTART, sizeof(dst), &dst }};
+	s32 err;
+
+	err = i2c_transfer(c->adapter, msgs, 2);
+	if (err < 0)
+		printk(KERN_INFO "ReadReg(%d) failed\n", reg);
+	return dst & 0xFF;
+}
+
+static int maven_set_reg(struct i2c_client* c, int reg, int val) {
+	s32 err;
+
+	err = i2c_smbus_write_byte_data(c, reg, val);
+	if (err)
+		printk(KERN_INFO "WriteReg(%d) failed\n", reg);
+	return err;
+}
+
+static int maven_set_reg_pair(struct i2c_client* c, int reg, int val) {
+	s32 err;
+
+	err = i2c_smbus_write_word_data(c, reg, val);
+	if (err)
+		printk(KERN_INFO "WriteRegPair(%d) failed\n", reg);
+	return err;
+}
+
+static const struct matrox_pll_features maven_pll = {
+	50000,
+	27000,
+	4, 127,
+	2, 31,
+	3
+};
+
+struct matrox_pll_features2 {
+	unsigned int	vco_freq_min;
+	unsigned int	vco_freq_max;
+	unsigned int	feed_div_min;
+	unsigned int	feed_div_max;
+	unsigned int	in_div_min;
+	unsigned int	in_div_max;
+	unsigned int	post_shift_max;
+};
+
+struct matrox_pll_ctl {
+	unsigned int	ref_freq;
+	unsigned int	den;
+};
+
+static const struct matrox_pll_features2 maven1000_pll = {
+	 50000000,
+	300000000,
+	 5, 128,
+	 3,  32,
+	 3
+};
+
+static const struct matrox_pll_ctl maven_PAL = {
+	540000,
+	    50
+};
+
+static const struct matrox_pll_ctl maven_NTSC = {
+	450450,	/* 27027000/60 == 27000000/59.94005994 */
+	    60
+};
+
+static int matroxfb_PLL_mavenclock(const struct matrox_pll_features2* pll,
+		const struct matrox_pll_ctl* ctl,
+		unsigned int htotal, unsigned int vtotal,
+		unsigned int* in, unsigned int* feed, unsigned int* post,
+		unsigned int* h2) {
+	unsigned int besth2 = 0;
+	unsigned int fxtal = ctl->ref_freq;
+	unsigned int fmin = pll->vco_freq_min / ctl->den;
+	unsigned int fwant;
+	unsigned int p;
+	unsigned int scrlen;
+	unsigned int fmax;
+
+	DBG(__FUNCTION__)
+
+	scrlen = htotal * (vtotal - 1);
+	fwant = htotal * vtotal;
+	fmax = pll->vco_freq_max / ctl->den;
+
+	dprintk(KERN_DEBUG "want: %u, xtal: %u, h: %u, v: %u, fmax: %u\n",
+		fwant, fxtal, htotal, vtotal, fmax);
+	for (p = 1; p <= pll->post_shift_max; p++) {
+		if (fwant * 2 > fmax)
+			break;
+		fwant *= 2;
+	}
+	if (fwant > fmax)
+		return 0;
+	for (; p-- > 0; fwant >>= 1) {
+		unsigned int m;
+
+		if (fwant < fmin) break;
+		for (m = pll->in_div_min; m <= pll->in_div_max; m++) {
+			unsigned int n;
+			unsigned int dvd;
+			unsigned int ln;
+
+			n = (fwant * m) / fxtal;
+			if (n < pll->feed_div_min)
+				continue;
+			if (n > pll->feed_div_max)
+				break;
+
+			ln = fxtal * n;
+			dvd = m << p;
+
+			if (ln % dvd)
+				continue;
+			ln = ln / dvd;
+
+			if (ln < scrlen + 2)
+				continue;
+			ln = ln - scrlen;
+			if (ln > htotal)
+				continue;
+			dprintk(KERN_DEBUG "Match: %u / %u / %u / %u\n", n, m, p, ln);
+			if (ln > besth2) {
+				dprintk(KERN_DEBUG "Better...\n");
+				*h2 = besth2 = ln;
+				*post = p;
+				*in = m;
+				*feed = n;
+			}
+		}
+	}
+	if (besth2 < 2)
+		return 0;
+	dprintk(KERN_ERR "clk: %02X %02X %02X %d %d\n", *in, *feed, *post, fxtal, fwant);
+	return fxtal * (*feed) / (*in) * ctl->den;
+}
+
+static unsigned int matroxfb_mavenclock(const struct matrox_pll_ctl* ctl,
+		unsigned int htotal, unsigned int vtotal,
+		unsigned int* in, unsigned int* feed, unsigned int* post,
+		unsigned int* htotal2) {
+	unsigned int fvco;
+	unsigned int p;
+
+	fvco = matroxfb_PLL_mavenclock(&maven1000_pll, ctl, htotal, vtotal, in, feed, &p, htotal2);
+	if (!fvco)
+		return -EINVAL;
+	p = (1 << p) - 1;
+	if (fvco <= 100000000)
+		;
+	else if (fvco <= 140000000)
+		p |= 0x08;
+	else if (fvco <= 180000000)
+		p |= 0x10;
+	else
+		p |= 0x18;
+	*post = p;
+	return 0;
+}
+
+static void DAC1064_calcclock(unsigned int freq, unsigned int fmax,
+		unsigned int* in, unsigned int* feed, unsigned int* post) {
+	unsigned int fvco;
+	unsigned int p;
+
+	fvco = matroxfb_PLL_calcclock(&maven_pll, freq, fmax, in, feed, &p);
+	p = (1 << p) - 1;
+	if (fvco <= 100000)
+		;
+	else if (fvco <= 140000)
+		p |= 0x08;
+	else if (fvco <= 180000)
+		p |= 0x10;
+	else
+		p |= 0x18;
+	*post = p;
+	return;
+}
+
+static unsigned char maven_compute_deflicker (const struct maven_data* md) {
+	unsigned char df;
+	
+	df = (md->version == MGATVO_B?0x40:0x00);
+	switch (md->primary_head->altout.tvo_params.deflicker) {
+		case 0:
+/*			df |= 0x00; */
+			break;
+		case 1:
+			df |= 0xB1;
+			break;
+		case 2:
+			df |= 0xA2;
+			break;
+	}
+	return df;
+}
+
+static void maven_compute_bwlevel (const struct maven_data* md,
+				   int *bl, int *wl) {
+	const int b = md->primary_head->altout.tvo_params.brightness + BLMIN;
+	const int c = md->primary_head->altout.tvo_params.contrast;
+
+	*bl = max(b - c, BLMIN);
+	*wl = min(b + c, WLMAX);
+}
+
+static const struct maven_gamma* maven_compute_gamma (const struct maven_data* md) {
+ 	return maven_gamma + md->primary_head->altout.tvo_params.gamma;
+}
+
+
+static void maven_init_TVdata(const struct maven_data* md, struct mavenregs* data) {
+	static struct mavenregs palregs = { {
+		0x2A, 0x09, 0x8A, 0xCB,	/* 00: chroma subcarrier */
+		0x00,
+		0x00,	/* ? not written */
+		0x00,	/* modified by code (F9 written...) */
+		0x00,	/* ? not written */
+		0x7E,	/* 08 */
+		0x44,	/* 09 */
+		0x9C,	/* 0A */
+		0x2E,	/* 0B */
+		0x21,	/* 0C */
+		0x00,	/* ? not written */
+		0x3F, 0x03, /* 0E-0F */
+		0x3F, 0x03, /* 10-11 */
+		0x1A,	/* 12 */
+		0x2A,	/* 13 */
+		0x1C, 0x3D, 0x14, /* 14-16 */
+		0x9C, 0x01, /* 17-18 */
+		0x00,	/* 19 */
+		0xFE,	/* 1A */
+		0x7E,	/* 1B */
+		0x60,	/* 1C */
+		0x05,	/* 1D */
+		0x89, 0x03, /* 1E-1F */
+		0x72,	/* 20 */
+		0x07,	/* 21 */
+		0x72,	/* 22 */
+		0x00,	/* 23 */
+		0x00,	/* 24 */
+		0x00,	/* 25 */
+		0x08,	/* 26 */
+		0x04,	/* 27 */
+		0x00,	/* 28 */
+		0x1A,	/* 29 */
+		0x55, 0x01, /* 2A-2B */
+		0x26,	/* 2C */
+		0x07, 0x7E, /* 2D-2E */
+		0x02, 0x54, /* 2F-30 */
+		0xB0, 0x00, /* 31-32 */
+		0x14,	/* 33 */
+		0x49,	/* 34 */
+		0x00,	/* 35 written multiple times */
+		0x00,	/* 36 not written */
+		0xA3,	/* 37 */
+		0xC8,	/* 38 */
+		0x22,	/* 39 */
+		0x02,	/* 3A */
+		0x22,	/* 3B */
+		0x3F, 0x03, /* 3C-3D */
+		0x00,	/* 3E written multiple times */
+		0x00,	/* 3F not written */
+	}, MATROXFB_OUTPUT_MODE_PAL, 625, 50 };
+	static struct mavenregs ntscregs = { {
+		0x21, 0xF0, 0x7C, 0x1F,	/* 00: chroma subcarrier */
+		0x00,
+		0x00,	/* ? not written */
+		0x00,	/* modified by code (F9 written...) */
+		0x00,	/* ? not written */
+		0x7E,	/* 08 */
+		0x43,	/* 09 */
+		0x7E,	/* 0A */
+		0x3D,	/* 0B */
+		0x00,	/* 0C */
+		0x00,	/* ? not written */
+		0x41, 0x00, /* 0E-0F */
+		0x3C, 0x00, /* 10-11 */
+		0x17,	/* 12 */
+		0x21,	/* 13 */
+		0x1B, 0x1B, 0x24, /* 14-16 */
+		0x83, 0x01, /* 17-18 */
+		0x00,	/* 19 */
+		0x0F,	/* 1A */
+		0x0F,	/* 1B */
+		0x60,	/* 1C */
+		0x05,	/* 1D */
+		0x89, 0x02, /* 1E-1F */
+		0x5F,	/* 20 */
+		0x04,	/* 21 */
+		0x5F,	/* 22 */
+		0x01,	/* 23 */
+		0x02,	/* 24 */
+		0x00,	/* 25 */
+		0x0A,	/* 26 */
+		0x05,	/* 27 */
+		0x00,	/* 28 */
+		0x10,	/* 29 */
+		0xFF, 0x03, /* 2A-2B */
+		0x24,	/* 2C */
+		0x0F, 0x78, /* 2D-2E */
+		0x00, 0x00, /* 2F-30 */
+		0xB2, 0x04, /* 31-32 */
+		0x14,	/* 33 */
+		0x02,	/* 34 */
+		0x00,	/* 35 written multiple times */
+		0x00,	/* 36 not written */
+		0xA3,	/* 37 */
+		0xC8,	/* 38 */
+		0x15,	/* 39 */
+		0x05,	/* 3A */
+		0x3B,	/* 3B */
+		0x3C, 0x00, /* 3C-3D */
+		0x00,	/* 3E written multiple times */
+		0x00,	/* never written */
+	}, MATROXFB_OUTPUT_MODE_NTSC, 525, 60 };
+	MINFO_FROM(md->primary_head);
+
+	if (ACCESS_FBINFO(outputs[1]).mode == MATROXFB_OUTPUT_MODE_PAL)
+		*data = palregs;
+	else
+		*data = ntscregs;
+
+	/* Set deflicker */
+	data->regs[0x93] = maven_compute_deflicker(md);
+ 
+	/* set gamma */
+	{
+		const struct maven_gamma* g;
+		g = maven_compute_gamma(md);
+		data->regs[0x83] = g->reg83;
+		data->regs[0x84] = g->reg84;
+		data->regs[0x85] = g->reg85;
+		data->regs[0x86] = g->reg86;
+		data->regs[0x87] = g->reg87;
+		data->regs[0x88] = g->reg88;
+		data->regs[0x89] = g->reg89;
+		data->regs[0x8A] = g->reg8a;
+		data->regs[0x8B] = g->reg8b;
+	}
+ 
+	/* Set contrast / brightness */
+	{
+		int bl, wl;
+		maven_compute_bwlevel (md, &bl, &wl);
+		data->regs[0x0e] = bl >> 2;
+		data->regs[0x0f] = bl & 3;
+		data->regs[0x1e] = wl >> 2;
+		data->regs[0x1f] = wl & 3;
+	}
+
+	/* Set saturation */
+	{
+		data->regs[0x20] =
+		data->regs[0x22] = ACCESS_FBINFO(altout.tvo_params.saturation);
+	}
+ 
+	/* Set HUE */
+	data->regs[0x25] = ACCESS_FBINFO(altout.tvo_params.hue);
+	return;
+}
+
+#define LR(x) maven_set_reg(c, (x), m->regs[(x)])
+#define LRP(x) maven_set_reg_pair(c, (x), m->regs[(x)] | (m->regs[(x)+1] << 8))
+static void maven_init_TV(struct i2c_client* c, const struct mavenregs* m) {
+	int val;
+
+
+	maven_set_reg(c, 0x3E, 0x01);
+	maven_get_reg(c, 0x82);	/* fetch oscillator state? */
+	maven_set_reg(c, 0x8C, 0x00);
+	maven_get_reg(c, 0x94);	/* get 0x82 */
+	maven_set_reg(c, 0x94, 0xA2);
+	/* xmiscctrl */
+
+	maven_set_reg_pair(c, 0x8E, 0x1EFF);
+	maven_set_reg(c, 0xC6, 0x01);
+
+	/* removed code... */
+
+	maven_get_reg(c, 0x06);
+	maven_set_reg(c, 0x06, 0xF9);	/* or read |= 0xF0 ? */
+
+	/* removed code here... */
+
+	/* real code begins here? */
+	/* chroma subcarrier */
+	LR(0x00); LR(0x01); LR(0x02); LR(0x03);
+
+	LR(0x04);
+
+	LR(0x2C);
+	LR(0x08);
+	LR(0x0A);
+	LR(0x09);
+	LR(0x29);
+	LRP(0x31);
+	LRP(0x17);
+	LR(0x0B);
+	LR(0x0C);
+	if (m->mode == MATROXFB_OUTPUT_MODE_PAL) {
+		maven_set_reg(c, 0x35, 0x10); /* ... */
+	} else {
+		maven_set_reg(c, 0x35, 0x0F); /* ... */
+	}
+
+	LRP(0x10);
+
+	LRP(0x0E);
+	LRP(0x1E);
+
+	LR(0x20);	/* saturation #1 */
+	LR(0x22);	/* saturation #2 */
+	LR(0x25);	/* hue */
+	LR(0x34);
+	LR(0x33);
+	LR(0x19);
+	LR(0x12);
+	LR(0x3B);
+	LR(0x13);
+	LR(0x39);
+	LR(0x1D);
+	LR(0x3A);
+	LR(0x24);
+	LR(0x14);
+	LR(0x15);
+	LR(0x16);
+	LRP(0x2D);
+	LRP(0x2F);
+	LR(0x1A);
+	LR(0x1B);
+	LR(0x1C);
+	LR(0x23);
+	LR(0x26);
+	LR(0x28);
+	LR(0x27);
+	LR(0x21);
+	LRP(0x2A);
+	if (m->mode == MATROXFB_OUTPUT_MODE_PAL)
+		maven_set_reg(c, 0x35, 0x1D);	/* ... */
+	else
+		maven_set_reg(c, 0x35, 0x1C);
+
+	LRP(0x3C);
+	LR(0x37);
+	LR(0x38);
+	maven_set_reg(c, 0xB3, 0x01);
+
+	maven_get_reg(c, 0xB0);	/* read 0x80 */
+	maven_set_reg(c, 0xB0, 0x08);	/* ugh... */
+	maven_get_reg(c, 0xB9);	/* read 0x7C */
+	maven_set_reg(c, 0xB9, 0x78);
+	maven_get_reg(c, 0xBF);	/* read 0x00 */
+	maven_set_reg(c, 0xBF, 0x02);
+	maven_get_reg(c, 0x94);	/* read 0x82 */
+	maven_set_reg(c, 0x94, 0xB3);
+
+	LR(0x80); /* 04 1A 91 or 05 21 91 */
+	LR(0x81);
+	LR(0x82);
+
+	maven_set_reg(c, 0x8C, 0x20);
+	maven_get_reg(c, 0x8D);
+	maven_set_reg(c, 0x8D, 0x10);
+
+	LR(0x90); /* 4D 50 52 or 4E 05 45 */
+	LR(0x91);
+	LR(0x92);
+
+	LRP(0x9A); /* 0049 or 004F */
+	LRP(0x9C); /* 0004 or 0004 */
+	LRP(0x9E); /* 0458 or 045E */
+	LRP(0xA0); /* 05DA or 051B */
+	LRP(0xA2); /* 00CC or 00CF */
+	LRP(0xA4); /* 007D or 007F */
+	LRP(0xA6); /* 007C or 007E */
+	LRP(0xA8); /* 03CB or 03CE */
+	LRP(0x98); /* 0000 or 0000 */
+	LRP(0xAE); /* 0044 or 003A */
+	LRP(0x96); /* 05DA or 051B */
+	LRP(0xAA); /* 04BC or 046A */
+	LRP(0xAC); /* 004D or 004E */
+
+	LR(0xBE);
+	LR(0xC2);
+
+	maven_get_reg(c, 0x8D);
+	maven_set_reg(c, 0x8D, 0x04);
+
+	LR(0x20);	/* saturation #1 */
+	LR(0x22);	/* saturation #2 */
+	LR(0x93);	/* whoops */
+	LR(0x20);	/* oh, saturation #1 again */
+	LR(0x22);	/* oh, saturation #2 again */
+	LR(0x25);	/* hue */
+	LRP(0x0E);
+	LRP(0x1E);
+	LRP(0x0E);	/* problems with memory? */
+	LRP(0x1E);	/* yes, matrox must have problems in memory area... */
+
+	/* load gamma correction stuff */
+	LR(0x83);
+	LR(0x84);
+	LR(0x85);
+	LR(0x86);
+	LR(0x87);
+	LR(0x88);
+	LR(0x89);
+	LR(0x8A);
+	LR(0x8B);
+
+	val = maven_get_reg(c, 0x8D);
+	val &= 0x14;			/* 0x10 or anything ored with it */
+	maven_set_reg(c, 0x8D, val);
+
+	LR(0x33);
+	LR(0x19);
+	LR(0x12);
+	LR(0x3B);
+	LR(0x13);
+	LR(0x39);
+	LR(0x1D);
+	LR(0x3A);
+	LR(0x24);
+	LR(0x14);
+	LR(0x15);
+	LR(0x16);
+	LRP(0x2D);
+	LRP(0x2F);
+	LR(0x1A);
+	LR(0x1B);
+	LR(0x1C);
+	LR(0x23);
+	LR(0x26);
+	LR(0x28);
+	LR(0x27);
+	LR(0x21);
+	LRP(0x2A);
+	if (m->mode == MATROXFB_OUTPUT_MODE_PAL)
+		maven_set_reg(c, 0x35, 0x1D);
+	else
+		maven_set_reg(c, 0x35, 0x1C);
+	LRP(0x3C);
+	LR(0x37);
+	LR(0x38);
+
+	maven_get_reg(c, 0xB0);
+	LR(0xB0);	/* output mode */
+	LR(0x90);
+	LR(0xBE);
+	LR(0xC2);
+
+	LRP(0x9A);
+	LRP(0xA2);
+	LRP(0x9E);
+	LRP(0xA6);
+	LRP(0xAA);
+	LRP(0xAC);
+	maven_set_reg(c, 0x3E, 0x00);
+	maven_set_reg(c, 0x95, 0x20);
+}
+
+static int maven_find_exact_clocks(unsigned int ht, unsigned int vt,
+		struct mavenregs* m) {
+	unsigned int x;
+	unsigned int err = ~0;
+
+	/* 1:1 */
+	m->regs[0x80] = 0x0F;
+	m->regs[0x81] = 0x07;
+	m->regs[0x82] = 0x81;
+
+	for (x = 0; x < 8; x++) {
+		unsigned int a, b, c, h2;
+		unsigned int h = ht + 2 + x;
+
+		if (!matroxfb_mavenclock((m->mode == MATROXFB_OUTPUT_MODE_PAL) ? &maven_PAL : &maven_NTSC, h, vt, &a, &b, &c, &h2)) {
+			unsigned int diff = h - h2;
+
+			if (diff < err) {
+				err = diff;
+				m->regs[0x80] = a - 1;
+				m->regs[0x81] = b - 1;
+				m->regs[0x82] = c | 0x80;
+				m->hcorr = h2 - 2;
+				m->htotal = h - 2;
+			}
+		}
+	}
+	return err != ~0U;
+}
+
+static inline int maven_compute_timming(struct maven_data* md,
+		struct my_timming* mt,
+		struct mavenregs* m) {
+	unsigned int tmpi;
+	unsigned int a, bv, c;
+	MINFO_FROM(md->primary_head);
+
+	m->mode = ACCESS_FBINFO(outputs[1]).mode;
+	if (m->mode != MATROXFB_OUTPUT_MODE_MONITOR) {
+		unsigned int lmargin;
+		unsigned int umargin;
+		unsigned int vslen;
+		unsigned int hcrt;
+		unsigned int slen;
+
+		maven_init_TVdata(md, m);
+
+		if (maven_find_exact_clocks(mt->HTotal, mt->VTotal, m) == 0)
+			return -EINVAL;
+
+		lmargin = mt->HTotal - mt->HSyncEnd;
+		slen = mt->HSyncEnd - mt->HSyncStart;
+		hcrt = mt->HTotal - slen - mt->delay;
+		umargin = mt->VTotal - mt->VSyncEnd;
+		vslen = mt->VSyncEnd - mt->VSyncStart;
+
+		if (m->hcorr < mt->HTotal)
+			hcrt += m->hcorr;
+		if (hcrt > mt->HTotal)
+			hcrt -= mt->HTotal;
+		if (hcrt + 2 > mt->HTotal)
+			hcrt = 0;	/* or issue warning? */
+
+		/* last (first? middle?) line in picture can have different length */
+		/* hlen - 2 */
+		m->regs[0x96] = m->hcorr;
+		m->regs[0x97] = m->hcorr >> 8;
+		/* ... */
+		m->regs[0x98] = 0x00; m->regs[0x99] = 0x00;
+		/* hblanking end */
+		m->regs[0x9A] = lmargin;	/* 100% */
+		m->regs[0x9B] = lmargin >> 8;	/* 100% */
+		/* who knows */
+		m->regs[0x9C] = 0x04;
+		m->regs[0x9D] = 0x00;
+		/* htotal - 2 */
+		m->regs[0xA0] = m->htotal;
+		m->regs[0xA1] = m->htotal >> 8;
+		/* vblanking end */
+		m->regs[0xA2] = mt->VTotal - mt->VSyncStart - 1;	/* stop vblanking */
+		m->regs[0xA3] = (mt->VTotal - mt->VSyncStart - 1) >> 8;
+		/* something end... [A6]+1..[A8] */
+		if (md->version == MGATVO_B) {
+			m->regs[0xA4] = 0x04;
+			m->regs[0xA5] = 0x00;
+		} else {
+			m->regs[0xA4] = 0x01;
+			m->regs[0xA5] = 0x00;
+		}
+		/* something start... 0..[A4]-1 */
+		m->regs[0xA6] = 0x00;
+		m->regs[0xA7] = 0x00;
+		/* vertical line count - 1 */
+		m->regs[0xA8] = mt->VTotal - 1;
+		m->regs[0xA9] = (mt->VTotal - 1) >> 8;
+		/* horizontal vidrst pos */
+		m->regs[0xAA] = hcrt;		/* 0 <= hcrt <= htotal - 2 */
+		m->regs[0xAB] = hcrt >> 8;
+		/* vertical vidrst pos */
+		m->regs[0xAC] = mt->VTotal - 2;
+		m->regs[0xAD] = (mt->VTotal - 2) >> 8;
+		/* moves picture up/down and so on... */
+		m->regs[0xAE] = 0x01; /* Fix this... 0..VTotal */
+		m->regs[0xAF] = 0x00;
+		{
+			int hdec;
+			int hlen;
+			unsigned int ibmin = 4 + lmargin + mt->HDisplay;
+			unsigned int ib;
+			int i;
+
+			/* Verify! */
+			/* Where 94208 came from? */
+			if (mt->HTotal)
+				hdec = 94208 / (mt->HTotal);
+			else
+				hdec = 0x81;
+			if (hdec > 0x81)
+				hdec = 0x81;
+			if (hdec < 0x41)
+				hdec = 0x41;
+			hdec--;
+			hlen = 98304 - 128 - ((lmargin + mt->HDisplay - 8) * hdec);
+			if (hlen < 0)
+				hlen = 0;
+			hlen = hlen >> 8;
+			if (hlen > 0xFF)
+				hlen = 0xFF;
+			/* Now we have to compute input buffer length.
+			   If you want any picture, it must be between
+			     4 + lmargin + xres
+			   and
+			     94208 / hdec
+			   If you want perfect picture even on the top
+			   of screen, it must be also
+			     0x3C0000 * i / hdec + Q - R / hdec
+			   where
+			        R      Qmin   Qmax
+			     0x07000   0x5AE  0x5BF
+			     0x08000   0x5CF  0x5FF
+			     0x0C000   0x653  0x67F
+			     0x10000   0x6F8  0x6FF
+			 */
+			i = 1;
+			do {
+				ib = ((0x3C0000 * i - 0x8000)/ hdec + 0x05E7) >> 8;
+				i++;
+			} while (ib < ibmin);
+			if (ib >= m->htotal + 2) {
+				ib = ibmin;
+			}
+
+			m->regs[0x90] = hdec;	/* < 0x40 || > 0x80 is bad... 0x80 is questionable */
+			m->regs[0xC2] = hlen;
+			/* 'valid' input line length */
+			m->regs[0x9E] = ib;
+			m->regs[0x9F] = ib >> 8;
+		}
+		{
+			int vdec;
+			int vlen;
+
+#define MATROX_USE64BIT_DIVIDE
+			if (mt->VTotal) {
+#ifdef MATROX_USE64BIT_DIVIDE
+				u64 f1;
+				u32 a;
+				u32 b;
+
+				a = m->vlines * (m->htotal + 2);
+				b = (mt->VTotal - 1) * (m->htotal + 2) + m->hcorr + 2;
+
+				f1 = ((u64)a) << 15;	/* *32768 */
+				do_div(f1, b);
+				vdec = f1;
+#else
+				vdec = m->vlines * 32768 / mt->VTotal;
+#endif
+			} else
+				vdec = 0x8000;
+			if (vdec > 0x8000)
+				vdec = 0x8000;
+			vlen = (vslen + umargin + mt->VDisplay) * vdec;
+			vlen = (vlen >> 16) - 146; /* FIXME: 146?! */
+			if (vlen < 0)
+				vlen = 0;
+			if (vlen > 0xFF)
+				vlen = 0xFF;
+			vdec--;
+			m->regs[0x91] = vdec;
+			m->regs[0x92] = vdec >> 8;
+			m->regs[0xBE] = vlen;
+		}
+		m->regs[0xB0] = 0x08;	/* output: SVideo/Composite */
+		return 0;
+	}
+
+	DAC1064_calcclock(mt->pixclock, 450000, &a, &bv, &c);
+	m->regs[0x80] = a;
+	m->regs[0x81] = bv;
+	m->regs[0x82] = c | 0x80;
+
+	m->regs[0xB3] = 0x01;
+	m->regs[0x94] = 0xB2;
+
+	/* htotal... */
+	m->regs[0x96] = mt->HTotal;
+	m->regs[0x97] = mt->HTotal >> 8;
+	/* ?? */
+	m->regs[0x98] = 0x00;
+	m->regs[0x99] = 0x00;
+	/* hsync len */
+	tmpi = mt->HSyncEnd - mt->HSyncStart;
+	m->regs[0x9A] = tmpi;
+	m->regs[0x9B] = tmpi >> 8;
+	/* hblank end */
+	tmpi = mt->HTotal - mt->HSyncStart;
+	m->regs[0x9C] = tmpi;
+	m->regs[0x9D] = tmpi >> 8;
+	/* hblank start */
+	tmpi += mt->HDisplay;
+	m->regs[0x9E] = tmpi;
+	m->regs[0x9F] = tmpi >> 8;
+	/* htotal + 1 */
+	tmpi = mt->HTotal + 1;
+	m->regs[0xA0] = tmpi;
+	m->regs[0xA1] = tmpi >> 8;
+	/* vsync?! */
+	tmpi = mt->VSyncEnd - mt->VSyncStart - 1;
+	m->regs[0xA2] = tmpi;
+	m->regs[0xA3] = tmpi >> 8;
+	/* ignored? */
+	tmpi = mt->VTotal - mt->VSyncStart;
+	m->regs[0xA4] = tmpi;
+	m->regs[0xA5] = tmpi >> 8;
+	/* ignored? */
+	tmpi = mt->VTotal - 1;
+	m->regs[0xA6] = tmpi;
+	m->regs[0xA7] = tmpi >> 8;
+	/* vtotal - 1 */
+	m->regs[0xA8] = tmpi;
+	m->regs[0xA9] = tmpi >> 8;
+	/* hor vidrst */
+	tmpi = mt->HTotal - mt->delay;
+	m->regs[0xAA] = tmpi;
+	m->regs[0xAB] = tmpi >> 8;
+	/* vert vidrst */
+	tmpi = mt->VTotal - 2;
+	m->regs[0xAC] = tmpi;
+	m->regs[0xAD] = tmpi >> 8;
+	/* ignored? */
+	m->regs[0xAE] = 0x00;
+	m->regs[0xAF] = 0x00;
+
+	m->regs[0xB0] = 0x03;	/* output: monitor */
+	m->regs[0xB1] = 0xA0;	/* ??? */
+	m->regs[0x8C] = 0x20;	/* must be set... */
+	m->regs[0x8D] = 0x04;	/* defaults to 0x10: test signal */
+	m->regs[0xB9] = 0x1A;	/* defaults to 0x2C: too bright */
+	m->regs[0xBF] = 0x22;	/* makes picture stable */
+
+	return 0;
+}
+
+static inline int maven_program_timming(struct maven_data* md,
+		const struct mavenregs* m) {
+	struct i2c_client* c = md->client;
+
+	if (m->mode == MATROXFB_OUTPUT_MODE_MONITOR) {
+		LR(0x80);
+		LR(0x81);
+		LR(0x82);
+
+		LR(0xB3);
+		LR(0x94);
+
+		LRP(0x96);
+		LRP(0x98);
+		LRP(0x9A);
+		LRP(0x9C);
+		LRP(0x9E);
+		LRP(0xA0);
+		LRP(0xA2);
+		LRP(0xA4);
+		LRP(0xA6);
+		LRP(0xA8);
+		LRP(0xAA);
+		LRP(0xAC);
+		LRP(0xAE);
+
+		LR(0xB0);	/* output: monitor */
+		LR(0xB1);	/* ??? */
+		LR(0x8C);	/* must be set... */
+		LR(0x8D);	/* defaults to 0x10: test signal */
+		LR(0xB9);	/* defaults to 0x2C: too bright */
+		LR(0xBF);	/* makes picture stable */
+	} else {
+		maven_init_TV(c, m);
+	}
+	return 0;
+}
+
+static inline int maven_resync(struct maven_data* md) {
+	struct i2c_client* c = md->client;
+	maven_set_reg(c, 0x95, 0x20);	/* start whole thing */
+	return 0;
+}
+
+static int maven_get_queryctrl (struct maven_data* md, 
+				struct v4l2_queryctrl *p) {
+	int i;
+	
+	i = get_ctrl_id(p->id);
+	if (i >= 0) {
+		*p = maven_controls[i].desc;
+		return 0;
+	}
+	if (i == -ENOENT) {
+		static const struct v4l2_queryctrl disctrl = 
+			{ .flags = V4L2_CTRL_FLAG_DISABLED };
+			
+		i = p->id;
+		*p = disctrl;
+		p->id = i;
+		sprintf(p->name, "Ctrl #%08X", i);
+		return 0;
+	}
+	return -EINVAL;
+}
+
+static int maven_set_control (struct maven_data* md, 
+			      struct v4l2_control *p) {
+	int i;
+	
+	i = get_ctrl_id(p->id);
+	if (i < 0) return -EINVAL;
+
+	/*
+	 * Check if changed.
+	 */
+	if (p->value == *get_ctrl_ptr(md, i)) return 0;
+
+	/*
+	 * Check limits.
+	 */
+	if (p->value > maven_controls[i].desc.maximum) return -EINVAL;
+	if (p->value < maven_controls[i].desc.minimum) return -EINVAL;
+
+	/*
+	 * Store new value.
+	 */
+	*get_ctrl_ptr(md, i) = p->value;
+
+	switch (p->id) {
+		case V4L2_CID_BRIGHTNESS:
+		case V4L2_CID_CONTRAST:
+		{
+		  int blacklevel, whitelevel;
+		  maven_compute_bwlevel(md, &blacklevel, &whitelevel);
+		  blacklevel = (blacklevel >> 2) | ((blacklevel & 3) << 8);
+		  whitelevel = (whitelevel >> 2) | ((whitelevel & 3) << 8);
+		  maven_set_reg_pair(md->client, 0x0e, blacklevel);
+		  maven_set_reg_pair(md->client, 0x1e, whitelevel);
+		}
+		break;
+		case V4L2_CID_SATURATION:
+		{
+		  maven_set_reg(md->client, 0x20, p->value);
+		  maven_set_reg(md->client, 0x22, p->value);
+		}
+		break;
+		case V4L2_CID_HUE:
+		{
+		  maven_set_reg(md->client, 0x25, p->value);
+		}
+		break;
+		case V4L2_CID_GAMMA:
+		{
+		  const struct maven_gamma* g;
+		  g = maven_compute_gamma(md);
+		  maven_set_reg(md->client, 0x83, g->reg83);
+		  maven_set_reg(md->client, 0x84, g->reg84);
+		  maven_set_reg(md->client, 0x85, g->reg85);
+		  maven_set_reg(md->client, 0x86, g->reg86);
+		  maven_set_reg(md->client, 0x87, g->reg87);
+		  maven_set_reg(md->client, 0x88, g->reg88);
+		  maven_set_reg(md->client, 0x89, g->reg89);
+		  maven_set_reg(md->client, 0x8a, g->reg8a);
+		  maven_set_reg(md->client, 0x8b, g->reg8b);
+		}
+		break;
+		case MATROXFB_CID_TESTOUT:
+		{
+			unsigned char val 
+			  = maven_get_reg (md->client,0x8d);
+			if (p->value) val |= 0x10;
+			else          val &= ~0x10;
+			maven_set_reg (md->client, 0x8d, val);
+		}
+		break;
+		case MATROXFB_CID_DEFLICKER:
+		{
+		  maven_set_reg(md->client, 0x93, maven_compute_deflicker(md));
+		}
+		break;
+	}
+	
+
+	return 0;
+}
+
+static int maven_get_control (struct maven_data* md, 
+			      struct v4l2_control *p) {
+	int i;
+	
+	i = get_ctrl_id(p->id);
+	if (i < 0) return -EINVAL;
+	p->value = *get_ctrl_ptr(md, i);
+	return 0;
+}
+
+/******************************************************/
+
+static int maven_out_compute(void* md, struct my_timming* mt) {
+#define mdinfo ((struct maven_data*)md)
+#define minfo (mdinfo->primary_head)
+	return maven_compute_timming(md, mt, &ACCESS_FBINFO(hw).maven);
+#undef minfo
+#undef mdinfo
+}
+
+static int maven_out_program(void* md) {
+#define mdinfo ((struct maven_data*)md)
+#define minfo (mdinfo->primary_head)
+	return maven_program_timming(md, &ACCESS_FBINFO(hw).maven);
+#undef minfo
+#undef mdinfo
+}
+
+static int maven_out_start(void* md) {
+	return maven_resync(md);
+}
+
+static int maven_out_verify_mode(void* md, u_int32_t arg) {
+	switch (arg) {
+		case MATROXFB_OUTPUT_MODE_PAL:
+		case MATROXFB_OUTPUT_MODE_NTSC:
+		case MATROXFB_OUTPUT_MODE_MONITOR:
+			return 0;
+	}
+	return -EINVAL;
+}
+
+static int maven_out_get_queryctrl(void* md, struct v4l2_queryctrl* p) {
+        return maven_get_queryctrl(md, p);
+}
+
+static int maven_out_get_ctrl(void* md, struct v4l2_control* p) {
+	return maven_get_control(md, p);
+}
+
+static int maven_out_set_ctrl(void* md, struct v4l2_control* p) {
+	return maven_set_control(md, p);
+}
+
+static struct matrox_altout maven_altout = {
+	.name		= "Secondary output",
+	.compute	= maven_out_compute,
+	.program	= maven_out_program,
+	.start		= maven_out_start,
+	.verifymode	= maven_out_verify_mode,
+	.getqueryctrl	= maven_out_get_queryctrl,
+	.getctrl	= maven_out_get_ctrl,
+	.setctrl	= maven_out_set_ctrl,
+};
+
+static int maven_init_client(struct i2c_client* clnt) {
+	struct maven_data* md = i2c_get_clientdata(clnt);
+	MINFO_FROM(container_of(clnt->adapter, struct i2c_bit_adapter, adapter)->minfo);
+
+	md->primary_head = MINFO;
+	md->client = clnt;
+	down_write(&ACCESS_FBINFO(altout.lock));
+	ACCESS_FBINFO(outputs[1]).output = &maven_altout;
+	ACCESS_FBINFO(outputs[1]).src = ACCESS_FBINFO(outputs[1]).default_src;
+	ACCESS_FBINFO(outputs[1]).data = md;
+	ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+	up_write(&ACCESS_FBINFO(altout.lock));
+	if (maven_get_reg(clnt, 0xB2) < 0x14) {
+		md->version = MGATVO_B;
+		/* Tweak some things for this old chip */
+	} else {
+		md->version = MGATVO_C;
+	}
+	/*
+	 * Set all parameters to its initial values.
+	 */
+	{
+		unsigned int i;
+
+		for (i = 0; i < MAVCTRLS; ++i) {
+			*get_ctrl_ptr(md, i) = maven_controls[i].desc.default_value;
+		}
+	}
+
+	return 0;
+}
+
+static int maven_shutdown_client(struct i2c_client* clnt) {
+	struct maven_data* md = i2c_get_clientdata(clnt);
+
+	if (md->primary_head) {
+		MINFO_FROM(md->primary_head);
+
+		down_write(&ACCESS_FBINFO(altout.lock));
+		ACCESS_FBINFO(outputs[1]).src = MATROXFB_SRC_NONE;
+		ACCESS_FBINFO(outputs[1]).output = NULL;
+		ACCESS_FBINFO(outputs[1]).data = NULL;
+		ACCESS_FBINFO(outputs[1]).mode = MATROXFB_OUTPUT_MODE_MONITOR;
+		up_write(&ACCESS_FBINFO(altout.lock));
+		md->primary_head = NULL;
+	}
+	return 0;
+}
+
+static unsigned short normal_i2c[] = { MAVEN_I2CID, I2C_CLIENT_END };
+static unsigned short normal_i2c_range[] = { MAVEN_I2CID, MAVEN_I2CID, I2C_CLIENT_END };
+I2C_CLIENT_INSMOD;
+
+static struct i2c_driver maven_driver;
+
+static int maven_detect_client(struct i2c_adapter* adapter, int address, int kind) {
+	int err = 0;
+	struct i2c_client* new_client;
+	struct maven_data* data;
+
+	if (!i2c_check_functionality(adapter, I2C_FUNC_SMBUS_WRITE_WORD_DATA |
+					      I2C_FUNC_SMBUS_BYTE_DATA |
+					      I2C_FUNC_PROTOCOL_MANGLING))
+		goto ERROR0;
+	if (!(new_client = (struct i2c_client*)kmalloc(sizeof(*new_client) + sizeof(*data),
+			GFP_KERNEL))) {
+		err = -ENOMEM;
+		goto ERROR0;
+	}
+	memset(new_client, 0, sizeof(*new_client) + sizeof(*data));
+	data = (struct maven_data*)(new_client + 1);
+	i2c_set_clientdata(new_client, data);
+	new_client->addr = address;
+	new_client->adapter = adapter;
+	new_client->driver = &maven_driver;
+	new_client->flags = 0;
+	strcpy(new_client->name, "maven client");
+	if ((err = i2c_attach_client(new_client)))
+		goto ERROR3;
+	err = maven_init_client(new_client);
+	if (err)
+		goto ERROR4;
+	return 0;
+ERROR4:;
+	i2c_detach_client(new_client);
+ERROR3:;
+	kfree(new_client);
+ERROR0:;
+	return err;
+}
+
+static int maven_attach_adapter(struct i2c_adapter* adapter) {
+	if (adapter->id == (I2C_ALGO_BIT | I2C_HW_B_G400))
+		return i2c_probe(adapter, &addr_data, &maven_detect_client);
+	return 0;
+}
+
+static int maven_detach_client(struct i2c_client* client) {
+	int err;
+
+	if ((err = i2c_detach_client(client))) {
+		printk(KERN_ERR "maven: Cannot deregister client\n");
+		return err;
+	}
+	maven_shutdown_client(client);
+	kfree(client);
+	return 0;
+}
+
+static int maven_command(struct i2c_client* client, unsigned int cmd, void* arg) {
+	return -ENOIOCTLCMD;	/* or -EINVAL, depends on who will call this */
+}
+
+static struct i2c_driver maven_driver={
+	.owner		= THIS_MODULE,
+	.name		= "maven",
+	.id		= I2C_DRIVERID_MGATVO,
+	.flags		= I2C_DF_NOTIFY,
+	.attach_adapter	= maven_attach_adapter,
+	.detach_client	= maven_detach_client,
+	.command	= maven_command,
+};
+
+/* ************************** */
+
+static int matroxfb_maven_init(void) {
+	int err;
+
+	err = i2c_add_driver(&maven_driver);
+	if (err) {
+		printk(KERN_ERR "maven: Maven driver failed to register (%d).\n", err);
+		return err;
+	}
+	return 0;
+}
+
+static void matroxfb_maven_exit(void) {
+	i2c_del_driver(&maven_driver);
+}
+
+MODULE_AUTHOR("(c) 1999-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Matrox G200/G400 Matrox MGA-TVO driver");
+MODULE_LICENSE("GPL");
+module_init(matroxfb_maven_init);
+module_exit(matroxfb_maven_exit);
+/* we do not have __setup() yet */
diff --git a/drivers/video/matrox/matroxfb_maven.h b/drivers/video/matrox/matroxfb_maven.h
new file mode 100644
index 0000000..99eddec
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_maven.h
@@ -0,0 +1,20 @@
+#ifndef __MATROXFB_MAVEN_H__
+#define __MATROXFB_MAVEN_H__
+
+#include <linux/ioctl.h>
+#include <linux/i2c.h>
+#include <linux/i2c-algo-bit.h>
+#include "matroxfb_base.h"
+
+struct i2c_bit_adapter {
+	struct i2c_adapter		adapter;
+	int				initialized;
+	struct i2c_algo_bit_data	bac;
+	struct matrox_fb_info*		minfo;
+	struct {
+		unsigned int		data;
+		unsigned int		clock;
+				      } mask;
+};
+
+#endif /* __MATROXFB_MAVEN_H__ */
diff --git a/drivers/video/matrox/matroxfb_misc.c b/drivers/video/matrox/matroxfb_misc.c
new file mode 100644
index 0000000..76fd3a5
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_misc.c
@@ -0,0 +1,777 @@
+/*
+ *
+ * Hardware accelerated Matrox Millennium I, II, Mystique, G100, G200 and G400
+ *
+ * (c) 1998-2002 Petr Vandrovec <vandrove@vc.cvut.cz>
+ *
+ * Portions Copyright (c) 2001 Matrox Graphics Inc.
+ *
+ * Version: 1.65 2002/08/14
+ *
+ * MTRR stuff: 1998 Tom Rini <trini@kernel.crashing.org>
+ *
+ * Contributors: "menion?" <menion@mindless.com>
+ *                     Betatesting, fixes, ideas
+ *
+ *               "Kurt Garloff" <garloff@suse.de>
+ *                     Betatesting, fixes, ideas, videomodes, videomodes timmings
+ *
+ *               "Tom Rini" <trini@kernel.crashing.org>
+ *                     MTRR stuff, PPC cleanups, betatesting, fixes, ideas
+ *
+ *               "Bibek Sahu" <scorpio@dodds.net>
+ *                     Access device through readb|w|l and write b|w|l
+ *                     Extensive debugging stuff
+ *
+ *               "Daniel Haun" <haund@usa.net>
+ *                     Testing, hardware cursor fixes
+ *
+ *               "Scott Wood" <sawst46+@pitt.edu>
+ *                     Fixes
+ *
+ *               "Gerd Knorr" <kraxel@goldbach.isdn.cs.tu-berlin.de>
+ *                     Betatesting
+ *
+ *               "Kelly French" <targon@hazmat.com>
+ *               "Fernando Herrera" <fherrera@eurielec.etsit.upm.es>
+ *                     Betatesting, bug reporting
+ *
+ *               "Pablo Bianucci" <pbian@pccp.com.ar>
+ *                     Fixes, ideas, betatesting
+ *
+ *               "Inaky Perez Gonzalez" <inaky@peloncho.fis.ucm.es>
+ *                     Fixes, enhandcements, ideas, betatesting
+ *
+ *               "Ryuichi Oikawa" <roikawa@rr.iiij4u.or.jp>
+ *                     PPC betatesting, PPC support, backward compatibility
+ *
+ *               "Paul Womar" <Paul@pwomar.demon.co.uk>
+ *               "Owen Waller" <O.Waller@ee.qub.ac.uk>
+ *                     PPC betatesting
+ *
+ *               "Thomas Pornin" <pornin@bolet.ens.fr>
+ *                     Alpha betatesting
+ *
+ *               "Pieter van Leuven" <pvl@iae.nl>
+ *               "Ulf Jaenicke-Roessler" <ujr@physik.phy.tu-dresden.de>
+ *                     G100 testing
+ *
+ *               "H. Peter Arvin" <hpa@transmeta.com>
+ *                     Ideas
+ *
+ *               "Cort Dougan" <cort@cs.nmt.edu>
+ *                     CHRP fixes and PReP cleanup
+ *
+ *               "Mark Vojkovich" <mvojkovi@ucsd.edu>
+ *                     G400 support
+ *
+ *               "David C. Hansen" <haveblue@us.ibm.com>
+ *                     Fixes
+ *
+ * (following author is not in any relation with this code, but his code
+ *  is included in this driver)
+ *
+ * Based on framebuffer driver for VBE 2.0 compliant graphic boards
+ *     (c) 1998 Gerd Knorr <kraxel@cs.tu-berlin.de>
+ *
+ * (following author is not in any relation with this code, but his ideas
+ *  were used when writting this driver)
+ *
+ *		 FreeVBE/AF (Matrox), "Shawn Hargreaves" <shawn@talula.demon.co.uk>
+ *
+ */
+
+/* make checkconfig does not check includes for this... */
+#include <linux/config.h>
+
+#include "matroxfb_misc.h"
+#include <linux/interrupt.h>
+#include <linux/matroxfb.h>
+
+void matroxfb_DAC_out(CPMINFO int reg, int val) {
+	DBG_REG(__FUNCTION__)
+	mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
+	mga_outb(M_RAMDAC_BASE+M_X_DATAREG, val);
+}
+
+int matroxfb_DAC_in(CPMINFO int reg) {
+	DBG_REG(__FUNCTION__)
+	mga_outb(M_RAMDAC_BASE+M_X_INDEX, reg);
+	return mga_inb(M_RAMDAC_BASE+M_X_DATAREG);
+}
+
+void matroxfb_var2my(struct fb_var_screeninfo* var, struct my_timming* mt) {
+	unsigned int pixclock = var->pixclock;
+
+	DBG(__FUNCTION__)
+
+	if (!pixclock) pixclock = 10000;	/* 10ns = 100MHz */
+	mt->pixclock = 1000000000 / pixclock;
+	if (mt->pixclock < 1) mt->pixclock = 1;
+	mt->mnp = -1;
+	mt->dblscan = var->vmode & FB_VMODE_DOUBLE;
+	mt->interlaced = var->vmode & FB_VMODE_INTERLACED;
+	mt->HDisplay = var->xres;
+	mt->HSyncStart = mt->HDisplay + var->right_margin;
+	mt->HSyncEnd = mt->HSyncStart + var->hsync_len;
+	mt->HTotal = mt->HSyncEnd + var->left_margin;
+	mt->VDisplay = var->yres;
+	mt->VSyncStart = mt->VDisplay + var->lower_margin;
+	mt->VSyncEnd = mt->VSyncStart + var->vsync_len;
+	mt->VTotal = mt->VSyncEnd + var->upper_margin;
+	mt->sync = var->sync;
+}
+
+int matroxfb_PLL_calcclock(const struct matrox_pll_features* pll, unsigned int freq, unsigned int fmax,
+		unsigned int* in, unsigned int* feed, unsigned int* post) {
+	unsigned int bestdiff = ~0;
+	unsigned int bestvco = 0;
+	unsigned int fxtal = pll->ref_freq;
+	unsigned int fwant;
+	unsigned int p;
+
+	DBG(__FUNCTION__)
+
+	fwant = freq;
+
+#ifdef DEBUG
+	printk(KERN_ERR "post_shift_max: %d\n", pll->post_shift_max);
+	printk(KERN_ERR "ref_freq: %d\n", pll->ref_freq);
+	printk(KERN_ERR "freq: %d\n", freq);
+	printk(KERN_ERR "vco_freq_min: %d\n", pll->vco_freq_min);
+	printk(KERN_ERR "in_div_min: %d\n", pll->in_div_min);
+	printk(KERN_ERR "in_div_max: %d\n", pll->in_div_max);
+	printk(KERN_ERR "feed_div_min: %d\n", pll->feed_div_min);
+	printk(KERN_ERR "feed_div_max: %d\n", pll->feed_div_max);
+	printk(KERN_ERR "fmax: %d\n", fmax);
+#endif
+	for (p = 1; p <= pll->post_shift_max; p++) {
+		if (fwant * 2 > fmax)
+			break;
+		fwant *= 2;
+	}
+	if (fwant < pll->vco_freq_min) fwant = pll->vco_freq_min;
+	if (fwant > fmax) fwant = fmax;
+	for (; p-- > 0; fwant >>= 1, bestdiff >>= 1) {
+		unsigned int m;
+
+		if (fwant < pll->vco_freq_min) break;
+		for (m = pll->in_div_min; m <= pll->in_div_max; m++) {
+			unsigned int diff, fvco;
+			unsigned int n;
+
+			n = (fwant * (m + 1) + (fxtal >> 1)) / fxtal - 1;
+			if (n > pll->feed_div_max)
+				break;
+			if (n < pll->feed_div_min)
+				n = pll->feed_div_min;
+			fvco = (fxtal * (n + 1)) / (m + 1);
+			if (fvco < fwant)
+				diff = fwant - fvco;
+			else
+				diff = fvco - fwant;
+			if (diff < bestdiff) {
+				bestdiff = diff;
+				*post = p;
+				*in = m;
+				*feed = n;
+				bestvco = fvco;
+			}
+		}
+	}
+	dprintk(KERN_ERR "clk: %02X %02X %02X %d %d %d\n", *in, *feed, *post, fxtal, bestvco, fwant);
+	return bestvco;
+}
+
+int matroxfb_vgaHWinit(WPMINFO struct my_timming* m) {
+	unsigned int hd, hs, he, hbe, ht;
+	unsigned int vd, vs, ve, vt, lc;
+	unsigned int wd;
+	unsigned int divider;
+	int i;
+	int fwidth;
+	struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+
+	fwidth = 8;
+
+	DBG(__FUNCTION__)
+
+	hw->SEQ[0] = 0x00;
+	if (fwidth == 9)
+		hw->SEQ[1] = 0x00;
+	else
+		hw->SEQ[1] = 0x01;	/* or 0x09 */
+	hw->SEQ[2] = 0x0F;	/* bitplanes */
+	hw->SEQ[3] = 0x00;
+	hw->SEQ[4] = 0x0E;
+	/* CRTC 0..7, 9, 16..19, 21, 22 are reprogrammed by Matrox Millennium code... Hope that by MGA1064 too */
+	if (m->dblscan) {
+		m->VTotal <<= 1;
+		m->VDisplay <<= 1;
+		m->VSyncStart <<= 1;
+		m->VSyncEnd <<= 1;
+	}
+	if (m->interlaced) {
+		m->VTotal >>= 1;
+		m->VDisplay >>= 1;
+		m->VSyncStart >>= 1;
+		m->VSyncEnd >>= 1;
+	}
+
+	/* GCTL is ignored when not using 0xA0000 aperture */
+	hw->GCTL[0] = 0x00;
+	hw->GCTL[1] = 0x00;
+	hw->GCTL[2] = 0x00;
+	hw->GCTL[3] = 0x00;
+	hw->GCTL[4] = 0x00;
+	hw->GCTL[5] = 0x40;
+	hw->GCTL[6] = 0x05;
+	hw->GCTL[7] = 0x0F;
+	hw->GCTL[8] = 0xFF;
+
+	/* Whole ATTR is ignored in PowerGraphics mode */
+	for (i = 0; i < 16; i++)
+		hw->ATTR[i] = i;
+	hw->ATTR[16] = 0x41;
+	hw->ATTR[17] = 0xFF;
+	hw->ATTR[18] = 0x0F;
+	if (fwidth == 9)
+		hw->ATTR[19] = 0x08;
+	else
+		hw->ATTR[19] = 0x00;
+	hw->ATTR[20] = 0x00;
+
+	hd = m->HDisplay >> 3;
+	hs = m->HSyncStart >> 3;
+	he = m->HSyncEnd >> 3;
+	ht = m->HTotal >> 3;
+	/* standard timmings are in 8pixels, but for interleaved we cannot */
+	/* do it for 4bpp (because of (4bpp >> 1(interleaved))/4 == 0) */
+	/* using 16 or more pixels per unit can save us */
+	divider = ACCESS_FBINFO(curr.final_bppShift);
+	while (divider & 3) {
+		hd >>= 1;
+		hs >>= 1;
+		he >>= 1;
+		ht >>= 1;
+		divider <<= 1;
+	}
+	divider = divider / 4;
+	/* divider can be from 1 to 8 */
+	while (divider > 8) {
+		hd <<= 1;
+		hs <<= 1;
+		he <<= 1;
+		ht <<= 1;
+		divider >>= 1;
+	}
+	hd = hd - 1;
+	hs = hs - 1;
+	he = he - 1;
+	ht = ht - 1;
+	vd = m->VDisplay - 1;
+	vs = m->VSyncStart - 1;
+	ve = m->VSyncEnd - 1;
+	vt = m->VTotal - 2;
+	lc = vd;
+	/* G200 cannot work with (ht & 7) == 6 */
+	if (((ht & 0x07) == 0x06) || ((ht & 0x0F) == 0x04))
+		ht++;
+	hbe = ht;
+	wd = ACCESS_FBINFO(fbcon).var.xres_virtual * ACCESS_FBINFO(curr.final_bppShift) / 64;
+
+	hw->CRTCEXT[0] = 0;
+	hw->CRTCEXT[5] = 0;
+	if (m->interlaced) {
+		hw->CRTCEXT[0] = 0x80;
+		hw->CRTCEXT[5] = (hs + he - ht) >> 1;
+		if (!m->dblscan)
+			wd <<= 1;
+		vt &= ~1;
+	}
+	hw->CRTCEXT[0] |=  (wd & 0x300) >> 4;
+	hw->CRTCEXT[1] = (((ht - 4) & 0x100) >> 8) |
+			  ((hd      & 0x100) >> 7) | /* blanking */
+			  ((hs      & 0x100) >> 6) | /* sync start */
+			   (hbe     & 0x040);	 /* end hor. blanking */
+	/* FIXME: Enable vidrst only on G400, and only if TV-out is used */
+	if (ACCESS_FBINFO(outputs[1]).src == MATROXFB_SRC_CRTC1)
+		hw->CRTCEXT[1] |= 0x88;		/* enable horizontal and vertical vidrst */
+	hw->CRTCEXT[2] =  ((vt & 0xC00) >> 10) |
+			  ((vd & 0x400) >>  8) |	/* disp end */
+			  ((vd & 0xC00) >>  7) |	/* vblanking start */
+			  ((vs & 0xC00) >>  5) |
+			  ((lc & 0x400) >>  3);
+	hw->CRTCEXT[3] = (divider - 1) | 0x80;
+	hw->CRTCEXT[4] = 0;
+
+	hw->CRTC[0] = ht-4;
+	hw->CRTC[1] = hd;
+	hw->CRTC[2] = hd;
+	hw->CRTC[3] = (hbe & 0x1F) | 0x80;
+	hw->CRTC[4] = hs;
+	hw->CRTC[5] = ((hbe & 0x20) << 2) | (he & 0x1F);
+	hw->CRTC[6] = vt & 0xFF;
+	hw->CRTC[7] = ((vt & 0x100) >> 8) |
+		      ((vd & 0x100) >> 7) |
+		      ((vs & 0x100) >> 6) |
+		      ((vd & 0x100) >> 5) |
+		      ((lc & 0x100) >> 4) |
+		      ((vt & 0x200) >> 4) |
+		      ((vd & 0x200) >> 3) |
+		      ((vs & 0x200) >> 2);
+	hw->CRTC[8] = 0x00;
+	hw->CRTC[9] = ((vd & 0x200) >> 4) |
+		      ((lc & 0x200) >> 3);
+	if (m->dblscan && !m->interlaced)
+		hw->CRTC[9] |= 0x80;
+	for (i = 10; i < 16; i++)
+		hw->CRTC[i] = 0x00;
+	hw->CRTC[16] = vs /* & 0xFF */;
+	hw->CRTC[17] = (ve & 0x0F) | 0x20;
+	hw->CRTC[18] = vd /* & 0xFF */;
+	hw->CRTC[19] = wd /* & 0xFF */;
+	hw->CRTC[20] = 0x00;
+	hw->CRTC[21] = vd /* & 0xFF */;
+	hw->CRTC[22] = (vt + 1) /* & 0xFF */;
+	hw->CRTC[23] = 0xC3;
+	hw->CRTC[24] = lc;
+	return 0;
+};
+
+void matroxfb_vgaHWrestore(WPMINFO2) {
+	int i;
+	struct matrox_hw_state * const hw = &ACCESS_FBINFO(hw);
+	CRITFLAGS
+
+	DBG(__FUNCTION__)
+
+	dprintk(KERN_INFO "MiscOutReg: %02X\n", hw->MiscOutReg);
+	dprintk(KERN_INFO "SEQ regs:   ");
+	for (i = 0; i < 5; i++)
+		dprintk("%02X:", hw->SEQ[i]);
+	dprintk("\n");
+	dprintk(KERN_INFO "GDC regs:   ");
+	for (i = 0; i < 9; i++)
+		dprintk("%02X:", hw->GCTL[i]);
+	dprintk("\n");
+	dprintk(KERN_INFO "CRTC regs: ");
+	for (i = 0; i < 25; i++)
+		dprintk("%02X:", hw->CRTC[i]);
+	dprintk("\n");
+	dprintk(KERN_INFO "ATTR regs: ");
+	for (i = 0; i < 21; i++)
+		dprintk("%02X:", hw->ATTR[i]);
+	dprintk("\n");
+
+	CRITBEGIN
+
+	mga_inb(M_ATTR_RESET);
+	mga_outb(M_ATTR_INDEX, 0);
+	mga_outb(M_MISC_REG, hw->MiscOutReg);
+	for (i = 1; i < 5; i++)
+		mga_setr(M_SEQ_INDEX, i, hw->SEQ[i]);
+	mga_setr(M_CRTC_INDEX, 17, hw->CRTC[17] & 0x7F);
+	for (i = 0; i < 25; i++)
+		mga_setr(M_CRTC_INDEX, i, hw->CRTC[i]);
+	for (i = 0; i < 9; i++)
+		mga_setr(M_GRAPHICS_INDEX, i, hw->GCTL[i]);
+	for (i = 0; i < 21; i++) {
+		mga_inb(M_ATTR_RESET);
+		mga_outb(M_ATTR_INDEX, i);
+		mga_outb(M_ATTR_INDEX, hw->ATTR[i]);
+	}
+	mga_outb(M_PALETTE_MASK, 0xFF);
+	mga_outb(M_DAC_REG, 0x00);
+	for (i = 0; i < 768; i++)
+		mga_outb(M_DAC_VAL, hw->DACpal[i]);
+	mga_inb(M_ATTR_RESET);
+	mga_outb(M_ATTR_INDEX, 0x20);
+
+	CRITEND
+}
+
+static void get_pins(unsigned char __iomem* pins, struct matrox_bios* bd) {
+	unsigned int b0 = readb(pins);
+	
+	if (b0 == 0x2E && readb(pins+1) == 0x41) {
+		unsigned int pins_len = readb(pins+2);
+		unsigned int i;
+		unsigned char cksum;
+		unsigned char* dst = bd->pins;
+
+		if (pins_len < 3 || pins_len > 128) {
+			return;
+		}
+		*dst++ = 0x2E;
+		*dst++ = 0x41;
+		*dst++ = pins_len;
+		cksum = 0x2E + 0x41 + pins_len;
+		for (i = 3; i < pins_len; i++) {
+			cksum += *dst++ = readb(pins+i);
+		}
+		if (cksum) {
+			return;
+		}
+		bd->pins_len = pins_len;
+	} else if (b0 == 0x40 && readb(pins+1) == 0x00) {
+		unsigned int i;
+		unsigned char* dst = bd->pins;
+
+		*dst++ = 0x40;
+		*dst++ = 0;
+		for (i = 2; i < 0x40; i++) {
+			*dst++ = readb(pins+i);
+		}
+		bd->pins_len = 0x40;
+	}
+}
+
+static void get_bios_version(unsigned char __iomem * vbios, struct matrox_bios* bd) {
+	unsigned int pcir_offset;
+	
+	pcir_offset = readb(vbios + 24) | (readb(vbios + 25) << 8);
+	if (pcir_offset >= 26 && pcir_offset < 0xFFE0 &&
+	    readb(vbios + pcir_offset    ) == 'P' &&
+	    readb(vbios + pcir_offset + 1) == 'C' &&
+	    readb(vbios + pcir_offset + 2) == 'I' &&
+	    readb(vbios + pcir_offset + 3) == 'R') {
+		unsigned char h;
+
+		h = readb(vbios + pcir_offset + 0x12);
+		bd->version.vMaj = (h >> 4) & 0xF;
+		bd->version.vMin = h & 0xF;
+		bd->version.vRev = readb(vbios + pcir_offset + 0x13);
+	} else {
+		unsigned char h;
+
+		h = readb(vbios + 5);
+		bd->version.vMaj = (h >> 4) & 0xF;
+		bd->version.vMin = h & 0xF;
+		bd->version.vRev = 0;
+	}
+}
+
+static void get_bios_output(unsigned char __iomem* vbios, struct matrox_bios* bd) {
+	unsigned char b;
+	
+	b = readb(vbios + 0x7FF1);
+	if (b == 0xFF) {
+		b = 0;
+	}
+	bd->output.state = b;
+}
+
+static void get_bios_tvout(unsigned char __iomem* vbios, struct matrox_bios* bd) {
+	unsigned int i;
+	
+	/* Check for 'IBM .*(V....TVO' string - it means TVO BIOS */
+	bd->output.tvout = 0;
+	if (readb(vbios + 0x1D) != 'I' ||
+	    readb(vbios + 0x1E) != 'B' ||
+	    readb(vbios + 0x1F) != 'M' ||
+	    readb(vbios + 0x20) != ' ') {
+	    	return;
+	}
+	for (i = 0x2D; i < 0x2D + 128; i++) {
+		unsigned char b = readb(vbios + i);
+		
+		if (b == '(' && readb(vbios + i + 1) == 'V') {
+			if (readb(vbios + i + 6) == 'T' &&
+			    readb(vbios + i + 7) == 'V' &&
+			    readb(vbios + i + 8) == 'O') {
+				bd->output.tvout = 1;
+			}
+			return;
+		}
+		if (b == 0)
+			break;
+	}
+}
+
+static void parse_bios(unsigned char __iomem* vbios, struct matrox_bios* bd) {
+	unsigned int pins_offset;
+	
+	if (readb(vbios) != 0x55 || readb(vbios + 1) != 0xAA) {
+		return;
+	}
+	bd->bios_valid = 1;
+	get_bios_version(vbios, bd);
+	get_bios_output(vbios, bd);
+	get_bios_tvout(vbios, bd);
+	pins_offset = readb(vbios + 0x7FFC) | (readb(vbios + 0x7FFD) << 8);
+	if (pins_offset <= 0xFF80) {
+		get_pins(vbios + pins_offset, bd);
+	}
+}
+
+#define get_u16(x) (le16_to_cpu(get_unaligned((__u16*)(x))))
+#define get_u32(x) (le32_to_cpu(get_unaligned((__u32*)(x))))
+static int parse_pins1(WPMINFO const struct matrox_bios* bd) {
+	unsigned int maxdac;
+
+	switch (bd->pins[22]) {
+		case 0:		maxdac = 175000; break;
+		case 1:		maxdac = 220000; break;
+		default:	maxdac = 240000; break;
+	}
+	if (get_u16(bd->pins + 24)) {
+		maxdac = get_u16(bd->pins + 24) * 10;
+	}
+	MINFO->limits.pixel.vcomax = maxdac;
+	MINFO->values.pll.system = get_u16(bd->pins + 28) ? get_u16(bd->pins + 28) * 10 : 50000;
+	/* ignore 4MB, 8MB, module clocks */
+	MINFO->features.pll.ref_freq = 14318;
+	MINFO->values.reg.mctlwtst	= 0x00030101;
+	return 0;
+}
+
+static void default_pins1(WPMINFO2) {
+	/* Millennium */
+	MINFO->limits.pixel.vcomax	= 220000;
+	MINFO->values.pll.system	=  50000;
+	MINFO->features.pll.ref_freq	=  14318;
+	MINFO->values.reg.mctlwtst	= 0x00030101;
+}
+
+static int parse_pins2(WPMINFO const struct matrox_bios* bd) {
+	MINFO->limits.pixel.vcomax	=
+	MINFO->limits.system.vcomax	= (bd->pins[41] == 0xFF) ? 230000 : ((bd->pins[41] + 100) * 1000);
+	MINFO->values.reg.mctlwtst	= ((bd->pins[51] & 0x01) ? 0x00000001 : 0) |
+					  ((bd->pins[51] & 0x02) ? 0x00000100 : 0) |
+					  ((bd->pins[51] & 0x04) ? 0x00010000 : 0) |
+					  ((bd->pins[51] & 0x08) ? 0x00020000 : 0);
+	MINFO->values.pll.system	= (bd->pins[43] == 0xFF) ? 50000 : ((bd->pins[43] + 100) * 1000);
+	MINFO->features.pll.ref_freq	= 14318;
+	return 0;
+}
+
+static void default_pins2(WPMINFO2) {
+	/* Millennium II, Mystique */
+	MINFO->limits.pixel.vcomax	=
+	MINFO->limits.system.vcomax	= 230000;
+	MINFO->values.reg.mctlwtst	= 0x00030101;
+	MINFO->values.pll.system	=  50000;
+	MINFO->features.pll.ref_freq	=  14318;
+}
+
+static int parse_pins3(WPMINFO const struct matrox_bios* bd) {
+	MINFO->limits.pixel.vcomax	=
+	MINFO->limits.system.vcomax	= (bd->pins[36] == 0xFF) ? 230000			: ((bd->pins[36] + 100) * 1000);
+	MINFO->values.reg.mctlwtst	= get_u32(bd->pins + 48) == 0xFFFFFFFF ? 0x01250A21	: get_u32(bd->pins + 48);
+	/* memory config */
+	MINFO->values.reg.memrdbk	= ((bd->pins[57] << 21) & 0x1E000000) |
+					  ((bd->pins[57] << 22) & 0x00C00000) |
+					  ((bd->pins[56] <<  1) & 0x000001E0) |
+					  ( bd->pins[56]        & 0x0000000F);
+	MINFO->values.reg.opt		= (bd->pins[54] & 7) << 10;
+	MINFO->values.reg.opt2		= bd->pins[58] << 12;
+	MINFO->features.pll.ref_freq	= (bd->pins[52] & 0x20) ? 14318 : 27000;
+	return 0;
+}
+
+static void default_pins3(WPMINFO2) {
+	/* G100, G200 */
+	MINFO->limits.pixel.vcomax	=
+	MINFO->limits.system.vcomax	= 230000;
+	MINFO->values.reg.mctlwtst	= 0x01250A21;
+	MINFO->values.reg.memrdbk	= 0x00000000;
+	MINFO->values.reg.opt		= 0x00000C00;
+	MINFO->values.reg.opt2		= 0x00000000;
+	MINFO->features.pll.ref_freq	=  27000;
+}
+
+static int parse_pins4(WPMINFO const struct matrox_bios* bd) {
+	MINFO->limits.pixel.vcomax	= (bd->pins[ 39] == 0xFF) ? 230000			: bd->pins[ 39] * 4000;
+	MINFO->limits.system.vcomax	= (bd->pins[ 38] == 0xFF) ? MINFO->limits.pixel.vcomax	: bd->pins[ 38] * 4000;
+	MINFO->values.reg.mctlwtst	= get_u32(bd->pins + 71);
+	MINFO->values.reg.memrdbk	= ((bd->pins[87] << 21) & 0x1E000000) |
+					  ((bd->pins[87] << 22) & 0x00C00000) |
+					  ((bd->pins[86] <<  1) & 0x000001E0) |
+					  ( bd->pins[86]        & 0x0000000F);
+	MINFO->values.reg.opt		= ((bd->pins[53] << 15) & 0x00400000) |
+					  ((bd->pins[53] << 22) & 0x10000000) |
+					  ((bd->pins[53] <<  7) & 0x00001C00);
+	MINFO->values.reg.opt3		= get_u32(bd->pins + 67);
+	MINFO->values.pll.system	= (bd->pins[ 65] == 0xFF) ? 200000 			: bd->pins[ 65] * 4000;
+	MINFO->features.pll.ref_freq	= (bd->pins[ 92] & 0x01) ? 14318 : 27000;
+	return 0;
+}
+
+static void default_pins4(WPMINFO2) {
+	/* G400 */
+	MINFO->limits.pixel.vcomax	=
+	MINFO->limits.system.vcomax	= 252000;
+	MINFO->values.reg.mctlwtst	= 0x04A450A1;
+	MINFO->values.reg.memrdbk	= 0x000000E7;
+	MINFO->values.reg.opt		= 0x10000400;
+	MINFO->values.reg.opt3		= 0x0190A419;
+	MINFO->values.pll.system	= 200000;
+	MINFO->features.pll.ref_freq	= 27000;
+}
+
+static int parse_pins5(WPMINFO const struct matrox_bios* bd) {
+	unsigned int mult;
+	
+	mult = bd->pins[4]?8000:6000;
+	
+	MINFO->limits.pixel.vcomax	= (bd->pins[ 38] == 0xFF) ? 600000			: bd->pins[ 38] * mult;
+	MINFO->limits.system.vcomax	= (bd->pins[ 36] == 0xFF) ? MINFO->limits.pixel.vcomax	: bd->pins[ 36] * mult;
+	MINFO->limits.video.vcomax	= (bd->pins[ 37] == 0xFF) ? MINFO->limits.system.vcomax	: bd->pins[ 37] * mult;
+	MINFO->limits.pixel.vcomin	= (bd->pins[123] == 0xFF) ? 256000			: bd->pins[123] * mult;
+	MINFO->limits.system.vcomin	= (bd->pins[121] == 0xFF) ? MINFO->limits.pixel.vcomin	: bd->pins[121] * mult;
+	MINFO->limits.video.vcomin	= (bd->pins[122] == 0xFF) ? MINFO->limits.system.vcomin	: bd->pins[122] * mult;
+	MINFO->values.pll.system	=
+	MINFO->values.pll.video		= (bd->pins[ 92] == 0xFF) ? 284000			: bd->pins[ 92] * 4000;
+	MINFO->values.reg.opt		= get_u32(bd->pins+ 48);
+	MINFO->values.reg.opt2		= get_u32(bd->pins+ 52);
+	MINFO->values.reg.opt3		= get_u32(bd->pins+ 94);
+	MINFO->values.reg.mctlwtst	= get_u32(bd->pins+ 98);
+	MINFO->values.reg.memmisc	= get_u32(bd->pins+102);
+	MINFO->values.reg.memrdbk	= get_u32(bd->pins+106);
+	MINFO->features.pll.ref_freq	= (bd->pins[110] & 0x01) ? 14318 : 27000;
+	MINFO->values.memory.ddr	= (bd->pins[114] & 0x60) == 0x20;
+	MINFO->values.memory.dll	= (bd->pins[115] & 0x02) != 0;
+	MINFO->values.memory.emrswen	= (bd->pins[115] & 0x01) != 0;
+	MINFO->values.reg.maccess	= MINFO->values.memory.emrswen ? 0x00004000 : 0x00000000;
+	if (bd->pins[115] & 4) {
+		MINFO->values.reg.mctlwtst_core = MINFO->values.reg.mctlwtst;
+	} else {
+		u_int32_t wtst_xlat[] = { 0, 1, 5, 6, 7, 5, 2, 3 };
+		MINFO->values.reg.mctlwtst_core = (MINFO->values.reg.mctlwtst & ~7) |
+		                                  wtst_xlat[MINFO->values.reg.mctlwtst & 7];
+	}
+	return 0;
+}
+
+static void default_pins5(WPMINFO2) {
+	/* Mine 16MB G450 with SDRAM DDR */
+	MINFO->limits.pixel.vcomax	=
+	MINFO->limits.system.vcomax	=
+	MINFO->limits.video.vcomax	= 600000;
+	MINFO->limits.pixel.vcomin	=
+	MINFO->limits.system.vcomin	=
+	MINFO->limits.video.vcomin	= 256000;
+	MINFO->values.pll.system	=
+	MINFO->values.pll.video		= 284000;
+	MINFO->values.reg.opt		= 0x404A1160;
+	MINFO->values.reg.opt2		= 0x0000AC00;
+	MINFO->values.reg.opt3		= 0x0090A409;
+	MINFO->values.reg.mctlwtst_core	=
+	MINFO->values.reg.mctlwtst	= 0x0C81462B;
+	MINFO->values.reg.memmisc	= 0x80000004;
+	MINFO->values.reg.memrdbk	= 0x01001103;
+	MINFO->features.pll.ref_freq	= 27000;
+	MINFO->values.memory.ddr	= 1;
+	MINFO->values.memory.dll	= 1;
+	MINFO->values.memory.emrswen	= 1;
+	MINFO->values.reg.maccess	= 0x00004000;
+}
+
+static int matroxfb_set_limits(WPMINFO const struct matrox_bios* bd) {
+	unsigned int pins_version;
+	static const unsigned int pinslen[] = { 64, 64, 64, 128, 128 };
+
+	switch (ACCESS_FBINFO(chip)) {
+		case MGA_2064:	default_pins1(PMINFO2); break;
+		case MGA_2164:
+		case MGA_1064:
+		case MGA_1164:	default_pins2(PMINFO2); break;
+		case MGA_G100:
+		case MGA_G200:	default_pins3(PMINFO2); break;
+		case MGA_G400:	default_pins4(PMINFO2); break;
+		case MGA_G450:
+		case MGA_G550:	default_pins5(PMINFO2); break;
+	}
+	if (!bd->bios_valid) {
+		printk(KERN_INFO "matroxfb: Your Matrox device does not have BIOS\n");
+		return -1;
+	}
+	if (bd->pins_len < 64) {
+		printk(KERN_INFO "matroxfb: BIOS on your Matrox device does not contain powerup info\n");
+		return -1;
+	}
+	if (bd->pins[0] == 0x2E && bd->pins[1] == 0x41) {
+		pins_version = bd->pins[5];
+		if (pins_version < 2 || pins_version > 5) {
+			printk(KERN_INFO "matroxfb: Unknown version (%u) of powerup info\n", pins_version);
+			return -1;
+		}
+	} else {
+		pins_version = 1;
+	}
+	if (bd->pins_len != pinslen[pins_version - 1]) {
+		printk(KERN_INFO "matroxfb: Invalid powerup info\n");
+		return -1;
+	}
+	switch (pins_version) {
+		case 1:
+			return parse_pins1(PMINFO bd);
+		case 2:
+			return parse_pins2(PMINFO bd);
+		case 3:
+			return parse_pins3(PMINFO bd);
+		case 4:
+			return parse_pins4(PMINFO bd);
+		case 5:
+			return parse_pins5(PMINFO bd);
+		default:
+			printk(KERN_DEBUG "matroxfb: Powerup info version %u is not yet supported\n", pins_version);
+			return -1;
+	}
+}
+
+void matroxfb_read_pins(WPMINFO2) {
+	u32 opt;
+	u32 biosbase;
+	u32 fbbase;
+	struct pci_dev* pdev = ACCESS_FBINFO(pcidev);
+	
+	memset(&ACCESS_FBINFO(bios), 0, sizeof(ACCESS_FBINFO(bios)));
+	pci_read_config_dword(pdev, PCI_OPTION_REG, &opt);
+	pci_write_config_dword(pdev, PCI_OPTION_REG, opt | PCI_OPTION_ENABLE_ROM);
+	pci_read_config_dword(pdev, PCI_ROM_ADDRESS, &biosbase);
+	pci_read_config_dword(pdev, ACCESS_FBINFO(devflags.fbResource), &fbbase);
+	pci_write_config_dword(pdev, PCI_ROM_ADDRESS, (fbbase & PCI_ROM_ADDRESS_MASK) | PCI_ROM_ADDRESS_ENABLE);
+	parse_bios(vaddr_va(ACCESS_FBINFO(video).vbase), &ACCESS_FBINFO(bios));
+	pci_write_config_dword(pdev, PCI_ROM_ADDRESS, biosbase);
+	pci_write_config_dword(pdev, PCI_OPTION_REG, opt);
+#ifdef CONFIG_X86
+	if (!ACCESS_FBINFO(bios).bios_valid) {
+		unsigned char __iomem* b;
+
+		b = ioremap(0x000C0000, 65536);
+		if (!b) {
+			printk(KERN_INFO "matroxfb: Unable to map legacy BIOS\n");
+		} else {
+			unsigned int ven = readb(b+0x64+0) | (readb(b+0x64+1) << 8);
+			unsigned int dev = readb(b+0x64+2) | (readb(b+0x64+3) << 8);
+			
+			if (ven != pdev->vendor || dev != pdev->device) {
+				printk(KERN_INFO "matroxfb: Legacy BIOS is for %04X:%04X, while this device is %04X:%04X\n",
+					ven, dev, pdev->vendor, pdev->device);
+			} else {
+				parse_bios(b, &ACCESS_FBINFO(bios));
+			}
+			iounmap(b);
+		}
+	}
+#endif
+	matroxfb_set_limits(PMINFO &ACCESS_FBINFO(bios));
+}
+
+EXPORT_SYMBOL(matroxfb_DAC_in);
+EXPORT_SYMBOL(matroxfb_DAC_out);
+EXPORT_SYMBOL(matroxfb_var2my);
+EXPORT_SYMBOL(matroxfb_PLL_calcclock);
+#ifndef CONFIG_FB_MATROX_MULTIHEAD
+struct matrox_fb_info matroxfb_global_mxinfo;
+EXPORT_SYMBOL(matroxfb_global_mxinfo);
+#endif
+EXPORT_SYMBOL(matroxfb_vgaHWinit);		/* DAC1064, Ti3026 */
+EXPORT_SYMBOL(matroxfb_vgaHWrestore);		/* DAC1064, Ti3026 */
+EXPORT_SYMBOL(matroxfb_read_pins);
+
+MODULE_AUTHOR("(c) 1999-2002 Petr Vandrovec <vandrove@vc.cvut.cz>");
+MODULE_DESCRIPTION("Miscellaneous support for Matrox video cards");
+MODULE_LICENSE("GPL");
diff --git a/drivers/video/matrox/matroxfb_misc.h b/drivers/video/matrox/matroxfb_misc.h
new file mode 100644
index 0000000..cb62cc0
--- /dev/null
+++ b/drivers/video/matrox/matroxfb_misc.h
@@ -0,0 +1,18 @@
+#ifndef __MATROXFB_MISC_H__
+#define __MATROXFB_MISC_H__
+
+#include "matroxfb_base.h"
+
+/* also for modules */
+int matroxfb_PLL_calcclock(const struct matrox_pll_features* pll, unsigned int freq, unsigned int fmax,
+	unsigned int* in, unsigned int* feed, unsigned int* post);
+static inline int PLL_calcclock(CPMINFO unsigned int freq, unsigned int fmax,
+		unsigned int* in, unsigned int* feed, unsigned int* post) {
+	return matroxfb_PLL_calcclock(&ACCESS_FBINFO(features.pll), freq, fmax, in, feed, post);
+}
+
+int matroxfb_vgaHWinit(WPMINFO struct my_timming* m);
+void matroxfb_vgaHWrestore(WPMINFO2);
+void matroxfb_read_pins(WPMINFO2);
+
+#endif	/* __MATROXFB_MISC_H__ */